summaryrefslogtreecommitdiffstats
Commit message (Collapse)AuthorAgeFilesLines
* RomFS ExtractionZach Hilman2018-07-2812-20/+351
|
* Merge pull request #845 from lioncash/nfcbunnei2018-07-276-0/+243
|\ | | | | service: Add nfc services
| * service/nfc: Implement Create[x]Interface functionsLioncash2018-07-271-4/+43
| | | | | | | | These simply return the respective interface.
| * service: Add nfc servicesLioncash2018-07-276-0/+204
| | | | | | | | | | Adds the skeleton of the nfc service based off the information provided on Switch Brew.
* | Merge pull request #839 from FearlessTobi/actually-port-3594bunnei2018-07-271-0/+16
|\ \ | | | | | | Port #3594 from Citra: "citra_qt: Add Continue/Pause & Toggle Speed Limit hotkeys"
| * | Port #3594 from CitrafearlessTobi2018-07-261-0/+16
| | |
* | | Merge pull request #844 from lioncash/lblbunnei2018-07-276-0/+111
|\ \ \ | | | | | | | | service: Add the lbl service
| * | | service/lbl: Implement EnableVrMode, DisableVrMode and GetVrModeLioncash2018-07-273-3/+37
| | | | | | | | | | | | | | | | | | | | Implements these functions according to the information available on Switch Brew.
| * | | service: Add the lbl serviceLioncash2018-07-274-0/+77
| | |/ | |/| | | | | | | | | | Adds the skeleton of the lbl service based off the information provided by Switch Brew.
* | | Merge pull request #841 from lioncash/btdrvbunnei2018-07-274-1/+93
|\ \ \ | |/ / |/| | service: Add the btdrv service
| * | service: Add the btdrv serviceLioncash2018-07-274-1/+93
| | | | | | | | | | | | Adds the skeleton for the btdrv service based off the information provided by Switch Brew
* | | Merge pull request #837 from lioncash/privbunnei2018-07-272-8/+20
|\ \ \ | | | | | | | | kernel/timer: Make data members private where applicable
| * | | kernel/timer: Make data members private where applicableLioncash2018-07-262-8/+20
| | | | | | | | | | | | | | | | | | | | Instead, we can just expose functions that return the queryable state instead of letting anything modify it.
* | | | Merge pull request #833 from lioncash/irsbunnei2018-07-276-0/+352
|\ \ \ \ | |_|/ / |/| | | service/hid: Add missing services
| * | | service/hid: Add the hidbus, hid:dbg, hid:sys, and hid:tmp servicesLioncash2018-07-261-0/+220
| | | |
| * | | service/hid: Add the xcd:sys serviceLioncash2018-07-264-0/+57
| | | |
| * | | service/hid: Add irs servicesLioncash2018-07-264-0/+75
|/ / /
* | | Merge pull request #836 from FearlessTobi/port-3594bunnei2018-07-262-0/+4
|\ \ \ | | | | | | | | Port #3665 from Citra: "frontend: Log Citra version"
| * | | Port #3665 from CitrafearlessTobi2018-07-262-0/+4
| | |/ | |/|
* | | Merge pull request #835 from FearlessTobi/port-minor-prsbunnei2018-07-262-2/+2
|\ \ \ | | | | | | | | Port #3641 and #3702 from Citra (Small changes to default_ini and gitignore)
| * | | Port #3702 from CitrafearlessTobi2018-07-261-1/+1
| | | |
| * | | Port #3641 from CitrafearlessTobi2018-07-261-1/+1
| |/ /
* | | Merge pull request #834 from lioncash/grcbunnei2018-07-264-0/+50
|\ \ \ | | | | | | | | service: Add the grc:c service
| * | | service: Add the grc:c serviceLioncash2018-07-264-0/+50
| | |/ | |/| | | | | | | | | | Adds the basic skeleton for the grc:c service based off the information provided by Switch Brew.
* | | Merge pull request #832 from lioncash/nimbunnei2018-07-264-0/+143
|\ \ \ | | | | | | | | service: Add the nim services
| * | | service: Add the nim servicesLioncash2018-07-264-0/+143
| |/ / | | | | | | | | | | | | Adds the skeleton for the nim services based off information from Switch Brew.
* | | Merge pull request #831 from lioncash/ldnbunnei2018-07-266-0/+164
|\ \ \ | | | | | | | | service: Add ldn services
| * | | service: Add ldn servicesLioncash2018-07-266-0/+164
| |/ / | | | | | | | | | Adds ldn services based off information provided by Switch Brew.
* | | Merge pull request #830 from lioncash/socketbunnei2018-07-266-0/+95
|\ \ \ | | | | | | | | service/sockets: Add missing socket services
| * | | service/sockets: Add ethc:c and ethc:i servicesLioncash2018-07-264-0/+66
| | | |
| * | | service/sockets: Add missing bsdcfg socket serviceLioncash2018-07-263-0/+29
| |/ /
* | | Merge pull request #808 from lioncash/mem-dedupbunnei2018-07-261-14/+22
|\ \ \ | | | | | | | | video_core/memory_manager: Avoid repeated unnecessary page slot lookups
| * | | video_core/memory_manager: Replace a loop with std::array's fill() function in PageSlot()Lioncash2018-07-241-3/+1
| | | | | | | | | | | | | | | | | | | | We already have a function that does what this code was doing, so let's use that instead.
| * | | video_core/memory_manager: Avoid repeated unnecessary page slot lookupsLioncash2018-07-241-11/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | We don't need to keep calling the same function over and over again in a loop, especially when the behavior is slightly non-trivial. We can just keep a reference to the looked up location and do all the checking and assignments based off it instead.
* | | | Merge pull request #829 from Subv/r16f_rtbunnei2018-07-262-1/+4
|\ \ \ \ | |_|_|/ |/| | | GPU: Allow using R16F as a render target format.
| * | | GPU: Allow using R16F as a render target format.Subv2018-07-262-1/+4
|/ / /
* | | Merge pull request #827 from lioncash/logbunnei2018-07-262-40/+35
|\ \ \ | | | | | | | | service/lm: Minor changes
| * | | lm: Move LM's class declaration into the cpp fileLioncash2018-07-262-37/+31
| | | | | | | | | | | | | | | | | | | | This isn't used directly outside of this translation unit, so we can hide it from external use.
| * | | lm: Amend names of Initialize() in Logger and Initialize() in LMLioncash2018-07-262-7/+7
| | | | | | | | | | | | | | | | Amends these to match the information on Switch Brew.
| * | | lm: Add missing function entry to Logger's function tableLioncash2018-07-261-0/+1
| | | |
* | | | Merge pull request #825 from greggameplayer/R16_G16bunnei2018-07-264-19/+100
|\ \ \ \ | |_|_|/ |/| | | Implement R16_G16
| * | | Implement R16_G16Unknown2018-07-264-19/+100
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | correct trailing white spaces Delete tabs correct placement Add RG16F & RG16UI & RG16I & RG16S PixelFormats Return correct data according to changes done previously correct PixelFormat declaration correct coding style error correct coding style error part 2 correct RG16S Declaration error correct alignment
* | | | Merge pull request #828 from lioncash/ldrSebastian Valle2018-07-264-0/+101
|\ \ \ \ | | | | | | | | | | service: Add ldr services
| * | | | service: Add ldr servicesLioncash2018-07-264-0/+101
| | | | | | | | | | | | | | | | | | | | | | | | | Adds the skeleton for the ldr-related services based off the information provided on Switch Brew.
* | | | | Merge pull request #826 from lioncash/erptSebastian Valle2018-07-266-0/+143
|\ \ \ \ \ | | | | | | | | | | | | service: Add erpt and eupld services
| * | | | | service: Add eupld servicesLioncash2018-07-264-0/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the skeleton for the eupld services based off information on Switch Brew.
| * | | | | service: Add the erpt servicesLioncash2018-07-264-0/+71
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | Adds the basic skeleton of the erpt service based off information on Switch Brew.
* | | | | Merge pull request #823 from lioncash/nifmSebastian Valle2018-07-269-141/+30
|\ \ \ \ \ | |_|/ / / |/| | | | service/nifm: Deduplicate interface code
| * | | | service/nifm: Deduplicate interface codeLioncash2018-07-259-141/+30
| | | | | | | | | | | | | | | | | | | | | | | | | Rather than having the same code for each nifm service variant, we can centralize it on one class and get rid of a bit of extra code.
* | | | | Merge pull request #824 from lioncash/nvdrvbunnei2018-07-262-5/+7
|\ \ \ \ \ | | | | | | | | | | | | service/nvdrv: Minor changes
| * | | | | service/nvdrv: Take std::string in Open() by const referenceLioncash2018-07-252-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids copies from being made, since the string is only ever used for lookup, the data is never transfered anywhere. Ideally, we'd use a std::string_view here, but devices is a std::unordered_map, not a std::map, so we can't use heterogenous lookup here.
| * | | | | service/nvdrv: Use std::move where applicableLioncash2018-07-251-3/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary reference count increments and decrements. In one case, we don't need to make a shared_ptr copy at all, just to call a member function.
* | | | | Merge pull request #822 from lioncash/pmbunnei2018-07-264-0/+90
|\ \ \ \ \ | |_|/ / / |/| | | | service: Add pm services
| * | | | service: Add pm servicesLioncash2018-07-254-0/+90
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the process management services based off information on Switch Brew.
* | | | Merge pull request #820 from lioncash/esMat M2018-07-264-0/+77
|\ \ \ \ | | | | | | | | | | service: Add the es service
| * | | | service: Add the es serviceLioncash2018-07-254-0/+77
| |/ / / | | | | | | | | | | | | | | | | Adds the skeleton for the ETicket service based off the information on Switch Brew
* | | | Merge pull request #821 from lioncash/waitMat M2018-07-261-0/+4
|\ \ \ \ | |_|/ / |/| | | wait_tree: Add missing switch case for WaitTreeThread::GetText()
| * | | wait_tree: Add missing switch case for WaitTreeThread::GetText()Lioncash2018-07-251-0/+4
| |/ / | | | | | | | | | We were missing the enum entry for WaitIPC
* | | Merge pull request #819 from Subv/srgbbunnei2018-07-252-9/+17
|\ \ \ | |/ / |/| | GPU: Use the right texture format for sRGBA framebuffers.
| * | GPU: Use the right texture format for sRGBA framebuffers.Subv2018-07-252-9/+17
| | |
* | | Merge pull request #801 from lioncash/timeMat M2018-07-256-64/+16
|\ \ \ | | | | | | | | time: Add the time:a service
| * | | time: Add the time:a serviceLioncash2018-07-253-10/+11
| | | | | | | | | | | | | | | | Given we already have time:s and time:u, we should also have time:a
| * | | time: Simplify interface creationLioncash2018-07-246-64/+15
| | | | | | | | | | | | | | | | We can use one instance of the interface instead of duplicating code.
* | | | Merge pull request #804 from lioncash/logMat M2018-07-251-1/+3
|\ \ \ \ | | | | | | | | | | svc: Log parameters in SetMemoryAttribute()
| * | | | svc: Log parameters in SetMemoryAttribute()Lioncash2018-07-241-1/+3
| | |_|/ | |/| | | | | | | | | | Provides slightly more context than only logging out the address value.
* | | | Merge pull request #803 from MerryMage/core_timing_utilbunnei2018-07-2512-114/+146
|\ \ \ \ | | | | | | | | | | core_timing: Split off utility functions into core_timing_util
| * | | | core_timing: Split off utility functions into core_timing_utilMerryMage2018-07-2412-105/+137
| | | | |
| * | | | CMakeLists: Sort filenamesMerryMage2018-07-241-9/+9
| | | | |
* | | | | Merge pull request #802 from lioncash/unreachbunnei2018-07-251-0/+3
|\ \ \ \ \ | | | | | | | | | | | | wait_tree: Silence warning about all code paths not returning a value
| * | | | | wait_tree: Silence warning about all code paths not returning a valueLioncash2018-07-241-0/+3
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | If code execution hits this spot, something has gone very wrong, so mark the path as unreachable. This silences a warning on MSVC.
* | | | | Merge pull request #800 from lioncash/setbunnei2018-07-253-5/+33
|\ \ \ \ \ | | | | | | | | | | | | set_sys: Implement SetColorSetId()
| * | | | | set_sys: Implement SetColorSetId()Lioncash2018-07-242-5/+25
| | | | | |
| * | | | | ipc_helper: Add helper member function for popping enum values to RequestParserLioncash2018-07-241-0/+8
| |/ / / /
* | | | | Merge pull request #813 from Subv/z24_s8_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | GPU: Allow the use of Z24S8 as a texture format.
| * | | | GPU: Allow the use of Z24S8 as a texture format.Subv2018-07-251-0/+4
|/ / / /
* | | | Merge pull request #816 from Subv/z32_s8bunnei2018-07-254-1/+16
|\ \ \ \ | | | | | | | | | | GPU: Implemented the Z32_S8_X24 depth buffer format.
| * | | | GPU: Implemented the Z32_S8_X24 depth buffer format.Subv2018-07-254-1/+16
| | | | |
* | | | | Merge pull request #815 from Subv/z32f_texbunnei2018-07-251-0/+4
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow using Z32 as a texture format.
| * | | | | GPU: Allow using Z32 as a texture format.Subv2018-07-251-0/+4
| |/ / / /
* | | | | Merge pull request #814 from Subv/rt_r8bunnei2018-07-252-0/+4
|\ \ \ \ \ | | | | | | | | | | | | GPU: Allow the usage of R8 as a render target format.
| * | | | | GPU: Allow the usage of R8 as a render target format.Subv2018-07-252-0/+4
| |/ / / /
* | | | | Merge pull request #818 from MerryMage/dynarmicbunnei2018-07-251-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to 98e2380
| * | | | | externals: Update dynarmic to 98e2380MerryMage2018-07-251-0/+0
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 98e2380 fuzz_with_unicorn: Disable testing of FDIV 041b7d5 block_of_code: Add ABI_PARAMS array 2a2371c A64: Implement MLA, MLS (by element), vector single/double variant 78c640a A64: Implement FMLS (vector), single/double variant b6b6993 emit_x64_vector_floating_point: Specify NanHandler::function_type explicitly 4b9d12a emit_x64_vector_floating_point: ChooseOnFsize arguments maybe_unused b1e3616 IR: Implement FPVectorNeg 4343612 A64: Implement FMLA (vector), single/double variant 93eeb25 IR: Implement FPVectorMulAdd 57e5c7e emit_x64_vector_floating_point: Standardize naming scheme bcb9e41 emit_x64_floating_point: Simplify indexers 83aa585 emit_x64_vector_floating_point: Simplify EmitVectorOperation* f4087c8 mp: rename mp.h to mp/function_info.h 1864090 emit_x64_vector: Slightly improve ArithmeticShiftRightByte e048441 emit_x64_vector: Simplify VectorShuffleImpl ff025e8 IR: Implement A64OrQC 6fac68d A64: Implement UQSHRN, UQRSHRN (vector) 5a8d9c3 emit_x64_vector: -0x80000000 isn't -0x80000000 759289e A64: Implement UQXTN (vector) 2a96281 emit_x64_vector: Fix non-SSE4.1 saturated narrowing reconstruction comparison 0682353 A64: Implement SQXTN (vector) 6c5229e emit_x64_vector: packusdw reqiures SSE4.1 158d9b1 A64: Implement SQSHRUN, SQRSHRUN (vector) f886013 simd_shift_by_immediate: Simplify ShiftRight d9b59c6 A64: Implement SQXTUN 50fe28b microinstruction: Reorganize FPSCR related instruction queries d9d036a microinstruction: Add missing FP scalar opcodes to ReadsFromFPSCR() and WritesToFPSCR() db96163 u128: Make Bit() a const-qualified member function f7052ae A64: Implement FRSQRTS (vector), single/double variant 0925ef6 A64: Implement FRSQRTE (vector), single/double variant f4cbbe3 A64: Implement FRSQRTS (scalar), single/double variant 4ef864e IR: Implement FPRSqrtStepFused 9dffeeb fp: Implement FPRSqrtStepFused aa04556 fp: Implement FPNeg cbde1c5 process_nan: Add two operand variant 1ec2663 A64: Implement FMAXP, FMINP, FMAXNMP and FMINNMP's scalar double/single-precision variant 027ddf9 emit_x64_floating_point: Fixup special NaN case in FMA FPMulAdd implementation 75a9f77 fp: Use a forward declaration in fused.h 1ee1630 u128: Implement comparison operators in terms of one another 3b77f48 tests: Print cpu info bed3cc0 u128: StickyLogicalShiftRight requires special-casing for amount == 64 15d04f4 A64: Implement FMLA and FMLS (by element)'s double/single-precision scalar variant 7cfccdf A64: Implement FMUL (by element)'s scalar double/single-precision variant 7d2d62e (fpmuladd) emit_x64_floating_point: Implement accurate fallback for FPMulAdd{32,64} a599eac fp: Implement FPMulAdd d70b90e process_nan: Add FPProcessNaNs3 38ef0e0 block_of_code: Add SysV ABI fifth and sixth parameters 8e2ff56 u128: Add StickyLogicalShiftRight 3b337df u128: Add Multiply64To128 8219075 u128: Add u128::Bit a574dcb u128: Add comparison operators 391d6d4 unpacked: Use ResidualErrorOnRightShift in FPRoundBase 5e0cf9c fp: Remove MantissaT 8c0a84c FPRSqrtEstimate: Improve documentation of RecipSqrtEstimate c41d855 FPRSqrtEstimate: Deduplicate array bounds 4cf055b A64: Implement FMAXV, FMINV, FMAXNMV, and FMINNMV bf24f0f FPRSqrtEstimate: Use forward declarations where applicable 206230e translate: Return by bool in helpers where applicable 346b725 Simplify fallback case for EmitVectorSetElement64() 2c34e1d emit_x64_floating_point: s/Esimate/Estimate/ 5213fb6 simd_scalar_two_register_misc: Implement FRSQRTE, scalar variant 7ed089f IR: Implement FPRSqrtEstimate cd2e286 simd_vector_x_indexed_element: Implement FMUL (by element), vector variant
* | | | | Merge pull request #809 from lioncash/rasterizerbunnei2018-07-252-16/+13
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Minor cleanup
| * | | | | gl_rasterizer: Replace magic number with GL_INVALID_INDEX in SetupConstBuffers()Lioncash2018-07-241-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is just the named constant that OpenGL provides, so we can use that instead of using a literal -1
| * | | | | gl_rasterizer: Use std::string_view instead of std::string when checking for extensionsLioncash2018-07-241-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid heap allocations here by just using a std::string_view instead of performing unnecessary copying of the string data.
| * | | | | gl_rasterizer: Use in-class member initializers where applicableLioncash2018-07-242-12/+5
| | |_|_|/ | |/| | | | | | | | | | | | | We can just assign to the members directly in these cases.
* | | | | Merge pull request #811 from Subv/code_address_assertbunnei2018-07-251-8/+0
|\ \ \ \ \ | |_|/ / / |/| | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.
| * | | | GPU: Remove the assert that required the CODE_ADDRESS to be 0.Subv2018-07-241-8/+0
| |/ / / | | | | | | | | | | | | Games usually just leave it at 0 but nouveau sets it to something else. This already works fine, the assert is useless.
* | | | Merge pull request #806 from lioncash/friendbunnei2018-07-256-48/+15
|\ \ \ \ | | | | | | | | | | friend: Deduplicate interfaces
| * | | | friend: Add friend:m, friend:s, and friend:v servicesLioncash2018-07-241-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Given we already have friend:a and friend:u, we should add the remaining services as well.
| * | | | friend/interface: Add missing CreateDaemonSuspendSessionService() to the function handler tableLioncash2018-07-241-0/+1
| | | | |
| * | | | friend: Deduplicate interfacesLioncash2018-07-246-48/+11
| |/ / /
* | | | Merge pull request #810 from Subv/r16bunnei2018-07-253-5/+32
|\ \ \ \ | | | | | | | | | | GPU: Implemented the R16 and R16F texture formats.
| * | | | GPU: Implemented the R16 and R16F texture formats.Subv2018-07-243-5/+32
| |/ / /
* | | | Merge pull request #805 from lioncash/signbunnei2018-07-241-4/+7
|\ \ \ \ | | | | | | | | | | svc: Resolve sign comparison warnings in WaitSynchronization()
| * | | | svc: Resolve sign comparison warnings in WaitSynchronization()Lioncash2018-07-241-4/+7
| |/ / / | | | | | | | | | | | | | | | | The loop's induction variable was signed, but we were comparing against an unsigned variable.
* | | | Merge pull request #807 from lioncash/unusedbunnei2018-07-241-29/+0
|\ \ \ \ | |/ / / |/| | | deconstructed_rom_directory: Remove unused FindRomFS() function
| * | | deconstructed_rom_directory: Remove unused FindRomFS() functionLioncash2018-07-241-29/+0
|/ / /
* | | Merge pull request #798 from lioncash/constbunnei2018-07-242-3/+3
|\ \ \ | | | | | | | | arm_dynarmic: Make MakeJit() a const member function
| * | | arm_dynarmic: Make MakeJit() a const member functionLioncash2018-07-242-3/+3
| |/ / | | | | | | | | | | | | This functions doesn't modify instance state, so it can be a made a const member function.
* | | Merge pull request #797 from lioncash/explicitbunnei2018-07-245-5/+5
|\ \ \ | | | | | | | | core: Make converting constructors explicit where applicable
| * | | core: Make converting constructors explicit where applicableLioncash2018-07-245-5/+5
| |/ / | | | | | | | | | | | | Avoids unwanted implicit conversions. Thankfully, given the large amount of cleanup in past PRs, only this tiny amount is left over to cover.
* | | Merge pull request #795 from lioncash/declbunnei2018-07-241-3/+0
|\ \ \ | | | | | | | | apm/interface: Remove redundant declaration of InstallInterfaces()
| * | | apm/interface: Remove redundant declaration of InstallInterfaces()Lioncash2018-07-241-3/+0
| |/ / | | | | | | | | | This is already declared in apm/apm.h
* | | Merge pull request #799 from Subv/tex_r32fbunnei2018-07-243-6/+19
|\ \ \ | | | | | | | | GPU: Implement texture format R32F.
| * | | GPU: Implement texture format R32F.Subv2018-07-243-6/+19
| | | |
* | | | Merge pull request #794 from lioncash/refbunnei2018-07-241-1/+1
|\ \ \ \ | | | | | | | | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by reference
| * | | | mutex: Pass SharedPtr to GetHighestPriorityMutexWaitingThread() by referenceLioncash2018-07-241-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | The pointed to thread's members are simply observed in this case, so we don't need to copy it here.
* | | | | Merge pull request #796 from bunnei/gl-uintbunnei2018-07-241-0/+3
|\ \ \ \ \ | | | | | | | | | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.
| * | | | | maxwell_to_gl: Implement VertexAttribute::Type::UnsignedInt.bunnei2018-07-241-0/+3
| | | | | |
* | | | | | Merge pull request #789 from bunnei/tex-wrap-borderbunnei2018-07-244-11/+13
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.
| * | | | | gl_rasterizer: Implement texture border color.bunnei2018-07-243-11/+11
| | | | | |
| * | | | | maxwell_to_gl: Implement Texture::WrapMode::Border.bunnei2018-07-241-0/+2
| | |_|/ / | |/| | |
* | | | | Merge pull request #793 from lioncash/privbunnei2018-07-242-17/+19
|\ \ \ \ \ | | | | | | | | | | | | ipc_helpers: Make member variables of ResponseBuilder private
| * | | | | hle_ipc: Make constructors explicit where applicableLioncash2018-07-242-12/+13
| | | | | |
| * | | | | ipc_helpers: Make member variables of ResponseBuilder privateLioncash2018-07-241-5/+6
| | |_|/ / | |/| | | | | | | | | | | | | These aren't used externally at all, so they can be made private.
* | | | | Merge pull request #785 from lioncash/fsbunnei2018-07-241-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | | partition_filesystem: Use std::move where applicable
| * | | | partition_filesystem: Use std::move where applicableLioncash2018-07-241-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Avoids copying a std::string instance and avoids unnecessary atomic reference count incrementing and decrementing.
* | | | | Merge pull request #791 from bunnei/rg32f-rgba32f-bgra8bunnei2018-07-245-12/+70
|\ \ \ \ \ | |_|_|/ / |/| | | | gl_rasterizer_cache: Implement formats BGRA8_UNORM/RGBA32_FLOAT/RG32_FLOAT
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RG32_FLOAT.bunnei2018-07-245-7/+25
| | | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat RGBA32_FLOAT.bunnei2018-07-242-10/+34
| | | | |
| * | | | gl_rasterizer_cache: Implement RenderTargetFormat BGRA8_UNORM.bunnei2018-07-244-8/+22
| | | | |
| * | | | gl_rasterizer_cache: Add missing log statements.bunnei2018-07-241-0/+2
| | | | |
* | | | | Merge pull request #792 from lioncash/retvalbunnei2018-07-241-2/+2
|\ \ \ \ \ | |_|_|_|/ |/| | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()
| * | | | gl_shader_decompiler: Correct return value of WriteTexsInstruction()Lioncash2018-07-241-2/+2
| | |_|/ | |/| | | | | | | | | | This should be returning void, not a std::string
* | | | Merge pull request #790 from bunnei/shader-print-instrbunnei2018-07-241-1/+2
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Print instruction value in shader comments.
| * | | | gl_shader_decompiler: Print instruction value in shader comments.bunnei2018-07-241-1/+2
| | |/ / | |/| |
* | | | Merge pull request #788 from bunnei/shader-check-zerobunnei2018-07-241-0/+6
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.
| * | | | gl_shader_decompiler: Check if SetRegister result is ZeroIndex.bunnei2018-07-241-0/+6
| |/ / /
* | / / VFS Regression and Accuracy Fixes (#776)Zach Hilman2018-07-245-37/+75
| |/ / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Regression and Mode Fixes * Review Fixes * string_view correction * Add operator& for FileSys::Mode * Return std::string from SanitizePath * Farming Simulator Fix * Use != With mode operator&
* | | Merge pull request #787 from bunnei/tldsbunnei2018-07-241-29/+43
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement shader instruction TLDS.
| * | | gl_shader_decompiler: Implement shader instruction TLDS.bunnei2018-07-241-29/+43
| | | |
* | | | Merge pull request #786 from lioncash/exclusivebunnei2018-07-243-22/+18
|\ \ \ \ | | | | | | | | | | exclusive_monitor: Use consistent type alias for u64
| * | | | exclusive_monitor: Use consistent type alias for u64Lioncash2018-07-243-22/+18
| | |_|/ | |/| | | | | | | | | | | | | | Uses the same type aliases we use for virtual addresses, and converts one lingering usage of std::array<uint64_t, 2> to u128 for consistency.
* | | | Merge pull request #784 from lioncash/loaderbunnei2018-07-241-1/+1
|\ \ \ \ | | | | | | | | | | loader: Minor cleanup
| * | | | loader: Remove unnecessary constructor call in IdentifyFile()Lioncash2018-07-231-1/+1
| |/ / / | | | | | | | | | | | | | | | | | | | | RealVfsFile inherits from VfsFile, the instance from std::make_shared is already compatible with the function argument type, making the copy constructor call unnecessary.
* | | | Merge pull request #783 from lioncash/linkerbunnei2018-07-242-7/+4
|\ \ \ \ | | | | | | | | | | linker: Remove unused parameter from WriteRelocations()
| * | | | linker: Remove unused parameter from WriteRelocations()Lioncash2018-07-232-7/+4
| |/ / / | | | | | | | | | | | | | | | | is_jump_relocation is never used within the function, so we can just remove it.
* | | | Merge pull request #782 from lioncash/filebunnei2018-07-242-14/+33
|\ \ \ \ | |_|/ / |/| | | loader/nro: Minor changes
| * | | nro: Replace inclusion with a forward declarationLioncash2018-07-232-1/+8
| | | | | | | | | | | | | | | | | | | | It's sufficient to use a forward declaration instead of a direct inclusion here.
| * | | nro: Make bracing consistentLioncash2018-07-231-10/+24
| | | | | | | | | | | | | | | | | | | | Makes the code more uniform, and also braces cases where the body of an unbraced conditional travels more than one line.
| * | | nro: Make constructor explicitLioncash2018-07-231-1/+1
| | | | | | | | | | | | | | | | | | | | Makes it consistent with the other Apploader constructors, and prevents implicit conversions.
| * | | nro: Remove unused forward declarationLioncash2018-07-231-2/+0
| |/ / | | | | | | | | | This isn't used anywhere in the header.
* | | Merge pull request #781 from lioncash/declbunnei2018-07-241-5/+5
|\ \ \ | | | | | | | | gl_shader_decompiler: Simplify GetCommonDeclarations()
| * | | gl_shader_decompiler: Simplify GetCommonDeclarations()Lioncash2018-07-231-5/+5
| | |/ | |/|
* | | Merge pull request #780 from lioncash/movebunnei2018-07-241-11/+22
|\ \ \ | | | | | | | | vi: Minor changes
| * | | vi: Add std::is_trivially_copyable checks to Read and Write functionsLioncash2018-07-231-2/+13
| | | | | | | | | | | | | | | | | | | | | | | | It's undefined behavior to memcpy an object that isn't considered trivially copyable, so put a compile-time check in to make sure this doesn't occur.
| * | | vi: std::move std::vector in constructors where applicableLioncash2018-07-231-9/+9
| |/ / | | | | | | | | | | | | | | | | | | Allows avoiding unnecessary copies of the vector depending on the calling code. While we're at it, remove a redundant no-parameter base constructor call
* | | Merge pull request #779 from lioncash/sharedbunnei2018-07-248-263/+0
|\ \ \ | |_|/ |/| | hle: Remove unused config_mem and shared_page source files
| * | hle: Remove config_mem.h/.cppLioncash2018-07-236-102/+0
| | | | | | | | | | | | | | | This is just an unused hold-over from citra, so we can get rid of this to trim off an exposed global, among other things.
| * | hle: Remove shared_page.h/.cppLioncash2018-07-236-161/+0
| |/ | | | | | | This is a holdover from citra that's essentially unused.
* | Merge pull request #695 from DarkLordZach/nro-assetbunnei2018-07-235-1/+215
|\ \ | | | | | | NRO Assets and NACP File Format
| * | NRO Assets and NACP file formatZach Hilman2018-07-235-1/+215
| | | | | | | | | | | | | | | | | | Cleanup Review fixes
* | | Merge pull request #778 from lioncash/logbunnei2018-07-231-0/+2
|\ \ \ | |_|/ |/| | set: Add missing log call in GetAvailableLanguageCodeCount()
| * | set: Add missing log call in GetAvailableLanguageCodeCount()Lioncash2018-07-231-0/+2
|/ / | | | | | | Forgot to include this in 22f448b6327044076959e338811ee576f3dcf093
* | Merge pull request #775 from lioncash/strbunnei2018-07-232-30/+32
|\ \ | | | | | | string_util: Minor changes
| * | string_util: Get rid of separate resize() in CPToUTF16(), UTF16ToUTF8(), CodeToUTF8() and UTF8ToUTF16()Lioncash2018-07-221-20/+22
| | | | | | | | | | | | | | | | | | | | | | | | There's no need to perform the resize separately here, since the constructor allows presizing the buffer. Also move the empty string check before the construction of the string to make the early out more straightforward.
| * | string_util: Use emplace_back() in SplitString() instead of push_back()Lioncash2018-07-221-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is equivalent to doing: push_back(std::string("")); which is likely not to cause issues, assuming a decent std::string implementation with small-string optimizations implemented in its design, however it's still a little unnecessary to copy that buffer regardless. Instead, we can use emplace_back() to directly construct the empty string within the std::vector instance, eliminating any possible overhead from the copy.
| * | string_util: Remove unnecessary std::string instance in TabsToSpaces()Lioncash2018-07-222-8/+7
| | | | | | | | | | | | | | | | | | We can just use the variant of std::string's replace() function that can replace an occurrence with N copies of the same character, eliminating the need to allocate a std::string containing a buffer of spaces.
* | | Merge pull request #777 from lioncash/langbunnei2018-07-232-23/+31
|\ \ \ | |_|/ |/| | set: Amend return value of GetAvailableLanguageCodes()
| * | set: Implement GetAvailableLanguageCodeCount()Lioncash2018-07-232-21/+29
| | | | | | | | | | | | This just returns the size of the language code buffer.
| * | set: Correct return code size of value in GetAvailableLanguageCodes()Lioncash2018-07-231-2/+2
| |/ | | | | | | The return code should be 32-bit in size.
* | Merge pull request #769 from bunnei/shader-mask-fixesbunnei2018-07-231-5/+9
|\ \ | | | | | | shader_bytecode: Implement other TEXS masks.
| * | shader_bytecode: Implement other TEXS masks.bunnei2018-07-221-5/+9
| | |
* | | Merge pull request #774 from Subv/atomic_signalbunnei2018-07-221-7/+31
|\ \ \ | |_|/ |/| | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.
| * | Kernel/SVC: Perform atomic accesses in SignalProcessWideKey as per the real kernel.Subv2018-07-221-7/+31
| | |
* | | Merge pull request #773 from Subv/gl_ext_checkbunnei2018-07-222-2/+24
|\ \ \ | | | | | | | | Frontend: Check for more required OpenGL extensions during startup.
| * | | Frontend: Check for more required OpenGL extensions during startup.Subv2018-07-222-2/+24
| |/ /
* | | Merge pull request #768 from lioncash/string-viewbunnei2018-07-2210-133/+213
|\ \ \ | | | | | | | | file_util, vfs: Use std::string_view where applicable
| * | | vfs: Correct file_p variable usage within InterpretAsDirectory()Lioncash2018-07-221-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ReplaceFileWithSubdirectory() takes a VirtualFile and a VirtualDir, but it was being passed a string as one of its arguments. The only reason this never caused issues is because this template isn't instantiated anywhere yet. This corrects an issue before it occurs.
| * | | file_util, vfs: Use std::string_view where applicableLioncash2018-07-2210-131/+208
| | | | | | | | | | | | | | | | | | | | Avoids unnecessary construction of std::string instances where applicable.
* | | | Merge pull request #770 from lioncash/constructbunnei2018-07-221-4/+8
|\ \ \ \ | |_|/ / |/| | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()
| * | | gl_shader_decompiler: Remove redundant Subroutine construction in AddSubroutine()Lioncash2018-07-221-4/+8
| | |/ | |/| | | | | | | | | | | | | We don't need to toss away the Subroutine instance after the find() call and reconstruct another instance with the same data right after it. Particularly give Subroutine contains a std::set.
* | | Merge pull request #638 from MerryMage/mpMat M2018-07-229-13/+160
|\ \ \ | | | | | | | | Implement exclusive monitor
| * | | Implement exclusive monitorMerryMage2018-07-229-13/+160
| |/ /
* | | Merge pull request #772 from MerryMage/dynarmicSebastian Valle2018-07-221-0/+0
|\ \ \ | |/ / |/| | externals: Update dynarmic to fc6b73bd
| * | externals: Update dynarmic to fc6b73bdMerryMage2018-07-221-0/+0
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | Resolves issues: * 128-bit exclusive writes on Windows * Non-updating CNTPCT_EL0 fc6b73 a64_emit_x64: Ensure host has updated ticks in EmitA64GetCNTPCT 888c67 a64_emit_x64: Fix stack misalignment on Windows for 128-bit exclusive writes 352d53 emit_x64_aes: Eliminate extraneous usage of a scratch register in EmitAESInverseMixColumns() ab7fe7 A64: Implement SADDLV 09bd2b A64: Implement UADDLV 62e86d fp: Use forward declarations where applicable b3edb7 emit_x64_vector: Append 'v' prefix onto movq in AVX path
* | Merge pull request #765 from lioncash/filebunnei2018-07-221-24/+14
|\ \ | | | | | | file_util: Remove goto usages from Copy()
| * | file_util: Remove goto usages from Copy()Lioncash2018-07-221-24/+14
| | | | | | | | | | | | | | | | | | We can just leverage std::unique_ptr to automatically close these for us in error cases instead of jumping to the end of the function to call fclose on them.
* | | Merge pull request #767 from bunnei/shader-cleanupbunnei2018-07-221-78/+15
|\ \ \ | | | | | | | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.
| * | | gl_shader_decompiler: Remove unused state tracking and minor cleanup.bunnei2018-07-221-78/+15
| | | |
* | | | Merge pull request #766 from bunnei/shader-selbunnei2018-07-222-0/+20
|\ \ \ \ | |_|_|/ |/| | | gl_shader_decompiler: Implement SEL instruction.
| * | | gl_shader_decompiler: Implement SEL instruction.bunnei2018-07-222-0/+20
| |/ /
* | | Merge pull request #764 from lioncash/movebunnei2018-07-225-19/+19
|\ \ \ | |/ / |/| | file_util: Minor changes to ScanDirectoryTree() and ForeachDirectoryEntry()
| * | file_util: Use a u64 to represent number of entriesLioncash2018-07-225-18/+18
| | | | | | | | | | | | | | | This avoids a truncating cast on size. I doubt we'd ever traverse a directory this large, however we also shouldn't truncate sizes away.
| * | file_util: std::move FST entries in ScanDirectoryTree()Lioncash2018-07-221-1/+1
| |/ | | | | | | Avoids unnecessary copies when building up the FST entries.
* | Merge pull request #761 from bunnei/improve-raster-cachebunnei2018-07-224-72/+157
|\ \ | |/ |/| Improvements to rasterizer cache
| * gl_rasterizer_cache: Blit surfaces on recreation instead of flush and load.bunnei2018-07-222-2/+86
| |
| * gl_rasterizer_cache: Use GPUVAddr as cache key, not parameter set.bunnei2018-07-223-57/+46
| |
| * gl_rasterizer_cache: Use zeta_width and zeta_height registers for depth buffer.bunnei2018-07-222-11/+11
| |
| * gl_rasterizer: Use zeta_enable register to enable depth buffer.bunnei2018-07-221-2/+2
| |
| * maxwell_3d: Add depth buffer enable, width, and height registers.bunnei2018-07-221-2/+14
|/
* Merge pull request #759 from lioncash/redundantbunnei2018-07-221-2/+1
|\ | | | | file_util: Remove redundant duplicate return in GetPathWithoutTop()
| * file_util: Remove explicit type from std::min() in GetPathWithoutTop()Lioncash2018-07-211-1/+1
| | | | | | | | | | Given both operands are the same type, there won't be an issue with overload selection that requires making this explicit.
| * file_util: Remove redundant duplicate return in GetPathWithoutTop()Lioncash2018-07-211-1/+0
| |
* | Merge pull request #748 from lioncash/namespacebunnei2018-07-2211-48/+24
|\ \ | | | | | | video_core: Use nested namespaces where applicable
| * | video_core: Use nested namespaces where applicableLioncash2018-07-2111-48/+24
| | | | | | | | | | | | Compresses a few namespace specifiers to be more compact.
* | | Merge pull request #758 from lioncash/syncbunnei2018-07-222-86/+0
|\ \ \ | | | | | | | | common: Remove synchronized_wrapper.h
| * | | common: Remove synchronized_wrapper.hLioncash2018-07-212-86/+0
| | | | | | | | | | | | | | | | This is entirely unused in the codebase.
* | | | Merge pull request #760 from lioncash/pathbunnei2018-07-2211-73/+85
|\ \ \ \ | | | | | | | | | | file_util: Use an enum class for GetUserPath()
| * | | | file_util: Use an enum class for GetUserPath()Lioncash2018-07-2111-73/+85
| | |_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of using an unsigned int as a parameter and expecting a user to always pass in the correct values, we can just convert the enum into an enum class and use that type as the parameter type instead, which makes the interface more type safe. We also get rid of the bookkeeping "NUM_" element in the enum by just using an unordered map. This function is generally low-frequency in terms of calls (and I'd hope so, considering otherwise would mean we're slamming the disk with IO all the time) so I'd consider this acceptable in this case.
* | | | Merge pull request #762 from Subv/ioctl2bunnei2018-07-223-6/+34
|\ \ \ \ | |/ / / |/| | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.
| * | | GPU: Implement the NVGPU_IOCTL_CHANNEL_KICKOFF_PB ioctl2 command.Subv2018-07-213-6/+34
|/ / / | | | | | | | | | | | | This behaves quite similarly to the SubmitGPFIFO command. Referenced from Ryujinx. Many thanks to @gdkchan for investigating this!
* | | Merge pull request #754 from lioncash/partbunnei2018-07-212-8/+20
|\ \ \ | | | | | | | | partition_filesystem, vfs_real: Minor changes
| * | | vfs_real: Remove redundant copying of std::vector instances in GetFiles() and GetSubdirectories()Lioncash2018-07-211-2/+3
| | | | | | | | | | | | | | | | | | | | We already return by value, so we don't explicitly need to make the copy.
| * | | partition_filesystem, vfs_real: Add missing standard includesLioncash2018-07-212-0/+4
| | | |
| * | | partition_filesystem, vfs_real: Use std::move in ReplaceFileWithSubdirectory() where applicableLioncash2018-07-212-2/+3
| | | | | | | | | | | | | | | | Avoids unnecessary atomic increment and decrement operations.
| * | | partition_filesystem, vfs_real: Use std::distance() instead of subtractionLioncash2018-07-212-4/+10
| | | | | | | | | | | | | | | | This is a little bit more self-documenting on what is being done here.
* | | | Merge pull request #750 from lioncash/ctxbunnei2018-07-213-9/+0
|\ \ \ \ | | | | | | | | | | arm_interface: Remove unused tls_address member of ThreadContext
| * | | | arm_interface: Remove unused tls_address member of ThreadContextLioncash2018-07-213-9/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Currently, the TLS address is set within the scheduler, making this member unused.
* | | | | Merge pull request #756 from lioncash/dynarmicbunnei2018-07-211-0/+0
|\ \ \ \ \ | |_|_|/ / |/| | | | externals: Update dynarmic to 7ea1241
| * | | | externals: Update dynarmic to 7ea1241Lioncash2018-07-211-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | Resolves an issue with TPIDR setting being erroneously removed in the dead code pass.
* | | | | Merge pull request #746 from lioncash/testsbunnei2018-07-212-4/+12
|\ \ \ \ \ | | | | | | | | | | | | tests/arm_test_common: Minor changes
| * | | | | arm_test_common: Get rid of truncation warningsLioncash2018-07-201-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | Explicitly cast the value to a u8 to show that this is intentional.
| * | | | | arm_test_common: Make file static variable a member variable of the testing environmentLioncash2018-07-202-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of file-static behavior.
| * | | | | arm_test_common: Add missing header guardLioncash2018-07-201-0/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #747 from lioncash/unimplementedbunnei2018-07-212-3/+3
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_manager: Remove unimplemented function prototype
| * | | | | gl_shader_manager: Replace unimplemented function prototypeLioncash2018-07-212-3/+3
| |/ / / / | | | | | | | | | | | | | | | This was just a linker error waiting to happen.
* | | | | Merge pull request #755 from lioncash/ctorbunnei2018-07-211-8/+8
|\ \ \ \ \ | | | | | | | | | | | | file_sys/errors: Remove redundant object constructor calls
| * | | | | file_sys/errors: Remove redundant object constructor callsLioncash2018-07-211-8/+8
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | Given we're already constructing the error code, we don't need to call the constructor inside of it.
* | | | | Merge pull request #749 from lioncash/consistencybunnei2018-07-214-14/+17
|\ \ \ \ \ | | | | | | | | | | | | gpu: Rename Get3DEngine() to Maxwell3D()
| * | | | | gpu: Rename Get3DEngine() to Maxwell3D()Lioncash2018-07-214-14/+17
| | |_|_|/ | |/| | | | | | | | | | | | | This makes it match its const qualified equivalent.
* | | | | Merge pull request #751 from Subv/tpidr_el0bunnei2018-07-218-0/+39
|\ \ \ \ \ | | | | | | | | | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch
| * | | | | CPU: Save and restore the TPIDR_EL0 system register on every context switch.Subv2018-07-218-0/+39
| | | | | | | | | | | | | | | | | | | | | | | | Note that there's currently a dynarmic bug preventing this register from being written.
* | | | | | Merge pull request #753 from lioncash/constbunnei2018-07-214-21/+15
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | vfs: Minor changes
| * | | | | vfs_offset: Simplify TrimToFit()Lioncash2018-07-211-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can simply use std::clamp() here, instead of using an equivalent with std::max() and std::min().
| * | | | | vfs: Make WriteBytes() overload taking a std::vector pass the std::vector by const referenceLioncash2018-07-214-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Given the data is intended to be directly written, there's no need to take the std::vector by value and copy the data.
| * | | | | vfs: Use variable template variants of std::is_trivially_copyableLioncash2018-07-211-13/+6
| | | | | | | | | | | | | | | | | | | | | | | | Provides the same behavior, but with less writing
| * | | | | vfs: Amend constness on pointers in WriteBytes() and WriteArrays() member functions to be const qualifiedLioncash2018-07-211-3/+3
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | These functions don't modify the data being pointed to, so these can be pointers to const data
* | | | | Merge pull request #752 from Subv/vfs_loadbunnei2018-07-211-5/+2
|\ \ \ \ \ | |/ / / / |/| | | | Loader: Only print the module names and addresses if they actually exist.
| * | | | Loader: Only print the module names and addresses if they actually exist.Subv2018-07-211-5/+2
| |/ / /
* | | | Merge pull request #743 from lioncash/viewbunnei2018-07-214-57/+56
|\ \ \ \ | | | | | | | | | | logging: Use std::string_view where applicable
| * | | | logging/filter: Use std::string_view in ParseFilterString()Lioncash2018-07-202-41/+40
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows avoiding constructing std::string instances, since this only reads an arbitrary sequence of characters. We can also make ParseFilterRule() internal, since it doesn't depend on any private instance state of Filter
| * | | | logging/backend: Add missing standard includesLioncash2018-07-202-4/+3
| | | | | | | | | | | | | | | | | | | | | | | | | A few inclusions were being satisfied indirectly. To prevent breakages in the future, include these directly.
| * | | | logging/backend: Use std::string_view in RemoveBackend() and GetBackend()Lioncash2018-07-202-12/+13
| | |_|/ | |/| | | | | | | | | | | | | | | | | | These can just use a view to a string since its only comparing against two names in both cases for matches. This avoids constructing std::string instances where they aren't necessary.
* | | | Merge pull request #745 from lioncash/packagebunnei2018-07-212-9/+12
|\ \ \ \ | |_|_|/ |/| | | param_package: Minor changes
| * | | param_package: Take std::string by value in string-based Set() functionLioncash2018-07-202-4/+6
| | | | | | | | | | | | | | | | | | | | Allows avoiding string copies by letting the strings be moved into the function calls.
| * | | param_package: Use std::unordered_map's insert_or_assign instead of map indexingLioncash2018-07-201-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids a redundant std::string construction if a key doesn't exist in the map already. e.g. data[key] requires constructing a new default instance of the value in the map (but this is wasteful, since we're already setting something into the map over top of it).
| * | | param_package: Get rid of file-static std::string constructionLioncash2018-07-201-3/+4
| |/ / | | | | | | | | | Avoids potential dynamic allocation occuring during program launch
* | | Merge pull request #742 from bunnei/misc-apmbunnei2018-07-211-1/+16
|\ \ \ | | | | | | | | apm: Improve stub for GetPerformanceConfiguration.
| * | | apm: Improve stub for GetPerformanceConfiguration.bunnei2018-07-201-1/+16
| |/ /
* | | Merge pull request #741 from lioncash/enumbunnei2018-07-211-0/+19
|\ \ \ | |/ / |/| | ipc_helpers: Add PushEnum() member function to ResponseBuilder
| * | ipc_helpers: Add PushEnum() member function to ResponseBuilderLioncash2018-07-201-0/+19
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allows pushing strongly-typed enum members without the need to always cast them at the call sites. Note that we *only* allow strongly-typed enums in this case. The reason for this is that strongly typed enums have a guaranteed defined size, so the size of the data being pushed is always deterministic. With regular enums this can be a little more error-prone, so we disallow them. This function simply uses the underlying type of the enum to determine the size of the data. For example, if an enum is defined as: enum class SomeEnum : u16 { SomeEntry }; if PushEnum(SomeEnum::SomeEntry); is called, then it will push a u16-size amount of data.
* | Merge pull request #740 from Subv/acc_crashbunnei2018-07-201-6/+8
|\ \ | | | | | | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.
| * | HLE/ACC: Stub IManagerForApplication::GetAccountId to return an error.Subv2018-07-201-6/+8
| |/ | | | | | | | | | | And make IManagerForApplication::CheckAvailability always return false. Returning a bogus id from GetAccountId causes games to crash on boot. We should investigate this with a hwtest and either stub it properly or implement it.
* | Merge pull request #739 from lioncash/gladbunnei2018-07-203-925/+993
|\ \ | | | | | | externals: Update glad to version 0.1.25
| * | externals: Update glad to version 0.1.25Lioncash2018-07-203-925/+993
| | | | | | | | | | | | | | | Keeps the OpenGL loader library up to date. Previously we were at version 0.1.16
* | | Merge pull request #738 from lioncash/signbunnei2018-07-201-16/+20
|\ \ \ | | | | | | | | gl_state: Get rid of mismatched sign conversions in Apply()
| * | | gl_state: Make references const where applicable in Apply()Lioncash2018-07-201-2/+3
| | | |
| * | | gl_state: Get rid of mismatched sign conversionsLioncash2018-07-201-14/+17
| |/ / | | | | | | | | | | | | While we're at it, amend the loop variable type to be the same width as that returned by the .size() call.
* | | Merge pull request #737 from lioncash/movebunnei2018-07-204-5/+9
|\ \ \ | | | | | | | | filesys/loader: std::move VirtualFile instances in constructors where applicable
| * | | loader/{nca, nro}: std::move VirtualFile in the constructors where applicableLioncash2018-07-202-2/+4
| | | | | | | | | | | | | | | | This avoids unnecessary atomic reference count increments and decrements
| * | | vfs_offset: std::move file and name parameters of OffsetVfsFileLioncash2018-07-202-3/+5
| |/ / | | | | | | | | | | | | Avoids potentially unnecessary atomic reference count incrementing and decrementing, as well as string copying.
* | | Merge pull request #736 from lioncash/nullbunnei2018-07-202-3/+6
|\ \ \ | | | | | | | | audout_u/audren_u: Ensure null terminators are written out in ListAudioOutsImpl(), ListAudioDeviceName(), and GetActiveAudioDeviceName()
| * | | audren_u: Use a std::array instead of std::string for holding the audio interface/device nameLioncash2018-07-201-2/+4
| | | | | | | | | | | | | | | | | | | | std::string doesn't include the null-terminator in its data() + size() range. This ensures that the null-terminator will also be written to the buffer
| * | | audout_u: Use a std::array instead of std::string for holding the audio interface nameLioncash2018-07-201-1/+2
| |/ / | | | | | | | | | | | | | | | Uses a type that doesn't potentially dynamically allocate, and ensures that the name of the interface is properly null-terminated when writing it to the buffer.
* | | Merge pull request #735 from lioncash/video-unusedbunnei2018-07-201-2/+0
|\ \ \ | | | | | | | | maxwell_3d: Remove unused variable within GetStageTextures()
| * | | maxwell_3d: Remove unused variable within GetStageTextures()Lioncash2018-07-201-2/+0
| |/ /
* | | Merge pull request #734 from lioncash/threadbunnei2018-07-2010-93/+92
|\ \ \ | | | | | | | | thread: Convert ThreadStatus into an enum class
| * | | thread: Convert ThreadStatus into an enum classLioncash2018-07-2010-93/+92
| |/ / | | | | | | | | | | | | Makes the thread status strongly typed, so implicit conversions can't happen. It also makes it easier to catch mistakes at compile time.
* | | Merge pull request #733 from lioncash/dirsbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()
| * | | partition_filesystem: Return pfs_dirs member variable within GetSubdirectories()Lioncash2018-07-201-1/+1
| |/ / | | | | | | | | | | | | This should be returned here, otherwise pfs_dirs is effectively only ever added to, but never read.
* | | Merge pull request #732 from lioncash/unusedbunnei2018-07-201-17/+6
|\ \ \ | | | | | | | | nso: Minor changes
| * | | nso: Silence implicit sign conversion warningsLioncash2018-07-201-4/+6
| | | |
| * | | nso: Remove unused function ReadSegment()Lioncash2018-07-201-13/+0
| |/ /
* | | Merge pull request #731 from lioncash/shadowbunnei2018-07-201-6/+4
|\ \ \ | |_|/ |/| | gl_shader_decompiler: Eliminate variable and declaration shadowing
| * | gl_shader_decompiler: Eliminate variable and declaration shadowingLioncash2018-07-201-6/+4
| |/ | | | | | | | | Ensures that no identifiers are being hidden, which also reduces compiler warnings.
* | Merge pull request #730 from lioncash/stringbunnei2018-07-201-2/+2
|\ \ | | | | | | gl_shader_decompiler: Remove unnecessary const from return values
| * | gl_shader_decompiler: Remove unnecessary const from return valuesLioncash2018-07-201-2/+2
| |/ | | | | | | | | This adds nothing from a behavioral point of view, and can inhibit the move constructor/RVO
* | Merge pull request #729 from lioncash/simplifybunnei2018-07-201-3/+3
|\ \ | |/ |/| pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()
| * pl_u: Simplify WriteBuffer() calls in GetSharedFontInOrderOfPriority()Lioncash2018-07-201-3/+3
|/ | | | With the new overload, we can simply pass the container directly.
* Merge pull request #726 from lioncash/overloadbunnei2018-07-205-10/+25
|\ | | | | hle_ipc: Introduce generic WriteBuffer overload for multiple container types
| * hle_ipc: Introduce generic WriteBuffer overload for multiple container typesLioncash2018-07-195-10/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This introduces a slightly more generic variant of WriteBuffer(). Notably, this variant doesn't constrain the arguments to only accepting std::vector instances. It accepts whatever adheres to the ContiguousContainer concept in the C++ standard library. This essentially means, std::array, std::string, and std::vector can be used directly with this interface. The interface no longer forces you to solely use containers that dynamically allocate. To ensure our overloads play nice with one another, we only enable the container-based WriteBuffer if the argument is not a pointer, otherwise we fall back to the pointer-based one.
* | Merge pull request #725 from lioncash/bytesbunnei2018-07-201-3/+3
|\ \ | | | | | | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()
| * | pl_u: Specify correct size for buffers in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-3/+3
| |/ | | | | | | | | This WriteBuffer overload expects its size argument to be in bytes, not elements.
* | Merge pull request #728 from Subv/acc_profilebunnei2018-07-201-7/+16
|\ \ | | | | | | HLE/ACC: Change the default user id and small improvements to the way we handle profiles
| * | HLE/ACC: Return an IProfile that is consistent with what was requested.Subv2018-07-191-5/+15
| | | | | | | | | | | | | | | The default username for now is "yuzu". We should eventually allow the creation of users in the emulator and have the ability to modify their parameters.
| * | HLE/ACC: Change the default user id to be consistent with what we tell games on startup.Subv2018-07-191-2/+1
| | | | | | | | | | | | In IApplicationFunctions::PopLaunchParameter we tell the games that they were launched as user id 1.
* | | Merge pull request #727 from Subv/acc_usersbunnei2018-07-201-4/+6
|\ \ \ | | | | | | | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.
| * | | HLE/ACC: Write a single whole user id in ListAllUsers and ListOpenUsers.Subv2018-07-191-4/+6
| |/ / | | | | | | | | | We only emulate a single user id for now.
* | | Merge pull request #724 from lioncash/printfbunnei2018-07-201-1/+1
|\ \ \ | | | | | | | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()
| * | | pl_u: Remove printf specifier in log call in a log call in GetSharedFontInOrderOfPriority()Lioncash2018-07-191-1/+1
| | |/ | |/| | | | | | | This can just use the fmt specifiers and be type-agnostic.
* | | Merge pull request #723 from lioncash/gdbbunnei2018-07-201-7/+7
|\ \ \ | | | | | | | | gdbstub: Get rid of a few signed/unsigned comparisons
| * | | gdbstub: Get rid of a few signed/unsigned comparisonsLioncash2018-07-191-7/+7
| | | | | | | | | | | | | | | | Ensures both operands in comparisons are the same signedness.
* | | | Merge pull request #722 from lioncash/signedbunnei2018-07-202-8/+4
|\ \ \ \ | | | | | | | | | | hid: Resolve a signed/unsigned comparison warning
| * | | | hid: Use a ranged-for loops in UpdatePadCallbackLioncash2018-07-191-7/+3
| | | | | | | | | | | | | | | | | | | | | | | | | Modernizes the loops themselves while also getting rid of a signed/unsigned comparison in a loop condition.
| * | | | hid: Use HID_NUM_LAYOUTS constant for indicating size of the layouts arrayLioncash2018-07-191-1/+1
| |/ / / | | | | | | | | | | | | Gets rid of the use of a magic constant
* | | | Merge pull request #721 from lioncash/svcbunnei2018-07-201-3/+4
|\ \ \ \ | | | | | | | | | | svc: Correct always true assertion case in SetThreadCoreMask
| * | | | svc: Correct always true assertion case in SetThreadCoreMaskLioncash2018-07-191-3/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The reason this would never be true is that ideal_processor is a u8 and THREADPROCESSORID_DEFAULT is an s32. In this case, it boils down to how arithmetic conversions are performed before performing the comparison. If an unsigned value has a lesser conversion rank (aka smaller size) than the signed type being compared, then the unsigned value is promoted to the signed value (i.e. u8 -> s32 happens before the comparison). No sign-extension occurs here either. An alternative phrasing: Say we have a variable named core and it's given a value of -2. u8 core = -2; This becomes 254 due to the lack of sign. During integral promotion to the signed type, this still remains as 254, and therefore the condition will always be true, because no matter what value the u8 is given it will never be -2 in terms of 32 bits. Now, if one type was a s32 and one was a u32, this would be entirely different, since they have the same bit width (and the signed type would be converted to unsigned instead of the other way around) but would still have its representation preserved in terms of bits, allowing the comparison to be false in some cases, as opposed to being true all the time. --- We also get rid of two signed/unsigned comparison warnings while we're at it.
* | | | | Merge pull request #719 from lioncash/docsbunnei2018-07-202-5/+5
|\ \ \ \ \ | | | | | | | | | | | | loader: Amend Doxygen comments
| * | | | | loader: Amend Doxygen commentsLioncash2018-07-192-5/+5
| |/ / / / | | | | | | | | | | | | | | | These weren't adjusted when VFS was introduced
* | | | | Merge pull request #718 from lioncash/readbunnei2018-07-201-4/+6
|\ \ \ \ \ | | | | | | | | | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic value
| * | | | | loader/nso: Check if read succeeded in IdentifyFile() before checking magic valueLioncash2018-07-191-4/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We should always assume the filesystem is volatile and check each IO operation. While we're at it reorganize checks so that early-out errors are near one another.
* | | | | | Merge pull request #717 from lioncash/explicitbunnei2018-07-2022-25/+25
|\ \ \ \ \ \ | | | | | | | | | | | | | | hle/service: Make constructors explicit where applicable
| * | | | | | hle/service: Make constructors explicit where applicableLioncash2018-07-1922-25/+25
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit construction and makes these lingering non-explicit constructors consistent with the rest of the other classes in services.
* | | | | | Merge pull request #716 from lioncash/constructbunnei2018-07-191-9/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | nvflinger: Emplace Display instances directly
| * | | | | | nvflinger: Emplace Display instances directlyLioncash2018-07-191-9/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can use emplace_back to construct the Display instances directly, instead of constructing them separately and copying them, avoiding the need to copy std::string and std::vector instances that are part of the Display struct.
* | | | | | Merge pull request #715 from lioncash/const-refbunnei2018-07-191-1/+1
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | nvdrv: Take std::string by const reference in GetDevice()
| * | | | | nvdrv: Take std::string by const reference in GetDevice()Lioncash2018-07-191-1/+1
| |/ / / / | | | | | | | | | | | | | | | | | | | | This is only ever used as a lookup into the device map, so we don't need to take the std::string instance by value here.
* | | | | Merge pull request #720 from Subv/getentrytype_rootSebastian Valle2018-07-191-0/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | Filesystem: Return EntryType::Directory for the root directory.
| * | | | Filesystem: Return EntryType::Directory for the root directory.Subv2018-07-191-0/+4
| | | | | | | | | | | | | | | | | | | | It is unknown if this is correct behavior, but it makes sense and fixes a regression with Stardew Valley.
* | | | | Merge pull request #714 from lioncash/indexSebastian Valle2018-07-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloads
| * | | | | hle_ipc: Amend usage of buffer_index within one of HLERequestContext's WriteBuffer() overloadsLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, the buffer_index parameter was unused, causing all writes to use the buffer index of zero, which is not necessarily what is wanted all the time. Thankfully, all current usages don't use a buffer index other than zero, so this just prevents a bug before it has a chance to spring.
* | | | | | Merge pull request #712 from lioncash/fspbunnei2018-07-191-17/+22
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | fsp_srv: Misc individual changes
| * | | | | fsp_srv: Remove unnecessary vector construction in IFile's Write() functionLioncash2018-07-191-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We can avoid constructing a std::vector here by simply passing a pointer to the original data and the size of the copy we wish to perform to the backend's Write() function instead, avoiding copying the data where it's otherwise not needed.
| * | | | | fsp_srv: Remove unnecessary std::vector construction in IDirectory's Read() functionLioncash2018-07-191-10/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | We were using a second std::vector as a buffer to convert another std::vector's data into a byte sequence, however we can just use pointers to the original data and use them directly with WriteBuffer, which avoids copying the data at all into a separate std::vector. We simply cast the pointers to u8* (which is allowed by the standard, given std::uint8_t is an alias for unsigned char on platforms that we support).
| * | | | | fsp_srv: Make IStorage constructor explicitLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | | fsp_srv: Add missing includesLioncash2018-07-191-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of relying on indirect inclusions.
| * | | | | fsp_srv: Resolve sign-mismatch warnings in assertion comparisonsLioncash2018-07-191-3/+3
| | | | | |
| * | | | | fsp_srv: Respect write length in Write()Lioncash2018-07-191-4/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were just copying the data whole-sale, even if the length was less than the total data size. This effectively makes the actual_data vector useless, which is likely not intended. Instead, amend this to only copy the given length amount of data. At the same time, we can avoid zeroing out the data before using it by passing iterators to the constructor instead of a size.
* | | | | Merge pull request #713 from lioncash/filesysbunnei2018-07-191-3/+3
|\ \ \ \ \ | | | | | | | | | | | | filesystem: Minor changes
| * | | | | filesystem: std::move VirtualDir instance in VfsDirectoryServiceWrapper's constructorLioncash2018-07-191-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | Avoids unnecessary atomic reference count incrementing and decrementing
| * | | | | filesystem: Use std::string's empty() function instead of comparing against a literalLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is simply a basic value check as opposed to potentially doing string based operations (unlikely, but still, avoiding it is free).
| * | | | | filesystem: Remove pragma disabling global optimizationsLioncash2018-07-191-2/+0
| |/ / / / | | | | | | | | | | | | | | | This was just an artifact missed during PR review.
* | | | | Merge pull request #711 from lioncash/swapbunnei2018-07-191-50/+50
|\ \ \ \ \ | | | | | | | | | | | | common/swap: Minor changes
| * | | | | common/swap: Remove unnecessary const on return value of swap()Lioncash2018-07-191-1/+1
| | | | | |
| * | | | | common/swap: Use static_cast where applicableLioncash2018-07-191-16/+16
| | | | | |
| * | | | | common/swap: Use using aliases where applicableLioncash2018-07-191-33/+33
| |/ / / /
* | | | | Merge pull request #710 from lioncash/unusedbunnei2018-07-191-38/+0
|\ \ \ \ \ | | | | | | | | | | | | common/common_funcs: Remove unused rotation functions
| * | | | | common/common_funcs: Remove unused rotation functionsLioncash2018-07-191-38/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These are unused and essentially don't provide much benefit either. If we ever need rotation functions, these can be introduced in a way that they don't sit in a common_* header and require a bunch of ifdefing to simply be available
* | | | | Merge pull request #694 from lioncash/warnbunnei2018-07-192-6/+4
|\ \ \ \ \ | |_|_|_|/ |/| | | | loader/{nro, nso}: Resolve compilation warnings
| * | | | loader/nro: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
| * | | | loader/nso: Remove unnecessary vector resizesLioncash2018-07-191-4/+2
| | | | | | | | | | | | | | | | | | | | We can just initialize these vectors directly via their constructor.
| * | | | loader/nso: Resolve sign mismatch warningsLioncash2018-07-191-1/+1
| | | | |
* | | | | Merge pull request #709 from lioncash/thread-localbunnei2018-07-192-12/+8
|\ \ \ \ \ | | | | | | | | | | | | common/misc: Deduplicate code in GetLastErrorMsg()
| * | | | | common/misc: Deduplicate code in GetLastErrorMsg()Lioncash2018-07-192-12/+8
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Android and macOS have supported thread_local for quite a while, but most importantly is that we don't even really need it. Instead of using a thread-local buffer, we can just return a non-static buffer as a std::string, avoiding the need for that quality entirely.
* | | | | Merge pull request #708 from lioncash/xbyakbunnei2018-07-191-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update Xbyak to 5.65
| * | | | | externals: Update Xbyak to 5.65Lioncash2018-07-191-0/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | Keeps the JIT assembler library up to date and ensures we don't run into any issues that may have been resolved.
* | | | | Merge pull request #707 from lioncash/catchbunnei2018-07-191-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update catch to v2.2.3
| * | | | | externals: Update catch to v2.2.3Lioncash2018-07-191-0/+0
| |/ / / / | | | | | | | | | | | | | | | Keeps the unit-testing library up to date.
* | | | | Merge pull request #705 from lioncash/string-refbunnei2018-07-192-2/+2
|\ \ \ \ \ | | | | | | | | | | | | file_util: return string by const reference for GetExeDirectory()
| * | | | | file_util: return string by const reference for GetExeDirectory()Lioncash2018-07-192-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This disallows modifying the internal string buffer (which shouldn't be modified anyhow).
* | | | | | Merge pull request #704 from lioncash/stringbunnei2018-07-192-15/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | string_util: Remove AsciiToHex()
| * | | | | | string_util: Remove AsciiToHex()Lioncash2018-07-192-15/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Easy TODO
* | | | | | | Merge pull request #703 from lioncash/constbunnei2018-07-192-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member function
| * | | | | | | savedata_factory: Make SaveDataDescriptor's DebugInfo() function a const member functionLioncash2018-07-192-2/+2
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | This function doesn't alter class state.
* | | | | | | Merge pull request #702 from lioncash/initializebunnei2018-07-192-24/+15
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initialized
| * | | | | | partition_filesystem: Ensure all class members of PartitionFilesystem are initializedLioncash2018-07-192-24/+15
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously is_hfs and pfs_header members wouldn't be initialized in the constructor, as they were stored in locals instead. This would result in things like GetName() and PrintDebugInfo() behaving incorrectly. While we're at it, initialize the members to deterministic values as well, in case loading ever fails.
* | | | | | Merge pull request #701 from lioncash/movingbunnei2018-07-192-2/+10
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | content_archive: Minor changes
| * | | | | content_archive: Make IsDirectoryExeFS() take a shared_ptr as a const referenceLioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There's no need to take this by value when it's possible to avoid unnecessary copies entirely like this.
| * | | | | content_archive: Add missing standard includesLioncash2018-07-191-0/+5
| | | | | |
| * | | | | content_archive: std::move VirtualFile in NCA's constructorLioncash2018-07-191-1/+4
| |/ / / / | | | | | | | | | | | | | | | | | | | | Gets rid of unnecessary atomic reference count incrementing and decrementing.
* | | | | Merge pull request #699 from lioncash/vfsbunnei2018-07-191-6/+6
|\ \ \ \ \ | | | | | | | | | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()
| * | | | | vfs: Deduplicate accumulation code in VfsDirectory's GetSize()Lioncash2018-07-191-6/+6
| |/ / / / | | | | | | | | | | | | | | | We can just use a generic lambda to avoid writing the same thing twice.
* | | | | Merge pull request #697 from bunnei/disable-depth-cullbunnei2018-07-191-1/+3
|\ \ \ \ \ | |_|_|/ / |/| | | | gl_state: Temporarily disable culling and depth test.
| * | | | gl_state: Temporarily disable culling and depth test.bunnei2018-07-191-1/+3
| | |_|/ | |/| |
* | | | Merge pull request #700 from bunnei/update-dynarmicbunnei2018-07-191-0/+0
|\ \ \ \ | |_|_|/ |/| | | externals: Update dynarmic to 5a91c94.
| * | | externals: Update dynarmic to 5a91c94.bunnei2018-07-191-0/+0
| |/ /
* | | Merge pull request #692 from lioncash/assignbunnei2018-07-191-1/+1
|\ \ \ | | | | | | | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()
| * | | address_arbiter: Correct assignment within an assertion statement in WakeThreads()Lioncash2018-07-191-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | This was introduced within 4f81bc4e1bd12e4df7410c6790ba818d8dbba9c0, and considering there's no comment indicating that this is intentional, this is very likely a bug.
* | | | Merge pull request #690 from lioncash/movebunnei2018-07-199-16/+26
|\ \ \ \ | |_|_|/ |/| | | core/memory, core/hle/kernel: Use std::move where applicable
| * | | core/memory, core/hle/kernel: Use std::move where applicableLioncash2018-07-199-16/+26
| | | | | | | | | | | | | | | | Avoids pointless copies
* | | | Merge pull request #691 from lioncash/guardbunnei2018-07-191-0/+2
|\ \ \ \ | | | | | | | | | | service/prepo: Add missing header guard
| * | | | service/prepo: Add missing header guardLioncash2018-07-191-0/+2
| | |/ / | |/| |
* | | | Merge pull request #686 from lioncash/fmtbunnei2018-07-192-1/+1
|\ \ \ \ | |_|_|/ |/| | | externals: update fmt to version 5.1.0
| * | | externals: update fmt to version 5.1.0Lioncash2018-07-182-1/+1
| | |/ | |/| | | | | | | Previously, we were on 4.1.0, which was a major version behind.
* | | Merge pull request #688 from lioncash/commabunnei2018-07-191-22/+12
|\ \ \ | | | | | | | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()
| * | | vm_manager: Add missing commas to string literal array elements in GetMemoryStateName()Lioncash2018-07-191-22/+12
| |/ / | | | | | | | | | | | | Without these, this would perform concatenation, which is definitely not what we want here.
* | | Merge pull request #693 from lioncash/unusedbunnei2018-07-191-7/+0
|\ \ \ | | | | | | | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()
| * | | core/memory: Remove unused function GetSpecialHandlers() and an unused variable in ZeroBlock()Lioncash2018-07-191-7/+0
| | |/ | |/|
* | | Merge pull request #687 from lioncash/instancebunnei2018-07-196-22/+26
|\ \ \ | | | | | | | | core: Don't construct instance of Core::System, just to access its live instance
| * | | core: Make System's default constructor privateLioncash2018-07-192-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | This makes it a compilation error to construct additional instances of the System class directly, preventing accidental wasteful constructions over and over.
| * | | core: Don't construct instance of Core::System, just to access its live instanceLioncash2018-07-195-22/+22
| | |/ | |/| | | | | | | | | | | | | | | | | | | | | | This would result in a lot of allocations and related object construction, just to toss it all away immediately after the call. These are definitely not intentional, and it was intended that all of these should have been accessing the static function GetInstance() through the name itself, not constructed instances.
* | | Merge pull request #680 from bunnei/fix-swizzbunnei2018-07-191-1/+4
|\ \ \ | | | | | | | | decoders: Fix calc of swizzle image_width_in_gobs.
| * | | decoders: Fix calc of swizzle image_width_in_gobs.bunnei2018-07-191-1/+4
| | | |
* | | | Merge pull request #685 from lioncash/buildbunnei2018-07-190-0/+0
|\ \ \ \ | | | | | | | | | | hle/filesystem: Amend trace log in OpenSaveData() to compile in debug mode
| * | | | hle/filesystem: Amend trace log in OpenSaveData() to compile in debug modeLioncash2018-07-181-1/+1
| | |/ / | |/| | | | | | | | | | | | | | Previously this wouldn't compile, since no such function named SaveStructDebugInfo() exists.
* | | | Merge pull request #684 from lioncash/nonmemberbunnei2018-07-192-2/+1
|\ \ \ \ | |_|/ / |/| | | game_list: Make ContainsAllWords an internally linked non-member function
| * | | game_list: Make ContainsAllWords an internally linked non-member functionLioncash2018-07-182-2/+1
| |/ / | | | | | | | | | | | | This function actually depends on no internal class state, so it doesn't even need to be a part of the class interface.
* | / Virtual Filesystem 2: Electric Boogaloo (#676)Zach Hilman2018-07-1954-1959/+1926
| |/ |/| | | | | | | | | | | | | | | | | * Virtual Filesystem * Fix delete bug and documentate * Review fixes + other stuff * Fix puyo regression
* | Merge pull request #683 from DarkLordZach/touchbunnei2018-07-181-4/+24
|\ \ | |/ |/| Touchscreen Support
| * Fill in more fields in TouchScreenEntryTouchZach Hilman2018-07-181-4/+9
| |
| * Single touch supportZach Hilman2018-07-181-4/+19
|/
* Merge pull request #681 from lioncash/constbunnei2018-07-182-5/+7
|\ | | | | game_list: Make containsAllWords a const member function
| * game_list: Upper-case containsAllWords to ContainsAllWords()Lioncash2018-07-182-3/+3
| | | | | | | | | | This makes it consistent with most of the other private utility functions.
| * game_list: Make containsAllWords a const member functionLioncash2018-07-182-4/+6
| | | | | | | | | | | | This doesn't actually modify the internal class state, so it can be a const member function. While we're at it, amend the function to take its arguments by const reference.
* | Merge pull request #682 from lioncash/telemetrybunnei2018-07-181-20/+7
|\ \ | | | | | | Telemetry: Minor changes
| * | telemetry: Remove unnecessary Field constructorLioncash2018-07-181-4/+1
| | | | | | | | | | | | | | | We can just take the value parameter by value which allows both moving into it, and copies at the same time, depending on the calling code.
| * | telemetry: Make operator== and operator!= const member functions of FieldLioncash2018-07-181-2/+2
| | | | | | | | | | | | | | | | | | | | | These operators don't modify internal class state, so they can be made const member functions. While we're at it, drop the unnecessary inline keywords. Member functions that are defined in the class declaration are already inline by default.
| * | telemetry: Default copy/move constructors and assignment operatorsLioncash2018-07-181-14/+4
| |/ | | | | | | | | | | This provides the equivalent behavior, but without as much boilerplate. While we're at it, explicitly default the move constructor, since we have a move-assignment operator defined.
* | Merge pull request #679 from lioncash/ctorbunnei2018-07-181-4/+1
|\ \ | | | | | | game_list: Remove unnecessary QString initialization in KeyReleaseEater
| * | game_list: Remove unnecessary QString initialization in KeyReleaseEaterLioncash2018-07-181-4/+1
| |/ | | | | | | | | | | QString initializes to an empty string by default, so this does nothing meaningful. While we're at it, use a constructor initializer list for initializing the gamelist member variable.
* | Merge pull request #678 from lioncash/astcbunnei2018-07-181-78/+60
|\ \ | | | | | | astc: Minor changes
| * | astc: Initialize vector size directly in DecompressLioncash2018-07-181-2/+1
| | | | | | | | | | | | There's no need to perform a separate resize.
| * | astc: Mark functions as internally linked where applicableLioncash2018-07-181-17/+20
| | |
| * | astc: const-correctness changes where applicableLioncash2018-07-181-14/+13
| | | | | | | | | | | | | | | A few member functions didn't actually modify class state, so these can be amended as necessary.
| * | astc: Delete Bits' copy contstructor and assignment operatorLioncash2018-07-181-8/+6
| | | | | | | | | | | | | | | This also potentially avoids warnings, considering the copy assignment operator is supposed to have a return value.
| * | astc: In-class initialize member variables where appropriateLioncash2018-07-181-39/+22
| |/
* | Merge pull request #677 from bunnei/crop-fbbunnei2018-07-1812-20/+52
|\ \ | |/ |/| Implement buffer cropping and default to handheld mode
| * settings: Turn docked mode off by default.bunnei2018-07-183-3/+3
| |
| * vi: Change TransactionId::CancelBuffer to LOG_CRITICAL.bunnei2018-07-181-1/+1
| |
| * vi: Fix size for ListDisplays default display.bunnei2018-07-181-2/+2
| |
| * vi: Partially implement buffer crop parameters.bunnei2018-07-189-14/+46
|/
* Merge pull request #675 from Subv/stencilbunnei2018-07-181-2/+25
|\ | | | | GPU: Added register definitions for the stencil parameters.
| * GPU: Added register definitions for the stencil parameters.Subv2018-07-171-2/+25
| |
* | General Filesystem and Save Data Fixes (#670)Zach Hilman2018-07-1716-212/+256
| |
* | Merge pull request #671 from MerryMage/clear-exclusive-statebunnei2018-07-176-0/+11
|\ \ | | | | | | scheduler: Clear exclusive state when switching contexts
| * | scheduler: Clear exclusive state when switching contextsMerryMage2018-07-166-0/+11
| | |
* | | Merge pull request #672 from SciresM/to_address_fixbunnei2018-07-171-2/+4
|\ \ \ | |_|/ |/| | svc:: Fix bug in svcWaitForAddress
| * | Kernel/Arbiter: Fix bug in WaitIfLessThanMichael Scire2018-07-171-2/+4
| |/
* | Merge pull request #673 from bunnei/fix-buffer-queue-evtbunnei2018-07-176-32/+21
|\ \ | |/ |/| nvflinger: Fix for BufferQueue event handling.
| * nvflinger: Fix for BufferQueue event handling.bunnei2018-07-176-32/+21
|/
* Merge pull request #669 from lioncash/dynarmicbunnei2018-07-161-0/+0
|\ | | | | externals: Update dynarmic to dfdec79
| * externals: Update dynarmic to dfdec79Lioncash2018-07-151-0/+0
|/
* Merge pull request #668 from jroweboy/controller-lagbunnei2018-07-151-3/+3
|\ | | | | HID: Update controllers less often
| * HID: Update controllers less oftenJames Rowe2018-07-151-3/+3
| |
* | Merge pull request #664 from jroweboy/logging-stuffbunnei2018-07-153-4/+17
|\ \ | |/ |/| Minor logging improvements
| * Logging: Dump all logs in the queue on close in debug modeJames Rowe2018-07-153-1/+12
| |
| * Logging: Don't lock the queue for the duration of the writeJames Rowe2018-07-141-3/+5
| |
* | Merge pull request #666 from bunnei/g8r8bunnei2018-07-153-9/+40
|\ \ | | | | | | gl_rasterizer_cache: Implement texture format G8R8.
| * | gl_rasterizer_cache: Implement texture format G8R8.bunnei2018-07-153-9/+40
|/ /
* | Merge pull request #665 from bunnei/fix-z24-s8bunnei2018-07-151-1/+2
|\ \ | | | | | | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.
| * | gl_rasterizer_cache: Fix incorrect offset in ConvertS8Z24ToZ24S8.bunnei2018-07-151-1/+2
| | |
* | | Merge pull request #659 from bunnei/depth16bunnei2018-07-153-1/+15
|\ \ \ | |/ / |/| | gl_rasterizer_cache: Implement depth format Z16_UNORM.
| * | gl_rasterizer_cache: Implement depth format Z16_UNORM.bunnei2018-07-153-1/+15
|/ /
* | Merge pull request #598 from bunnei/makedonecurrentbunnei2018-07-156-2/+39
|\ \ | | | | | | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.
| * | OpenGL: Use MakeCurrent/DoneCurrent for multithreaded rendering.bunnei2018-07-146-2/+39
| | |
* | | Merge pull request #663 from Subv/bsdbunnei2018-07-151-2/+1
|\ \ \ | | | | | | | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC
| * | | Services/BSD: Corrected the return for StartMonitoring according to SwIPC.Subv2018-07-141-2/+1
| | | |
* | | | Merge pull request #662 from Subv/delete_filebunnei2018-07-141-2/+4
|\ \ \ \ | | | | | | | | | | FileSys: Append the requested path to the filesystem base path in DeleteFile
| * | | | FileSys: Append the requested path to the filesystem base path in DeleteFile.Subv2018-07-141-2/+4
| |/ / / | | | | | | | | | | | | We were trying to delete things in the current directory instead of the actual filesystem directory. This may fix some savedata issues in some games.
* | | | Merge pull request #661 from ogniK5377/assert-nitbunnei2018-07-141-2/+2
|\ \ \ \ | |/ / / |/| | | No need to use ASSERT_MSG with an empty assert message
| * | | No need to use ASSERT_MSG with an empty messageDavid Marcec2018-07-141-2/+2
|/ / /
* | | Merge pull request #660 from Subv/depth_writebunnei2018-07-141-3/+8
|\ \ \ | |/ / |/| | GPU: Always enable the depth write when clearing the depth buffer.
| * | GPU: Always enable the depth write when clearing the depth buffer.Subv2018-07-141-3/+8
|/ / | | | | | | The GPU ignores that register when clearing, but OpenGL obeys the glDepthMask parameter, so we set the depth mask to GL_TRUE when clearing the depth buffer. It will be restored to the correct value automatically on the next draw call.
* | Merge pull request #657 from bunnei/dual-vsbunnei2018-07-137-89/+149
|\ \ | | | | | | gl_shader_gen: Implement dual vertex shader mode.
| * | gl_rasterizer: Fix check for if a shader stage is enabled.bunnei2018-07-133-35/+11
| | |
| * | gl_shader_gen: Implement dual vertex shader mode.bunnei2018-07-135-55/+139
| | | | | | | | | | | | - When VertexA shader stage is enabled, we combine with VertexB program to make a single Vertex Shader stage.
* | | More improvements to GDBStub (#653)Hedges2018-07-138-50/+173
|/ / | | | | | | | | | | | | | | | | | | | | * More improvements to GDBStub - Debugging of threads should work correctly with source and assembly level stepping and modifying registers and memory, meaning threads and callstacks are fully clickable in VS. - List of modules is available to the client, with assumption that .nro and .nso are backed up by an .elf with symbols, while deconstructed ROMs keep N names. - Initial support for floating point registers. * Tidy up as requested in PR feedback * Tidy up as requested in PR feedback
* | Merge pull request #656 from ogniK5377/audren-mem-initbunnei2018-07-131-3/+3
|\ \ | | | | | | Initialized memory for RequestUpdateAudioRenderer and fixed MemoryPoolSection to be more accurate
| * | We only need to alert for memory pool changesDavid Marcec2018-07-131-2/+0
| | |
| * | initialized voice status and unused sizes in the update data headerDavid Marcec2018-07-131-1/+3
| | |
* | | Merge pull request #655 from bunnei/pred-lt-nanbunnei2018-07-132-5/+7
|\ \ \ | | | | | | | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.
| * | | gl_shader_decompiler: Implement PredCondition::LessThanWithNan.bunnei2018-07-132-5/+7
| |/ /
* | | Merge pull request #654 from bunnei/cond-exitbunnei2018-07-132-8/+34
|\ \ \ | |/ / |/| | gl_shader_decompiler: Use FlowCondition field in EXIT instruction.
| * | gl_shader_decompiler: Use FlowCondition field in EXIT instruction.bunnei2018-07-132-8/+34
|/ /
* | Merge pull request #652 from Subv/fadd32iSebastian Valle2018-07-132-0/+32
|\ \ | | | | | | GPU: Implement the FADD32I shader instruction.
| * | GPU: Implement the FADD32I shader instruction.Subv2018-07-122-0/+32
| | |
* | | Merge pull request #651 from Subv/ffma_decodebunnei2018-07-121-1/+1
|\ \ \ | | | | | | | | GPU: Corrected the decoding of FFMA for immediate operands.
| * | | GPU: Corrected the decoding of FFMA for immediate operands.Subv2018-07-121-1/+1
| |/ /
* | | Port #3335 and #3373 from Citra: "Small SDL fixes" and "Print the actual error preventing SDL from working" (#637)Tobias2018-07-122-6/+4
| | | | | | | | | | | | | | | | | | * Port #3335 and #3373 from Citra * Fixup: Use the new logging placeholders
* | | Merge pull request #648 from ogniK5377/no-netbunnei2018-07-121-3/+21
|\ \ \ | | | | | | | | Let games/application know that we're offline
| * | | Added IsWirelessCommunicationEnabled, IsEthernetCommunicationEnabled, IsAnyInternetRequestAcceptedDavid Marcec2018-07-121-3/+21
| | | | | | | | | | | | | | | | Since we have no socket implementation we should be returning 0 to indicate we're currently offline.
* | | | Merge pull request #649 from ogniK5377/audout-autobunnei2018-07-122-14/+14
|\ \ \ \ | | | | | | | | | | Audout "Auto" functions
| * | | | Audout "Auto" functionsDavid Marcec2018-07-122-14/+14
| |/ / / | | | | | | | | | | | | Audout autos are identical to their counterpart except for the buffer type which yuzu already handles for us.
* | | | Merge pull request #650 from jroweboy/logging-stuffbunnei2018-07-123-4/+8
|\ \ \ \ | |/ / / |/| | / | | |/ | |/| Minor logging fixes
| * | yuzu - Fix duplicate logsJames Rowe2018-07-122-2/+7
| | |
| * | yuzu-cmd Apply the filter string from settingsJames Rowe2018-07-121-2/+1
|/ /
* | Merge pull request #559 from Subv/mount_savedatabunnei2018-07-122-2/+12
|\ \ | | | | | | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.
| * | Services/FS: Return the correct error code when trying to mount a nonexistent savedata.Subv2018-06-192-2/+12
| | |
* | | Merge pull request #585 from janisozaur/patch-11bunnei2018-07-121-3/+3
|\ \ \ | | | | | | | | Improve directory creation in WindowsCopyFiles.cmake
| * | | Improve directory creation in WindowsCopyFiles.cmakeMichał Janiszewski2018-06-241-3/+3
| | | |
* | | | Merge pull request #646 from bunnei/fix-hid-smobunnei2018-07-111-7/+5
|\ \ \ \ | | | | | | | | | | hid: Fix timestamps and controller type.
| * | | | hid: Fix timestamps and controller type.bunnei2018-07-111-7/+5
|/ / / / | | | | | | | | | | | | - This fixes user input in SMO.
* | | | Merge pull request #644 from ogniK5377/getconfig-errbunnei2018-07-111-17/+2
|\ \ \ \ | | | | | | | | | | NvOsGetConfigU32 production impl
| * | | | NvOsGetConfigU32 production implDavid Marcec2018-07-101-17/+2
| | | | | | | | | | | | | | | | | | | | | | | | | Settings are only used when RMOS_SET_PRODUCTION_MODE is set to 0. If production mode is set, the error code 0x30006 is returned instead
* | | | | Merge pull request #633 from FearlessTobi/port-definesbunnei2018-07-103-7/+7
|\ \ \ \ \ | | | | | | | | | | | | Port #3579 from Citra: Clean up architecture-specific defines
| * | | | | Port #3579 from CitrafearlessTobi2018-07-073-7/+7
| | | | | |
* | | | | | Merge pull request #642 from bunnei/create-save-dirbunnei2018-07-101-0/+9
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | savedata_factory: Always create a save directory for games.
| * | | | | savedata_factory: Always create a save directory for games.bunnei2018-07-081-0/+9
| | | | | |
* | | | | | Merge pull request #636 from FearlessTobi/add-gitignorebunnei2018-07-101-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #3513 (partly) from Citra: .gitignore: Add CMakeLists.txt.user to Project/editor files
| * | | | | | Port #3513 (partly) from CitrafearlessTobi2018-07-071-0/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #635 from FearlessTobi/port-crashfixbunnei2018-07-101-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #3474 from Citra: Do not crash on unimplemented code in debug build
| * | | | | | Port #3474 from CitrafearlessTobi2018-07-071-1/+1
| |/ / / / /
* | | | | | Merge pull request #634 from FearlessTobi/port-viewport-fixbunnei2018-07-101-6/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port #3505 from Citra: Fix QGLWidget viewport resize on macOS
| * | | | | | Port #3505 from CItrafearlessTobi2018-07-071-6/+7
| |/ / / / /
* | | | | | Merge pull request #640 from bunnei/flip-tris-viewportbunnei2018-07-091-1/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.
| * | | | | | gl_rasterizer: Flip triangles when regs.viewport_transform[0].scale_y is negative.bunnei2018-07-081-1/+4
| | |/ / / / | |/| | | | | | | | | | | | | | | | - Fixes a regression with Binding of Isaac.
* | | | | | Merge pull request #641 from bunnei/nvhost-ctrl-fixbunnei2018-07-091-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.
| * | | | | nvhost_ctrl: Fix NvOsGetConfigU32 for Snipper Clips.bunnei2018-07-081-1/+1
|/ / / / /
* | | | | Merge pull request #625 from Subv/imnmxbunnei2018-07-082-3/+31
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the IMNMX shader instruction.
| * | | | | GPU: Implemented the IMNMX shader instruction.Subv2018-07-042-3/+31
| | | | | | | | | | | | | | | | | | | | | | | | It's similar to the FMNMX instruction but it works on integers.
* | | | | | Merge pull request #627 from Subv/bc7ubunnei2018-07-083-7/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implemented the BC7U texture format.
| * | | | | | GPU: Implemented the BC7U texture format.Subv2018-07-073-7/+21
| | |/ / / / | |/| | | | | | | | | | | | | | | | Note: Our version of glad exports GL_COMPRESSED_RGBA_BPTC_UNORM as GL_COMPRESSED_RGBA_BPTC_UNORM_ARB, maybe it's time we update it.
* | | | | | Merge pull request #639 from bunnei/revert-vfsbunnei2018-07-0845-1784/+1676
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | Revert "Virtual Filesystem (#597)"
| * | | | | Revert "Virtual Filesystem (#597)"bunnei2018-07-0845-1784/+1676
|/ / / / / | | | | | | | | | | | | | | | This reverts commit 77c684c1140f6bf3fb7d4560d06d2efb1a2ee5e2.
* | | | | Merge pull request #632 from FearlessTobi/add-discord-linkbunnei2018-07-071-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | Port #3466 from Citra: Add link to Discord
| * | | | Port #3466 from CitraTobias2018-07-071-1/+1
| | | | |
* | | | | Merge pull request #631 from lioncash/dynarmicbunnei2018-07-071-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to f7d11baa1
| * | | | | externals: Update dynarmic to f7d11baa1Lioncash2018-07-071-0/+0
|/ / / / /
* | | | | Merge pull request #630 from FearlessTobi/remove-citra-referencesbunnei2018-07-063-3/+3
|\ \ \ \ \ | | | | | | | | | | | | Remove some references to Citra
| * | | | | Remove some references to CitrafearlessTobi2018-07-063-3/+3
| |/ / / /
* / / / / Virtual Filesystem (#597)Zach Hilman2018-07-0645-1676/+1784
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add VfsFile and VfsDirectory classes * Finish abstract Vfs classes * Implement RealVfsFile (computer fs backend) * Finish RealVfsFile and RealVfsDirectory * Finished OffsetVfsFile * More changes * Fix import paths * Major refactor * Remove double const * Use experimental/filesystem or filesystem depending on compiler * Port partition_filesystem * More changes * More Overhaul * FSP_SRV fixes * Fixes and testing * Try to get filesystem to compile * Filesystem on linux * Remove std::filesystem and document/test * Compile fixes * Missing include * Bug fixes * Fixes * Rename v_file and v_dir * clang-format fix * Rename NGLOG_* to LOG_* * Most review changes * Fix TODO * Guess 'main' to be Directory by filename
* | | | Merge pull request #629 from Subv/depth_testbunnei2018-07-052-9/+29
|\ \ \ \ | | | | | | | | | | GPU: Allow using the old NV04 values for the depth test function.
| * | | | GPU: Allow using the old NV04 values for the depth test function.Subv2018-07-052-9/+29
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | These seem to be just a valid as the GL token values. Thanks @ReinUsesLisp This restores graphical output to Disgaea 5
* | | | | Merge pull request #626 from Subv/shader_syncbunnei2018-07-052-0/+12
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Stub the shader SYNC and DEPBAR instructions.
| * | | | GPU: Stub the shader SYNC and DEPBAR instructions.Subv2018-07-042-0/+12
| |/ / / | | | | | | | | | | | | It is unknown at this moment if we actually need to do something with these instructions or if the GLSL compiler takes care of that for us.
* | | | Merge pull request #624 from Subv/f2f_roundbunnei2018-07-051-0/+3
|\ \ \ \ | | | | | | | | | | GPU: Implemented the F2F 'round' rounding mode.
| * | | | GPU: Implemented the F2F 'round' rounding mode.Subv2018-07-041-0/+3
| |/ / / | | | | | | | | | | | | It's implemented via the GLSL 'roundEven()' function.
* | | | Merge pull request #623 from Subv/vertex_typesbunnei2018-07-051-0/+8
|\ \ \ \ | | | | | | | | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types
| * | | | GPU: Implement the Size_16_16 and Size_10_10_10_2 vertex attribute types.Subv2018-07-041-0/+8
| |/ / / | | | | | | | | | | | | Both signed and unsigned variants.
* | | | Merge pull request #622 from Subv/unused_texbunnei2018-07-052-2/+5
|\ \ \ \ | | | | | | | | | | GPU: Ignore unused textures and corrected the TEX shader instruction decoding.
| * | | | GPU: Ignore textures that the GLSL compiler deemed unused when binding textures to the shaders.Subv2018-07-041-1/+4
| | | | |
| * | | | GPU: Corrected the decoding for the TEX shader instruction.Subv2018-07-041-1/+1
| |/ / /
* | | | Merge pull request #621 from Subv/psetp_bunnei2018-07-052-0/+43
|\ \ \ \ | | | | | | | | | | GPU: Implemented the PSETP shader instruction.
| * | | | GPU: Implemented the PSETP shader instruction.Subv2018-07-042-0/+43
| |/ / / | | | | | | | | | | | | It's similar to the isetp and fsetp instructions but it works on predicates instead.
* | | | Merge pull request #620 from Subv/depth_z32fbunnei2018-07-053-2/+15
|\ \ \ \ | | | | | | | | | | GPU: Implemented the 32 bit float depth buffer format.
| * | | | GPU: Implemented the 32 bit float depth buffer format.Subv2018-07-043-2/+15
| |/ / /
* | | | Merge pull request #619 from Subv/flip_cullbunnei2018-07-042-3/+29
|\ \ \ \ | |/ / / |/| | | GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.
| * | | GPU: Flip the triangle front face winding if the GPU is configured to not flip the triangles.Subv2018-07-042-3/+29
|/ / / | | | | | | | | | | | | | | | OpenGL's default behavior is already correct when the GPU is configured to flip the triangles. This fixes 1-2 Switch's splash screen.
* | | Merge pull request #618 from Subv/clear_used_buffersbunnei2018-07-044-17/+48
|\ \ \ | | | | | | | | GPU: Only configure the used framebuffers during clear.
| * | | GPU: Only configure the used framebuffers during clear.Subv2018-07-044-17/+48
|/ / / | | | | | | | | | Don't try to configure the color buffer if it is not being cleared, it may not be completely valid at this point.
* | | Merge pull request #609 from Subv/clear_buffersbunnei2018-07-045-16/+105
|\ \ \ | | | | | | | | GPU: Implemented the CLEAR_BUFFERS register.
| * | | GPU: Factor out the framebuffer configuration code for both Clear and Draw commands.Subv2018-07-032-72/+39
| | | |
| * | | GPU: Support clears that don't clear the color buffer.Subv2018-07-032-6/+17
| | | |
| * | | GPU: Bind and clear the render target when the CLEAR_BUFFERS register is written to.Subv2018-07-034-0/+86
| | | |
| * | | GPU: Added registers for the CLEAR_BUFFERS and CLEAR_COLOR methods.Subv2018-07-031-2/+27
| | | |
* | | | Merge pull request #616 from bunnei/s8z24bunnei2018-07-043-11/+83
|\ \ \ \ | | | | | | | | | | gl_rasterizer_cache: Implement PixelFormat S8Z24.
| * | | | gl_rasterizer_cache: Implement PixelFormat S8Z24.bunnei2018-07-033-11/+83
| | | | |
* | | | | Merge pull request #613 from jroweboy/qt-stylebunnei2018-07-032-0/+7
|\ \ \ \ \ | |/ / / / |/| | | | Add qt windowsvistastyle dll to the build
| * | | | Add qt windowsvistastyle dll to the buildJames Rowe2018-07-032-0/+7
|/ / / /
* | | | Update AudioRenderer Voice Sections (#614)David2018-07-031-0/+87
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * voice section updating * fixed slight offset miscalculation * fixed overflow
* | | | Merge pull request #607 from jroweboy/loggingbunnei2018-07-03116-887/+1261
|\ \ \ \ | | | | | | | | | | Logging - Customizable backends
| * | | | Fix build and address review feedbackbunnei2018-07-032-4/+5
| | | | |
| * | | | Add configurable logging backendsJames Rowe2018-07-0314-22/+408
| | | | |
| * | | | Update clang formatJames Rowe2018-07-0337-154/+141
| | | | |
| * | | | Rename logging macro back to LOG_*James Rowe2018-07-03105-730/+730
| |/ / /
* | | | Merge pull request #612 from bunnei/fix-cullbunnei2018-07-031-2/+5
|\ \ \ \ | | | | | | | | | | gl_rasterizer: Only set cull mode and front face if enabled.
| * | | | gl_rasterizer: Only set cull mode and front face if enabled.bunnei2018-07-031-2/+5
| |/ / /
* | | | Merge pull request #611 from Subv/enabled_depth_testbunnei2018-07-032-9/+13
|\ \ \ \ | | | | | | | | | | GPU: Don't try to parse the depth test function if the depth test is disabled and use only the least significant 3 bits in the depth test func
| * | | | GPU: Use only the least significant 3 bits when reading the depth test func.Subv2018-07-031-9/+9
| | | | | | | | | | | | | | | | | | | | Some games set the full GL define value here (including nouveau), but others just seem to set those last 3 bits.
| * | | | GPU: Don't try to parse the depth test function if the depth test is disabled.Subv2018-07-031-0/+4
| |/ / /
* | | | Merge pull request #610 from Subv/mufu_8bunnei2018-07-032-0/+5
|\ \ \ \ | |/ / / |/| | | GPU: Implemented MUFU suboperation 8, sqrt.
| * | | GPU: Implemented MUFU suboperation 8, sqrt.Subv2018-07-032-0/+5
| | | |
* | | | Merge pull request #608 from Subv/depthbunnei2018-07-039-32/+246
|\ \ \ \ | | | | | | | | | | GPU: Implemented the depth buffer and depth test + culling
| * | | | GPU: Set up the culling configuration on each draw.Subv2018-07-031-6/+8
| | | | |
| * | | | GPU: Set up the depth test state on every draw.Subv2018-07-022-0/+14
| | | | |
| * | | | MaxwellToGL: Added conversion functions for depth test and cull mode.Subv2018-07-021-0/+50
| | | | |
| * | | | GPU: Added registers for depth test and cull mode.Subv2018-07-021-3/+51
| | | | |
| * | | | GPU: Implemented the Z24S8 depth format and load the depth framebuffer.Subv2018-07-027-24/+124
| |/ / /
* | | | Merge pull request #606 from Subv/base_vertexSebastian Valle2018-07-022-8/+15
|\ \ \ \ | | | | | | | | | | GPU: Fixed the index offset and implement BaseVertex when doing indexed rendering.
| * | | | GPU: Implement offsetted rendering when using non-indexed drawing.Subv2018-07-021-1/+1
| | | | |
| * | | | GPU: Fixed the index offset rendering, and implemented the base vertex functionality.Subv2018-07-021-6/+8
| | | | | | | | | | | | | | | | | | | | This fixes Stardew Valley.
| * | | | GPU: Added register definitions for the vertex buffer base element.Subv2018-07-021-1/+6
| |/ / /
* | | | Merge pull request #603 from Subv/nvmap_freeSebastian Valle2018-07-023-4/+16
|\ \ \ \ | | | | | | | | | | GPU: Remove unmapped surfaces from the rasterizer cache and fix our nvmap::Free behavior.
| * | | | GPU: Remove a surface from the cache when its backing memory is being unmapped from the GPU's MMU.Subv2018-07-011-0/+5
| | | | |
| * | | | nvmap: Return the address of the nvmap object when Freeing it for the last time.Subv2018-07-012-4/+11
| | | | | | | | | | | | | | | | | | | | This behavior is confirmed by reverse engineering.
* | | | | Merge pull request #605 from Subv/dma_copySebastian Valle2018-07-021-1/+5
|\ \ \ \ \ | | | | | | | | | | | | GPU: Directly copy the pixels when performing a same-layout DMA.
| * | | | | GPU: Directly copy the pixels when performing a same-layout DMA.Subv2018-07-021-1/+5
| |/ / / /
* | | | | Merge pull request #604 from Subv/invalid_texturesbunnei2018-07-023-3/+12
|\ \ \ \ \ | |_|/ / / |/| | | | GPU: Ignore invalid and disabled textures when drawing.
| * | | | GPU: Ignore disabled textures and textures with an invalid address.Subv2018-07-022-1/+10
| | | | |
| * | | | GPU: Allow GpuToCpuAddress to return boost::none for unmapped addresses.Subv2018-07-021-2/+2
| |/ / /
* | | | Merge pull request #602 from Subv/mufu_subopbunnei2018-07-012-6/+1
|\ \ \ \ | | | | | | | | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.
| * | | | GPU: Corrected the size of the MUFU subop field, and removed incorrect "min" operation.Subv2018-06-302-6/+1
| |/ / /
* | | | Merge pull request #601 from Subv/rgba32_uibunnei2018-07-014-25/+48
|\ \ \ \ | | | | | | | | | | GPU: Implement the RGBA32_UINT rendertarget format.
| * | | | GPU: Implemented the RGBA32_UINT rendertarget format.Subv2018-06-304-9/+28
| | | | |
| * | | | GLCache: Specify the component type along the texture type in the format tuple.Subv2018-06-301-17/+21
| |/ / /
* | | | Merge pull request #600 from bunnei/pred-not-eq-nanbunnei2018-07-012-17/+24
|\ \ \ \ | |/ / / |/| | | gl_shader_decompiler: Implement predicate NotEqualWithNan.
| * | | gl_shader_decompiler: Implement predicate NotEqualWithNan.bunnei2018-06-302-17/+24
|/ / /
* | | Merge pull request #595 from bunnei/raster-cachebunnei2018-06-2915-1454/+425
|\ \ \ | | | | | | | | Rewrite the OpenGL rasterizer cache
| * | | gl_rasterizer_cache: Only dereference color_surface/depth_surface if valid.bunnei2018-06-291-2/+6
| | | |
| * | | gl_rasterizer_cache: Implement caching for texture and framebuffer surfaces.bunnei2018-06-273-16/+168
| | | | | | | | | | | | | | | | | | | | | | | | gl_rasterizer_cache: Improved cache management based on Citra's implementation. gl_surface_cache: Add some docstrings.
| * | | gl_rasterizer_cache: Various fixes for ASTC handling.bunnei2018-06-272-35/+39
| | | |
| * | | gl_rasterizer_cache: Use SurfaceParams as a key for surface caching.bunnei2018-06-272-43/+72
| | | |
| * | | maxwell_3d: Add a struct for RenderTargetConfig.bunnei2018-06-271-17/+19
| | | |
| * | | settings: Add a configuration for use_accurate_framebuffers.bunnei2018-06-277-0/+21
| | | |
| * | | gl_rasterizer: Implement AccelerateDisplay to forward textures to framebuffers.bunnei2018-06-276-8/+62
| | | |
| * | | gl_rasterizer_cache: Cache size_in_bytes as a const per surface.bunnei2018-06-272-9/+13
| | | |
| * | | gl_rasterizer_cache: Refactor to make SurfaceParams members const.bunnei2018-06-272-52/+37
| | | |
| * | | gl_rasterizer_cache: Remove Citra's rasterizer cache, always load/flush surfaces.bunnei2018-06-274-1494/+210
| | | |
* | | | Merge pull request #588 from mailwl/hwopusbunnei2018-06-284-0/+53
|\ \ \ \ | | | | | | | | | | Service/Audio: add hwopus service, stub GetWorkBufferSize function
| * | | | Service/Audio: add hwopus service, stub GetWorkBufferSize functionmailwl2018-06-254-0/+53
| | |/ / | |/| |
* | | | gl_shader_decompiler: Add a return path for unknown instructions.bunnei2018-06-271-0/+1
| |/ / |/| |
* | | Merge pull request #594 from bunnei/max-constbuffbunnei2018-06-272-1/+7
|\ \ \ | | | | | | | | gl_rasterizer: Workaround for when exceeding max UBO size.
| * | | gl_rasterizer: Workaround for when exceeding max UBO size.bunnei2018-06-272-1/+7
|/ / /
* | | Merge pull request #593 from bunnei/fix-swizzlebunnei2018-06-275-12/+20
|\ \ \ | | | | | | | | gl_state: Fix state management for texture swizzle.
| * | | gl_state: Fix state management for texture swizzle.bunnei2018-06-265-12/+20
| | | |
* | | | Merge pull request #592 from bunnei/cleanup-gl-statebunnei2018-06-272-94/+0
|\ \ \ \ | | | | | | | | | | gl_state: Remove unused state management from 3DS.
| * | | | gl_state: Remove unused state management from 3DS.bunnei2018-06-262-94/+0
| |/ / /
* | | | Merge pull request #591 from bunnei/fix-rgb565bunnei2018-06-271-1/+1
|\ \ \ \ | |/ / / |/| | | gl_rasterizer_cache: Fix inverted B5G6R5 format.
| * | | gl_rasterizer_cache: Fix inverted B5G6R5 format.bunnei2018-06-261-1/+1
|/ / /
* | | Merge pull request #590 from bunnei/rm-ssbo-checkbunnei2018-06-261-2/+0
|\ \ \ | | | | | | | | yuzu: Remove SSBOs check from Qt frontend.
| * | | yuzu: Remove SSBOs check from Qt frontend.bunnei2018-06-261-2/+0
|/ / /
* | | Merge pull request #554 from Subv/constbuffer_ubobunnei2018-06-264-18/+39
|\ \ \ | | | | | | | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.
| * | | Rasterizer: Use UBOs instead of SSBOs for uploading const buffers.Subv2018-06-104-18/+39
| | | | | | | | | | | | | | | | This should help a bit with GPU performance once we're GPU-bound.
* | | | Merge pull request #589 from mailwl/fix-crashbunnei2018-06-261-2/+4
|\ \ \ \ | | | | | | | | | | Fix crash at exit
| * | | | Fix crash at exitmailwl2018-06-251-2/+4
| | |/ / | |/| |
* / | | Send the correct RequestUpdateAudioRenderer revision in the output header (#587)David2018-06-251-1/+1
|/ / / | | | | | | | | | | | | | | | | | | | | | * We should be returning our revision instead of what is requested. Hardware test on a 5.1.0 console * Added sysversion comment
* | | Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader (#583)David2018-06-242-34/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removed duplicate structs, changed AudioRendererResponse -> UpdateDataHeader According to game symbols(SMO), there's references to UpdateDataHeader which seems to be what AudioRendererResponse actually is * oops * AudioRendererParameters should be AudioRendererParameter according to SMO
* | | Revert "Use Ninja for MSVC AppVeyor builds" (#584)bunnei2018-06-236-17/+9
| | |
* | | Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly (#580)David2018-06-232-44/+76
| | | | | | | | | | | | | | | * Fixed RequestUpdateAudioRenderer deadlocks and calculated section sizes properly This fixes RequestUpdateAudioRenderer deadlocks in games like Puyo Puyo Tetris and games which require a proper section size in games such as Retro City Rampage. This fixes causes various games to start rendering or trying to render
* | | Merge pull request #526 from janisozaur/appveyor-ninjabunnei2018-06-226-9/+17
|\ \ \ | | | | | | | | Use Ninja for MSVC AppVeyor builds
| * | | Use Ninja for MSVC AppVeyor buildsMichał Janiszewski2018-06-055-8/+16
| | | |
| * | | Drop /std:c++latest from MSVC command lineMichał Janiszewski2018-06-051-1/+1
| | | | | | | | | | | | | | | | CMake already sets it to version 17 in all cases
* | | | Merge pull request #579 from SciresM/masterbunnei2018-06-2212-9/+312
|\ \ \ \ | | | | | | | | | | svc: Fully implement svcSignalToAddress and svcWaitForAddress
| * | | | Kernel/Arbiters: Fix casts, cleanup comments/magic numbersMichael Scire2018-06-224-17/+27
| | | | |
| * | | | Add additional missing format.Michael Scire2018-06-222-21/+27
| | | | |
| * | | | Run clang-format on PR.Michael Scire2018-06-223-180/+181
| | | | |
| * | | | Kernel/Arbiters: HLE is atomic, adjust code to reflect that.Michael Scire2018-06-222-37/+13
| | | | |
| * | | | Kernel/Arbiters: Initialize arb_wait_address in thread struct.Michael Scire2018-06-213-1/+7
| | | | |
| * | | | Kernel/Arbiters: Clear WaitAddress in SignalToAddressMichael Scire2018-06-211-0/+1
| | | | |
| * | | | Kernel/Arbiters: Mostly implement SignalToAddressMichael Scire2018-06-215-11/+111
| | | | |
| * | | | Kernel/Arbiters: Implement WaitForAddressMichael Scire2018-06-215-6/+71
| | | | |
| * | | | Kernel/Arbiters: Add stubs for 4.x SignalToAddress/WaitForAddres SVCs.Michael Scire2018-06-217-9/+147
| | | | |
* | | | | Merge pull request #581 from mailwl/empty-buf-skipbunnei2018-06-221-0/+5
|\ \ \ \ \ | | | | | | | | | | | | IPC: skip empty buffer write
| * | | | | IPC: skip empty buffer writemailwl2018-06-221-0/+5
|/ / / / / | | | | | | | | | | | | | | | prevent yuzu crash, if games, like Axiom Verge, trying to read 0 bytes from file
* | | | | Merge pull request #577 from mailwl/audren-updatebunnei2018-06-222-49/+60
|\ \ \ \ \ | | | | | | | | | | | | Service/Audio: update audren:u service
| * | | | | Service/Audio: update audren:u servicemailwl2018-06-212-49/+60
| |/ / / /
* / / / / Add support for decrypted NCA files (#567)Zach Hilman2018-06-2110-16/+453
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Start to add NCA support in loader * More nca stuff * More changes to nca.cpp * Now identifies decrypted NCA cont. * Game list fixes and more structs and stuff * More updates to Nca class * Now reads ExeFs (i think) * ACTUALLY LOADS EXEFS! * RomFS loads and games execute * Cleanup and Finalize * plumbing, cleanup and testing * fix some things that i didnt think of before * Preliminary Review Changes * Review changes for bunnei and subv
* | | | Merge pull request #576 from Subv/warnings1bunnei2018-06-2012-22/+24
|\ \ \ \ | | | | | | | | | | Build: Fixed some MSVC warnings in various parts of the code.
| * | | | Build: Fixed some MSVC warnings in various parts of the code.Subv2018-06-2012-22/+24
|/ / / /
* | | | Implement GetAvailableLanguageCodes2 (#575)greggameplayer2018-06-191-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implement GetAvailableLanguageCodes2 * Revert "Implement GetAvailableLanguageCodes2" This reverts commit caadd9eea3497ae2a13382aecb8ca29e1c02c5af. * Implement GetAvailableLanguageCodes2 * Implement GetAvailableLanguageCodes2
* | | | Merge pull request #574 from Subv/shader_abs_negbunnei2018-06-191-7/+14
|\ \ \ \ | | | | | | | | | | GPU: Perform negation after absolute value in the float shader instructions.
| * | | | GPU: Perform negation after absolute value in the float shader instructions.Subv2018-06-191-7/+14
| | | | |
* | | | | Merge pull request #561 from DarkLordZach/fix-odyssey-input-crashbunnei2018-06-191-0/+4
|\ \ \ \ \ | | | | | | | | | | | | Avoid initializing single-joycon layouts with handheld controller
| * | | | | Narrow down filter of layout configsZach Hilman2018-06-142-10/+5
| | | | | |
| * | | | | Move loop condition to free functionZach Hilman2018-06-131-4/+9
| | | | | |
| * | | | | Avoid initializing single-joycon layouts with handheld controllerZach Hilman2018-06-132-1/+5
| | | | | |
* | | | | | Merge pull request #573 from Subv/shader_immbunnei2018-06-192-14/+18
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.
| * | | | | GPU: Don't mark uniform buffers and registers as used for instructions which don't have them.Subv2018-06-192-14/+18
|/ / / / / | | | | | | | | | | | | | | | | | | | | Like the MOV32I and FMUL32I instructions. This fixes a potential crash when using these instructions.
* | | | | Merge pull request #570 from bunnei/astcbunnei2018-06-196-1/+1709
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.
| * | | | | gl_rasterizer: Implement texture format ASTC_2D_4X4.bunnei2018-06-186-1/+1709
| | | | | |
* | | | | | Merge pull request #562 from DarkLordZach/extracted-ncas-uibunnei2018-06-184-3/+50
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add UI support for extracted NCA folders
| * | | | | | Bug fixes, testing, and review changesZach Hilman2018-06-142-7/+20
| | | | | | |
| * | | | | | Add 'Load Folder' menu optionZach Hilman2018-06-143-0/+17
| | | | | | |
| * | | | | | Add support for main files in file pickerZach Hilman2018-06-141-0/+2
| | | | | | |
| * | | | | | Recognize main files in game listZach Hilman2018-06-141-2/+17
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #572 from Armada651/user-except-stubbunnei2018-06-181-0/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Add a stub for UserExceptionContextAddr.
| * | | | | | svc: Add a stub for UserExceptionContextAddr.Jules Blok2018-06-181-0/+5
| | | | | | |
* | | | | | | Merge pull request #571 from Armada651/loose-blendbunnei2018-06-181-1/+1
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | gl_rasterizer: Get loose on independent blending.
| * | | | | | gl_rasterizer: Get loose on independent blending.Jules Blok2018-06-181-1/+1
| | | | | | |
* | | | | | | Merge pull request #569 from bunnei/fix-cachebunnei2018-06-181-26/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_rasterizer_cache: Loosen things up a bit.
| * | | | | | | gl_rasterizer_cache: Loosen things up a bit.bunnei2018-06-181-26/+8
|/ / / / / / /
* | | | | | | Merge pull request #568 from bunnei/lopbunnei2018-06-172-63/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Implement LOP instructions.
| * | | | | | gl_shader_decompiler: Implement LOP instructions.bunnei2018-06-172-6/+42
| | | | | | |
| * | | | | | gl_shader_decompiler: Refactor LOP32I instruction a bit in support of LOP.bunnei2018-06-172-57/+42
|/ / / / / /
* | | | | | Merge pull request #565 from bunnei/shader_conversionsbunnei2018-06-162-14/+43
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement register size conversions for I2I and I2F.
| * | | | | | gl_shader_decompiler: Implement integer size conversions for I2I/I2F/F2I.bunnei2018-06-162-14/+43
|/ / / / / /
* | | | | | Merge pull request #564 from bunnei/lop32i_passbbunnei2018-06-161-6/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.
| * | | | | | gl_shader_decompiler: Implement LOP32I LogicOperation PassB.bunnei2018-06-161-6/+12
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #566 from bunnei/set_pos_wbunnei2018-06-161-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_gen: Set position.w to 1.
| * | | | | gl_shader_gen: Set position.w to 1.bunnei2018-06-161-0/+4
|/ / / / /
* | | | | Merge pull request #560 from Subv/crash_widgetbunnei2018-06-136-292/+0
|\ \ \ \ \ | | | | | | | | | | | | Qt: Removed the Registers widget.
| * | | | | Qt: Removed the Registers widget.Subv2018-06-136-292/+0
| | |_|_|/ | |/| | | | | | | | | | | | | It was crashing and nobody actually uses this.
* | | | | Merge pull request #556 from Subv/dma_enginebunnei2018-06-127-1/+237
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the Maxwell DMA engine.
| * | | | | GPU: Partially implemented the Maxwell DMA engine.Subv2018-06-127-1/+237
| | | | | | | | | | | | | | | | | | | | | | | | Only tiled->linear and linear->tiled copies that aren't offsetted are supported for now. Queries are not supported. Swizzled copies are not supported.
* | | | | | Merge pull request #558 from Subv/iadd32ibunnei2018-06-122-2/+31
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implemented the iadd32i shader instruction.
| * | | | | | GPU: Implemented the iadd32i shader instruction.Subv2018-06-122-2/+31
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #557 from shinyquagsire23/libnx-hid-fixbunnei2018-06-122-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTO
| * | | | | | hid: Update all layouts and only show handheld as connected, fixes libnx input for P1_AUTOshinyquagsire232018-06-122-2/+3
| |/ / / / /
* | | | | | Merge pull request #552 from bunnei/sat-fmulbunnei2018-06-122-39/+32
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Implement saturate for float instructions.
| * | | | | gl_shader_decompiler: Implement saturate for float instructions.bunnei2018-06-122-39/+32
|/ / / / /
* | | | | Merge pull request #555 from Subv/gpu_sysregsbunnei2018-06-111-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.
| * | | | GPU: Convert the gl_InstanceId and gl_VertexID variables to floats when reading from them.Subv2018-06-101-1/+1
|/ / / / | | | | | | | | | | | | This corrects the invalid position values in some games when doing attribute-less rendering.
* | | | Merge pull request #553 from Subv/isetbunnei2018-06-102-2/+53
|\ \ \ \ | |_|_|/ |/| | | GPU: Implement the ISET family of shader instructions.
| * | | GPU: Implement the iset family of shader instructions.Subv2018-06-092-2/+46
| | | |
| * | | GPU: Added decodings for the ISET family of instructions.Subv2018-06-091-0/+7
|/ / /
* | | Merge pull request #550 from Subv/ssybunnei2018-06-092-0/+7
|\ \ \ | | | | | | | | GPU: Stub the SSY shader instruction.
| * | | GPU: Stub the SSY shader instruction.Subv2018-06-092-0/+7
| | | | | | | | | | | | | | | | This instruction tells the GPU where the flow reconverges in a non-uniform control flow scenario, we can ignore this when generating GLSL code.
* | | | Merge pull request #551 from bunnei/shrbunnei2018-06-092-0/+17
|\ \ \ \ | | | | | | | | | | gl_shader_decompiler: Implement SHR instruction.
| * | | | gl_shader_decompiler: Implement SHR instruction.bunnei2018-06-092-0/+17
| |/ / /
* | | | Merge pull request #549 from bunnei/iaddbunnei2018-06-092-19/+55
|\ \ \ \ | |/ / / |/| | | gl_shader_decompiler: Implement IADD instruction.
| * | | gl_shader_decompiler: Implement IADD instruction.bunnei2018-06-092-11/+37
| | | |
| * | | gl_shader_decompiler: Add missing asserts for saturate_a instructions.bunnei2018-06-092-8/+18
|/ / /
* | | Merge pull request #505 from janisozaur/ccache-travisbunnei2018-06-095-7/+17
|\ \ \ | | | | | | | | Enable ccache usage on Travis
| * | | Cache ccache on TravisMichał Janiszewski2018-06-071-0/+4
| | | |
| * | | Add ccache support for macOS on TravisMichał Janiszewski2018-06-072-1/+5
| | | |
| * | | Add ccache support for Linux on TravisMichał Janiszewski2018-06-072-2/+8
| | | |
| * | | Install cmake from repositories for UbuntuMichał Janiszewski2018-06-071-5/+1
| | | | | | | | | | | | | | | | Ubuntu 18.04 already has cmake 3.10.2
* | | | Merge pull request #533 from mailwl/array-to-bufferbunnei2018-06-093-22/+15
|\ \ \ \ | | | | | | | | | | Common/string_util: add StringFromBuffer() function
| * | | | Common/string_util: add StringFromBuffer functionmailwl2018-06-073-22/+15
| | | | | | | | | | | | | | | | | | | | convert input buffer (std::vector<u8>) to string, stripping zero chars
* | | | | Merge pull request #548 from Subv/blendbunnei2018-06-093-47/+47
|\ \ \ \ \ | | | | | | | | | | | | GPU: Fixed ghosting when drawing with blending disabled
| * | | | | GPU: Synchronize the blend state on every draw call.Subv2018-06-092-16/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only independent blending on render target 0 is implemented for now. This fixes the elongated squids in Splatoon 2's boot screen.
| * | | | | GPU: Added registers for normal and independent blending.Subv2018-06-092-31/+27
|/ / / / /
* | | | | Merge pull request #547 from Subv/compressed_alignmentbunnei2018-06-081-2/+7
|\ \ \ \ \ | | | | | | | | | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.
| * | | | | GLCache: Align compressed texture sizes to their compression ratio, and then align that compressed size to the block height for tiled textures.Subv2018-06-081-2/+7
| | |/ / / | |/| | | | | | | | | | | | | This fixes issues with retrieving non-block-aligned tiled compressed textures from the cache.
* | | | | Merge pull request #546 from Subv/flush_ubo_bufferbunnei2018-06-081-0/+3
|\ \ \ \ \ | |/ / / / |/| | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.
| * | | | Rasterizer: Flush the written region when writing shader uniform data before copying it to the uniform buffers.Subv2018-06-081-0/+3
|/ / / / | | | | | | | | | | | | This fixes the flip_viewport uniform having invalid values when drawing.
* | | | Merge pull request #478 from janisozaur/patch-1bunnei2018-06-071-3/+3
|\ \ \ \ | | | | | | | | | | Use Ninja for Travis builds
| * | | | Use Ninja for Travis buildsMichał Janiszewski2018-05-281-3/+3
| | | | |
* | | | | Merge pull request #543 from Subv/uniformsbunnei2018-06-071-3/+4
|\ \ \ \ \ | |_|/ / / |/| | | | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.
| * | | | GLRenderer: Write the shader stage configuration UBO data *before* copying it to the GPU.Subv2018-06-071-3/+4
| | | | | | | | | | | | | | | | | | | | This should fix the bug with the vs_config UBO being uninitialized during shader execution.
* | | | | Merge pull request #522 from mailwl/mm-ubunnei2018-06-076-0/+85
|\ \ \ \ \ | | | | | | | | | | | | Service/MM: add service and stub some functions
| * | | | | Remove unused header filesmailwl2018-06-061-2/+0
| | | | | |
| * | | | | Small fixesmailwl2018-06-052-6/+8
| | | | | |
| * | | | | Service/MM: add service and stub some functionsmailwl2018-06-056-0/+85
| | | | | |
* | | | | | Merge pull request #542 from bunnei/bfe_immbunnei2018-06-072-7/+44
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.
| * | | | | | gl_shader_decompiler: Implement BFE_IMM instruction.bunnei2018-06-072-7/+44
| | | | | | |
* | | | | | | Merge pull request #541 from Subv/blittexturesbunnei2018-06-071-56/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GLCache: Fixed copying compressed textures in the rasterizer cache.
| * | | | | | GLCache: Use the full uncompressed size when blitting from one texture to another.Subv2018-06-071-3/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This avoids the problem of only copying a tiny piece of the textures when they are compressed.
| * | | | | | GLCache: Simplify the logic to copy from one texture to another in BlitTextures.Subv2018-06-071-53/+3
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | We now use glCopyImageSubData, this should avoid errors with trying to attach a compressed texture as a framebuffer's color attachment and then blitting to it. Maybe in the future we can change this to glCopyTextureSubImage which only requires GL_ARB_direct_state_access.
* | | | | | Merge pull request #539 from bunnei/f2f-roundingbunnei2018-06-072-10/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: F2F: Implement rounding modes.
| * | | | | | gl_shader_decompiler: F2F: Implement rounding modes.bunnei2018-06-072-10/+35
| | | | | | |
* | | | | | | Merge pull request #503 from mailwl/nfp-stubsbunnei2018-06-071-7/+101
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/nfp:user : stub some functions.
| * | | | | | Stub IUser::AttachAvailabilityChangeEventmailwl2018-06-061-5/+23
| | | | | | |
| * | | | | | Correct function resultsmailwl2018-06-041-4/+16
| | | | | | |
| * | | | | | Service/nfp:user : stub some functions.mailwl2018-06-041-6/+70
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Used by Zelda: BoTW
* | | | | | | Merge pull request #537 from bunnei/misc-shaderbunnei2018-06-072-8/+24
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Additional decodings, remove unused stuff from TEX
| * | | | | | | gl_shader_decompiler: Remove some attribute stuff that has nothing to do with TEX/TEXS.bunnei2018-06-071-8/+4
| | | | | | | |
| * | | | | | | shader_bytecode: Add instruction decodings for BFE, IMNMX, and XMAD.bunnei2018-06-071-0/+20
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #535 from Subv/gpu_swizzlebunnei2018-06-076-0/+65
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.
| * | | | | | | GPU: Support changing the texture swizzles for Maxwell textures.Subv2018-06-073-0/+45
| | | | | | | |
| * | | | | | | GLState: Support changing the GL_TEXTURE_SWIZZLE parameter of each texture unit.Subv2018-06-073-0/+20
| |/ / / / / /
* | | | | | | Merge pull request #536 from bunnei/isetp_immbunnei2018-06-071-8/+9
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Implement ISETP_IMM instruction.
| * | | | | | gl_shader_decompiler: Implement ISETP_IMM instruction.bunnei2018-06-071-8/+9
|/ / / / / /
* | | | | | Merge pull request #534 from Subv/multitexturingbunnei2018-06-079-69/+172
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.
| * | | | | | GPU: Implement sampling multiple textures in the generated glsl shaders.Subv2018-06-069-69/+172
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All tested games that use a single texture show no regression. Only Texture2D textures are supported right now, each shader gets its own "tex_fs/vs/gs" sampler array to maintain independent textures between shader stages, the textures themselves are reused if possible.
* | | | | | | Merge pull request #532 from bunnei/ld_cbunnei2018-06-074-28/+110
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_shader_decompiler: Implement LD_C instruction.
| * | | | | | gl_shader_decompiler: Implement LD_C instruction.bunnei2018-06-072-0/+43
| | | | | | |
| * | | | | | gl_shader_gen: Add uniform handling for indirect const buffer access.bunnei2018-06-073-4/+40
| | | | | | |
| * | | | | | gl_shader_decompiler: Refactor uniform handling to allow different decodings.bunnei2018-06-062-26/+29
|/ / / / / /
* | | | | | nvdrv/devices/nvidia_ctrl_gpu : add IoctlCommands with their params (#524)greggameplayer2018-06-062-0/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add IoctlCommands with their params in nvidia_ctrl_gpu.h * add function related to the changes done previously * fix clang-format * delete trailing whitespace * correct mistake
* | | | | | Merge pull request #529 from bunnei/am-nifm-stubsSebastian Valle2018-06-063-2/+23
|\ \ \ \ \ \ | | | | | | | | | | | | | | Stub SetConnectionConfirmationOption, GetPseudoDeviceId
| * | | | | | nifm: Stub out IRequest::SetConnectionConfirmationOption.bunnei2018-06-061-1/+10
| | | | | | |
| * | | | | | am: Stub out IApplicationFunctions::GetPseudoDeviceId.bunnei2018-06-062-1/+13
| | | | | | |
* | | | | | | Merge pull request #531 from bunnei/fix-shlSebastian Valle2018-06-061-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.
| * | | | | | | gl_shader_decompiler: Fix un/signed mismatch with SHL.bunnei2018-06-061-1/+1
| |/ / / / / /
* | | | | | | Merge pull request #530 from bunnei/wrap-mirrorSebastian Valle2018-06-061-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | maxwell_to_gl: Implement WrapMode Mirror.
| * | | | | | | maxwell_to_gl: Implement WrapMode Mirror.bunnei2018-06-061-0/+2
| |/ / / / / /
* | | | | | | Merge pull request #527 from Subv/rgba32f_texcopybunnei2018-06-062-0/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Allow the usage of RGBA32_FLOAT and RGBA16_FLOAT in the texture copy engine.
| * | | | | | | GPU: Allow the usage of RGBA16_FLOAT in the texture copy engine.Subv2018-06-061-0/+2
| | | | | | | |
| * | | | | | | GPU: Allow the usage of RGBA32_FLOAT in the texture copy engine.Subv2018-06-062-0/+3
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #528 from Subv/rg11b10fbunnei2018-06-064-12/+31
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.
| * | | | | | | GPU: Implemented the R11FG11FB10F texture and rendertarget formats.Subv2018-06-064-11/+30
| | | | | | | |
| * | | | | | | GPU: Fixed the compression factor for RGBA16F textures.Subv2018-06-061-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | They're not compressed.
* | / / / / / GDB Stub Improvements (#508)Hedges2018-06-064-27/+194
| |/ / / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GDB Stub should work now. * Applied clang-format. * Replaced htonll with swap64. * Tidy up.
* | | | | | Merge pull request #516 from Subv/f2i_rbunnei2018-06-062-7/+64
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | GPU: Implemented the F2I_R shader instruction.
| * | | | | GPU: Implemented the F2I_R shader instruction.Subv2018-06-052-7/+64
| | | | | |
* | | | | | Merge pull request #523 from yuzu-emu/revert-507-3616James Rowe2018-06-051-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Revert "Port citra #3616"
| * | | | | | Revert "Port citra #3616"bunnei2018-06-051-1/+1
|/ / / / / /
* | | | | | Merge pull request #521 from Subv/brabunnei2018-06-051-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Corrected the branch targets for the shader bra instruction.
| * | | | | | GPU: Corrected the branch targets for the shader bra instruction.Subv2018-06-051-4/+5
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #520 from bunnei/shader-shlbunnei2018-06-052-15/+48
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gl_shader_decompiler: Implement SHL instruction.
| * | | | | gl_shader_decompiler: Fix typo with ISCADD instruction.bunnei2018-06-051-1/+1
| | | | | |
| * | | | | gl_shader_decompiler: Implement SHL instruction.bunnei2018-06-052-14/+47
| | | | | |
* | | | | | Merge pull request #518 from Subv/incomplete_shadersbunnei2018-06-051-5/+16
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Implemented predicated exit instructions in the shader programs.
| * | | | | GPU: Implement predicated exit instructions in the shader programs.Subv2018-06-051-4/+6
| | | | | |
| * | | | | GPU: Take into account predicated exits when performing shader control flow analysis.Subv2018-06-051-1/+10
| | | | | |
* | | | | | Merge pull request #519 from bunnei/pred-not-equalbunnei2018-06-051-3/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.
| * | | | | | gl_shader_decompiler: Implement PredCondition::NotEqual.bunnei2018-06-051-3/+3
|/ / / / / /
* | | | | | Merge pull request #517 from Subv/iscaddbunnei2018-06-052-0/+47
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | GPU: Implement the ISCADD shader instruction.
| * | | | | GPU: Implement the ISCADD shader instructions.Subv2018-06-052-0/+40
| | | | | |
| * | | | | GPU: Added decodings for the ISCADD instructions.Subv2018-06-051-0/+7
|/ / / / /
* | | | | Merge pull request #514 from Subv/lop32ibunnei2018-06-052-1/+58
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the LOP32I instruction.
| * | | | | GPU: Implemented the LOP32I instruction.Subv2018-06-042-1/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #510 from Subv/isetpbunnei2018-06-052-6/+63
|\ \ \ \ \ | | | | | | | | | | | | GPU: Implemented the ISETP_R and ISETP_C instructions
| * | | | | GPU: Use explicit types when retrieving the uniform values for fsetp/fset and isetp instead of the type of an invalid output register.Subv2018-06-041-9/+18
| | | | | |
| * | | | | GPU: Implemented the ISETP_R and ISETP_C shader instructions.Subv2018-06-042-0/+48
| | | | | |
* | | | | | Merge pull request #512 from Subv/fsetbunnei2018-06-052-4/+19
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | GPU: Corrected the FSET and I2F instructions.
| * | | | | GPU: Use the bf bit in FSET to determine whether to write 0xFFFFFFFF or 1.0f.Subv2018-06-042-2/+7
| | | | | |
| * | | | | GPU: Corrected the I2F_R implementation.Subv2018-06-041-2/+12
| | |/ / / | |/| | |
* | | | | Merge pull request #501 from Subv/shader_brabunnei2018-06-052-1/+45
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the bra shader instruction
| * | | | | GPU: Partially implemented the shader BRA instruction.Subv2018-06-042-1/+43
| | | | | |
| * | | | | GPU: Added decoding for the BRA instruction.Subv2018-06-041-0/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #515 from Subv/viewport_fixbunnei2018-06-052-14/+30
|\ \ \ \ \ | | | | | | | | | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.
| * | | | | GPU: Calculate the correct viewport dimensions based on the scale and translate registers.Subv2018-06-042-14/+30
| | |/ / / | |/| | | | | | | | | | | | | This is how nouveau calculates the viewport width and height. For some reason some games set 0xFFFF in the VIEWPORT_HORIZ and VIEWPORT_VERT registers, maybe those are a misnomer and actually refer to something else?
* | | | | Merge pull request #490 from BreadFish64/extension-checkbunnei2018-06-044-0/+53
|\ \ \ \ \ | | | | | | | | | | | | Add checks for OpenGL extension support
| * | | | | sdl: add check for GL extension supportBreadFish642018-06-042-0/+26
| | | | | |
| * | | | | qt: add check for GL extension supportBreadFish642018-06-042-0/+27
| | | | | |
* | | | | | Merge pull request #513 from Subv/cache_alignmentbunnei2018-06-041-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.
| * | | | | | GLCache: Corrected a mismatch between storing compressed sizes and verifying the uncompressed alignment in GetSurface.Subv2018-06-041-1/+2
| | |/ / / / | |/| | | |
* | | | | | Nvdrv/devices/nvhost_gpu : Add some IoctlCommands with their params (#511)greggameplayer2018-06-041-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add some IoctlCommand with their params to nvhost_gpu * fix clang-format * delete trailing whitespace * fix some clang-format * delete one other trailing whitespace * last clang-format fix
* | | | | | Merge pull request #502 from bunnei/more-am-stuffbunnei2018-06-041-4/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | am: Implement PopOutData, and various fixes.
| * | | | | | am: Implement ILibraryAppletAccessor::PopOutData.bunnei2018-06-041-1/+11
| | | | | | |
| * | | | | | am: ISelfController:LaunchableEvent should be sticky.bunnei2018-06-041-1/+1
| | | | | | |
| * | | | | | am: Stub out ILibraryAppletAccessor Start and GetResult methods.bunnei2018-06-041-2/+16
| |/ / / / /
* | | | | | Merge pull request #507 from valentinvanelslande/3616James Rowe2018-06-041-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Port citra #3616
| * | | | | Port citra #3616Valentin Vanelslande2018-06-041-1/+1
|/ / / / /
* | | | | Merge pull request #499 from bunnei/am-stuffbunnei2018-06-042-66/+105
|\ \ \ \ \ | |_|/ / / |/| | | | am: Implement CreateStorage, PushInData, etc.
| * | | | am: Implement ILibraryAppletAccessor::PushInData.bunnei2018-06-041-43/+55
| | | | |
| * | | | am: Implement IStorageAccessor::Write.bunnei2018-06-041-1/+17
| | | | |
| * | | | am: Cleanup IStorageAccessor::Read.bunnei2018-06-041-5/+3
| | | | |
| * | | | am: Implement ILibraryAppletCreator::CreateStorage.bunnei2018-06-042-21/+34
| | | | |
* | | | | Merge pull request #500 from Subv/long_queriesbunnei2018-06-041-9/+24
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partial implementation of long GPU queries.
| * | | | | GPU: Partial implementation of long GPU queries.Subv2018-06-041-9/+24
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Long queries write a 128-bit result value to memory, which consists of a 64 bit query value and a 64 bit timestamp. In this implementation, only select=Zero of the Crop unit is implemented, this writes the query sequence as a 64 bit value, and a 0u64 value for the timestamp, since we emulate an infinitely fast GPU. This specific type was hwtested, but more rigorous tests should be performed in the future for the other types.
* | | | | | Merge pull request #498 from bunnei/texs-maskbunnei2018-06-042-9/+26
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | gl_shader_decompiler: Implement TEXS component mask.
| * | | | | gl_shader_decompiler: Implement TEXS component mask.bunnei2018-06-032-9/+26
|/ / / / /
* | | | | Merge pull request #494 from bunnei/shader-texbunnei2018-06-032-2/+58
|\ \ \ \ \ | | | | | | | | | | | | gl_shader_decompiler: Implement TEX, fixes for TEXS.
| * | | | | gl_shader_decompiler: Implement TEX instruction.bunnei2018-06-012-1/+36
| | | | | |
| * | | | | gl_shader_decompiler: Support multi-destination for TEXS.bunnei2018-06-012-2/+23
| | | | | |
* | | | | | Merge pull request #495 from bunnei/improve-rrobunnei2018-06-032-9/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_shader_decompiler: Implement RRO as a register move.
| * | | | | | gl_shader_decompiler: Implement RRO as a register move.bunnei2018-06-032-9/+18
| |/ / / / /
* | | | | | Merge pull request #484 from mailwl/nvhost-nvdecbunnei2018-06-034-0/+74
|\ \ \ \ \ \ | | | | | | | | | | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' device
| * | | | | | Services/nvdrv: add '/dev/nvhost-nvdec' devicemailwl2018-05-304-0/+74
| | | | | | |
* | | | | | | Merge pull request #496 from Subv/waitprocesswidekey_timeoutbunnei2018-06-031-2/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.
| * | | | | | | Kernel/Threads: A thread waking up by timeout from a WaitProcessWideKey may already have an assigned lock owner.Subv2018-06-021-2/+5
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This situation may happen like so: Thread 1 with low priority calls WaitProcessWideKey with timeout. Thread 2 with high priority calls WaitProcessWideKey without timeout. Thread 3 calls SignalProcessWideKey - Thread 2 acquires the lock and awakens. - Thread 1 can't acquire the lock and is put to sleep with the lock owner being Thread 2. Thread 1's timeout expires, with the lock owner still being set to Thread 2.
* | | | | | | Merge pull request #497 from Subv/dxn1bunnei2018-06-033-3/+16
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Implemented the DXN1 (BC4) texture format.
| * | | | | | GPU: Implemented the DXN1 (BC4) texture format.Subv2018-06-023-3/+16
|/ / / / / /
* | | | | | Merge pull request #492 from mailwl/timebunnei2018-06-012-14/+72
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Service/time: implement posix time to calendar conversion
| * | | | | Service/time: implement posix time to calendar conversionmailwl2018-06-012-14/+72
|/ / / / /
* | | | | Merge pull request #488 from Subv/thread_masksbunnei2018-06-013-4/+31
|\ \ \ \ \ | | | | | | | | | | | | Kernel/SVC: Corrected the behavior of svcSetThreadCoreMask for core values -2 and -3.
| * | | | | Kernel/Thread: Corrected a typo that caused the affinity mask to never be changed.Subv2018-05-311-2/+2
| | | | | |
| * | | | | Kernel/SVC: Support special core values -2 and -3 in svcSetThreadCoreMask.Subv2018-05-312-1/+28
| | | | | | | | | | | | | | | | | | | | | | | | Also added some proper error handling.
| * | | | | Kernel/Thread: Corrected a typo in an assert about the processor id.Subv2018-05-301-1/+1
| | | | | |
* | | | | | Merge pull request #491 from bunnei/rgba16fbunnei2018-06-013-7/+24
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.
| * | | | | | gl_rasterizer_cache: Assert that component type is UNorm or format is RGBA16F.bunnei2018-05-311-1/+2
| | | | | | |
| * | | | | | gl_rasterizer_cache: Implement PixelFormat RGBA16F.bunnei2018-05-313-6/+22
|/ / / / / /
* | | | | | Merge pull request #489 from Subv/vertexidbunnei2018-05-302-1/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.
| * | | | | | Shaders: Implemented reading the gl_InstanceID and gl_VertexID variables in the vertex shader.Subv2018-05-302-1/+11
| |/ / / / /
* | | / / / add IPC CommandType & Some HID FunctionInfo (#487)greggameplayer2018-05-302-0/+33
| |_|/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * add some CommandType * add some hid FunctionInfo * add some other HID FunctionInfo * delete non useful comments
* | | | | Merge pull request #483 from bunnei/sonicSebastian Valle2018-05-305-10/+35
|\ \ \ \ \ | |_|/ / / |/| | | | Several GPU fixes to boot Sonic Mania
| * | | | gl_shader_decompiler: F2F_R instruction: Implement abs.bunnei2018-05-301-1/+7
| | | | |
| * | | | gl_shader_decompiler: Partially implement F2F_R instruction.bunnei2018-05-302-4/+9
| | | | |
| * | | | nvhost_ctrl: Stub out IocCtrlEventRegister.bunnei2018-05-302-0/+10
| | | | |
| * | | | nvhost_ctrl: Stub out IocCtrlEventWaitAsyncCommand.bunnei2018-05-302-5/+9
| | | | |
| * | | | gl_rasterize_cache: Invert order of tex format RGB565.bunnei2018-05-301-1/+1
| |/ / /
* | | | Merge pull request #482 from Subv/r8bunnei2018-05-303-5/+18
|\ \ \ \ | |/ / / |/| | | GPU: Implemented the R8 texture format (0x1D)
| * | | GPU: Implemented the R8 texture format (0x1D)Subv2018-05-303-5/+18
|/ / /
* | | Merge pull request #480 from mailwl/bcatbunnei2018-05-308-0/+120
|\ \ \ | | | | | | | | Service/BCAT: add module and services
| * | | Service/BCAT: add module and servicesmailwl2018-05-288-0/+120
| |/ /
* / / add all the known TextureFormat (#474)greggameplayer2018-05-291-2/+71
|/ /
* | Merge pull request #472 from bunnei/greater-equalbunnei2018-05-271-4/+3
|\ \ | | | | | | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.
| * | gl_shader_decompiler: Implement GetPredicateComparison GreaterEqual.bunnei2018-05-261-4/+3
| | |
* | | Merge pull request #476 from Subv/a1bgr5bunnei2018-05-274-5/+21
|\ \ \ | | | | | | | | GPU: Implemented the A1B5G5R5 texture format (0x14)
| * | | GPU: Implemented the A1B5G5R5 texture format (0x14)Subv2018-05-274-5/+21
| |/ /
* | | Merge pull request #475 from ogniK5377/nvos-getconfigbunnei2018-05-271-1/+1
|\ \ \ | | | | | | | | NvOsGetConfigU32 should return null instead of 0 for default output value
| * | | NvOsGetConfigU32 should return null instead of 0 for default outputDavid Marcec2018-05-271-1/+1
| |/ /
* | | Merge pull request #473 from bunnei/get-display-versionbunnei2018-05-272-1/+10
|\ \ \ | | | | | | | | am: Stub IApplicationFunctions GetDisplayVersion.
| * | | am: Stub IApplicationFunctions GetDisplayVersion.bunnei2018-05-262-1/+10
| |/ /
* | | Merge pull request #471 from bunnei/fmnmxSebastian Valle2018-05-272-4/+10
|\ \ \ | |/ / |/| | shader_bytecode: Implement other variants of FMNMX.
| * | shader_bytecode: Implement other variants of FMNMX.bunnei2018-05-262-4/+10
|/ /
* | Add & correct miscellaneous things (#470)greggameplayer2018-05-264-4/+55
| | | | | | | | | | | | | | | | | | | | | | | | * add some InfoType * correct OpenApplicationProxy cmd number * add IDisplayController functions * fix clang-format * add more system languages
* | Merge pull request #466 from mailwl/nv-timeoutbunnei2018-05-262-0/+16
|\ \ | | | | | | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUT
| * | Stub NVGPU_IOCTL_CHANNEL_SET_TIMEOUTmailwl2018-05-242-0/+16
| | | | | | | | | | | | Used in Nintendo Labo ToyCon 1&2
* | | GetAudioRendererWorkBufferSize impl (#465)David2018-05-262-2/+88
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetAudioRendererWorkBufferSize impl Impl of GetAudioRendererWorkBufferSize based on RE, if this can be cleaned up, please contribute! * Naming conventions * Removed unneeded placeholder * lioncache changes * fixed const * switched to Common::AlignUp
* | | Merge pull request #468 from Subv/compound_predsbunnei2018-05-261-46/+66
|\ \ \ | | | | | | | | Shader: Implemented compound predicates in the fset and fsetp instructions
| * | | Shader: Implemented compound predicates in fset.Subv2018-05-251-28/+12
| | | | | | | | | | | | | | | | | | | | | | | | You can specify a predicate in the fset instruction: Result = ((Value1 Comp Value2) OP P0) ? 1.0 : 0.0;
| * | | Shader: Implemented compound predicates in fsetp.Subv2018-05-251-19/+55
| |/ / | | | | | | | | | | | | | | | | | | You can specify three predicates in an fsetp instruction: P1 = (Value1 Comp Value2) OP P0; P2 = !(Value1 Comp Value2) OP P0;
* | | Merge pull request #469 from Subv/channel_rebindbunnei2018-05-261-1/+0
|\ \ \ | | | | | | | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.
| * | | GPU: Allow command lists to rebind a channel to another engine in the middle of the command list.Subv2018-05-251-1/+0
| |/ /
* / / Stubbed NVGPU_GPU_IOCTL_ZBC_SET_TABLE (#463)David2018-05-252-0/+22
|/ / | | | | We have no clue on what this actually does yet so stubbing it since it's just input only should be fine for now
* | Merge pull request #464 from bunnei/fix-msvcbunnei2018-05-241-14/+12
|\ \ | | | | | | yuzu_cmd: Fix project for latest msvc.
| * | yuzu_cmd: Fix project for latest msvc.bunnei2018-05-241-14/+12
|/ /
* | Merge pull request #462 from ogniK5377/hid-fixbunnei2018-05-241-1/+1
|\ \ | | | | | | Fix deadlocks caused from HID having too many layouts
| * | Fix deadlocks caused from HID having too many layoutsDavid Marcec2018-05-241-1/+1
|/ / | | | | | | Games such as SMO deadlock if we have more than 2 layouts
* | Merge pull request #460 from greggameplayer/patch-6bunnei2018-05-231-2/+8
|\ \ | | | | | | Add & correct some error modules
| * | Add & correct some error modulesgreggameplayer2018-05-231-2/+8
| | |
* | | Merge pull request #459 from greggameplayer/patch-5bunnei2018-05-233-29/+117
|\ \ \ | | | | | | | | Add ioctl commands with their params and size check
| * | | change some functionsgreggameplayer2018-05-231-6/+6
| | | | | | | | | | | | according to the changes made previously
| * | | correct placement and add size checkgreggameplayer2018-05-231-21/+25
| | | |
| * | | Add ioctl commands with their params and size checkgreggameplayer2018-05-231-2/+86
| |/ /
* | | Merge pull request #461 from lioncash/dynarmicbunnei2018-05-231-0/+0
|\ \ \ | | | | | | | | externals: Update dynarmic
| * | | externals: Update dynarmicLioncash2018-05-231-0/+0
|/ / / | | | | | | | | | Updates dynarmic to revision 990a569b7a5f2518fe08682f5ebf8536e5388d66
* | | Merge pull request #454 from Subv/signal_processwidebunnei2018-05-231-83/+74
|\ \ \ | |/ / |/| | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey
| * | Kernel/SVC: Signal the highest priority threads first in svcSignalProcessWideKey.Subv2018-05-191-51/+68
| | |
| * | Kernel/Threads: Reschedule the proper core when operating on that core's threads.Subv2018-05-191-2/+6
| | |
| * | SVC: Removed unused WaitSynchronization1 functionSubv2018-05-191-30/+0
| | |
* | | Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE (#440)David2018-05-222-1/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Implemented NVHOST_IOCTL_CHANNEL_GET_WAITBASE struct + 4 seems to be hard coded at 0 and struct + 0 seems to be ignored? * IocGetWaitbase -> IocChannelGetWaitbaseCommand * Added super late fixes
* | | Merge pull request #456 from Subv/unmap_bufferbunnei2018-05-216-1/+118
|\ \ \ | | | | | | | | Implemented nvhost-as-gpu's UnmapBuffer and nvmap's Free ioctls.
| * | | GPU: Implemented the nvmap Free ioctl.Subv2018-05-202-1/+48
| | | | | | | | | | | | | | | | It releases a reference to an nvmap object
| * | | GPU: Implemented nvhost-as-gpu's UnmapBuffer ioctl.Subv2018-05-204-0/+70
| |/ / | | | | | | | | | It removes a mapping previously created with the MapBufferEx ioctl.
* | | Correct audio command numbers & add or rename some functions (#455)greggameplayer2018-05-215-34/+34
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add unknown function at the number command 2 * correct audout:u commands numbers * correct audrec:u cmd number & add Unknown function * correct IAudioDevice command numbers * correct codecctl cmd numbers & rename the 8 function * correct place of unknown function & fix clang-format
* | | Merge pull request #457 from Subv/mutex_waitersbunnei2018-05-211-1/+0
|\ \ \ | | | | | | | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.
| * | | Mutex: Do not assert when the mutex waiting threads list isn't empty on mutex release.Subv2018-05-201-1/+0
| |/ / | | | | | | | | | A thread may own multiple mutexes at the same time, and only release one of them while other threads are waiting for the other mutexes.
* | | Merge pull request #458 from Subv/fmnmxbunnei2018-05-212-6/+26
|\ \ \ | | | | | | | | Shaders: Implemented the FMNMX shader instruction.
| * | | Shaders: Implemented the FMNMX shader instruction.Subv2018-05-212-6/+26
| |/ /
* | | Merge pull request #445 from greggameplayer/patch-2bunnei2018-05-213-6/+7
|\ \ \ | | | | | | | | Properly rename functions of Fatal Module & add ThrowFatal to this module
| * | | rename fatal:u functions & add ThrowFatalgreggameplayer2018-05-181-2/+3
| | | |
| * | | Properly update fatal.h void namegreggameplayer2018-05-181-2/+2
| | | |
| * | | Properly rename fatal module functionsgreggameplayer2018-05-181-2/+2
| |/ /
* | | Merge pull request #453 from Subv/thread_callstackSebastian Valle2018-05-212-0/+37
|\ \ \ | | | | | | | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget
| * | | Qt/WaitTree: Display the callstack for each thread in the wait tree widget.Subv2018-05-192-0/+37
| |/ /
* | | Merge pull request #452 from Subv/psetpSebastian Valle2018-05-211-0/+3
|\ \ \ | | | | | | | | ShadersDecompiler: Added decoding for the PSETP instruction.
| * | | ShadersDecompiler: Added decoding for the PSETP instruction.Subv2018-05-191-0/+3
| |/ /
* | | Merge pull request #451 from Subv/gl_array_sizeSebastian Valle2018-05-212-13/+3
|\ \ \ | | | | | | | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.
| * | | GLRenderer: Remove unused hw_vao_enabled_attributes variable.Subv2018-05-192-4/+0
| | | |
| * | | GLRenderer: Remove unused vertex buffer and increase the size of the stream buffer to 128 MB.Subv2018-05-192-9/+3
| |/ / | | | | | | | | | The stream buffer is where all the vertex data is copied, some games require this to be much bigger than the 4 MB we used to have.
* | | Merge pull request #450 from Subv/shader_link_errorSebastian Valle2018-05-201-0/+27
|\ \ \ | | | | | | | | GLRenderer: Log the shader source code when program linking fails.
| * | | GLRenderer: Log the shader source code when program linking fails.Subv2018-05-191-0/+27
| |/ /
* | | Merge pull request #443 from ogniK5377/ipc-500Sebastian Valle2018-05-203-1/+7
|\ \ \ | | | | | | | | Added IPC RequestWithContext & ControlWithContext
| * | | Added RequestWithContext & ControlWithContextDavid Marcec2018-05-173-1/+7
| |/ /
* | | Add and correct some Error Modules (#444)greggameplayer2018-05-201-6/+40
| | | | | | | | | | | | * Add and correct some Error Modules
* | | Merge pull request #442 from Hexagon12/nfp-service-namesSebastian Valle2018-05-201-24/+24
|\ \ \ | |/ / |/| | Updated nfp to have more service names
| * | Updated nfp with more service namesHexagon122018-05-131-24/+24
|/ /
* | Merge pull request #436 from bunnei/multi-corebunnei2018-05-1124-189/+613
|\ \ | | | | | | Initial support for multi-core
| * | core: Add several missing docstrings.bunnei2018-05-111-0/+8
| | |
| * | thread: Rename mask to affinity_masks.bunnei2018-05-114-5/+6
| | |
| * | core: Run all CPU cores separately, even in single-thread mode.bunnei2018-05-112-13/+23
| | |
| * | thread: Support core change on ResumeFromWait and improve ChangeCore.bunnei2018-05-111-37/+68
| | |
| * | scheduler: Protect scheduling functions with a global mutex.bunnei2018-05-112-0/+18
| | |
| * | wait_tree: Add ideal core and affinity mask.bunnei2018-05-111-0/+2
| | |
| * | thread: Initialize ideal_core and mask members.bunnei2018-05-111-0/+2
| | |
| * | threading: Reschedule only on cores that are necessary.bunnei2018-05-114-3/+10
| | |
| * | svc: Implement GetThreadCoreMask and SetThreadCoreMask.bunnei2018-05-111-7/+22
| | |
| * | thread: Implement ChangeCore function.bunnei2018-05-112-1/+58
| | |
| * | svc: SignalProcessWideKey should apply to all cores.bunnei2018-05-111-43/+50
| | |
| * | svc: Implement GetCurrentProcessorNumber.bunnei2018-05-111-2/+2
| | |
| * | wait_tree: Show all threads on all schedulers.bunnei2018-05-111-6/+14
| | |
| * | core: Add a configuration setting for use_multi_core.bunnei2018-05-1110-17/+56
| | |
| * | core: Support session close with multicore.bunnei2018-05-114-16/+47
| | |
| * | core: Implement multicore support.bunnei2018-05-1113-78/+113
| | |
| * | core: Create a thread for each CPU core, keep in lock-step with a barrier.bunnei2018-05-114-18/+94
| | |
| * | core: Move common CPU core things to its own class.bunnei2018-05-115-58/+135
| | |
* | | Merge pull request #439 from ogniK5377/GetTPCMasksbunnei2018-05-112-4/+8
|\ \ \ | |/ / |/| | More accurate GetTPCMasks impl
| * | More accurate GetTPCMasks implDavid Marcec2018-05-112-4/+8
|/ /
* | Stubs for QLaunch (#428)Hexagon122018-05-074-5/+221
| | | | | | | | | | | | | | | | | | | | * Stubs for QLaunch * Wiped unrelated stuff * Addressed comment * Dropped GetPopFromGeneralChannelEvent
* | hid: Tweaks, Analog Sticks (#435)Max Thomas2018-05-073-68/+224
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * hid: Update mouse/keyboard state * hid: Working analog sticks * hid: Nits * hid: Nits * hid: Update mystery sections * hid: Tweaks
* | Merge pull request #434 from lioncash/vdtorbunnei2018-05-033-1/+13
|\ \ | | | | | | memory_hook: Default virtual destructor in the cpp file
| * | memory_hook: Default virtual destructor in the cpp fileLioncash2018-05-033-1/+13
| | | | | | | | | | | | | | | Prevents creating multiple copies of the vtable in every translation unit that uses the class. Also silences a -Wweak-vtables warning
* | | Merge pull request #433 from lioncash/loggingbunnei2018-05-032-48/+55
|\ \ \ | |/ / |/| | core_timing: Don't include the log header in core timing's header
| * | core_timing: Don't include the log header in core timing's headerLioncash2018-05-032-48/+55
|/ / | | | | | | | | Avoids propagating logging macros and facilities to files that may not need them. This also allows hiding an internal constant.
* | Merge pull request #431 from lioncash/fmtbunnei2018-05-0229-104/+105
|\ \ | | | | | | general: Make formatting of logged hex values more straightforward
| * | general: Make formatting of logged hex values more straightforwardLioncash2018-05-0229-104/+105
| | | | | | | | | | | | | | | | | | This makes the formatting expectations more obvious (e.g. any zero padding specified is padding that's entirely dedicated to the value being printed, not any pretty-printing that also gets tacked on).
* | | Merge pull request #430 from lioncash/vecbunnei2018-05-021-9/+9
|\ \ \ | | | | | | | | vector_math: Ensure members are always initialized
| * | | vector_math: Ensure members are always initializedLioncash2018-05-021-9/+9
| |/ / | | | | | | | | | Ensures that values are always in a well-defined state.
* | | Merge pull request #427 from bunnei/domain-inputsbunnei2018-05-024-0/+23
|\ \ \ | |/ / |/| | ipc: Add support for PopIpcInterface() method.
| * | ipc: Add support for PopIpcInterface() method.bunnei2018-05-024-0/+23
|/ / | | | | | | - This can be used for domain objects as inputs to service functions.
* | Merge pull request #429 from Subv/ioctl_corruptionbunnei2018-05-012-5/+0
|\ \ | | | | | | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.
| * | GPU: Don't write to invalid memory locations when handling ioctls that don't have an output.Subv2018-05-012-5/+0
| | |
* | | GetSharedFontInOrderOfPriority (#381)David2018-05-014-24/+54
|/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * GetSharedFontInOrderOfPriority * Update pl_u.cpp * Ability to use ReadBuffer and WriteBuffer with different buffer indexes, fixed up GetSharedFontInOrderOfPriority * switched to NGLOG * Update pl_u.cpp * Update pl_u.cpp * language_code is actually language code and not index * u32->u64 * final cleanups
* | Merge pull request #425 from lioncash/namespacebunnei2018-04-309-14/+18
|\ \ | | | | | | core_timing: Namespace all functions and constants in core_timing's header
| * | core_timing: Namespace all functions and constants in core_timing's headerLioncash2018-04-309-14/+18
|/ / | | | | | | All of these variables and functions are related to timings and should be within the namespace.
* | Merge pull request #424 from lioncash/stringbunnei2018-04-308-99/+19
|\ \ | | | | | | string_util: Remove StringFromFormat() and related functions
| * | string_util: Remove StringFromFormat() and related functionsLioncash2018-04-308-99/+19
| | | | | | | | | | | | Given we utilize fmt, we don't need to provide our own functions for formatting anymore
* | | Merge pull request #422 from bunnei/shader-movbunnei2018-04-304-0/+30
|\ \ \ | | | | | | | | Shader instructions MOV_C, MOV_R, and several minor GPU things
| * | | maxwell_3d: Reset vertex counts after drawing.bunnei2018-04-291-0/+10
| | | |
| * | | gl_shader_decompiler: Implement MOV_R.bunnei2018-04-291-1/+2
| | | |
| * | | maxwell_to_gl: Implement type SignedNorm, Size_8_8_8_8.bunnei2018-04-291-0/+12
| | | |
| * | | shader_bytecode: Add decoding for FMNMX instruction.bunnei2018-04-291-0/+2
| | | |
| * | | gl_shader_decompiler: Implement MOV_C.bunnei2018-04-291-0/+5
| | | |
* | | | Merge pull request #423 from lioncash/filebunnei2018-04-302-8/+12
|\ \ \ \ | |_|/ / |/| | | file_util: Minor changes to IOFile
| * | | file_util: Make move constructor/assignment operator and related functions noexceptLioncash2018-04-302-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Without this, it's possible to get compilation failures in the (rare) scenario where a container is used to store a bunch of live IOFile instances, as they may be using std::move_if_noexcept under the hood. Given these definitely don't throw exceptions this is also not incorrect to add either.
| * | | file_util: Add static assertions to ReadBytes() and WriteBytes()Lioncash2018-04-301-2/+6
|/ / / | | | | | | | | | | | | | | | Ensure that the actual types being passed in are trivially copyable. The internal call to ReadArray() and WriteArray() will always succeed, since they're passed a pointer to char* which is always trivially copyable.
* | | Merge pull request #421 from Subv/sh_pred3bunnei2018-04-291-0/+7
|\ \ \ | |/ / |/| | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.
| * | Shaders: Implemented predicate condition 3 (LessEqual) in the fset and fsetp instructions.Subv2018-04-291-0/+7
|/ /
* | Merge pull request #416 from bunnei/shader-ints-p3bunnei2018-04-292-114/+206
|\ \ | | | | | | gl_shader_decompiler: Implement MOV32I, partially implement I2I, I2F
| * | gl_shader_decompiler: Partially implement I2I_R, and I2F_R.bunnei2018-04-292-8/+34
| | |
| * | gl_shader_decompiler: More cleanups, etc. with how we handle register types.bunnei2018-04-291-44/+120
| | |
| * | GLSLRegister: Simplify register declarations, etc.bunnei2018-04-291-63/+31
| | |
| * | shader_bytecode: Add decodings for i2i instructions.bunnei2018-04-291-3/+20
| | |
| * | gl_shader_decompiler: Implement MOV32_IMM instruction.bunnei2018-04-292-2/+7
| | |
* | | Merge pull request #417 from bunnei/lang-codesbunnei2018-04-293-8/+49
|\ \ \ | | | | | | | | set/am: Fix code for getting language codes
| * | | am: Fix GetDesiredLanguage implementation.bunnei2018-04-291-2/+4
| | | |
| * | | set: Fix GetAvailableLanguageCodes implementation.bunnei2018-04-292-6/+45
| |/ /
* | | Merge pull request #418 from bunnei/copy-block-heightSebastian Valle2018-04-292-2/+7
|\ \ \ | |/ / |/| | fermi_2d: Fix surface copy block height.
| * | fermi_2d: Fix surface copy block height.bunnei2018-04-292-2/+7
|/ /
* | Merge pull request #414 from lioncash/cruftbunnei2018-04-281-8/+0
|\ \ | | | | | | file_util: Remove compiler version checks around is_trivially_copyable
| * | file_util: Remove compiler version checks around is_trivially_copyable()Lioncash2018-04-281-8/+0
| | | | | | | | | | | | | | | | | | The minimum clang/GCC versions we support already support this. We can also remove is_standard_layout(), as fread and fwrite only require the type to be trivially copyable.
* | | Merge pull request #413 from lioncash/dynarmicbunnei2018-04-281-0/+0
|\ \ \ | |/ / |/| | externals: Update dynarmic
| * | externals: Update dynarmicLioncash2018-04-281-0/+0
| | | | | | | | | | | | Just a basic update to keep it in sync
* | | Merge pull request #412 from lioncash/logbunnei2018-04-282-54/+1
|\ \ \ | |/ / |/| | log: Remove old logging macros and functions
| * | log: Remove old logging macros and functionsLioncash2018-04-272-54/+1
| | | | | | | | | | | | Now that the old macros are no longer used, we can remove all functionality related to them.
* | | Merge pull request #411 from lioncash/travisMat M2018-04-281-1/+1
|\ \ \ | |/ / |/| | travis: Use Xcode 9.3 instead of 9.2
| * | travis: Use Xcode 9.3 instead of 9.2Lioncash2018-04-271-1/+1
| | | | | | | | | | | | Keeps the toolchains up to date.
* | | Merge pull request #408 from bunnei/shader-ints-p2bunnei2018-04-271-154/+262
|\ \ \ | | | | | | | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.
| * | | gl_shader_decompiler: Add GLSLRegisterManager class to track register state.bunnei2018-04-271-154/+262
| |/ /
* | | Merge pull request #410 from lioncash/genericbunnei2018-04-274-12/+11
|\ \ \ | |/ / |/| | core/renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalents
| * | renderer_opengl: Replace usages of LOG_GENERIC with fmt-capable equivalentsLioncash2018-04-271-6/+7
| | |
| * | core: Replace usages of LOG_GENERIC with new fmt-capable equivalentsLioncash2018-04-273-6/+4
|/ /
* | Merge pull request #409 from lioncash/assertbunnei2018-04-2717-39/+39
|\ \ | | | | | | general: Convert assertion macros over to be fmt-compatible
| * | general: Convert assertion macros over to be fmt-compatibleLioncash2018-04-2717-39/+39
|/ /
* | Merge pull request #380 from ogniK5377/service-implbunnei2018-04-2713-13/+140
|\ \ | | | | | | Implemented some useful interfaces needed for games.
| * | Switched to NGLOG_WARNINGDavid Marcec2018-04-274-5/+5
| | |
| * | Merge branch 'master' of https://github.com/yuzu-emu/yuzu into service-implDavid Marcec2018-04-26110-2244/+1811
| |\ \
| * | | Added PREPO to logging backend, Removed comments from SaveReportWithUserDavid Marcec2018-04-263-13/+3
| | | |
| * | | GetIUserInterface->CreateUserInterface, Added todos and stub logs. Playreport->PlayReport.David Marcec2018-04-2310-25/+64
| | | |
| * | | lioncash proposed changesDavid2018-04-221-2/+2
| | | |
| * | | Implemented GetIUserInterface properly, Playreport and SSL::SetInterfaceVersion. Fixed ipc issues with IAudioDevice(wrong ids)David Marcec2018-04-2211-11/+109
| | | |
* | | | Merge pull request #406 from lioncash/frontendbunnei2018-04-275-27/+26
|\ \ \ \ | | | | | | | | | | frontends: Move logging macros over to new fmt-capable ones
| * | | | frontends: Move logging macros over to new fmt-capable onesLioncash2018-04-275-27/+26
| | | | |
* | | | | Merge pull request #407 from lioncash/commonbunnei2018-04-274-67/+67
|\ \ \ \ \ | | | | | | | | | | | | common: Move logging macros over to new fmt-capable macros where applicable
| * | | | | common: Move logging macros over to new fmt-capable macros where applicableLioncash2018-04-274-67/+67
| |/ / / /
* | | | | Merge pull request #405 from lioncash/inputbunnei2018-04-271-3/+3
|\ \ \ \ \ | |/ / / / |/| | | | input_common: Move old logging macros over to fmt-capable ones
| * | | | input_common: Move old logging macros over to fmt-capable onesLioncash2018-04-271-3/+3
|/ / / /
* | | | Merge pull request #402 from lioncash/corebunnei2018-04-276-28/+28
|\ \ \ \ | | | | | | | | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalents
| * | | | core: Replace remaining old non-generic logger usages with fmt-capable equivalentsLioncash2018-04-266-28/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LOG_GENERIC usages will be amended in a follow-up to keep API changes separate from interface changes, as it will require removing a parameter from the relevant function in the VMManager class.
* | | | | Merge pull request #399 from bunnei/shader-intsbunnei2018-04-272-9/+120
|\ \ \ \ \ | |_|_|/ / |/| | | | Shader decompiler prep for integer instructions
| * | | | gl_shader_decompiler: Boilerplate for handling integer instructions.bunnei2018-04-262-6/+111
| | | | |
| * | | | gl_shader_decompiler: Move color output to EXIT instruction.bunnei2018-04-261-6/+12
| |/ / /
* | | | Merge pull request #403 from lioncash/commonbunnei2018-04-263-792/+0
|\ \ \ \ | |/ / / |/| | | common: Remove chunk_file.h and linear_disk_cache.h
| * | | common: Remove chunk_file.h and linear_disk_cache.hLioncash2018-04-263-792/+0
|/ / / | | | | | | | | | These are unused (and given chunk_file references Dolphin's >SVN< I doubt they were going to be used).
* | | Merge pull request #401 from lioncash/gdbstubbunnei2018-04-261-38/+37
|\ \ \ | | | | | | | | core/gdbstub: Move logging macros to new fmt-compatible ones
| * | | core/gdbstub: Move logging macros to new fmt-compatible onesLioncash2018-04-261-38/+37
|/ / /
* | | Merge pull request #400 from lioncash/hwbunnei2018-04-262-8/+10
|\ \ \ | | | | | | | | core/hw: Move logging macros over to fmt-capable ones
| * | | core/hw: Move logging macros over to fmt-capable onesLioncash2018-04-262-8/+10
|/ / /
* | | Merge pull request #396 from Subv/shader_opsbunnei2018-04-262-9/+89
|\ \ \ | | | | | | | | Shaders: Implemented the FSET instruction.
| * | | Shaders: Added bit decodings for the I2I instruction.Subv2018-04-251-0/+6
| | | |
| * | | Shaders: Implemented the FSET instruction.Subv2018-04-251-0/+53
| | | | | | | | | | | | | | | | This instruction is similar to the FSETP instruction, but it doesn't set a predicate, it sets the destination register to 1.0 if the condition holds, and 0 otherwise.
| * | | Shaders: Added decodings for the FSET instructions.Subv2018-04-252-9/+30
| | | |
* | | | Merge pull request #398 from lioncash/kernelbunnei2018-04-2611-107/+110
|\ \ \ \ | | | | | | | | | | kernel: Migrate logging macros to fmt-compatible ones
| * | | | kernel/shared_memory: Remove unnecessary semicolon at end of ConvertPermissions()Lioncash2018-04-261-1/+1
| | | | | | | | | | | | | | | | | | | | Functions don't need to be terminated by semicolons.
| * | | | kernel: Migrate logging macros to fmt-compatible onesLioncash2018-04-2611-106/+109
| | | | |
* | | | | Merge pull request #387 from Subv/maxwell_2dbunnei2018-04-2610-52/+203
|\ \ \ \ \ | | | | | | | | | | | | GPU: Partially implemented the 2D surface copy engine
| * | | | | GPU: Partially implemented the Fermi2D surface copy operation.Subv2018-04-252-0/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The hardware allows for some rather complicated operations to be performed on the data during the copy, this is not implemented. Only same-format same-size raw copies are implemented for now.
| * | | | | Memory: Added a missing shortcut for Memory::CopyBlock for the current process.Subv2018-04-251-0/+4
| | | | | |
| * | | | | GPU: Make the Textures::CopySwizzledData function accessible from the outside of the file.Subv2018-04-252-3/+6
| | | | | |
| * | | | | GPU: Added a function to retrieve the bytes per pixel of the render target formats.Subv2018-04-252-0/+15
| | | | | |
| * | | | | GPU: Added surface copy registers to Fermi2DSubv2018-04-251-1/+57
| | | | | |
| * | | | | GPU: Added boilerplate code for the Fermi2D engineSubv2018-04-253-3/+34
| | | | | |
| * | | | | GPU: Reduce the number of registers of Maxwell3D to 0xE00.Subv2018-04-252-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | The rest are just macro shim registers.
| * | | | | GPU: Move the Maxwell3D macro uploading code to the inside of the Maxwell3D processor.Subv2018-04-254-40/+23
| | | | | | | | | | | | | | | | | | | | | | | | It doesn't belong in the PFIFO handler.
| * | | | | GPU: Corrected the upper bound of the PFIFO method ids in the command processor.Subv2018-04-251-1/+1
| | | | | |
* | | | | | Merge pull request #395 from lioncash/file-sysbunnei2018-04-268-68/+59
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | file-sys: Move logging macros over to the new fmt-capable ones
| * | | | | file-sys: convert a StringFromFormat call into fmt::format in GetFullPath()Lioncash2018-04-251-4/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Lessens the amount to read and gets rid of the PRIX64 macro, allowing us to use a single string for the whole path, making it easier to read.
| * | | | | file-sys: Move logging macros over to the new fmt-capable onesLioncash2018-04-258-64/+58
| | |/ / / | |/| | |
* | | | | Merge pull request #390 from mailwl/pctl-modulebunnei2018-04-257-39/+71
|\ \ \ \ \ | | | | | | | | | | | | Service/PCTL: convert to module, add services, stub
| * | | | | Service/PCTL: convert to module, add services, stubmailwl2018-04-257-39/+71
| |/ / / / | | | | | | | | | | | | | | | PCTL::CreateServiceWithoutInitialize and IParentalControlService::Initialize, required by Kirby Star Allies
* | | | | Merge pull request #397 from lioncash/corebunnei2018-04-251-24/+26
|\ \ \ \ \ | |_|/ / / |/| | | | core/memory: Move logging macros over to the new fmt-capable ones
| * | | | core/memory: Amend address widths in assertsLioncash2018-04-251-2/+2
| | | | | | | | | | | | | | | | | | | | Addresses are 64-bit, these formatting specifiers are simply holdovers from citra. Adjust them to be the correct width.
| * | | | core/memory: Move logging macros over to new fmt-capable onesLioncash2018-04-251-22/+24
| |/ / / | | | | | | | | | | | | While we're at it, correct addresses to print all 64 bits where applicable, which were holdovers from citra.
* | | | Merge pull request #394 from lioncash/video-corebunnei2018-04-255-18/+20
|\ \ \ \ | |/ / / |/| | | video-core: Move logging macros over to new fmt-capable ones
| * | | video-core: Move logging macros over to new fmt-capable onesLioncash2018-04-255-18/+20
|/ / /
* | | Merge pull request #388 from bunnei/refactor-rasterizer-cachebunnei2018-04-2514-175/+334
|\ \ \ | | | | | | | | Refactor rasterizer cache
| * | | renderer_opengl: Use correct byte order for framebuffer pixel format ABGR8.bunnei2018-04-251-2/+1
| | | |
| * | | gl_rasterizer_cache: Use CHAR_BIT for bpp conversions instead of 8.bunnei2018-04-252-4/+4
| | | |
| * | | gl_rasterizer_cache: Use GPU PAGE_BITS/SIZE, not CPU.bunnei2018-04-251-5/+5
| | | |
| * | | gl_rasterizer_cache: Use new logger.bunnei2018-04-251-4/+4
| | | |
| * | | gl_rasterizer_cache: Add a function for finding framebuffer GPU address.bunnei2018-04-253-0/+31
| | | |
| * | | gl_rasterizer_cache: Handle compressed texture sizes.bunnei2018-04-252-24/+65
| | | |
| * | | gl_rasterizer_cache: Update to be based on GPU addresses, not CPU addresses.bunnei2018-04-2510-67/+122
| | | |
| * | | memory_manager: Add implement CpuToGpuAddress.bunnei2018-04-242-0/+27
| | | |
| * | | memory_manager: Make GpuToCpuAddress return an optional.bunnei2018-04-247-28/+37
| | | |
| * | | memory_manager: Use GPUVAdddr, not PAddr, for GPU addresses.bunnei2018-04-247-60/+57
| | | |
* | | | Merge pull request #393 from lioncash/loaderbunnei2018-04-255-26/+25
|\ \ \ \ | |/ / / |/| | | loader: Move old logging macros over to new fmt-capable ones
| * | | loader: Move old logging macros over to new fmt-capable onesLioncash2018-04-255-26/+25
|/ / /
* | | Merge pull request #386 from Subv/gpu_querybunnei2018-04-242-2/+53
|\ \ \ | | | | | | | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.
| * | | GPU: Added asserts to our code for handling the QUERY_GET GPU command.Subv2018-04-242-2/+53
| | | | | | | | | | | | | | | | | | | | This is based on research from nouveau. Many things are currently unknown and will require hwtests in the future. This commit also stubs QueryMode::Write2 to do the same as Write. Nouveau code treats them interchangeably, it is currently unknown what the difference is.
* | | | Merge pull request #392 from lioncash/logbunnei2018-04-2438-297/+298
|\ \ \ \ | | | | | | | | | | service: Move logging macros over to the new fmt-compatible ones
| * | | | service: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-5/+5
| | | | |
| * | | | vi: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-26/+27
| | | | |
| * | | | time: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-12/+12
| | | | |
| * | | | ssl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | | | |
| * | | | spl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | sockets: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-7/+8
| | | | |
| * | | | sm: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-9/+8
| | | | |
| * | | | set: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-2/+2
| | | | |
| * | | | pctl: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | nvflinger: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-3/+3
| | | | |
| * | | | nvdrv: Move logging macros over to new fmt-compatible onesLioncash2018-04-247-60/+61
| | | | |
| * | | | ns: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | | | |
| * | | | nifm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-11/+11
| | | | |
| * | | | nfp: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | lm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-6/+6
| | | | |
| * | | | hid: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-25/+25
| | | | |
| * | | | friend: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-1/+1
| | | | |
| * | | | filesystem: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-30/+29
| | | | |
| * | | | fatal: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | | | |
| * | | | audio: Move logging macros over to new fmt-compatible onesLioncash2018-04-242-21/+21
| | | | |
| * | | | apm: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-3/+3
| | | | |
| * | | | aoc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-2/+2
| | | | |
| * | | | am: Move logging macros over to new fmt-compatible onesLioncash2018-04-243-50/+50
| | | | |
| * | | | acc: Move logging macros over to new fmt-compatible onesLioncash2018-04-241-10/+10
| | | | |
* | | | | Merge pull request #391 from lioncash/videobunnei2018-04-241-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()
| * | | | renderer_opengl: Silence a -Wdangling-else warning in DrawScreenTriangles()Lioncash2018-04-241-1/+2
|/ / / /
* | | | Merge pull request #389 from mailwl/fs-renamefilebunnei2018-04-246-8/+36
|\ \ \ \ | | | | | | | | | | Service/FS: implement IFileSystem::RenameFile
| * | | | Service/FS: implement IFileSystem::RenameFilemailwl2018-04-246-8/+36
|/ / / /
* | | | Merge pull request #379 from Subv/multi_buffersbunnei2018-04-243-43/+89
|\ \ \ \ | | | | | | | | | | GPU: Support multiple enabled vertex arrays.
| * | | | GPU: Support multiple enabled vertex arrays.Subv2018-04-233-43/+89
| |/ / / | | | | | | | | | | | | | | | | | | | | The vertex arrays will be copied to the stream buffer one after the other, and the attributes will be set using the ARB_vertex_attrib_binding extension. yuzu now thus requires OpenGL 4.3 or the ARB_vertex_attrib_binding extension.
* | | | Merge pull request #370 from Subv/sync_primitivesbunnei2018-04-2316-525/+285
|\ \ \ \ | | | | | | | | | | Kernel: Reworked the new kernel synchronization primitives.
| * | | | Kernel: Implemented mutex priority inheritance.Subv2018-04-234-10/+94
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Verified with a hwtest and implemented based on reverse engineering. Thread A's priority will get bumped to the highest priority among all the threads that are waiting for a mutex that A holds. Once A releases the mutex and ownership is transferred to B, A's priority will return to normal and B's priority will be bumped.
| * | | | Kernel: Use 0x2C as default main thread priority for homebrew and lone NRO/NSOsSubv2018-04-213-3/+3
| | | | |
| * | | | Qt: Update the WaitTree widget to show info about the current mutex of each thread.Subv2018-04-215-90/+55
| | | | |
| * | | | Kernel: Remove unused ConditionVariable class.Subv2018-04-216-150/+0
| | | | |
| * | | | Kernel: Remove old and unused Mutex code.Subv2018-04-214-209/+3
| | | | |
| * | | | Kernel: Properly implemented svcWaitProcessWideKey and svcSignalProcessWideKeySubv2018-04-211-83/+46
| | | | | | | | | | | | | | | | | | | | They work in tandem with guest code to provide synchronization primitives along with svcArbitrateLock/Unlock
| * | | | Kernel: Corrected the implementation of svcArbitrateLock and svcArbitrateUnlock.Subv2018-04-216-22/+126
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Switch mutexes are no longer kernel objects, they are managed in userland and only use the kernel to handle the contention case. Mutex addresses store a special flag value (0x40000000) to notify the guest code that there are still some threads waiting for the mutex to be released. This flag is updated when a thread calls ArbitrateUnlock. TODO: * Fix svcWaitProcessWideKey * Fix svcSignalProcessWideKey * Remove the Mutex class.
* | | | | Merge pull request #384 from Subv/nvhost-remapbunnei2018-04-232-0/+57
|\ \ \ \ \ | | | | | | | | | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.
| * | | | | NvDrv/nvhost-as-gpu: Ensure that the object passed to MapBufferEx has already been allocated.Subv2018-04-231-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | Also added a consistency check and a comment for the case when the object id is different than its handle. The real nvservices doesn't make a distinction between ids and handles, each object gets an unique handle which doubles as its id.
| * | | | | Nvdrv/nvhost-as-gpu: Implemented the ioctl REMAP command.Subv2018-04-232-0/+47
| | |/ / / | |/| | | | | | | | | | | | | It takes a previously-reserved (AllocateSpace) GPU memory address and maps it to the address of the nvmap object passed to Remap.
* | | | | Merge pull request #385 from Subv/unimpl_ioctlsbunnei2018-04-235-5/+5
|\ \ \ \ \ | | | | | | | | | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.
| * | | | | Nvdrv: Assert when receiving an unimplemented ioctl in the nv* handlers.Subv2018-04-235-5/+5
| |/ / / /
* | | | | Merge pull request #383 from Subv/gpu_mmubunnei2018-04-232-34/+25
|\ \ \ \ \ | | | | | | | | | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 pagetable bits.
| * | | | | GPU: Make the GPU virtual memory manager use 16 page bits and 10 page table bits.Subv2018-04-232-34/+25
| |/ / / / | | | | | | | | | | | | | | | Also removed some dead code and added memory map consistency asserts.
* | | | | Merge pull request #382 from Subv/a2rgb10_rtbunnei2018-04-232-0/+4
|\ \ \ \ \ | |_|_|/ / |/| | | | GPU: Implement the RGB10_A2 RenderTarget format
| * | | | GPU: Implement the RGB10_A2 RenderTarget format, it will use the same format as the A2BGR10 texture format.Subv2018-04-232-0/+4
|/ / / /
* | | | Merge pull request #378 from Subv/a2bgr10bunnei2018-04-224-6/+18
|\ \ \ \ | |/ / / |/| | | GPU: Implement the A2BGR10 texture format.
| * | | GPU: Implement the A2BGR10 texture format.Subv2018-04-224-6/+18
|/ / /
* | | Merge pull request #377 from adityaruplaha/sdl2-fullscreenbunnei2018-04-213-4/+40
|\ \ \ | | | | | | | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)
| * | | SDL2: Implement fullscreen. (Original PR: citra-emu/citra#3607)adityaruplaha2018-04-213-4/+40
| | | |
* | | | Merge pull request #376 from bunnei/shader-decoderbunnei2018-04-212-210/+249
|\ \ \ \ | | | | | | | | | | Shader opcode decoding
| * | | | gl_shader_decompiler: Skip RRO instruction.bunnei2018-04-211-0/+4
| | | | |
| * | | | gl_shader_decompiler: Cleanup error logging.bunnei2018-04-211-14/+6
| | | | |
| * | | | shader_bytecode: Add several more instruction decodings.bunnei2018-04-211-5/+52
| | | | |
| * | | | shader_bytecode: Decode instructions based on bit strings.bunnei2018-04-212-205/+201
| | | | |
* | | | | Merge pull request #375 from lioncash/headerbunnei2018-04-214-11/+0
|\ \ \ \ \ | |/ / / / |/| | | | opengl: Remove unnecessary header inclusions
| * | | | opengl: Remove unnecessary header inclusionsLioncash2018-04-214-11/+0
| | | | |
* | | | | Merge pull request #369 from Subv/shader_instr2bunnei2018-04-212-4/+179
|\ \ \ \ \ | | | | | | | | | | | | ShaderGen: Implemented fsetp/kil and predicated instruction execution.
| * | | | | ShaderGen: Implemented the KIL instruction, which is equivalent to 'discard'.Subv2018-04-211-1/+7
| | | | | |
| * | | | | ShaderGen: Implemented predicated instruction execution.Subv2018-04-212-1/+40
| | | | | | | | | | | | | | | | | | | | | | | | Each predicated instruction will be wrapped in an `if (predicate) { instruction_body; }` in the GLSL, where `predicate` is one of the predicate boolean variables previously set by fsetp.
| * | | | | ShaderGen: Implemented the fsetp instruction.Subv2018-04-212-3/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Predicate variables are now added to the generated shader code in the form of 'pX' where X is the predicate id. These predicate variables are initialized to false on shader startup and are set via the fsetp instructions. TODO: * Not all the comparison types are implemented. * Only the single-predicate version is implemented.
| * | | | | ShaderGen: Register id 255 is special and is hardcoded to return 0 (SR_ZERO).Subv2018-04-202-0/+5
| | | | | |
| * | | | | ShaderGen: Ignore the 'sched' instruction when generating shaders.Subv2018-04-201-0/+16
| | |_|/ / | |/| | | | | | | | | | | | | The 'sched' instruction has a very convoluted encoding, but fortunately it seems to only appear on a fixed interval (once every 4 instructions).
* | | | | Merge pull request #374 from lioncash/noexceptbunnei2018-04-211-20/+19
|\ \ \ \ \ | | | | | | | | | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operators
| * | | | | gl_resource_manager: Add missing noexcept specifiers to move constructors and assignment operatorsLioncash2018-04-211-20/+19
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Standard library containers may use std::move_if_noexcept to perform move operations. If a move cannot be performed under these circumstances, then a copy is attempted. Given we only intend for these types to be move-only this can be somewhat problematic. By defining these to be noexcept we prevent cases where copies may be attempted.
* | | | | Merge pull request #373 from lioncash/enum2bunnei2018-04-211-4/+9
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Make MatchFlags an enum class
| * | | | | gl_rasterizer_cache: Make MatchFlags an enum classLioncash2018-04-211-4/+9
| |/ / / / | | | | | | | | | | | | | | | Prevents implicit conversions and scope pollution.
* | | | | Merge pull request #372 from lioncash/enumbunnei2018-04-213-38/+38
|\ \ \ \ \ | | | | | | | | | | | | resource_limit: Make ResourceTypes an enum class
| * | | | | resource_limit: Make ResourceTypes an enum classLioncash2018-04-213-38/+38
| |/ / / / | | | | | | | | | | | | | | | Prevents enum identifiers from leaking into the surrounding scope.
* | | | | Merge pull request #371 from lioncash/globalbunnei2018-04-216-38/+66
|\ \ \ \ \ | |/ / / / |/| | | | core: Relocate g_service_manager to the System class
| * | | | core: Relocate g_service_manager to the System classLioncash2018-04-216-38/+66
|/ / / / | | | | | | | | | | | | | | | | Converts the service manager from a global into an instance-based variable.
* | | | Merge pull request #340 from mailwl/vi-updatebunnei2018-04-201-7/+27
|\ \ \ \ | |/ / / |/| | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution output
| * | | Service/VI: stub SetLayerVisibility, fix GetDisplayResolution outputmailwl2018-04-171-7/+27
| | | | | | | | | | | | | | | | | | | | both SetLayerVisibility() functions used in Lego games, GetDisplayResolution() fixed according switchbrew.org
* | | | Merge pull request #367 from lioncash/clampbunnei2018-04-205-24/+22
|\ \ \ \ | | | | | | | | | | math_util: Remove the Clamp() function
| * | | | math_util: Remove the Clamp() functionLioncash2018-04-205-24/+22
| | | | | | | | | | | | | | | | | | | | | | | | | C++17 adds clamp() to the standard library, so we can remove ours in favor of it.
* | | | | Merge pull request #361 from lioncash/commonbunnei2018-04-201-18/+12
|\ \ \ \ \ | | | | | | | | | | | | common_types: Minor changes
| * | | | | common_types: Convert typedefs to using aliasesLioncash2018-04-201-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | May as well while we're making changes to this file.
| * | | | | common_types: Remove unnecessary check for whether or not__func__ is definedLioncash2018-04-201-6/+0
| |/ / / / | | | | | | | | | | | | | | | VS has supported this for quite a while.
* | | | | Merge pull request #368 from lioncash/dynarmicbunnei2018-04-201-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: Update dynarmic to HEAD
| * | | | | externals: Update dynarmic to HEADLioncash2018-04-201-0/+0
| | | | | |
* | | | | | Merge pull request #360 from lioncash/namespacesbunnei2018-04-20136-570/+273
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Use nested namespace specifiers where applicable
| * | | | | | service: Use nested namespace specifiers where applicableLioncash2018-04-20136-570/+273
| | |/ / / / | |/| | | | | | | | | | | | | | | | Tidies up namespace declarations
* | | | | | Merge pull request #364 from lioncash/thread-localbunnei2018-04-201-19/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | common/thread: Remove unnecessary feature checking for thread_local
| * | | | | | common/thread: Remove unnecessary feature checking for thread_localLioncash2018-04-201-19/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | Every compiler we require already supports it.
* | | | | | Merge pull request #362 from lioncash/snprintfbunnei2018-04-201-5/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | common_funcs: Remove check for VS versions that we don't even support
| * | | | | | common_funcs: Remove check for VS versions that we don't even supportLioncash2018-04-201-5/+0
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | We don't support any VS versions that don't already have snprintf in the standard library implementation.
* | | | | | Merge pull request #363 from lioncash/array-sizebunnei2018-04-203-5/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | common_funcs: Remove ARRAY_SIZE macro
| * | | | | | common_funcs: Remove ARRAY_SIZE macroLioncash2018-04-203-5/+4
| |/ / / / / | | | | | | | | | | | | | | | | | | C++17 has non-member size() which we can just call where necessary.
* | | | | | Merge pull request #366 from lioncash/vecbunnei2018-04-201-30/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]
| * | | | | | vector_math: Remove AsArray() and Write() functions from Vec[2,3,4]Lioncash2018-04-201-30/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | These are all unused and the Write() ones should arguably not even be in the interface. There are better ways to provide this if we ever need it (like iterators).
* | | | | | | Merge pull request #365 from lioncash/codeblockbunnei2018-04-202-86/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | common: Remove code_block.h
| * | | | | | | common: Remove code_block.hLioncash2018-04-202-86/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | We use dynarmic, so this is unued. Anything else we need will likely use Xbyak, so this header isn't necessary any more.
* | | | | | | Merge pull request #357 from lioncash/guardbunnei2018-04-202-0/+4
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | renderer_opengl: Add missing header guards
| * | | | | | | renderer_opengl: Add missing header guardsLioncash2018-04-202-0/+4
| |/ / / / / /
* | | | | | | Merge pull request #358 from lioncash/explicitbunnei2018-04-202-4/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | disk_filesystem: Minor changes
| * | | | | | | disk_filesystem: Remove unused total_entries_in_directory member from Disk_DirectoryLioncash2018-04-201-1/+0
| | | | | | | |
| * | | | | | | disk_filesystem: Remove redundant initializer in Disk_Directory's constructorLioncash2018-04-201-1/+1
| | | | | | | |
| * | | | | | | disk_filesystem: Make constructors explicit where applicableLioncash2018-04-201-2/+2
| |/ / / / / /
* | | | | | | Merge pull request #359 from lioncash/redundantbunnei2018-04-201-9/+5
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | vi: Remove redundant initializers in the constructors
| * | | | | | vi: Remove redundant initializers in the constructorsLioncash2018-04-201-9/+5
|/ / / / / /
* | | | | | Merge pull request #356 from lioncash/shaderbunnei2018-04-201-12/+30
|\ \ \ \ \ \ | |/ / / / / |/| | | | | glsl_shader_decompiler: Minor API changes to ShaderWriter
| * | | | | glsl_shader_decompiler: Use std::string_view instead of std::string for AddLine()Lioncash2018-04-201-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to take ownership of the string data being given to it, considering all we do is append the characters to the internal string instance. Instead, use a string view to simply reference the string data without any potential heap allocation. Now anything that is a raw const char* won't need to be converted to a std::string before appending.
| * | | | | glsl_shader_decompiler: Add AddNewLine() function to ShaderWriterLioncash2018-04-201-6/+12
| | | | | | | | | | | | | | | | | | | | | | | | Avoids constructing a std::string just to append a newline character
| * | | | | glsl_shader_decompiler: Add char overload for ShaderWriter's AddLine()Lioncash2018-04-201-4/+11
| | | | | | | | | | | | | | | | | | | | | | | | Avoids constructing a std::string just to append a character.
| * | | | | glsl_shader_decompiler: Append indentation without constructing a separate std::stringLioncash2018-04-201-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The interface of std::string already lets us append N copies of a character to an existing string.
* | | | | | Merge pull request #355 from Subv/shader_instrbunnei2018-04-202-11/+39
|\ \ \ \ \ \ | |/ / / / / |/| | | | | ShaderGen: Fixed TEXS overriding its own texcoords and implemented fmul32i
| * | | | | ShaderGen: Implemented the fmul32i shader instruction.Subv2018-04-192-9/+30
| | | | | |
| * | | | | ShaderGen: Fixed a case where the TEXS instruction would use the same registers for the input and the output.Subv2018-04-191-2/+9
| | | | | | | | | | | | | | | | | | | | | | | | It will now save the coords before writing the outputs in a subscope.
* | | | | | Merge pull request #348 from jlachniet/patch-1James Rowe2018-04-191-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Technically, yuzu can boot commercial games
| * | | | | | Technically, yuzu can boot commercial gamesjlachniet2018-04-181-1/+1
| | | | | | | | | | | | | | | | | | | | | Clarifies the yuzu cannot play commercial games to any reasonable extent, rather than not at all.
* | | | | | | Implement Pull #3528 from citra: use nvidia graphics automatically on laptops with optimus (with AMD support) (#271)N00byKing2018-04-192-0/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port 3528: use nvidia graphics automatically on laptops with optimus * Force dedicated AMD Card for switchable Graphics * Ran clang-format
* | | | | | | Merge pull request #352 from bunnei/fix-microprofileJames Rowe2018-04-191-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.
| * | | | | | nvflinger: Call MicroProfileFlip on NVFlinger::Compose.bunnei2018-04-191-0/+3
| |/ / / / /
* | | | | | Merge pull request #353 from Subv/compressed_formatsbunnei2018-04-193-28/+35
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.
| * | | | | | GPU: Add support for the DXT23 and DXT45 compressed texture formats.Subv2018-04-193-28/+35
|/ / / / / /
* | | | | | Merge pull request #351 from Subv/tex_formatsbunnei2018-04-194-8/+28
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Implemented the B5G6R5 format.
| * | | | | | GPU: Implemented the B5G6R5 format.Subv2018-04-194-8/+28
| | | | | | |
* | | | | | | gl_shader_gen: Support vertical/horizontal viewport flipping. (#347)bunnei2018-04-184-5/+29
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * gl_shader_gen: Support vertical/horizontal viewport flipping. * fixup! gl_shader_gen: Support vertical/horizontal viewport flipping.
* | | | | | Merge pull request #350 from Subv/tex_componentsbunnei2018-04-183-43/+90
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Fixed the incorrect component order in ABGR8 textures.
| * | | | | | GLCache: Added boilerplate code to make supporting configurable texture component types.Subv2018-04-183-9/+69
| | | | | | | | | | | | | | | | | | | | | | | | | | | | For now only the UNORM type is supported.
| * | | | | | GLCache: Unify texture and framebuffer formats when converting to OpenGL.Subv2018-04-182-26/+13
| | | | | | |
| * | | | | | GPU: Texture format 8 and framebuffer format 0xD5 are actually ABGR8.Subv2018-04-182-10/+10
|/ / / / / /
* | | | | | Merge pull request #349 from Subv/texturingbunnei2018-04-187-53/+97
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GPU: Support non-tiled textures and configurable block height.
| * | | | | GPU: Pitch textures are now supported, don't assert when encountering them.Subv2018-04-181-2/+3
| | | | | |
| * | | | | GLCache: Take into account the texture's block height when caching and unswizzling.Subv2018-04-183-43/+43
| | | | | |
| * | | | | GLCache: Added a function to convert cached PixelFormats back to texture formats.Subv2018-04-181-0/+12
| | | | | | | | | | | | | | | | | | | | | | | | TODO: The way we handle cached formats must change, framebuffer and texture formats are too different to keep them in the same place.
| * | | | | GPU: Allow using a configurable block height when unswizzling textures.Subv2018-04-184-7/+23
| | | | | |
| * | | | | GPU/TIC: Added the pitch and block height fields to the TIC structure.Subv2018-04-181-1/+16
|/ / / / /
* | | | | Merge pull request #346 from bunnei/misc-gpu-improvementsbunnei2018-04-184-2/+11
|\ \ \ \ \ | | | | | | | | | | | | Misc gpu improvements
| * | | | | gl_rasterizer_cache: Add missing LOG statements.bunnei2018-04-181-0/+3
| | | | | |
| * | | | | texture: Add missing formats.bunnei2018-04-181-1/+3
| | | | | |
| * | | | | gpu: Add several framebuffer formats to RenderTargetFormat.bunnei2018-04-181-0/+3
| | | | | |
| * | | | | maxwell3d: Allow Texture2DNoMipmap as Texture2D.bunnei2018-04-181-1/+2
| | | | | |
* | | | | | Merge pull request #344 from bunnei/shader-decompiler-p2bunnei2018-04-184-73/+180
|\ \ \ \ \ \ | | | | | | | | | | | | | | Shader decompiler changes part 2
| * | | | | | shader_bytecode: Make ctor's constexpr and explicit.bunnei2018-04-181-7/+7
| | | | | | |
| * | | | | | bit_field: Remove is_pod check, add is_trivially_copyable_v.bunnei2018-04-181-6/+1
| | | | | | |
| * | | | | | gl_shader_decompiler: Fix warnings with MarkAsUsed.bunnei2018-04-171-1/+2
| | | | | | |
| * | | | | | gl_shader_decompiler: Cleanup logging, updating to NGLOG_*.bunnei2018-04-171-24/+22
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement several MUFU subops and abs_d.bunnei2018-04-171-7/+21
| | | | | | |
| * | | | | | gl_shader_decompiler: Fix swizzle in GetRegister.bunnei2018-04-171-1/+1
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement FMUL/FADD/FFMA immediate instructions.bunnei2018-04-172-12/+53
| | | | | | |
| * | | | | | gl_shader_decompiler: Allow vertex position to be used in fragment shader.bunnei2018-04-172-16/+18
| | | | | | |
| * | | | | | gl_shader_decompiler: Implement IPA instruction.bunnei2018-04-171-0/+11
| | | | | | |
| * | | | | | gl_shader_decompiler: Add support for TEXS instruction.bunnei2018-04-172-12/+43
| | | | | | |
| * | | | | | gl_shader_decompiler: Use fragment output color for GPR 0-3.bunnei2018-04-171-0/+5
| | | | | | |
| * | | | | | gl_shader_decompiler: Partially implement MUFU.bunnei2018-04-171-2/+11
| |/ / / / /
* | | | | | Merge pull request #345 from bunnei/blendingbunnei2018-04-186-7/+140
|\ \ \ \ \ \ | |/ / / / / |/| | | | | renderer_opengl: Implement BlendEquation and BlendFunc.
| * | | | | renderer_opengl: Implement BlendEquation and BlendFunc.bunnei2018-04-186-7/+140
|/ / / / /
* | | | | Merge pull request #341 from shinyquagsire23/pfs-hfs-implbunnei2018-04-173-0/+214
|\ \ \ \ \ | |_|/ / / |/| | | | file_sys: Add HFS/PFS helper component
| * | | | file_sys: Use NGLOGshinyquagsire232018-04-171-5/+5
| | | | |
| * | | | file_sys: tweaksshinyquagsire232018-04-162-6/+7
| | | | |
| * | | | file_sys: Add HFS/PFS helper componentshinyquagsire232018-04-163-0/+213
| |/ / /
* | | | Merge pull request #343 from Subv/tex_wrap_4bunnei2018-04-171-0/+7
|\ \ \ \ | | | | | | | | | | GPU: Implement some wrap modes
| * | | | MaxwellToGL: Implemented tex wrap mode 1 (Wrap, GL_REPEAT).Subv2018-04-171-0/+2
| | | | |
| * | | | MaxwellToGL: Added a TODO and partial implementation of maxwell wrap mode 4 (Clamp, GL_CLAMP).Subv2018-04-171-0/+5
| |/ / / | | | | | | | | | | | | This clamp mode was removed from OpenGL as of 3.1, we can emulate it by using GL_CLAMP_TO_BORDER to get the border color of the texture, and then manually sampling the edge to mix them in the fragment shader.
* | | | Various service name fixes - part 2 (rebased) (#322)Hexagon122018-04-1713-11/+207
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated ACC with more service names * Updated SVC with more service names * Updated set with more service names * Updated sockets with more service names * Updated SPL with more service names * Updated time with more service names * Updated vi with more service names
* | | | Merge pull request #342 from bunnei/indexed-vertsbunnei2018-04-175-28/+98
|\ \ \ \ | |/ / / |/| | | Implement indexed mode rendering
| * | | gl_rendering: Use NGLOG* for changed code.bunnei2018-04-172-10/+11
| | | |
| * | | gl_rasterizer: Implement indexed vertex mode.bunnei2018-04-175-23/+92
|/ / /
* | | Merge pull request #338 from bunnei/unrequire-shared-fontbunnei2018-04-151-17/+14
|\ \ \ | | | | | | | | pl_u: Use empty shared font if none is available.
| * | | pl_u: Use empty shared font if none is available.bunnei2018-04-151-17/+14
| | | | | | | | | | | | | | | | - Makes games work in lieu of shared_font.bin.
* | | | Merge pull request #337 from Subv/used_buffersbunnei2018-04-155-12/+59
|\ \ \ \ | | | | | | | | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl
| * | | | GPU: Use the same buffer names in the generated GLSL and the buffer uploading code.Subv2018-04-154-17/+24
| | | | |
| * | | | GPU: Don't use explicit binding points when uploading the constbuffers to opengl.Subv2018-04-153-7/+47
| | | | | | | | | | | | | | | | | | | | The bindpoints will now be dynamically calculated based on the number of buffers used by the previous shader stage.
* | | | | Merge pull request #335 from bunnei/delete-filebunnei2018-04-156-9/+27
|\ \ \ \ \ | | | | | | | | | | | | fsp_srv: Implement DeleteFile.
| * | | | | fsp_srv: Implement DeleteFile.bunnei2018-04-156-9/+27
| | |/ / / | |/| | | | | | | | | | | | | - Used by Binding of Isaac.
* | | | | Merge pull request #334 from Subv/used_buffersbunnei2018-04-153-28/+39
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage
| * | | GPU: Don't use GetPointer when uploading the constbuffer data to the GPU.Subv2018-04-151-3/+4
| | | |
| * | | GPU: Use the buffer hints from the shader decompiler to upload only the necessary const buffers for each shader stage.Subv2018-04-153-31/+41
|/ / /
* | | Merge pull request #333 from bunnei/const-buff-hintsbunnei2018-04-155-31/+146
|\ \ \ | | | | | | | | shaders: Expose hints about used const buffers.
| * | | shaders: Expose hints about used const buffers.bunnei2018-04-155-31/+146
|/ / /
* | | Merge pull request #328 from Subv/constbuffersbunnei2018-04-158-16/+104
|\ \ \ | | | | | | | | GPU: Upload the shader Constant Buffers as SSBOs to the GPU
| * | | GPU: Upload the entirety of each constbuffer for each shader stage as SSBOs.Subv2018-04-154-14/+48
| | | | | | | | | | | | | | | | We're going to need the shader generator to give us a mapping of the actual used const buffers to properly bind them to the shader.
| * | | GPU: Allow configuring ssbos in the opengl state manager.Subv2018-04-154-0/+30
| | | |
| * | | GPU: Added a function to determine whether a shader stage is enabled or not.Subv2018-04-153-3/+27
|/ / /
* | | Merge pull request #332 from bunnei/fix-total-mem-usagebunnei2018-04-151-1/+1
|\ \ \ | | | | | | | | vm_manager: Increase GetTotalMemoryUsage value.
| * | | vm_manager: Increase GetTotalMemoryUsage value.bunnei2018-04-151-1/+1
| |/ / | | | | | | | | | - Gets Binding of Isaac running.
* | | Merge pull request #327 from adityaruplaha/fullscreen-fixbunnei2018-04-151-2/+4
|\ \ \ | | | | | | | | Fix the stuck in fullscreen bug
| * | | Fix the stuck in fullscreen bug (Original PR: citra-emu/citra#3611)adityaruplaha2018-04-141-2/+4
| |/ /
* | | Merge pull request #331 from bunnei/fsp-flushbunnei2018-04-151-1/+9
|\ \ \ | | | | | | | | fsp_srv: Implement IFile::Flush.
| * | | fsp_srv: Implement IFile::Flush.bunnei2018-04-151-1/+9
| |/ /
* | | Merge pull request #329 from bunnei/shader-gen-part-1bunnei2018-04-1526-642/+1872
|\ \ \ | |/ / |/| | OpenGL shader generation part 1
| * | shaders: Add NumTextureSamplers const, remove unused #pragma.bunnei2018-04-154-4/+5
| | |
| * | shaders: Address PR review feedback.bunnei2018-04-142-7/+9
| | |
| * | gl_shader_decompiler: Cleanup log statements.bunnei2018-04-141-15/+15
| | |
| * | shaders: Fix GCC and clang build issues.bunnei2018-04-143-5/+5
| | |
| * | gl_shader_decompiler: Implement negate, abs, etc. and lots of cleanup.bunnei2018-04-142-40/+96
| | |
| * | shader_bytecode: Add FSETP and KIL to GetInfo.bunnei2018-04-141-0/+3
| | |
| * | shader_bytecode: Add SubOp decoding.bunnei2018-04-141-0/+10
| | |
| * | gl_shader_decompiler: Add shader stage hint.bunnei2018-04-142-5/+12
| | |
| * | renderer_opengl: Fix Morton copy byteswap, etc.bunnei2018-04-142-6/+6
| | |
| * | gl_shader_manager: Implement SetShaderSamplerBindings.bunnei2018-04-141-0/+8
| | |
| * | gl_rasterizer: Generate shaders and upload uniforms.bunnei2018-04-142-32/+77
| | |
| * | gl_shader_decompiler: Basic impl. for very simple vertex shaders.bunnei2018-04-142-16/+311
| | | | | | | | | | | | - Tested with Puyo Puyo Tetris and Cave Story+
| * | gl_shader_manager: Cleanup and consolidate uniform handling.bunnei2018-04-142-26/+24
| | |
| * | maxwell_3d: Make memory_manager public.bunnei2018-04-141-2/+1
| | |
| * | maxwell_3d: Fix shader_config decodings.bunnei2018-04-141-6/+3
| | |
| * | gl_rasterizer: Use shader program manager, remove test shader.bunnei2018-04-142-196/+31
| | |
| * | renderer_opengl: Add gl_shader_manager class.bunnei2018-04-143-0/+209
| | |
| * | maxwell_to_gl: Add a few types, etc.bunnei2018-04-141-0/+10
| | |
| * | gl_shader_gen: Add hashable setup/config structs.bunnei2018-04-142-29/+50
| | |
| * | gl_shader_util: Add missing includes.bunnei2018-04-141-0/+2
| | |
| * | common: Port cityhash code from Citra.bunnei2018-04-145-147/+502
| | |
| * | renderer_opengl: Use OGLProgram instead of OGLShader.bunnei2018-04-146-6/+6
| | |
| * | gl_shader_util: Grab latest upstream.bunnei2018-04-142-149/+74
| | |
| * | gl_resource_manager: Grab latest upstream.bunnei2018-04-141-30/+86
| | |
| * | gl_shader_decompiler: Add skeleton code from Citra for shader analysis.bunnei2018-04-142-44/+142
| | |
| * | shader_bytecode: Add initial module for shader decoding.bunnei2018-04-142-0/+298
| | |
| * | bit_field: Make all methods constexpr.bunnei2018-04-141-5/+5
|/ /
* | Merge pull request #323 from Hexagon12/stub-hidbunnei2018-04-131-1/+7
|\ \ | | | | | | Service/HID: Stubbed out GetPlayerLedPattern
| * | Stubbed out GetPlayerLedPatternHexagon122018-04-131-1/+7
| | |
* | | Merge pull request #325 from Hexagon12/ipc-value-fixbunnei2018-04-131-1/+1
|\ \ \ | | | | | | | | Service/vi: Fix normal_params_size in GetDisplayResolution
| * | | Fixed normal params in GetDisplayResolutionHexagon122018-04-131-1/+1
| |/ /
| * | Merge pull request #1 from yuzu-emu/masterHexagon122018-04-1334-193/+853
| |\ \ | |/ / |/| | Update fork
* | | Merge pull request #319 from Hexagon12/service-name-fixbunnei2018-04-1321-65/+413
|\ \ \ | | | | | | | | Various service name fixes - part 1
| * | | Various fixes and clangHexagon122018-04-116-115/+108
| | | |
| * | | Decimal changeHexagon122018-04-101-4/+4
| | | |
| * | | Updated pctl:a with new service names.Hexagon122018-04-101-4/+101
| | | |
| * | | Updated nvmemp with new service names.Hexagon122018-04-101-4/+4
| | | |
| * | | Updated nvdrv with more service names.Hexagon122018-04-101-0/+7
| | | |
| * | | Updated pl:u with more service names.Hexagon122018-04-101-1/+3
| | | |
| * | | Updated hid with more service names.Hexagon122018-04-101-0/+50
| | | |
| * | | Updated friend:u with more service names.Hexagon122018-04-101-1/+2
| | | |
| * | | Updated the unknown nameHexagon122018-04-101-1/+1
| | | |
| * | | Updated friend:a with more service names.Hexagon122018-04-101-1/+2
| | | |
| * | | Updated fsp-srv with more service names.Hexagon122018-04-101-4/+102
| | | |
| * | | Updated CodecCtl with more service names.Hexagon122018-04-101-3/+3
| | | |
| * | | Updated audren with more service names.Hexagon122018-04-101-10/+14
| | | |
| * | | Updated audrec with more service names.Hexagon122018-04-101-7/+9
| | | |
| * | | Updated audout with more service names.Hexagon122018-04-101-13/+16
| | | |
| * | | Updated audin with more service names.Hexagon122018-04-101-9/+16
| | | |
| * | | Updated AOC with more service names.Hexagon122018-04-101-0/+1
| | | |
| * | | Updated AppletOE with more service names.Hexagon122018-04-101-0/+1
| | | |
| * | | Updated AppletAE with more service names.Hexagon122018-04-101-0/+1
| | | |
| * | | Updated AM with more service names.Hexagon122018-04-101-2/+82
| |/ /
* | | Merge pull request #320 from mailwl/ssl-updatebunnei2018-04-122-1/+98
|\ \ \ | | | | | | | | Service/SSL: update service according switchbrew
| * | | Service/SSL: update service according switchbrewmailwl2018-04-112-1/+98
|/ / /
* | | Merge pull request #318 from mailwl/accountbunnei2018-04-1011-127/+342
|\ \ \ | |/ / |/| | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 services
| * | Service/ACC: convert to module, add acc:aa, acc:su, acc:u1 servicesmailwl2018-04-1011-127/+342
|/ /
* | Merge pull request #314 from jroweboy/tegra-progress-3bbunnei2018-04-089-173/+274
|\ \ | | | | | | GPU: Bind uploaded textures when drawing (Rebased)
| * | Fix clang format issuesJames Rowe2018-04-071-1/+1
| | |
| * | GPU: Assert when finding a texture with a format type other than UNORM.Subv2018-04-072-4/+16
| | |
| * | GL: Set up the textures used for each draw call.Subv2018-04-072-2/+39
| | | | | | | | | | | | | | | Each Maxwell shader stage can have an arbitrary number of textures, but we're limited to a certain number in OpenGL. We try to only use the minimum amount of host textures by not keeping a 1:1 relation between guest texture ids and host texture ids, ie, guest texture id 8 can be host texture id 0 if it's the only texture used in the guest shader program. This mapping will have to be passed to the shader decompiler so it can rewrite the texture accesses.
| * | GL: Bind the textures to the shaders used for drawing.Subv2018-04-071-2/+11
| | |
| * | GLCache: Specialize the MortonCopy function for the DXT1 texture format.Subv2018-04-071-1/+15
| | | | | | | | | | | | It will now use the UnswizzleTexture function instead of the MortonCopyPixels128, which doesn't seem to work for textures.
| * | GLCache: Implemented GetTextureSurface.Subv2018-04-071-3/+28
| | |
| * | GLCache: Support uploading compressed textures to the GPU.Subv2018-04-071-5/+17
| | | | | | | | | | | | Compressed texture formats like DXT1, DXT2, DXT3, etc will use this to ease the load on the CPU.
| * | GL: Remove remaining references to 3DS-specific pixel formatsSubv2018-04-071-83/+22
| | |
| * | RasterizerCache: Remove 3DS-specific pixel formats.Subv2018-04-072-71/+32
| | | | | | | | | | | | We're only left with RGB8 and DXT1 for now. More will be added as they are needed.
| * | GL: Create the sampler objects when starting up the GL rasterizer.Subv2018-04-071-0/+6
| | |
| * | GL: Ported the SamplerInfo struct from citra.Subv2018-04-072-1/+59
| | |
| * | GL: Rename PicaTexture to MaxwellTexture.Subv2018-04-072-2/+2
| | |
| * | GL: Added functions to convert Maxwell tex filters and wrap modes to OpenGL.Subv2018-04-071-0/+23
| | |
| * | Textures: Added a helper function to know if a texture is blocklinear or pitch.Subv2018-04-071-0/+5
| | |
* | | Merge pull request #315 from jroweboy/spelling-fixbunnei2018-04-072-3/+3
|\ \ \ | | | | | | | | Fix spelling of Initialize
| * | | Fix spelling of InitializeJames Rowe2018-04-072-3/+3
| |/ /
* | | Merge pull request #316 from jroweboy/dontcrashbunnei2018-04-071-2/+1
|\ \ \ | |/ / |/| | Prevent crash from uninitialized telemetry
| * | Prevent crash from uninitialized telemetryJames Rowe2018-04-071-2/+1
|/ /
* | Merge pull request #310 from N00byKing/patch-1bunnei2018-04-065-10/+10
|\ \ | | | | | | Update multiple comments from citra to yuzu
| * | rasterizer_interface.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| | |
| * | default_ini.h: Update from citra to yuzuN00byKing2018-04-041-1/+1
| | |
| * | gl_rasterizer_cache.cpp: Update from citra to yuzuN00byKing2018-04-041-1/+1
| | |
| * | gl_rasterizer_cache.h: Update from citra to yuzuN00byKing2018-04-041-3/+3
| | |
| * | renderer_opengl.h: Update from citra to yuzuN00byKing2018-04-041-2/+2
| | |
* | | core, main.h: Abort on 32Bit ROMs (#309)N00byKing2018-04-065-1/+17
| | | | | | | | | | | | | | | | | | * core, main.h: Abort on 32Bit ROMs * main.cpp: Fix Grammar
* | | Merge pull request #312 from jroweboy/update-fmtlibbunnei2018-04-063-5/+8
|\ \ \ | |/ / |/| | Update fmtlib to fix msvc warnings
| * | Update fmtlib to fix msvc warningsJames Rowe2018-04-063-5/+8
|/ / | | | | | | | | | | Additionally, when updating fmtlib, there was a change in fmtlib broke how the old logging macro was overloaded, so this works around that by just naming the fmtlib macro impl something different
* | Merge pull request #308 from bunnei/misc-fixes-2bunnei2018-04-0412-18/+108
|\ \ | | | | | | Implement and stub several SVC/VI/Audio/Friend/etc. funcs
| * | svc: Stub out SetThreadActivity, GetThreadContext.bunnei2018-04-032-2/+19
| | |
| * | audren_u: Stub out GetActiveAudioDeviceName.bunnei2018-04-031-1/+13
| | |
| * | audout_u: Implement GetAudioOutState.bunnei2018-04-031-1/+8
| | |
| * | nifm: GetResult does not return a data field.bunnei2018-04-031-2/+1
| | |
| * | vi: Implement GetDisplayResolution.bunnei2018-04-032-0/+26
| | |
| * | shared_memory: Remove incorrect 3ds-specific check.bunnei2018-04-031-12/+0
| | |
| * | service: Add friend:u interface.bunnei2018-04-034-0/+41
|/ /
* | Merge pull request #306 from daniellimws/new-fmt-macrosbunnei2018-04-032-5/+11
|\ \ | | | | | | logging: Use variadic template instead of FMT_VARIADIC
| * | logging: Change FmtLogMessage to use variadic template instead of FMT_VARIADICDaniel Lim Wee Soong2018-04-032-5/+11
|/ / | | | | | | Due to premature merging of #262 I think the build may be failing right now. Should merge this ASAP to fix it.
* | Merge pull request #262 from daniellimws/fmtlib-macrosbunnei2018-04-0311-68/+112
|\ \ | | | | | | Logging: Add fmtlib-based macros
| * | Remove dependency chronoDaniel Lim Wee Soong2018-03-221-1/+0
| | | | | | | | | | | | | | | | | | Earlier chrono was included but after some code changed it was no longer needed Forgot to remove it so I'm removing it now
| * | Change "yuzu starting..." to be logged with the new macroDaniel Lim Wee Soong2018-03-221-1/+1
| | | | | | | | | | | | Just as a proof that it works
| * | Logging: Create logging macros based on fmtlibDaniel Lim Wee Soong2018-03-2210-67/+112
| | | | | | | | | | | | | | | | | | | | | | | | | | | Add a new set of logging macros based on fmtlib Similar but not exactly the same as https://github.com/citra-emu/citra/pull/3533 Citra currently uses a different version of fmt, which does not support FMT_VARIADIC so make_args is used instead. On the other hand, yuzu uses fmt 4.1.0 which doesn't have make_args yet so FMT_VARIADIC is used.
* | | Merge pull request #267 from N00byKing/patch-1bunnei2018-04-032-14/+14
|\ \ \ | | | | | | | | Update Dialog from citra to yuzu
| * | | yuzu.cpp: Update Link from citra to yuzuN00byKing2018-03-261-1/+1
| | | |
| * | | main.cpp: Replace Citra with yuzu Wiki LinksN00byKing2018-03-251-4/+4
| | | |
| * | | main.cpp: Update Dialog from citra to yuzuN00byKing2018-03-251-11/+11
| | | |
* | | | Merge pull request #276 from N00byKing/acctoyuzubunnei2018-04-034-10/+10
|\ \ \ \ | | | | | | | | | | Change Telemetry Names to yuzu and remove links to citra
| * | | | telemetry.h: Reword comment from citra to yuzuN00byKing2018-03-271-1/+1
| | | | |
| * | | | telemetry_session.h: Reword Documentation Comment from citra to yuzuN00byKing2018-03-271-2/+2
| | | | |
| * | | | Remove Links to citra ServicesN00byKing2018-03-271-2/+2
| | | | |
| * | | | Change Telemetry Names to yuzuN00byKing2018-03-272-5/+5
| | | | |
* | | | | Merge pull request #304 from daniellimws/fix-openbsdbunnei2018-04-034-7/+20
|\ \ \ \ \ | | | | | | | | | | | | Fix build on OpenBSD
| * | | | | externals: Update fmt to 4d35f94Daniel Lim Wee Soong2018-04-023-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Versions prior to this didn't compile on OpenBSD due to unconditional use of the non-standard strtod_l() function. The fmt::MemoryWriter API has been removed in the intervening versions, so replace its use with fmt::memory_buffer and fmt::format_to. The library also no longer provides the fmt::fmt ALIAS, so define it in externals/CMakeLists.txt.
| * | | | | common: fix swap functions on Bitrig and OpenBSDDaniel Lim Wee Soong2018-04-021-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | swap{16,32,64} are defined as macros on the two, but client code tries to invoke them as Common::swap{16,32,64}, which naturally doesn't work. This hack redefines the macros as inline functions in the Common namespace: the bodies of the functions are the same as the original macros, but relying on OS-specific implementation details like this is of course brittle.
* | | | | | Merge pull request #305 from N00byKing/patch-2James Rowe2018-04-031-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | deconstructed_rom_directory.cpp: Fix Typo
| * | | | | | deconstructed_rom_directory.cpp: Fix TypoN00byKing2018-04-031-1/+1
|/ / / / / /
* | | | | | Merge pull request #66 from RiverCityRansomware/qtUpdatebunnei2018-04-021-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Updates CMakeLists to use Qt 5.10.0 instead of Qt 5.7
| * | | | | Update qtRiver City Ransomware2018-01-171-1/+1
| | | | | | | | | | | | | | | | | | Updates qt from 5.7 to 5.10.0, fixing some errors relating to setting the process dpi
* | | | | | Merge pull request #297 from bunnei/hid-touch-statebunnei2018-04-021-5/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | hid: Write empty touch screen state.
| * | | | | | hid: Write empty touch screen state.bunnei2018-04-011-5/+21
| | | | | | |
* | | | | | | Merge pull request #296 from bunnei/misc-mem-fsp-fixesbunnei2018-04-0210-16/+49
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix stack region, implement FSP GetSize/SetSize, and some stubs
| * | | | | | | hle_ipc, fsp_srv: Cleanup logging.bunnei2018-04-012-3/+3
| | | | | | | |
| * | | | | | | hid: Stub out GetSupportedNpadStyleSet.bunnei2018-03-311-0/+8
| | | | | | | |
| * | | | | | | hle_ipc: Do not ensure write buffer size.bunnei2018-03-311-2/+5
| | | | | | | |
| * | | | | | | fsp_srv: Implement GetSize and SetSize.bunnei2018-03-312-4/+24
| | | | | | | |
| * | | | | | | memory: Fix stack region.bunnei2018-03-316-10/+12
| |/ / / / / /
* | | | | | | Merge pull request #288 from Subv/macro_interpreterbunnei2018-04-025-121/+444
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Implemented a gpu macro interpreter
| * | | | | | GPU: Use the MacroInterpreter class to execute the GPU macros instead of HLEing them.Subv2018-04-012-121/+13
| | | | | | |
| * | | | | | GPU: Implemented a gpu macro interpreter.Subv2018-04-015-0/+431
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Ryujinx macro interpreter and envydis were used as reference. Macros are programs that are uploaded by the games during boot and can later be called by writing to their method id in a GPU command buffer.
* | | | | | | Merge pull request #293 from N00byKing/drkthmbunnei2018-03-3157-5/+1428
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Add Dark Theme (And Theming in General + Icon Theming)
| * | | | | | | Port citra-emu/citra#3610 to yuzuN00byKing2018-03-302-3/+7
| | | | | | | |
| * | | | | | | Remove whitespacesN00byKing2018-03-301-1/+1
| | | | | | | |
| * | | | | | | Add Dark theme, Icon themingN00byKing2018-03-3057-5/+1424
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | configure_general.ui: Add UI Option for Themes config.cpp: Save Theme Settings
* | | | | | | | Merge pull request #292 from bunnei/botw-progressbunnei2018-03-3011-11/+163
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | NFP, SVC, and AudRen progress
| * | | | | | | audren_u: Stub QueryAudioDeviceSystemEvent and GetActiveChannelCount.bunnei2018-03-301-8/+36
| | | | | | | |
| * | | | | | | svc: Stub GetThreadCoreMask.bunnei2018-03-302-3/+26
| | | | | | | |
| * | | | | | | service: Add NFP module interface.bunnei2018-03-308-0/+101
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | service: Initialize NFP service. Log: Add NFP service as a log subtype.
* | | | | | | Merge pull request #290 from MerryMage/dfix-20180329bunnei2018-03-291-0/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | dynarmic: Update to 9cc12d8
| * | | | | | | dynarmic: Update to 9cc12d8MerryMage2018-03-291-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 9cc12d8 abi: Missing includes ac35ad5 emit_x64_floating_point: Near jump instead of short jump in FPMinNumberic{32,64} 6f03fdd A64: system: Use an enum class for MRS/MSR register encodings
* | | | | | | | Merge pull request #289 from lioncash/self-assignbunnei2018-03-291-0/+3
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | result: Check against self-assignment in ResultVal's copy assignment operator
| * | | | | | | result: Check against self-assignment in ResultVal's copy assignment operatorLioncash2018-03-291-0/+3
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Avoids doing work that doesn't need to be done.
* | | | | | | Merge pull request #286 from N00byKing/citratoyuzuagainbunnei2018-03-281-5/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | main.h: Add pragma once, remove ifndef
| * | | | | | | main.h: Add pragma once, remove ifndefN00byKing2018-03-271-5/+2
| | | | | | | |
* | | | | | | | Merge pull request #285 from MerryMage/dfix-20180327bunnei2018-03-271-0/+0
|\ \ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | dynarmic: Update to 12a1020
| * | | | | | | dynarmic: Update to 12a1020MerryMage2018-03-271-0/+0
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 12a1020 emit_X64_floating_point: Near jmp to end instead of short jmp 6278f83 emit_x64_vector: Fix typo in VectorShuffleImpl 25a0204 A64: Implement REV64 aa92e33 bit_util: Do nothing in RotateRight if the rotation amount is zero e537985 A64: Implement REV32 (vector) f62a258 ir: Add IR opcodes for emitting vector shuffles 36ac6ec emit_x64_vector_floating_point: Fix out of bounds array access in EmitVectorOperation64 20a59a9 A64: Implement REV16 (vector) b2f7bb0 CMakeLists: Add fp_util, macro_util and math_util headers fd21b58 A64: Implement EOR3 and BCAX a48c0bb travis: Use yuzu's unicorn fork 59e62e0 externals: Update catch to v2.2.1
* | | | | | | Merge pull request #284 from bunnei/docked-configbunnei2018-03-279-61/+88
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Add config for "Docked" mode and various settings cleanup
| * | | | | | settings: Remove unused CpuCore class.bunnei2018-03-271-5/+0
| | | | | | |
| * | | | | | config: Use simplified checkbox (from Citra) for CPU JIT.bunnei2018-03-278-46/+33
| | | | | | |
| * | | | | | config: Rename is_docked to use_docked_mode to be consistent with other config bools.bunnei2018-03-277-14/+14
| | | | | | |
| * | | | | | configure_general: Cleanup naming.bunnei2018-03-271-14/+14
| | | | | | |
| * | | | | | qt: Add config option for is_docked.bunnei2018-03-272-0/+23
| | | | | | |
| * | | | | | config: Add setting for whether the system is docked or not.bunnei2018-03-275-2/+24
| | | | | | |
* | | | | | | Merge pull request #282 from N00byKing/patch-2bunnei2018-03-274-4/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Change comments from citra to yuzu
| * | | | | | log.h: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | | |
| * | | | | | file_util.h: Update Comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | | |
| * | | | | | cpu_detect.cpp: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| | | | | | |
| * | | | | | pre-commit: Change comment from citra to yuzuN00byKing2018-03-261-1/+1
| |/ / / / /
* | | | | | Merge pull request #279 from bunnei/tegra-progress-3bunnei2018-03-2720-446/+913
|\ \ \ \ \ \ | | | | | | | | | | | | | | Tegra progress 3
| * | | | | | renderer_opengl: Use better naming for DrawScreens and DrawSingleScreen.bunnei2018-03-272-8/+8
| | | | | | |
| * | | | | | graphics_surface: Remove superfluous cast.bunnei2018-03-271-2/+1
| | | | | | |
| * | | | | | gl_rasterizer: Move code to bind framebuffer surfaces before draw to its own function.bunnei2018-03-272-22/+31
| | | | | | |
| * | | | | | gl_rasterizer: Add a SyncViewport method.bunnei2018-03-273-18/+30
| | | | | | |
| * | | | | | gl_rasterizer: Move PrimitiveTopology check to MaxwellToGL.bunnei2018-03-272-11/+12
| | | | | | |
| * | | | | | graphics_surface: Fix merge conflicts.bunnei2018-03-272-3/+4
| | | | | | |
| * | | | | | gl_rasterizer: Use ReadBlock instead of GetPointer for SetupVertexArray.bunnei2018-03-271-1/+1
| | | | | | |
| * | | | | | gl_rasterizer: Normalize vertex array data as appropriate.bunnei2018-03-272-1/+5
| | | | | | |
| * | | | | | memory: Fix cast for ReadBlock/WriteBlock/ZeroBlock/CopyBlock.bunnei2018-03-271-4/+8
| | | | | | |
| * | | | | | maxwel_to_gl: Fix string formatting in log statements.bunnei2018-03-271-2/+2
| | | | | | |
| * | | | | | rasterizer: Rename DrawTriangles to DrawArrays.bunnei2018-03-273-5/+5
| | | | | | |
| * | | | | | gl_rasterizer: Use passthrough shader for SetupVertexShader.bunnei2018-03-271-1/+2
| | | | | | |
| * | | | | | renderer_opengl: Logging, etc. cleanup.bunnei2018-03-276-33/+34
| | | | | | |
| * | | | | | renderer_opengl: Remove framebuffer RasterizerFlushVirtualRegion hack.bunnei2018-03-271-5/+0
| | | | | | |
| * | | | | | gl_rasterizer_cache: Implement UpdatePagesCachedCount.bunnei2018-03-272-8/+37
| | | | | | |
| * | | | | | memory: Add RasterizerMarkRegionCached code and cleanup.bunnei2018-03-272-200/+195
| | | | | | |
| * | | | | | gl_rasterizer: Implement SetupVertexArray.bunnei2018-03-271-20/+38
| | | | | | |
| * | | | | | gl_rasterizer_cache: Fix an ASSERT_MSG.bunnei2018-03-271-1/+1
| | | | | | |
| * | | | | | maxwell_to_gl: Add module and function for decoding VertexType.bunnei2018-03-272-0/+41
| | | | | | |
| * | | | | | maxwell_3d: Use names that match envytools for VertexType.bunnei2018-03-271-8/+8
| | | | | | |
| * | | | | | maxwell_3d: Add VertexAttribute struct and cleanup.bunnei2018-03-271-121/+160
| | | | | | |
| * | | | | | gl_rasterizer: Use 32 texture units instead of 3.bunnei2018-03-273-2/+3
| | | | | | |
| * | | | | | gl_rasterizer: Implement DrawTriangles.bunnei2018-03-271-1/+194
| | | | | | |
| * | | | | | Maxwell3D: Call AccelerateDrawBatch on DrawArrays.bunnei2018-03-271-1/+8
| | | | | | |
| * | | | | | gl_rasterizer: Implement AnalyzeVertexArray.bunnei2018-03-272-1/+56
| | | | | | |
| * | | | | | gl_rasterizer_cache: MortonCopy Switch-style.bunnei2018-03-271-72/+32
| | | | | | |
| * | | | | | gl_rasterizer_cache: Implement GetFramebufferSurfaces.bunnei2018-03-272-4/+104
| | | | | | |
| * | | | | | maxwell: Add RenderTargetFormat enum.bunnei2018-03-272-4/+5
| | | | | | |
| * | | | | | renderer_opengl: Only draw the screen if a framebuffer is specified.bunnei2018-03-271-6/+7
|/ / / / / /
* | | | | | Merge pull request #283 from Subv/tscbunnei2018-03-273-25/+147
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Added sampler information structures (TSC)
| * | | | | | GPU: Load the sampler info (TSC) when retrieving active textures.Subv2018-03-262-21/+67
| | | | | | |
| * | | | | | GPU: Added the TSC structure. It contains information about the sampler.Subv2018-03-261-0/+50
| | | | | | |
| * | | | | | GPU: Added more fields to the TIC structure.Subv2018-03-261-4/+30
| |/ / / / /
* | | | | | Merge pull request #102 from N00byKing/masterbunnei2018-03-272-15/+47
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Implement Pull #3043 from citra: appveyor: Determine dlls to include in package programmatically
| * | | | | Implement Citra pull 3043N00byKing2018-02-242-15/+47
| | | | | |
* | | | | | Merge pull request #280 from bunnei/misc-service-fixesbunnei2018-03-255-8/+66
|\ \ \ \ \ \ | | | | | | | | | | | | | | Minor changes to VI, PL, HID, and AUDREN
| * | | | | | audren_u: Fix GetAudioDevice.bunnei2018-03-252-7/+48
| | | | | | |
| * | | | | | hid: Stub out SetNpadJoyAssignmentModeDual.bunnei2018-03-251-1/+7
| | | | | | |
| * | | | | | pl_u: Add RequestLoad.bunnei2018-03-252-0/+11
| | | | | | |
* | | | | | | Merge pull request #273 from Subv/texturesbunnei2018-03-2521-10/+1464
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Added code to unswizzle textures and ported the surface viewer from citra
| * | | | | | | GPU: Make the debug_context variable a member of the frontend instead of a global.Subv2018-03-257-19/+40
| | | | | | | |
| * | | | | | | GPU: Added a function to retrieve the active textures for a shader stage.Subv2018-03-242-50/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | TODO: A shader may not use all of these textures at the same time, shader analysis should be performed to determine which textures are actually sampled.
| * | | | | | | Frontend: Updated the surface view debug widget to work with Maxwell surfaces.Subv2018-03-243-19/+38
| | | | | | | |
| * | | | | | | Frontend: Allow opening the Surface View widget in the Qt frontend.Subv2018-03-242-0/+8
| | | | | | | |
| * | | | | | | GPU: Implement the Incoming/FinishedPrimitiveBatch debug breakpoints.Subv2018-03-241-0/+7
| | | | | | | |
| * | | | | | | GPU: Implement the MaxwellCommandLoaded/Processed debug breakpoints.Subv2018-03-241-0/+10
| | | | | | | |
| * | | | | | | Frontend: Ported the GPU breakpoints and surface viewer widgets from citra.Subv2018-03-2415-4/+1155
| | | | | | | |
| * | | | | | | GPU: Added a method to unswizzle a texture without decoding it.Subv2018-03-244-5/+95
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Allow unswizzling of DXT1 textures.
| * | | | | | | GPU: Preliminary work for texture decoding.Subv2018-03-245-0/+139
| |/ / / / / /
* | | | | | | Merge pull request #281 from mailwl/sockets-servicesbunnei2018-03-258-32/+96
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/sockets: add bsd:s, nsd:a, nsd:u services
| * | | | | | Service/sockets: add bsd:s, nsd:a, nsd:u servicesmailwl2018-03-258-32/+96
|/ / / / / /
* | | | | | Merge pull request #275 from MerryMage/addticks-dynarmicbunnei2018-03-241-7/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | arm_dynarmic: Fix timing
| * | | | | | arm_dynarmic: Fix timingMerryMage2018-03-241-7/+3
|/ / / / / /
* | | | | | Merge pull request #274 from Subv/viewport_regsbunnei2018-03-241-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Added viewport registers to Maxwell3D's reg structure.
| * | | | | | GPU: Added viewport registers to Maxwell3D's reg structure.Subv2018-03-241-1/+18
|/ / / / / /
* | | | | | Merge pull request #265 from bunnei/tegra-progress-2bunnei2018-03-2417-296/+591
|\ \ \ \ \ \ | | | | | | | | | | | | | | Tegra progress 2
| * | | | | | gl_rasterizer: Fake render in green, because it's cooler.bunnei2018-03-241-1/+1
| | | | | | |
| * | | | | | gl_rasterizer: Log warning instead of sync'ing unimplemented funcs.bunnei2018-03-241-7/+1
| | | | | | |
| * | | | | | gl_rasterizer_cache: Add missing include for vm_manager.bunnei2018-03-231-0/+1
| | | | | | |
| * | | | | | renderer_opengl: Only invalidate the framebuffer region, not flush.bunnei2018-03-231-4/+3
| | | | | | |
| * | | | | | renderer_opengl: Fixes for properly flushing & rendering the framebuffer.bunnei2018-03-232-12/+12
| | | | | | |
| * | | | | | memory: Fix typo in RasterizerFlushVirtualRegion.bunnei2018-03-231-3/+3
| | | | | | |
| * | | | | | RasterizerCacheOpenGL: FlushAll should flush full memory region.bunnei2018-03-231-1/+1
| | | | | | |
| * | | | | | memory: RasterizerFlushVirtualRegion should also check process image region.bunnei2018-03-231-0/+1
| | | | | | |
| * | | | | | rasterizer: Flush and invalidate regions should be 64-bit.bunnei2018-03-235-12/+12
| | | | | | |
| * | | | | | renderer_opengl: Add framebuffer_transform_flags member variable.bunnei2018-03-231-2/+2
| | | | | | |
| * | | | | | renderer_opengl: Better handling of framebuffer transform flags.bunnei2018-03-234-6/+23
| | | | | | |
| * | | | | | renderer_opengl: Use accelerated framebuffer load with LoadFBToScreenInfo.bunnei2018-03-231-31/+25
| | | | | | |
| * | | | | | nvdisp_disp0: Always flush and invalidate framebuffer region.bunnei2018-03-231-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - Workaround for texture forwarding until we have a better place.
| * | | | | | gl_rasterizer: Implement AccelerateDisplay method from Citra.bunnei2018-03-232-2/+44
| | | | | | |
| * | | | | | LoadGLBuffer: Use bytes_per_pixel, not bits.bunnei2018-03-231-1/+2
| | | | | | |
| * | | | | | memory: Port RasterizerFlushVirtualRegion from Citra.bunnei2018-03-232-1/+58
| | | | | | |
| * | | | | | gl_rasterizer_cache: LoadGLBuffer should do a morton copy.bunnei2018-03-231-16/+5
| | | | | | |
| * | | | | | video_core: Move MortonCopyPixels128 to utils header.bunnei2018-03-232-111/+113
| | | | | | |
| * | | | | | video_core: Remove usage of PAddr and replace with VAddr.bunnei2018-03-235-39/+39
| | | | | | |
| * | | | | | video_core: Move FramebufferInfo to FramebufferConfig in GPU.bunnei2018-03-238-69/+77
| | | | | | |
| * | | | | | gl_rasterizer: Replace a bunch of UNIMPLEMENTED with ASSERT.bunnei2018-03-232-20/+20
| | | | | | |
| * | | | | | gl_rasterizer: Add a simple passthrough shader in lieu of shader generation.bunnei2018-03-232-5/+68
| | | | | | |
| * | | | | | gpu: Expose Maxwell3D engine.bunnei2018-03-231-0/+4
| | | | | | |
| * | | | | | maxwell_3d: Add some format decodings and string helper functions.bunnei2018-03-231-3/+107
| | | | | | |
| * | | | | | renderer: Create rasterizer and cleanup.bunnei2018-03-234-4/+16
| | | | | | |
* | | | | | | Merge pull request #255 from Subv/sd_cardbunnei2018-03-2412-48/+329
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | FS: Implemented access to the SD card
| * | | | | | | FS: Move the file open mode calculation to a separate function.Subv2018-03-231-7/+14
| | | | | | | |
| * | | | | | | FS: Implemented IFileSystem::CreateDirectory.Subv2018-03-216-7/+29
| | | | | | | |
| * | | | | | | FS: Implemented IFileSystem's OpenDirectory function.Subv2018-03-201-0/+28
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Note that the filter parameter is not yet implemented.
| * | | | | | | FS: Added the IDirectory IPC interface and implemented its two functions.Subv2018-03-201-0/+51
| | | | | | | |
| * | | | | | | FS: Implement DiskFileSystem's OpenDirectory interface.Subv2018-03-205-6/+19
| | | | | | | |
| * | | | | | | FS: Implement DiskFileSystem::GetEntryType for existing files/directories.Subv2018-03-201-2/+4
| | | | | | | |
| * | | | | | | FS: Updated the Directory Entry structure to match the Switch.Subv2018-03-205-30/+84
| | | | | | | |
| * | | | | | | FS: Support the file Append open mode.Subv2018-03-202-2/+23
| | | | | | | |
| * | | | | | | FS: Implement MountSdCard.Subv2018-03-201-2/+6
| | | | | | | |
| * | | | | | | FS: Added an SDMC archive factory and registered it to the SDMC archive on startup.Subv2018-03-205-0/+79
| | | | | | | |
* | | | | | | | Merge pull request #268 from mailwl/sslbunnei2018-03-236-0/+45
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Service/SSL: add ssl service
| * | | | | | | | Service/SSL: add ssl servicemailwl2018-03-236-0/+45
| | |_|_|_|/ / / | |/| | | | | |
* | | | | | | | Merge pull request #270 from N00byKing/patch-2bunnei2018-03-231-4/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Remove Option for N/3DS from default.ini
| * | | | | | | | Remove Option for N/3DS from default.iniN00byKing2018-03-231-4/+0
| |/ / / / / / /
* | | | | | | | Merge pull request #269 from N00byKing/icontoyuzubunnei2018-03-231-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | CITRA_ICON -> YUZU_ICON
| * | | | | | | CITRA_ICON -> YUZU_ICONN00byKing2018-03-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #264 from valentinvanelslande/cmd-dynarmicbunnei2018-03-232-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | yuzu_cmd: change default cpu core to dynarmic
| * | | | | | | yuzu_cmd: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
| | | | | | | |
| * | | | | | | default_ini: change default cpu core to dynarmicValentin Vanelslande2018-03-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #263 from N00byKing/non3dsbunnei2018-03-222-20/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove more N3DS References
| * | | | | | | Remove more N3DS ReferencesN00byKing2018-03-222-20/+0
|/ / / / / / /
* | | | | | | Merge pull request #261 from mailwl/splbunnei2018-03-2210-0/+176
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Service/spl: add module and services
| * | | | | | Service/spl: add module and servicesmailwl2018-03-2210-0/+176
|/ / / / / /
* | | | | | Merge pull request #258 from Subv/gpu_attribsbunnei2018-03-221-3/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Added vertex attrib format and triangle topology registers
| * | | | | | GPU: Added vertex attribute format registers.Subv2018-03-211-1/+14
| | | | | | |
| * | | | | | GPU: Added registers for the number of vertices to render.Subv2018-03-211-2/+13
| | | | | | |
* | | | | | | Merge pull request #260 from N00byKing/3535bunnei2018-03-214-36/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Implement Pull #3535 from citra: CMake: Set EMU_ARCH_BITS in CMakeLists.txt
| * | | | | | | CMake: Set EMU_ARCH_BITS in CMakeLists.txtN00byKing2018-03-214-36/+3
| | | | | | | |
* | | | | | | | Merge pull request #259 from N00byKing/usehttpsbunnei2018-03-211-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Use HTTPS for lz4
| * | | | | | | Use HTTPS for Submodule lz4N00byKing2018-03-211-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #257 from mailwl/vi-modulebunnei2018-03-218-212/+160
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/vi: convert services to module
| * | | | | | Service/vi: convert services to modulemailwl2018-03-218-212/+160
|/ / / / / /
* | | | | | Merge pull request #254 from bunnei/port-citra-rendererbunnei2018-03-2122-1172/+24167
|\ \ \ \ \ \ | | | | | | | | | | | | | | Port Citra OpenGL rasterizer code
| * | | | | | renderer_gl: Port boilerplate rasterizer code over from Citra.bunnei2018-03-205-1/+495
| | | | | | |
| * | | | | | gl_shader_util: Sync latest version with Citra.bunnei2018-03-203-46/+116
| | | | | | |
| * | | | | | renderer_gl: Port over gl_shader_gen module from Citra.bunnei2018-03-203-0/+88
| | | | | | |
| * | | | | | renderer_gl: Port over gl_shader_decompiler module from Citra.bunnei2018-03-203-0/+87
| | | | | | |
| * | | | | | renderer_gl: Port over gl_rasterizer_cache module from Citra.bunnei2018-03-203-0/+1714
| | | | | | |
| * | | | | | gl_resource_manager: Sync latest version with Citra.bunnei2018-03-201-8/+77
| | | | | | |
| * | | | | | renderer_gl: Port over gl_stream_buffer module from Citra.bunnei2018-03-203-0/+218
| | | | | | |
| * | | | | | externals: Update Glad to latest version used by Citra.bunnei2018-03-204-1071/+21262
| | | | | | |
| * | | | | | gl_state: Sync latest version with Citra.bunnei2018-03-202-47/+111
| | | | | | |
* | | | | | | Merge pull request #256 from mailwl/fatalbunnei2018-03-2010-0/+146
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Service: add fatal:u, fatal:p services
| * | | | | | | Service: add fatal:u, fatal:p servicesmailwl2018-03-2010-0/+146
|/ / / / / / /
* | | | | | | Merge pull request #253 from Subv/rt_depthMat M2018-03-201-1/+48
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Added registers for color and Z buffers.
| * | | | | | GPU: Added Z buffer registers to Maxwell3D's reg structure.Subv2018-03-191-1/+17
| | | | | | |
| * | | | | | GPU: Added the render target (RT) registers to Maxwell3D's reg structure.Subv2018-03-191-1/+32
| |/ / / / /
* | | | | | Merge pull request #252 from N00byKing/3064bunnei2018-03-1915-27/+29
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Implement Pull #3064 from citra: Clean all format warnings (Yuzu-specific format warnings cleared too)
| * | | | | Clang FixesN00byKing2018-03-195-9/+11
| | | | | |
| * | | | | oopsN00byKing2018-03-191-3/+3
| | | | | |
| * | | | | More Warning cleanupsN00byKing2018-03-193-3/+3
| | | | | |
| * | | | | Clean Warnings (?)N00byKing2018-03-1915-20/+20
|/ / / / /
* | | | | Merge pull request #251 from Subv/tic_tscbunnei2018-03-191-1/+30
|\ \ \ \ \ | | | | | | | | | | | | GPU: Added TIC and TSC registers to the Maxwell3D register structure.
| * | | | | GPU: Added the TSC registers to the Maxwell3D register structure.Subv2018-03-191-1/+15
| | | | | |
| * | | | | GPU: Added the TIC registers to the Maxwell3D register structure.Subv2018-03-191-1/+16
|/ / / / /
* | | | | Merge pull request #193 from N00byKing/3184_2_robotic_boogaloobunnei2018-03-197-41/+41
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3184 from citra: core/arm: Improve timing accuracy before service calls in JIT (Rebased)
| * | | | | Implements citra-emu/citra#3184N00byKing2018-02-257-41/+41
| | | | | |
* | | | | | Merge pull request #250 from bunnei/buffer-dequeue-waitbunnei2018-03-1910-51/+128
|\ \ \ \ \ \ | | | | | | | | | | | | | | vi: TransactParcel DequeueBuffer should wait current thread
| * | | | | | vi: Remove DequeueBuffer and wait until next available buffer.bunnei2018-03-193-12/+49
| | | | | | |
| * | | | | | hle_ipc: Add SleepClientThread to block current thread within HLE routines.bunnei2018-03-192-0/+47
| | | | | | |
| * | | | | | hle_ipc: Use shared_ptr instead of unique_ptr to allow copies.bunnei2018-03-192-9/+9
| | | | | | |
| * | | | | | hle_ipc: Remove GetPointer(..) usage with WriteToOutgoingCommandBuffer.bunnei2018-03-193-7/+14
| | | | | | |
| * | | | | | thread: Add THREADSTATUS_WAIT_HLE_EVENT, remove THREADSTATUS_WAIT_ARB.bunnei2018-03-194-23/+9
| | | | | | |
* | | | | | | Merge pull request #249 from Subv/macro_E1Abunnei2018-03-192-1/+29
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.
| * | | | | | GPU: Implement macro 0xE1A BindTextureInfoBuffer in HLE.Subv2018-03-192-1/+29
|/ / / / / / | | | | | | | | | | | | | | | | | | This macro simply sets the current CB_ADDRESS to the texture buffer address for the input shader stage.
* | | | | | Merge pull request #248 from Subv/cb_databunnei2018-03-195-11/+105
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Handle writes to the CB_DATA method.
| * | | | | | GPU: Implement the BindStorageBuffer macro method in HLE.Subv2018-03-182-1/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This macro binds the SSBO Info Buffer as the current ConstBuffer. This buffer is usually bound to c0 during shader execution. Games seem to use this macro instead of directly writing the address for some reason.
| * | | | | | GPU: Handle writes to the CB_DATA method.Subv2018-03-182-0/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Writing to this method will cause the written value to be stored in the currently-set ConstBuffer plus CB_POS. This method is usually used to upload uniforms or other shader-visible data.
| * | | | | | GPU: Move the GPU's class constructor and destructors to a cpp file.Subv2018-03-183-10/+30
|/ / / / / / | | | | | | | | | | | | | | | | | | This should reduce recompile times when editing the Maxwell3D register structure.
* | | | | | Merge pull request #246 from Subv/gpu_macro_callsSebastian Valle2018-03-188-80/+119
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Store uploaded GPU macros and keep track of the number of method arguments.
| * | | | | | GPU: Store uploaded GPU macros and keep track of the number of method parameters.Subv2018-03-184-27/+74
| | | | | | |
| * | | | | | GPU: Macros are specific to the Maxwell3D engine, so handle them internally.Subv2018-03-188-63/+55
|/ / / / / /
* | | | | | Merge pull request #245 from Subv/set_shader2bunnei2018-03-182-23/+115
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Store shader constbuffer bindings in the GPU state.
| * | | | | | GPU: Renamed ShaderType to ShaderStage as that is less confusing.Subv2018-03-182-19/+19
| | | | | | |
| * | | | | | GPU: Store shader constbuffer bindings in the GPU state.Subv2018-03-182-5/+61
| | | | | | |
| * | | | | | GPU: Corrected some register offsets and removed superfluous macro registers.Subv2018-03-181-9/+3
| | | | | | |
| * | | | | | GPU: Make the SetShader macro call do the same as the real macro's code.Subv2018-03-182-3/+44
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It'll now set the CB_SIZE, CB_ADDRESS and CB_BIND registers when it's called. Presumably this SetShader function is binding the constant shader uniforms to buffer 1 (c1[]).
| * | | | | | GPU: Corrected the parameter documentation for the SetShader macro call.Subv2018-03-172-11/+12
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Register 0xE24 is actually a macro that sets some shader parameters in the register structure. Macros are uploaded to the GPU at startup and have their own ISA, we'll probably write an interpreter for this in the future.
* | | | | | Merge pull request #242 from Subv/set_shaderbunnei2018-03-172-4/+38
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.
| * | | | | | GPU: Handle the SetShader method call (0xE24) and store the shader config.Subv2018-03-172-4/+38
| | | | | | |
* | | | | | | Merge pull request #243 from Subv/vertex_bufferbunnei2018-03-171-2/+33
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | GPU: Added the vertex array registers.
| * | | | | | GPU: Added the vertex array registers.Subv2018-03-171-2/+33
|/ / / / / /
* | | | | | Merge pull request #241 from Subv/gpu_method_callbunnei2018-03-179-8/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands
| * | | | | | GPU: Process command mode 5 (IncreaseOnce) differently from other commands.Subv2018-03-179-8/+97
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Accumulate all arguments before calling the desired method. Note: Maybe we should do the same for the NonIncreasing mode?
* | | | | | | Merge pull request #239 from Subv/shadersbunnei2018-03-172-2/+63
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | GPU: Added some shader-related registers.
| * | | | | | | GPU: Assert that we get a 0 CODE_ADDRESS register in the 3D engine.Subv2018-03-171-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Shader address calculation depends on this value to some extent, we do not currently know what it being 0 entails.
| * | | | | | | GPU: Added Maxwell registers for Shader Program control.Subv2018-03-171-2/+55
| |/ / / / / /
* | | | | | | Merge pull request #238 from bunnei/fix-buffer-checkbunnei2018-03-171-3/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | nvflinger: Remove superfluous buffer format check.
| * | | | | | | nvflinger: Remove superfluous buffer format check.bunnei2018-03-171-3/+1
|/ / / / / / /
* | | | | | | Merge pull request #232 from bunnei/heap-fixesbunnei2018-03-1715-82/+110
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Various heap fixes for libtransistor
| * | | | | | | process: MirrorMemory should use MemoryState::Mapped.bunnei2018-03-171-1/+1
| | | | | | | |
| * | | | | | | process: Unmap previously allocated heap.bunnei2018-03-161-1/+3
| | | | | | | |
| * | | | | | | arm_interface: Support unmapping previously mapped memory.bunnei2018-03-166-2/+18
| | | | | | | |
| * | | | | | | svc: Use more correct values for GetInfo MapRegion and NewMapRegion.bunnei2018-03-163-29/+5
| | | | | | | |
| * | | | | | | kernel: Move stack region outside of application heap.bunnei2018-03-166-11/+6
| | | | | | | |
| * | | | | | | memory: Add regions for map region, "new" map region, etc.bunnei2018-03-161-19/+29
| | | | | | | |
| * | | | | | | process: Fix stack memory state.bunnei2018-03-161-2/+4
| | | | | | | |
| * | | | | | | MemoryState: Add additional memory states and improve naming.bunnei2018-03-165-18/+45
|/ / / / / / /
* | | | | | | Merge pull request #237 from mailwl/nifm-modulebunnei2018-03-168-125/+84
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/NIFM: convert to module
| * | | | | | IGeneralService: fix function listmailwl2018-03-161-2/+3
| | | | | | |
| * | | | | | Service/NIFM: stub cancel functionmailwl2018-03-161-1/+6
| | | | | | |
| * | | | | | Service/NIFM: convert to modulemailwl2018-03-168-122/+75
|/ / / / / /
* | | | | | Merge pull request #236 from bunnei/refactor-process-creationbunnei2018-03-1522-72/+87
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Move process creation out of global state.
| * | | | | | core: Move process creation out of global state.bunnei2018-03-1422-72/+87
|/ / / / / /
* | | | | | Merge pull request #213 from Hexagon12/dynarmic-defaultbunnei2018-03-081-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Make Dynarmic the default CPU core
| * | | | | | pls, that was easyHexagon122018-02-141-1/+1
| |/ / / / /
* | | | | | Merge pull request #230 from Subv/gpu_drawbunnei2018-03-052-1/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU: Intercept writes to the VERTEX_END_GL register.
| * | | | | | GPU: Intercept writes to the VERTEX_END_GL register.Subv2018-03-052-1/+18
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the register that gets written after a game calls DrawArrays(). We should collect all GPU state and draw using our graphics API here.
* | | | | | Merge pull request #229 from Subv/ensuresavedata_implbunnei2018-03-0412-43/+91
|\ \ \ \ \ \ | | | | | | | | | | | | | | FS: Make EnsureSaveData create the save data if it doesn't already exist.
| * | | | | | FS: Use the correct error code when trying to open files that don't exist.Subv2018-03-042-26/+6
| | | | | | |
| * | | | | | FS: Stubbed CreateSaveData. It currently does nothing.Subv2018-03-042-0/+15
| | | | | | |
| * | | | | | FS: Make EnsureSaveData create the savedata folder when called for the first time.Subv2018-03-048-17/+70
| | | | | | |
* | | | | | | Merge pull request #228 from Subv/unschedule_eventsbunnei2018-03-043-2/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed
| * | | | | | CoreTiming: Unschedule the pending events when an Interface is destroyed.Subv2018-03-043-2/+10
|/ / / / / /
* | | | | | Merge pull request #226 from Subv/buffer_queue_eventbunnei2018-03-031-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called
| * | | | | | Vi: Signal the BufferQueue's Native Handle right after ReleaseBuffer is called.Subv2018-03-031-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents a thread starvation issue in Puyo Puyo Tetris. We should hwtest this behavior and figure out where exactly this event is signaled.
* | | | | | | Merge pull request #225 from mailwl/settingsbunnei2018-03-0312-10/+348
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Service/Set: add more services
| * | | | | | Service/Set: add more servicesmailwl2018-03-0312-10/+348
|/ / / / / /
* | | | | | Merge pull request #216 from Subv/savedatabunnei2018-03-0222-44/+546
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implemented the SaveData archive and MountSaveData.
| * | | | | | SaveData: Use the current titleid when opening the savedata archive.Subv2018-03-021-2/+3
| | | | | | |
| * | | | | | Kernel: Store the program id in the Process class instead of the CodeSet class.Subv2018-03-029-26/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | There may be many CodeSets per Process, so it's wasteful and overcomplicated to store the program id in each of them.
| * | | | | | FS: Implement MountSaveData and some of the IFile interface.Subv2018-03-022-0/+189
| | | | | | |
| * | | | | | Filesystem: Added a SaveData Factory and associated Disk_FileSystem.Subv2018-03-0210-16/+329
| | | | | | |
| * | | | | | ResultCode: Mark any error code that isn't 0 as an error.Subv2018-02-271-2/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #224 from Armada651/clear-processbunnei2018-02-281-1/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | thread: Clear the process list on shutdown.
| * | | | | thread: Clear the process list on shutdown.Jules Blok2018-02-271-1/+3
|/ / / / /
* | | | | Removes the use of QKeySequence::Cancel (#186)Vishal Sharma2018-02-271-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removes the use of QKeySequence::Cancel to remove issues while running make * Corrects characters in a line for travis failure * Corrects space in a line for travis failure
* | | | | Merge pull request #207 from mailwl/duplicatesessionbunnei2018-02-273-6/+12
|\ \ \ \ \ | |_|_|_|/ |/| | | | IPC: add domain header to response if only it exists in request
| * | | | Add warning if Domain request has no domain message headermailwl2018-02-201-0/+3
| | | | |
| * | | | Fix: change check for domain order and existance of domain message headermailwl2018-02-203-3/+4
| | | | |
| * | | | IPC: add domain header to response if only it exists in requestmailwl2018-02-203-6/+8
| | | | |
* | | | | Merge pull request #215 from N00byKing/umapsharedmmrybunnei2018-02-262-1/+17
|\ \ \ \ \ | | | | | | | | | | | | UnmapSharedMemory
| * | | | | (Hopefully) Fix MinGW BuildN00byKing2018-02-251-1/+1
| | | | | |
| * | | | | Add UnmapSharedMemoryN00byKing2018-02-252-1/+17
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | C++11 requires spaces on the Identifier Add inttypes include clang
* | | | | | Merge pull request #222 from shinyquagsire23/npdm-parsingbunnei2018-02-267-9/+294
|\ \ \ \ \ \ | | | | | | | | | | | | | | NPDM Parsing
| * | | | | | file_sys: Style tweaksshinyquagsire232018-02-262-11/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Asdf
| * | | | | | loader: Check error on NPDM load, use TID for CodeSetshinyquagsire232018-02-253-6/+10
| | | | | | |
| * | | | | | loader: Use NPDM information when loading NSOsshinyquagsire232018-02-252-4/+15
| | | | | | |
| * | | | | | file_sys: Add support for parsing NPDM filesshinyquagsire232018-02-253-0/+276
|/ / / / / /
* | | | | | Merge pull request #212 from mailwl/stubsbunnei2018-02-2410-9/+112
|\ \ \ \ \ \ | | | | | | | | | | | | | | Stub some functions
| * | | | | | Stub more functionsmailwl2018-02-227-8/+90
| | | | | | |
| * | | | | | Stub am::SetScreenShotPermission, and bsd::StartMonitoring functionsmailwl2018-02-225-1/+22
| |/ / / / /
* | | | | | Merge pull request #217 from shinyquagsire23/time-s-missingbunnei2018-02-231-0/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | time: Add missing time:s functions, used for libnx
| * | | | | | time: Add missing time:s functions, used for libnxshinyquagsire232018-02-231-0/+4
| |/ / / / /
* | | | | | Merge pull request #210 from MerryMage/f/dynarmic/sysregbunnei2018-02-233-2/+33
|\ \ \ \ \ \ | |/ / / / / |/| | | | | arm_dynarmic: Implement system registers and provide more hooks
| * | | | | dynarmic: Update to 6b4c6b0MerryMage2018-02-212-2/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 6b4c6b0 impl: Update PC when raising exception 7a1313a A64: Implement FDIV (vector) b2d781d system: Raise exception for YIELD, WFE, WFI, SEV, SEVL b277bf5 Correct FPSR and FPCR 7673933 A64: Implement USHL 8d0e558 A64: Implement UCVTF (vector, integer), scalar variant da9a4f8 A64: Partially implement FCVTZU (scalar, fixed-point) and FCVTZS (scalar, fixed-point) 7479684 A64: Implement system register TPIDR_EL0 0fd75fd A64: Implement system registers FPCR and FPSR 31e370c A64: Implement system register CNTPCT_EL0 9a88fd3 A64: Implement system register CTR_EL0 1d16896 A64: Implement NEG (vector) 3184edf IR: Add IR instruction ZeroVector 31f8fbc emit_x64_floating_point: Add maybe_unused to preprocess parameter 567eb1a A64: Implement FMINNM (scalar) c6d8fa1 A64: Implement FMAXNM (scalar) 616056d constant_pool: Add frame parameter a3747cb A64: Implement ADDP (scalar) 5cd5d9f reg_alloc: Only exchange GPRs dd0452a A64: Implement DUP (element), scalar variant e5732ea emit_x64_floating_point: Correct FP{Max,Min}{32,64} implementations for -0/+0 40eb9c3 A64: Implement FMAX (scalar), FMIN (scalar) 7cef39b fuzz_with_unicorn: QEMU's implementation of FCVT is incorrect 826dce2 travis: Switch unicorn repository 9605f28 a64/config: Allow NaN emulation accuracy to be set e9435bc a64_emit_x64: Add conf to A64EmitContext 30b596d fuzz_with_unicorn: Explicitly test floating point instructions be292a8 A64: Implement FSQRT (scalar) 3c42d48 backend_x64: Accurately handle NaNs 4aefed0 fuzz_with_unicorn: Print AArch64 disassembly
| * | | | | arm_dynarmic: LOG_INFO on unicorn fallbackMerryMage2018-02-211-0/+4
| | | | | |
| * | | | | memory: LOG_ERROR when falling off end of page tableMerryMage2018-02-211-0/+11
| |/ / / /
* | | | | Merge pull request #211 from shinyquagsire23/time_localbunnei2018-02-223-0/+9
|\ \ \ \ \ | | | | | | | | | | | | time: Add GetStandardLocalSystemClock, used by libnx
| * | | | | time: Add GetStandardLocalSystemClock, used by libnxshinyquagsire232018-02-223-0/+9
| |/ / / /
* | | | | Merge pull request #209 from MerryMage/f/scheduler-shutdownbunnei2018-02-221-5/+9
|\ \ \ \ \ | |/ / / / |/| | | | core: Fix scheduler-shutdown related crash
| * | | | core: Fix scheduler-shutdown related crashMerryMage2018-02-211-5/+9
|/ / / /
* | | | Merge pull request #206 from mailwl/aoc-listaddoncontentbunnei2018-02-204-2/+28
|\ \ \ \ | | | | | | | | | | Service/AOC: stub ListAddOnContent function
| * | | | Service/AOC: stub ListAddOnContent functionmailwl2018-02-204-2/+28
| | | | |
* | | | | Merge pull request #205 from bunnei/more-puyo-stubsbunnei2018-02-2010-1/+113
|\ \ \ \ \ | |/ / / / |/| | | | Stub several friend:a and acc:u0 service functions
| * | | | acc_u0: Stub ListOpenUsers service function.bunnei2018-02-192-1/+11
| | | | |
| * | | | service: Add Friend service interface.bunnei2018-02-196-0/+100
| | | | |
| * | | | logging: Add category for Friend service.bunnei2018-02-192-0/+2
|/ / / /
* | | | Merge pull request #202 from bunnei/scheduler-cleanupbunnei2018-02-1911-379/+239
|\ \ \ \ | | | | | | | | | | Scheduler cleanup
| * | | | scheduler: Cleanup based on PR feedback.bunnei2018-02-193-5/+4
| | | | |
| * | | | kernel: Use Scheduler class for threading.bunnei2018-02-186-174/+26
| | | | |
| * | | | kernel: Add Scheduler, which encapsulates the scheduling loading from Thread module.bunnei2018-02-183-0/+210
| | | | |
| * | | | core: Use shared_ptr for cpu_core.bunnei2018-02-182-6/+4
| | | | |
| * | | | kernel: Remove unused address_arbiter code.bunnei2018-02-185-199/+0
| | | | |
* | | | | Merge pull request #203 from Subv/ensure_save_databunnei2018-02-191-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | AM: Corrected the response in EnsureSaveData.
| * | | | AM: Corrected the response in EnsureSaveData.Subv2018-02-191-1/+2
|/ / / / | | | | | | | | | | | | | | | | The values are still unknown and the function is still considered a stub. Puyo Puyo Tetris now tries to call fsp-srv:MountSaveData.
* | | | Merge pull request #198 from N00byKing/clangbunnei2018-02-184-9/+18
|\ \ \ \ | | | | | | | | | | Use Docker for Build Target clang-format for travis.
| * | | | Update build.shN00byKing2018-02-181-1/+1
| | | | |
| * | | | Use Docker for Build Target clang-format for travis.N00byKing2018-02-164-9/+18
| | | | | | | | | | | | | | | | | | | | This uses the (apparently) more stable Ubuntu Repo instead of the LLVM one.
* | | | | Merge pull request #201 from Subv/ipc_delay_bunnei2018-02-184-50/+63
|\ \ \ \ \ | | | | | | | | | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.
| * | | | | Kernel/IPC: Add a small delay after each SyncRequest to prevent thread starvation.Subv2018-02-184-50/+63
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Ported from citra PR #3091 The delay specified here is from a Nintendo 3DS, and should be measured in a Nintendo Switch. This change is enough to prevent Puyo Puyo Tetris's main thread starvation.
* | | | | | Merge pull request #200 from Subv/bufferproducerfencebunnei2018-02-185-28/+68
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Make the fence handling in Vi a little less of a hack.
| * | | | | nvmap: Make IocFromId return the same existing handle instead of creating a new one.Subv2018-02-171-5/+2
| | | | | | | | | | | | | | | | | | | | | | | | Games like Puyo Puyo Tetris and BOTW seem to depend on the buffer always having the same handle
| * | | | | Parcel: Ensure we don't read past the end of the parcels in Vi.Subv2018-02-171-0/+5
| | | | | |
| * | | | | Vi: Mark all fences as NO_FENCE in the DequeueBuffer response parcel.Subv2018-02-171-2/+2
| | | | | |
| * | | | | Vi: Always write the IGBPBuffer in the RequestBuffer response parcel.Subv2018-02-171-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | This may break libnx homebrew due to a bug in libnx but is required by official games since they always assume that the buffer will be there.
| * | | | | nvhost-ctrl: Stub NVHOST_IOCTL_CTRL_EVENT_WAIT.Subv2018-02-152-0/+25
| | | | | |
| * | | | | Vi: Mark the fences as valid in the DequeueBuffer response parcel.Subv2018-02-151-0/+3
| | | | | |
| * | | | | Vi: Added a missing u32 in the DequeueBuffer response parcel.Subv2018-02-151-0/+1
| | | | | |
| * | | | | Vi: Don't write the IGBPBuffer in the IGBPRequestBufferResponseParcel.Subv2018-02-151-4/+2
| | | | | |
| * | | | | Vi: Properly write the BufferProducerFence object in the DequeueBuffer response parcel.Subv2018-02-152-18/+28
| | | | | |
* | | | | | Merge pull request #199 from FernandoS27/update_dynarmicbunnei2018-02-171-0/+0
|\ \ \ \ \ \ | | | | | | | | | | | | | | Updated Dynarmic
| * | | | | | updated dynarmicFernandoS272018-02-171-0/+0
|/ / / / / /
* | | | | | Merge pull request #197 from mailwl/hidbunnei2018-02-174-1/+98
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Service/hid: stub some functions
| * | | | | Service/hid: stub some functionsmailwl2018-02-164-1/+98
|/ / / / /
* | | | | Merge pull request #195 from bunnei/shared-fontbunnei2018-02-1510-13/+199
|\ \ \ \ \ | |/ / / / |/| | | | pl_u: Add basic support for shared fonts.
| * | | | shared_memory: Remove some checks.bunnei2018-02-151-13/+0
| | | | |
| * | | | pl_u: Implement basic shared font loading from RAM dump.bunnei2018-02-156-0/+182
| | | | |
| * | | | log: Add logging category for NS services.bunnei2018-02-152-0/+2
| | | | |
| * | | | hid: Stub GetVibrationDeviceInfo and SendVibrationValues.bunnei2018-02-151-0/+15
|/ / / /
* | | | Merge pull request #188 from bunnei/refactor-buffer-descriptorbunnei2018-02-1511-108/+102
|\ \ \ \ | | | | | | | | | | Refactor IPC buffer descriptor interface
| * | | | hle_ipc: Remove const from WriteBuffer size.bunnei2018-02-142-2/+2
| | | | |
| * | | | hle_ipc: Add GetReadBufferSize and check write buffer size.bunnei2018-02-142-0/+10
| | | | |
| * | | | service: Remove remaining uses of BufferDescriptor*.bunnei2018-02-145-14/+8
| | | | |
| * | | | audio: Use WriteBuffer instead of BufferDescriptorB.bunnei2018-02-142-9/+3
| | | | |
| * | | | vi: Eliminate direct usage of BufferDescriptorB.bunnei2018-02-141-14/+3
| | | | |
| * | | | nvdrv: Use ReadBuffer/WriteBuffer functions for Ioctl.bunnei2018-02-141-17/+5
| | | | |
| * | | | vi: Use ReadBuffer/WriteBuffer functions for TransactParcel.bunnei2018-02-141-44/+19
| | | | |
| * | | | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-141-4/+2
| | | | |
| * | | | hle_ipc: Add helper functions for reading and writing buffers.bunnei2018-02-143-0/+55
| | | | |
| * | | | vi: Fix TransactParcelAuto to support both buffer formats.bunnei2018-02-141-25/+16
| | | | |
* | | | | Merge pull request #192 from jroweboy/fix-fpsbunnei2018-02-141-0/+2
|\ \ \ \ \ | |_|/ / / |/| | | | Fix fps counter to correctly measure frame end when there was no frame to draw
| * | | | Fix fps counter to correctly measure frame end when there was no frame to drawJames Rowe2018-02-141-0/+2
|/ / / /
* | | | Merge pull request #190 from bunnei/fix-qt-waittreebunnei2018-02-141-1/+1
|\ \ \ \ | | | | | | | | | | debugger: Fix wait_tree crash.
| * | | | debugger: Fix wait_tree crash.bunnei2018-02-141-1/+1
| |/ / /
* | | | Merge pull request #191 from lioncash/logbunnei2018-02-1412-57/+82
|\ \ \ \ | | | | | | | | | | core: Silence formatting specifier warnings
| * | | | memory: Silence formatting sepecifier warningsLioncash2018-02-141-21/+30
| | | | |
| * | | | nso: Silence formatting specifier warningsLioncash2018-02-141-2/+4
| | | | |
| * | | | deconstructed_rom_directory: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| | | | |
| * | | | nvdrv/interface: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| | | | |
| * | | | nvmap: Silence formatting specifier warningsLioncash2018-02-141-1/+2
| | | | |
| * | | | nvhost_gpu: Silence formatting specifier warningsLioncash2018-02-141-6/+8
| | | | |
| * | | | nvhost_ctrl: Silence formatting specifier warningsLioncash2018-02-141-2/+2
| | | | |
| * | | | nvhost_ctrl_gpu: Silence formatting specifier warningsLioncash2018-02-141-3/+4
| | | | |
| * | | | nvhost_as_gpu: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| | | | |
| * | | | thread: Silence formatting specifier warningsLioncash2018-02-141-2/+3
| | | | |
| * | | | vm_manager: Silence formatting specifier warningsLioncash2018-02-141-5/+7
| | | | |
| * | | | gdbstub: Silence formatting specifier warningsLioncash2018-02-141-6/+9
| |/ / /
* | | | Merge pull request #189 from lioncash/miscbunnei2018-02-141-1/+1
|\ \ \ \ | |/ / / |/| | | maxwell_3d: Make constructor explicit
| * | | maxwell_3d: Make constructor explicitLioncash2018-02-141-1/+1
|/ / /
* | | Merge pull request #187 from Subv/maxwell3d_querybunnei2018-02-143-3/+95
|\ \ \ | | | | | | | | GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.
| * | | GPU: Partially implemented the QUERY_* registers in the Maxwell3D engine.Subv2018-02-123-3/+95
| | | | | | | | | | | | | | | | Only QueryMode::Write is supported at the moment.
* | | | audren_u: Schedule reoccuring event. (#183)bunnei2018-02-142-6/+36
| | | | | | | | | | | | | | | | | | | | | | | | * audren_u: Schedule reoccuring event. * audren_u: Stub GetAudioRenderersProcessMasterVolume, and misc. changes.
* | | | Merge pull request #181 from bunnei/vi-fixes-2bunnei2018-02-141-17/+36
|\ \ \ \ | | | | | | | | | | VI cleanup and add a hack for booting games
| * | | | vi: Add FENCE_HACK, which is useful for booting BOTW.bunnei2018-02-131-7/+21
| | | | |
| * | | | vi: Stub TransactParcel CancelBuffer.bunnei2018-02-131-0/+2
| | | | |
| * | | | TransactParcel: Move WriteBlock to narrowest scope.bunnei2018-02-131-10/+13
| | | | |
* | | | | Merge pull request #184 from mailwl/lmbunnei2018-02-131-20/+49
|\ \ \ \ \ | |/ / / / |/| | | | Service/lm: add support to multiline logs
| * | | | Service/lm: add support to multiline logsmailwl2018-02-131-20/+49
| | | | |
* | | | | Merge pull request #180 from MerryMage/f/dynarmic/direct-page-tablebunnei2018-02-134-10/+19
|\ \ \ \ \ | |/ / / / |/| | | | arm_dynarmic: Support direct page table access
| * | | | arm_dynarmic: Support direct page table accessMerryMage2018-02-124-10/+19
|/ / / /
* | | | Merge pull request #179 from gdkchan/audren_stubsbunnei2018-02-121-2/+76
|\ \ \ \ | | | | | | | | | | Stub RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer
| * | | | Add RequestUpdateAudioRenderer, StartAudioRenderer and StopAudioRenderer stubs to audren:ugdkchan2018-02-121-2/+76
| | | | |
* | | | | Merge pull request #178 from Subv/command_buffersbunnei2018-02-1220-23/+364
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines
| * | | Make a GPU class in VideoCore to contain the GPU state.Subv2018-02-1220-76/+125
| | | | | | | | | | | | | | | | Also moved the GPU MemoryManager class to video_core since it makes more sense for it to be there.
| * | | GPU: Added a command processor to decode the GPU pushbuffers and forward the commands to their respective engines.Subv2018-02-1212-3/+285
| | | |
| * | | nvdrv: Make the GPU memory manager available to nvhost-gpu.Subv2018-02-123-6/+16
| | | |
* | | | Merge pull request #177 from bunnei/vi-fixesbunnei2018-02-129-22/+67
|\ \ \ \ | |/ / / |/| | | Several misc. VI fixes
| * | | renderer_opengl: Support framebuffer flip vertical.bunnei2018-02-123-5/+13
| | | |
| * | | vi: Parse IGBPQueueBufferRequestParcel params and expose buffer flip vertical.bunnei2018-02-126-11/+46
| | | |
| * | | vi: Fix OpenLayer and CreateStrayLayer.bunnei2018-02-111-6/+8
|/ / /
* | | Merge pull request #175 from bunnei/libnx-fixes-2bunnei2018-02-109-99/+166
|\ \ \ | | | | | | | | More fixes for Libnx
| * | | fsp_srv: Stub MountSdCard.bunnei2018-02-102-0/+9
| | | |
| * | | apm: Refactor service impl. to support multiple ports.bunnei2018-02-105-58/+102
| | | |
| * | | vi: Implement TransactParcelAuto.bunnei2018-02-101-32/+46
| | | |
| * | | nvflinger: (Hack) Use first available buffer if none are found.bunnei2018-02-101-1/+5
| | | |
| * | | IGBPQueueBufferRequestParcel: Don't enforce buffer length.bunnei2018-02-101-1/+0
| | | | | | | | | | | | | | | | - Another fix for libnx.
| * | | IGBPRequestBufferResponseParcel: Fix response for libnx.bunnei2018-02-101-7/+4
|/ / /
* | | Merge pull request #171 from bunnei/libnx-fixesbunnei2018-02-096-9/+38
|\ \ \ | | | | | | | | Various fixes for libnx, etc.
| * | | nvdrv: Fix QueryEvent for libnx.bunnei2018-02-092-4/+8
| | | |
| * | | IApplicationDisplayService::CloseDisplay: Fix response params size.bunnei2018-02-091-1/+1
| | | |
| * | | nvhost_ctrl_gpu: Implement ZCullGetInfo.bunnei2018-02-091-2/+14
| | | |
| * | | acc_u0: Implement ListAllUsers.bunnei2018-02-092-2/+15
| | | |
* | | | Merge pull request #173 from MerryMage/feature/dynarmic-fix-windowsbunnei2018-02-091-0/+0
|\ \ \ \ | | | | | | | | | | dynarmic: Fix bug due to Windows ABI mismatch
| * | | | dynarmic: Fix bug due to Windows ABI mismatchMerryMage2018-02-091-0/+0
| | | | |
* | | | | Merge pull request #170 from MerryMage/feature/dynarmic-update-201802bunnei2018-02-095-32/+46
|\| | | | | |/ / / |/| | | dynarmic: Update to 41ae12263
| * | | dynarmic: Update to 41ae12263MerryMage2018-02-095-32/+46
|/ / / | | | | | | | | | Changes: Primarily implementing more A64 instructions
* | | Merge pull request #169 from bunnei/gpu-membunnei2018-02-088-30/+225
|\ \ \ | | | | | | | | nvdrv: Implement AllocateSpace and MapBufferEx
| * | | nvhost_as_gpu: Implement AllocateSpace and MapBufferEx.bunnei2018-02-082-10/+33
| | | |
| * | | nvdrv: Add MemoryManager class to track GPU memory.bunnei2018-02-083-0/+162
| | | |
| * | | nvmap: Refactor to expose nvmap objects.bunnei2018-02-082-19/+22
| | | |
| * | | nvhost_as_gpu: Add nvmap as a class member.bunnei2018-02-083-2/+9
|/ / /
* | | Merge pull request #168 from mailwl/new-stubsbunnei2018-02-079-6/+191
|\ \ \ | | | | | | | | Service: stub some functions in am, audio, time, vi services
| * | | Service: stub some functions in am, audio, time, vi servicesmailwl2018-02-079-6/+191
|/ / /
* | | Merge pull request #166 from mailwl/hid-SetNpadHandhelpActivationModebunnei2018-02-061-0/+7
|\ \ \ | | | | | | | | Service/hid: stub SetNpadHandheldActivationMode
| * | | Service/hid: stub SetNpadHandheldActivationModemailwl2018-02-061-0/+7
|/ / /
* | | Merge pull request #165 from bunnei/puyo-fixesbunnei2018-02-064-2/+23
|\ \ \ | | | | | | | | Stubs for HID, AM, and a mutex fix
| * | | mutex: Update hasWaiters on release.bunnei2018-02-061-0/+1
| | | |
| * | | hid: Stub ActivateTouchScreen and SetNpadJoyHoldType.bunnei2018-02-061-2/+14
| | | |
| * | | IApplicationFunctions: Stub out EnsureSaveData.bunnei2018-02-062-0/+8
| | | |
* | | | Extra nvdrv support (#162)David2018-02-0617-37/+765
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * FinishInitalize needed for 3.0.1+ games * nvdrv:s and nvdrv:t both use NVDRV * Most settings return 0 on hardware, disabled NV_MEMORY_PROFILER for now. NVN_THROUGH_OPENGL & NVRM_GPU_PREVENT_USE are a few interesting settings to look at. Carefully choosing settings can help with drawing graphics later on * Initial /dev/nvhost-gpu support * ZCullBind * Stubbed SetErrorNotifier * Fixed SetErrorNotifier log, Added SetChannelPriority * Allocate GPFIFO Ex2, Allocate Obj Ctx, Submit GPFIFO * oops * Fixed up naming/structs/enums. Used vector instead of array for "gpfifo_entry" * Added missing fixes * /dev/nvhost-ctrl-gpu * unneeded struct * Forgot u32 in enum class * Automatic descriptor swapping for ioctls, fixed nvgpu_gpu_get_tpc_masks_args being incorrect size * nvdrv#QueryEvent * Renamed logs for nvdrv * Refactor ioctl so nv_result isn't needed * /dev/nvhost-as-gpu * Fixed Log service naming, CtxObjects now u32, renamed all structs, added static_asserts to structs, used INSERT_PADDING_WORDS instead of u32s * nvdevices now uses "Ioctl" union, * IoctlGpfifoEntry now uses bit field * final changes
* | | Merge pull request #164 from ogniK5377/libnx_sm_fixbunnei2018-02-051-0/+2
|\ \ \ | | | | | | | | Don't call UNIMPLEMENTED for 'empty services', just return error code
| * | | Dont call UNIMPLEMENTED for 'empty services', just return error codeDavid Marcec2018-02-051-0/+2
| | | |
* | | | Merge pull request #163 from ogniK5377/istorage_to_romfsbunnei2018-02-052-5/+5
|\ \ \ \ | |/ / / |/| | | Changed .istorage to .romfs
| * | | Changed .istorage to .romfsDavid Marcec2018-02-052-5/+5
|/ / /
* | | Merge pull request #161 from bunnei/service-improvementsbunnei2018-02-0524-124/+211
|\ \ \ | | | | | | | | Many service improvements
| * | | set: GetAvailableLanguageCodes should not return lang_codes size.bunnei2018-02-051-2/+3
| | | |
| * | | nvflinger: Signal BufferQueue native handle event.bunnei2018-02-051-0/+1
| | | | | | | | | | | | | | | | - This gets BOTW booting.
| * | | logger: Add Time service logging category.bunnei2018-02-053-10/+12
| | | |
| * | | logger: Add SET service logging category.bunnei2018-02-053-16/+12
| | | |
| * | | logger: Add PCTL service logging category.bunnei2018-02-053-1/+3
| | | |
| * | | logger: Add LM service logging category.bunnei2018-02-053-2/+4
| | | |
| * | | logger: Add APM service logging category.bunnei2018-02-053-2/+5
| | | |
| * | | lm: Ensure log string is non-empty before checking back().bunnei2018-02-051-1/+1
| | | |
| * | | logger: Add NIFM service logging category.bunnei2018-02-056-11/+13
| | | |
| * | | logger: Add VI service logging category.bunnei2018-02-056-21/+22
| | | |
| * | | hid: Stub out several functions.bunnei2018-02-051-1/+39
| | | |
| * | | hid: Implement CreateActiveVibrationDeviceList.bunnei2018-02-041-0/+25
| | | |
| * | | logger: Use Service_HID category where applicable.bunnei2018-02-041-2/+2
| | | |
| * | | logger: Use Service_NVDRV category where applicable.bunnei2018-02-042-10/+10
| | | |
| * | | logger: Add AM service logging category.bunnei2018-02-045-42/+44
| | | |
| * | | logger: Add "account" service logging category.bunnei2018-02-043-8/+10
| | | |
| * | | acc_u0: Stub out GetLastOpenedUser.bunnei2018-02-042-0/+10
|/ / /
* | | Merge pull request #160 from bunnei/svc-improvementsbunnei2018-02-045-24/+32
|\ \ \ | | | | | | | | Several SVC fixes and improvements
| * | | GetInfo: Implement IsCurrentProcessBeingDebugged.bunnei2018-02-041-0/+3
| | | |
| * | | WaitProcessWideKeyAtomic: Handle case where condition variable was already created.bunnei2018-02-043-13/+17
| | | |
| * | | svc: SharedMemory size should be 64-bits and cleanup.bunnei2018-02-033-11/+11
| | | |
| * | | ArbitrateLock: Assert that requesting_thread is current_thread.bunnei2018-02-031-0/+1
| | | |
* | | | Merge pull request #159 from mailwl/acc0-fixbunnei2018-02-041-1/+9
|\ \ \ \ | |/ / / |/| | | acc:u0 : stub GetAccountId
| * | | acc:u0 : stub GetAccountIdmailwl2018-02-041-1/+9
|/ / /
* | | Merge pull request #157 from bunnei/fix-duplicate-sessionbunnei2018-02-031-4/+9
|\ \ \ | | | | | | | | controller: DuplicateSession should return a ClientSession.
| * | | controller: DuplicateSession should return a ClientSession.bunnei2018-02-031-4/+9
| | | |
* | | | Merge pull request #156 from mailwl/nifmbunnei2018-02-0310-0/+378
|\ \ \ \ | |/ / / |/| | | Service/nifm: add nifm:a, nifm:s and nifm:u services
| * | | Service:nifm: add nifm:a, nifm:s and nifm:u servicesmailwl2018-02-0310-0/+378
|/ / /
* | | Service/am: Add AppletAE service (#153)mailwl2018-02-027-379/+571
| | | | | | | | | | | | | | | | | | * Add AppletAE, step 1: move common interfaces to am.h * Add AppletAE, step 2
* | | Merge pull request #154 from mailwl/vi_create_stray_arraybunnei2018-02-021-0/+1
|\ \ \ | | | | | | | | vi::CreateStrayLayer : add padding to request
| * | | vi::CreateStrayLayer : add padding to requestmailwl2018-02-021-0/+1
| | | |
* | | | Merge pull request #155 from mailwl/vi-servicesbunnei2018-02-026-0/+128
|\ \ \ \ | | | | | | | | | | Services/vi: add vi:s and vi:u services
| * | | | Services/vi: add vi:s and vi:u servicesmailwl2018-02-026-0/+128
| |/ / /
* | | | Merge pull request #152 from shinyquagsire23/sharedmem-valid-boundsbunnei2018-02-021-1/+2
|\ \ \ \ | |/ / / |/| | | shared_memory: Only mark addresses as invalid if they are within the heap
| * | | shared_memory: Only mark addresses as invalid if they are within the heapshinyquagsire232018-01-301-1/+2
| | | |
* | | | [WIP] sfdnsres: stub (#146)mailwl2018-01-305-2/+52
|/ / / | | | | | | sfdnsres: Add several stubs
* | | Merge pull request #151 from lioncash/catchbunnei2018-01-281-0/+0
|\ \ \ | | | | | | | | externals: Update catch to v2.1.1
| * | | externals: Update catch to v2.1.1Lioncash2018-01-271-0/+0
|/ / /
* | | Merge pull request #148 from MerryMage/feature/special-memorybunnei2018-01-2711-441/+273
|\ \ \ | | | | | | | | memory: Replace all memory hooking with Special regions
| * | | memory: Replace all memory hooking with Special regionsMerryMage2018-01-2711-441/+273
| | | |
* | | | Merge pull request #149 from MerryMage/feature/remove-x86_64hbunnei2018-01-271-1/+1
|\ \ \ \ | | | | | | | | | | travis: Remove CMAKE_OSX_ARCHITECTURES argument
| * | | | travis: Remove CMAKE_OSX_ARCHITECTURES argumentMerryMage2018-01-271-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | Unicorn only builds a x86_64 library, without a x86_64h slice. We can't link against x86_64-only in this manner for static libraries.
* | | | | Merge pull request #147 from chris062689/masterFlame Sage2018-01-271-0/+5
|\ \ \ \ \ | | | | | | | | | | | | Added webhook notifications to TravisCI build.
| * | | | | Added webhook notifications to TravisCI build.Flame Sage2018-01-271-0/+5
|/ / / / /
* | | | | Merge pull request #144 from KAMiKAZOW/patch-1bunnei2018-01-271-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Install Linux icon in hicolor instead of pixmaps
| * | | | | Install Linux icon in hicolor instead of pixmapsKAMiKAZOW2018-01-261-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hicolor is the preferred location for applications. See https://specifications.freedesktop.org/icon-theme-spec/icon-theme-spec-latest.html#directory_layout Same as https://github.com/citra-emu/citra/pull/3007
* | | | | | Merge pull request #145 from jroweboy/oopsbunnei2018-01-261-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix typo for dependent options
| * | | | | Fix typo for dependent optionsJames Rowe2018-01-261-1/+1
|/ / / / /
* | | | | Merge pull request #142 from bunnei/improve-timebunnei2018-01-262-1/+22
|\ \ \ \ \ | | | | | | | | | | | | time: Implement ISteadyClock::GetCurrentTimePoint
| * | | | | time: Implement ISteadyClock::GetCurrentTimePoint.bunnei2018-01-262-1/+22
|/ / / / /
* | | | | Merge pull request #137 from bunnei/improve-ipcbunnei2018-01-2532-452/+311
|\ \ \ \ \ | | | | | | | | | | | | Improve IPC, unify Domains and Sessions, and add validation
| * | | | | audout_u: Various cleanups.bunnei2018-01-251-29/+17
| | | | | |
| * | | | | ResponseBuilder: Use a bit field for customizing instead of always_move_handles.bunnei2018-01-253-11/+21
| | | | | |
| * | | | | time: Stub GetSystemClockContext function.bunnei2018-01-252-2/+17
| | | | | |
| * | | | | server_session: Fix scenario where all domain handlers are closed.bunnei2018-01-251-3/+3
| | | | | |
| * | | | | hle: Rename RequestBuilder to ResponseBuilder.bunnei2018-01-2519-128/+129
| | | | | |
| * | | | | service: Fix all incorrect IPC response headers.bunnei2018-01-2514-82/+42
| | | | | |
| * | | | | ipc_helpers: Make interface domain agnostic and add header validation.bunnei2018-01-252-25/+58
| | | | | |
| * | | | | hle: Integrate Domain handling into ServerSession.bunnei2018-01-257-38/+74
| | | | | |
| * | | | | hle: Remove Domain and SyncObject kernel objects.bunnei2018-01-2510-169/+2
| | | | | |
| * | | | | handle_table: Remove ConvertSessionToDomain.bunnei2018-01-252-17/+0
|/ / / / /
* | | | | audout:u OpenAudioOut and IAudioOut (#138)st4rk2018-01-254-14/+168
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * Updated the audout:u and IAudioOut, now it might work with RetroArch without trigger an assert, however it's not the ideal implementation * audout:u OpenAudioOut implementation and IAudioOut cmd 1,2,3,4,5 implementation * using an enum for audio_out_state as well as changing its initialize to member initializer list * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * Minor fixes, added Service_Audio for LOG_*, changed PcmFormat enum to EnumClass * added missing Audio loggin subclass, minor fixes, clang comment breakline * Solving backend logging conflict * minor fix * Fixed duplicated Service NVDRV in backend.cpp, my bad
* | | | | Merge pull request #140 from gdkchan/time_fixbunnei2018-01-241-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Fix time returning epoch time in milliseconds rather than in seconds
| * | | | | Fix time returning epoch time in milliseconds rather than in secondsgdkchan2018-01-241-1/+1
|/ / / / /
* | | | | Merge pull request #139 from Rozelette/log_nvdrvbunnei2018-01-241-0/+1
|\ \ \ \ \ | | | | | | | | | | | | logging: add missing NVDRV subclass to macro list
| * | | | | logging: add missing NVDRV subclass to macro listRozlette2018-01-241-0/+1
|/ / / / /
* | | | | Merge pull request #136 from N00byKing/patch-1bunnei2018-01-241-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Correct Spelling
| * | | | | Correct SpellingN00byKing2018-01-231-2/+2
|/ / / / /
* | | | | Merge pull request #135 from Subv/no_portsbunnei2018-01-235-65/+67
|\ \ \ \ \ | | | | | | | | | | | | IPC: Don't create unnecessary ports when returning sub interfaces.
| * | | | | Services: Added a todo about returning interfaces as domain objects in lm, hid and time.Subv2018-01-233-0/+12
| | | | | |
| * | | | | Time: Don't create unnecessary ports when retrieving the clock service sessions.Subv2018-01-221-33/+27
| | | | | |
| * | | | | HID: Don't create an unnecessary port in CreateAppletResource.Subv2018-01-221-13/+13
| | | | | |
| * | | | | LM: Don't create an unnecessary port in Initialize.Subv2018-01-222-15/+10
| | | | | |
| * | | | | IPC: Don't create an unnecessary port when using PushIpcInterface outside of a domain.Subv2018-01-221-4/+5
| | | | | |
* | | | | | Merge pull request #133 from Subv/nvflinger2bunnei2018-01-229-17/+59
|\ \ \ \ \ \ | |/ / / / / |/| | | | | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the default display.
| * | | | | AppletOE: Stubbed CreateManagedDisplayLayer to create a new layer in the Default display.Subv2018-01-221-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | This function is used by libnx to obtain a new layer.
| * | | | | AppletOE: Make ISelfController keep a reference to nvflinger.Subv2018-01-225-10/+32
| | | | | | | | | | | | | | | | | | | | | | | | It'll be needed when we implement CreateManagedDisplayLayer.
| * | | | | Services: Vi shouldn't be responsible for creating nvflinger.Subv2018-01-225-7/+13
| | | | | | | | | | | | | | | | | | | | | | | | It is now created during Service initialization and passed to all the services that need it.
* | | | | | Merge pull request #134 from gdkchan/audout_hid_fixbunnei2018-01-223-2/+21
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Stub OpenAudioOut and fix a issue with HID IAppletResource
| * | | | | Stub OpenAudioOut and fix a issue with HID IAppletResource being created more than oncegdkchan2018-01-223-2/+21
| | | | | |
* | | | | | Merge pull request #132 from Subv/nvflingerbunnei2018-01-229-363/+452
|\ \ \ \ \ \ | |/ / / / / |/| | | | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.
| * | | | | VI: Move BufferQueue and NVFlinger to their own folder/namespace.Subv2018-01-229-363/+452
|/ / / / /
* | | | | Added stubs for audio services. (#116)st4rk2018-01-2212-5/+309
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * stubs for audout:u, audin:u, audrec:u, audren:u, codecctl and decoding tables with nullptr for future implementations * fixing the changes requested (remove private, explicit)
* | | | | Merge pull request #131 from lioncash/enumbunnei2018-01-222-12/+13
|\ \ \ \ \ | | | | | | | | | | | | nvmap: Make IoctlCommands an enum class
| * | | | | nvmap: Add a return 0 underneath the UNIMPLEMENTED macroLioncash2018-01-211-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | This macro resolves to an empty macro in release builds.
| * | | | | nvmap: Make IoctlCommands an enum classLioncash2018-01-212-12/+12
| | | | | | | | | | | | | | | | | | | | | | | | Prevents the enum values from polluting the surrounding scope
* | | | | | Merge pull request #130 from MerryMage/dynarmicbunnei2018-01-221-0/+0
|\ \ \ \ \ \ | | |_|/ / / | |/| | | | externals: Update dynarmic
| * | | | | externals: Update dynarmicMerryMage2018-01-211-0/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | a6d17e A64: Implement AND (vector) 963453 tests/A64: Randomize vectors adcd34 tests/A64/unicorn: Print interrupt number when InterruptHook is hit 304c91 tests/A64: Allow RunTestInstance to start from an arbitrary offset d333b5 A64: Implement ADD (vector, vector) 1cf87a A64: Implement REV, REV32, and REV16 (#126) 9fc157 IR: Simplify types. F32 -> U32, F64 -> U64, F128 -> U128 50c181 reg_alloc: GetBitWidth: Add UNREACHABLE adccbf reg_alloc: Consider bitwidth of data and registers when emitting instructions 7b7f23 A64: Implement CSEL 2f8413 IR: Implement Conditional Select ebb3e8 A64/tests: Split unicorn sanity checking from other tests 5740a0 tests/A64: Single random instruction: Test branch instructions as well 0892b4 A64/translate/branch: bug: Read-after-write error in BLR e77bc2 A64: Implement SBFM, BFM, UBFM 0c37ca A64: Implement MOVN, MOVZ, MOVK b6bb59 travis: Print current test information e77207 fuzz_thumb: Off by one error a04ca2 ir/location_descriptor: Add missing <functional> header for std::hash 1e0f5c travis: Run A64 tests
* | | | | | Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid (#114)David2018-01-219-5/+163
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added nvmemp, Added /dev/nvhost-ctrl, SetClientPID now stores pid * used clang-format-3.9 instead * lowercase pid * Moved nvmemp handlers to cpp * Removed unnecessary logging for NvOsGetConfigU32. Cleaned up log and changed to LOG_DEBUG * using std::arrays instead of c arrays * nvhost get config now uses std::array completely * added pid logging back * updated cmakelist * missing includes * added array, removed memcpy * clang-format6.0
* | | | | | Merge pull request #128 from Subv/parcel_querybunnei2018-01-212-0/+58
|\ \ \ \ \ \ | | | | | | | | | | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.
| * | | | | | VI: Implement the Query transaction of IHOSBinderDriver, and stubbed some results.Subv2018-01-212-0/+58
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #123 from bunnei/fsbunnei2018-01-2125-947/+535
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Initial implementation of RomFS filesystem and fsp-srv
| * | | | | file_sys: Clang format fixes.bunnei2018-01-213-4/+4
| | | | | |
| * | | | | fsp_srv: Various improvements to IStorage:Read implementation.bunnei2018-01-215-48/+79
| | | | | |
| * | | | | deconstructed_rom_directory: Implement istorage loading for RomFS.bunnei2018-01-212-2/+71
| | | | | |
| * | | | | filesystem: Implement basic IStorage functionality.David Marcec2018-01-216-0/+258
| | | | | |
| * | | | | file_sys: Cleanup to better match Switch file system constructs.bunnei2018-01-2110-63/+136
| | | | | | | | | | | | | | | | | | | | | | | | file_sys: Add factory class for RomFS file system.
| * | | | | file_sys: Remove disk_archive, savedata_archive, and title_metadata.bunnei2018-01-217-835/+0
| | | | | |
| * | | | | archive_backend: Minor changes to match Switch IFileSystem.bunnei2018-01-215-26/+26
| | | | | |
| * | | | | file_sys: Repurpose 3DS IVFC code for Switch ROMFS.bunnei2018-01-213-51/+43
|/ / / / /
* | | | | Merge pull request #129 from Rozelette/masterbunnei2018-01-211-113/+155
|\ \ \ \ \ | | | | | | | | | | | | gdbstub: Update registers and sizes for aarch64
| * | | | | gdbstub: Update registers and sizes for aarch64Rozlette2018-01-211-113/+155
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets gdbstub working at least to the point where clients can communicate with it. What works: - Reading/writing GPRegs - Reading/writing memory - Interrupting the emulated program and continuing What does NOT work: - Breakpoints. Sizes have been updated to u64, but support will need to be added in the interpreter for them to work. - VRegs. Mostly because my gdb was having issues with 128-bit regs for some reason. However, the current u128 representation is a bit awkward to use and should probably be updated first.
* | | | | Merge pull request #124 from akkatracker/patch-1bunnei2018-01-211-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Fix minor spelling error in CMakeLists
| * | | | | Fix spelling error in CMakeListsMatthew Brener2018-01-211-1/+1
| |/ / / / | | | | | | | | | | Minor spelling error of its --> it's
* | | | | Merge pull request #125 from MerryMage/bundled-unicornbunnei2018-01-211-3/+6
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / Unicorn build fixups
| * | | CMakeLists: Fix unicorn build for macOS developers with x86_64-only systemsMerryMage2018-01-211-1/+1
| | | | | | | | | | | | | | | | Some of us do not have any i386 libraries required to build x86-32 universal libraries.
| * | | CMakeLists: Do not look for system Unicorn by defaultMerryMage2018-01-211-2/+5
|/ / / | | | | | | | | | | | | Since we use a custom build of unicorn it doesn't make much sense to look for the system version, unless the user explicitly wants to override this.
* | | Merge pull request #72 from N00byKing/patch-2bunnei2018-01-211-1/+0
|\ \ \ | | | | | | | | Implement Pull #3275 from citra: core: Don't Shutdown before we've even Init-ed
| * | | Update core.cppN00byKing2018-01-171-1/+0
| | | |
* | | | Merge pull request #92 from gdkchan/nro_refactorbunnei2018-01-211-2/+2
|\ \ \ \ | | | | | | | | | | Fix NRO entry point
| * | | | Fix NRO Entry Pointgdkchan2018-01-181-2/+2
| | | | |
* | | | | Merge pull request #122 from tgsm/time-remove-pragmabunnei2018-01-212-4/+0
|\ \ \ \ \ | | | | | | | | | | | | service/time: remove accidental #pragmas
| * | | | | service/time: remove accidental #pragmastgsm2018-01-212-4/+0
| | | | | |
* | | | | | Merge pull request #121 from Rozelette/masterbunnei2018-01-211-1/+0
|\ \ \ \ \ \ | |/ / / / / |/| | | | | loader: Minor style fix in deconstructed_rom_directory
| * | | | | loader: Minor style fix in deconstructed_rom_directoryRozlette2018-01-211-1/+0
|/ / / / /
* | | | | Merge pull request #117 from jroweboy/clang-formatbunnei2018-01-2178-122/+275
|\ \ \ \ \ | | | | | | | | | | | | Clang format as a build target
| * | | | | Travis: Add missing PPA for newer libstdc++James Rowe2018-01-211-0/+1
| | | | | |
| * | | | | Travis: Update clang-format to 6.0James Rowe2018-01-212-2/+5
| | | | | |
| * | | | | Format: Run the new clang format on everythingJames Rowe2018-01-2174-117/+207
| | | | | |
| * | | | | CMake: Conditionally turn on bundled libs for MSVCJames Rowe2018-01-211-2/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the annoying step when generating sln for MSVC where you have to click an extra checkbox after the first generate fails by using a conditional option. The USE_BUNDLED options will be off by default, but if the enable_lib option is enabled and the toolset is msvc, they are turned ON.
| * | | | | CMake: Update contributing guide with the new clang format infoJames Rowe2018-01-211-1/+10
| | | | | |
| * | | | | CMake: Add a custom clang format targetJames Rowe2018-01-201-0/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Checks to see if clang-format can be found, and if it is, sets up a custom target that will run against the src dir and auto formats all files. In MSVC, this is a project, and in Makefiles, its a make target
* | | | | | Merge pull request #120 from Rozelette/masterbunnei2018-01-201-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | memory: Return false for large VAddr in IsValidVirtualAddress
| * | | | | | memory: Return false for large VAddr in IsValidVirtualAddressRozlette2018-01-201-0/+3
| |/ / / / /
* | | | | | Merge pull request #119 from bunnei/desconstucted-loaderbunnei2018-01-2011-51/+200
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Separate NSO loading from DesconstuctedRomLoader
| * | | | | loader: Clean up ctors and includes.bunnei2018-01-2010-18/+22
| | | | | |
| * | | | | loader: Add DeconstructedRomDirectory for game dumps.bunnei2018-01-205-0/+156
| | | | | |
| * | | | | loader: Refactor to also pass filepath into IdentifyType.bunnei2018-01-208-19/+19
| | | | | |
| * | | | | nso: Remove code specific to directory loading.bunnei2018-01-202-17/+6
|/ / / / /
* | | | | Port citra #3352 to yuzu (#103)River City Ransomware2018-01-204-12/+36
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Port citra #3352 to yuzu This change allows non x86_64 architectures to compile yuzu by skipping the building of dynarmic * Fixed clang-format errors * fixes more clang-format errors
* | | | | Added CreateSharedMemory & UNIMPLEMENTED() for non existent services. (#113)David2018-01-203-1/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added svcCreateSharedMemory * Services which are not implemented now throw UNIMPLEMENTED() * clang-format * changed perms to u32 * removed camelcase
* | | | | Fixes some cast warnings, partial port of citra #3064 (#106)River City Ransomware2018-01-206-21/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Fixes some cast warnings, partially fixes citra #3064 * Converted casts to uint32_t to u32 * Ran clang-format
* | | | | Merge pull request #112 from Rozelette/masterbunnei2018-01-191-0/+16
|\ \ \ \ \ | | | | | | | | | | | | ISelfController: Stub LockExit and UnlockExit
| * | | | | ISelfController: Stub LockExit and UnlockExitRozlette2018-01-191-0/+16
| | | | | |
* | | | | | acc, set, applet_oe: stub various functions, add set service (#105)goaaats2018-01-198-0/+161
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stubs for various acc:u0 funcs needed * Stub for GetDesiredLanguage in IApplicationFunctions * Add set service + stubs needed for games * Fix formatting * Implement IProfile, IManagerForApplication, return bool in CheckAvailability, style fixes * Remove IProfile::Get(needs more research), fix IPC response sizes
* | | | | Merge pull request #109 from bunnei/libnx-fixesbunnei2018-01-196-1/+26
|\ \ \ \ \ | | | | | | | | | | | | Fix svcGetInfo for libnx
| * | | | | nvdrv: Stub SetClientPID.bunnei2018-01-192-0/+13
| | | | | |
| * | | | | svc: Fix svcGetInfo MapRegionBaseAddr.bunnei2018-01-193-1/+9
| | | | | |
| * | | | | svc: Add additional fields to MemoryInfo struct.bunnei2018-01-191-0/+4
| | | | | |
* | | | | | Merge pull request #97 from bunnei/time-stubbunnei2018-01-192-4/+12
|\ \ \ \ \ \ | | | | | | | | | | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.
| * | | | | | time: Stub out GetTotalLocationNameCount and some cleanup.bunnei2018-01-192-4/+12
| | | | | | |
* | | | | | | time: Add new line to ends of files.bunnei2018-01-194-4/+4
| | | | | | |
* | | | | | | applet_oe: Clang-format.bunnei2018-01-191-2/+1
|/ / / / / /
* | | | | | Merge pull request #108 from gdkchan/dispdrvbunnei2018-01-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix dispdrv typo
| * | | | | Fix dispdrv typogdkchan2018-01-191-1/+1
|/ / / / /
* | | | | Merge pull request #100 from Rozelette/masterbunnei2018-01-197-32/+113
|\ \ \ \ \ | | | | | | | | | | | | time: Refactor time:* to use a single shared module
| * | | | | time: Fix use of CamelCase in ToCalendarTimeWithMyRuleRozlette2018-01-181-6/+6
| | | | | |
| * | | | | time: Refactor time:* to use a single shared moduleRozlette2018-01-187-26/+107
| | |_|/ / | |/| | |
* | | | | Merge pull request #104 from RiverCityRansomware/resizedConfigWindowbunnei2018-01-191-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Port citra #3336
| * | | | | Port citra #3336 - Resizes the configuration window to not be so stretched outRiver City Ransomware2018-01-181-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #107 from lioncash/qtbunnei2018-01-195-31/+31
|\ \ \ \ \ | | | | | | | | | | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicable
| * | | | | qt: Migrate to Qt 5 signal/slot connection syntax where applicableLioncash2018-01-195-31/+31
|/ / / / /
* | | | | ui: Rename almost all classes in configuration_input.ui (#99)Evgeni Danailov2018-01-181-66/+66
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Rename verticalLayout_25 to verticalLayout_23. * Rename almost all classes.
* | | | | Merge pull request #101 from jroweboy/add-missing-dllsbunnei2018-01-181-3/+10
|\ \ \ \ \ | |/ / / / |/| | | | Build: Add missing dlls to msvc release
| * | | | Build: Add missing dlls to msvc releaseJames Rowe2018-01-181-3/+10
| | | | |
* | | | | Stub PopLaunchParameter and implement Buffer C Descriptors reading on hle_ipc (#96)gdkchan2018-01-185-7/+127
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Stub PopLaunchParameter and implement Buffer C Descriptors reading * Address PR feedback * Ensure we push a u64 not a size_t * Fix formatting
* | | | | Start to implement/stub BSD:U and SFDNSRES services (#78)flerovium^-^2018-01-187-0/+159
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * bsd: start stubbing bsd:u and sfdnsres * bsd: stubbed RegisterClient * bsd: attempt to get past socket() * bsd: fix some wrong assumptions about IPC * bsd: fix format specifiers * bsd: stubbed Connect() * bsd: stubbed SendTo() * made requested changes * sockets: respect alphabetical order at service installation * run clang-format * run clang-format (2)
* | | | | Merge pull request #98 from lioncash/xcodebunnei2018-01-181-1/+1
|\ \ \ \ \ | | | | | | | | | | | | travis: Use Xcode 9.2
| * | | | | travis: Use Xcode 9.2Lioncash2018-01-181-1/+1
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Uses the latest available Xcode version. This allows the use of more C++17 facilities without the CI failing.
* | | | | Merge pull request #95 from bunnei/lm-skip-bytebunnei2018-01-181-0/+7
|\ \ \ \ \ | |/ / / / |/| | | | lm: Minor logging fix to skip a byte.
| * | | | lm: Minor logging fix to skip a byte.bunnei2018-01-181-0/+7
| | | | |
* | | | | Merge pull request #84 from lioncash/cmakebunnei2018-01-1811-389/+361
|\ \ \ \ \ | | | | | | | | | | | | CMakeLists: Derive the source directory grouping from targets themselves
| * | | | | CMakeLists: Derive the source directory grouping from targets themselvesLioncash2018-01-1811-389/+361
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Removes the need to store to separate SRC and HEADER variables, and then construct the target in most cases.
* | | | | | Merge pull request #91 from lioncash/svcbunnei2018-01-181-9/+9
|\ \ \ \ \ \ | | | | | | | | | | | | | | svc: Minor clarity changes
| * | | | | | svc: Rename some entries to match their analogue on SwitchBrewLioncash2018-01-181-7/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Makes the codebase a little more consistent with regards to available documentation. Also amends the duplicate case where there was a similar entry at 0x72 named ConnectToPort.
| * | | | | | svc: Add CreateJitMemory and MapJitMemory svc stringsLioncash2018-01-181-2/+2
| |/ / / / / | | | | | | | | | | | | | | | | | | Makes the table match SwitchBrew for these entries
* | | | | | Merge pull request #90 from lioncash/vi-overridebunnei2018-01-181-20/+21
|\ \ \ \ \ \ | | | | | | | | | | | | | | vi: Minor clean up/correctness changes
| * | | | | | vi: Make constructors explicit where applicableLioncash2018-01-181-13/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
| * | | | | | vi: Add missing override specifiersLioncash2018-01-181-7/+7
| |/ / / / /
* | | | | | Merge pull request #89 from lioncash/vi-vectorbunnei2018-01-181-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock function
| * | | | | | vi: Copy data directly into the std::vector within Parcel's ReadBlock functionLioncash2018-01-181-2/+3
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | Previously this would unnecessarily zero-initialize the vector before copying the actual data into the vector instance.
* | | | | | Merge pull request #88 from lioncash/includebunnei2018-01-181-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | hotkeys: Add missing <QTreeWidgetItem> include
| * | | | | | hotkeys: Add missing <QTreeWidgetItem> includeLioncash2018-01-181-0/+1
| |/ / / / /
* | | | | | Merge pull request #87 from lioncash/overridebunnei2018-01-181-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter function
| * | | | | | game_list: Add missing override specifier for KeyReleaseEater's eventFilter functionLioncash2018-01-181-1/+1
| |/ / / / /
* | | | | | Merge pull request #93 from jroweboy/deploy-keyFlame Sage2018-01-182-2/+2
|\ \ \ \ \ \ | | |_|/ / / | |/| | | | Build: Update deploy keys
| * | | | | Build: Update deploy keysJames Rowe2018-01-182-2/+2
|/ / / / /
* | | | | Merge pull request #86 from lioncash/doxygenbunnei2018-01-181-2/+2
|\ \ \ \ \ | | | | | | | | | | | | game_list: Amend doxygen parameter identifiers
| * | | | | game_list: Amend doxygen parameter identifiers for containsAllWords()Lioncash2018-01-181-2/+2
| |/ / / /
* | | | | Merge pull request #85 from lioncash/warnbunnei2018-01-181-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | telemetry: Silence initialization order warnings
| * | | | telemetry: Silence initialization order warningsLioncash2018-01-181-2/+2
| |/ / /
* | | | controller: Use DuplicateSession for DuplicateSessionEx.bunnei2018-01-182-1/+8
| | | |
* | | | Merge pull request #83 from lioncash/pessimizing-movebunnei2018-01-181-1/+1
|\ \ \ \ | | | | | | | | | | input_common/sdl: Silence a -Wpessimizing-move warning
| * | | | input_common/sdl: Silence a -Wpessimizing-move warningLioncash2018-01-181-1/+1
| |/ / /
* | | | Merge pull request #82 from lioncash/catchbunnei2018-01-181-0/+0
|\ \ \ \ | | | | | | | | | | externals: Update catch to 2.1.0
| * | | | externals: Update catch to 2.1.0Lioncash2018-01-181-0/+0
| |/ / /
* | | | Merge pull request #81 from lioncash/qt-bootmgrbunnei2018-01-182-7/+6
|\ \ \ \ | | | | | | | | | | bootmanager: Minor tidiness/correctness changes
| * | | | bootmanager: Minor tidiness/correctness changesLioncash2018-01-182-7/+6
| |/ / / | | | | | | | | | | | | Moved over from #3266 in citra.
* | | | Merge pull request #80 from gdkchan/nro_fixbunnei2018-01-181-20/+9
|\ \ \ \ | |/ / / |/| | | Fix NRO loading
| * | | Fix NRO loadinggdkchan2018-01-181-20/+9
| | | |
* | | | Merge pull request #73 from N00byKing/3093bunnei2018-01-182-0/+2
|\ \ \ \ | |/ / / |/| | | Implement Pull #3093 from citra: Added missing headers to CMakeLists.txt and fixed includes.
| * | | Update CMakeLists.txtN00byKing2018-01-171-0/+1
| | | |
| * | | Update title_metadata.hN00byKing2018-01-171-0/+1
| | | |
* | | | Merge pull request #76 from Rozelette/masterbunnei2018-01-175-85/+164
|\ \ \ \ | | | | | | | | | | TIME: consolidate time:* interfaces, stub functions and structs
| * | | | TIME: consolidate time:* interfaces, stub functions and structsRozlette2018-01-175-85/+164
| | | | |
* | | | | Implement Pull #3306 from citra: citra_qt: Drop Qt 5 version checks in code (#41)N00byKing2018-01-171-13/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update bootmanager.cpp * This *should* fix the clang error
* | | | | Merge pull request #77 from gdkchan/no_relocsbunnei2018-01-173-19/+2
|\ \ \ \ \ | |/ / / / |/| | | | Remove relocation on NSO/NRO
| * | | | Remove relocation on NSO/NROgdkchan2018-01-173-19/+2
|/ / / /
* | | | Merge pull request #42 from N00byKing/3295bunnei2018-01-171-5/+1
|\ \ \ \ | | | | | | | | | | Implement Pull #3295 from citra: citra_qt: CMakeLists: Drop leftover handling code for Qt 4 UI files
| * | | | Update CMakeLists.txtN00byKing2018-01-161-5/+1
| |/ / /
* | | | Merge pull request #57 from nkatz565/fix-trbunnei2018-01-171-1/+2
|\ \ \ \ | | | | | | | | | | Fix non translated string (same as Citra PR 2949)
| * | | | Fixed formattingnoah katz2018-01-171-2/+2
| | | | |
| * | | | Fix non translated string (same as Citra PR 2949)noah katz2018-01-171-1/+1
| | | | |
* | | | | Merge pull request #64 from shinyquagsire23/hid-timingbunnei2018-01-171-3/+3
|\ \ \ \ \ | | | | | | | | | | | | hid: Adjust timing based on actual hardware
| * | | | | hid: Adjust timing based on actual hardwareshinyquagsire232018-01-171-3/+3
| | |_|_|/ | |/| | |
* | | | | Merge pull request #70 from flerovii/nvdrv-closebunnei2018-01-174-0/+26
|\ \ \ \ \ | | | | | | | | | | | | nvdrv: stubbed Close(cmd 2)
| * | | | | nvdrv: stubbed Close(cmd 2)Frederic Meyer2018-01-174-0/+26
| | | | | |
* | | | | | svc: Clang-format fix.bunnei2018-01-171-6/+4
| |_|_|_|/ |/| | | |
* | | | | Merge pull request #71 from N00byKing/patch-1bunnei2018-01-171-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3109 from citra: sdl2 default ini: fix framelimit
| * | | | | Update default_ini.hN00byKing2018-01-171-2/+2
| |/ / / /
* | | | | Merge pull request #62 from bunnei/domain-close-handlebunnei2018-01-175-4/+38
|\ \ \ \ \ | |/ / / / |/| | | | Implement IPC domain command CloseVirtualHandle
| * | | | hle_ipc: Clang format.bunnei2018-01-171-2/+3
| | | | |
| * | | | ipc: Implement domain command CloseVirtualHandle.bunnei2018-01-173-3/+34
| | | | |
| * | | | loggin: Add IPC logging category.bunnei2018-01-172-1/+3
| | | | |
* | | | | Merge pull request #67 from RiverCityRansomware/gdbstubtypobunnei2018-01-171-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Fix gdbstub typo
| * | | | Fix gdbstub typo, fixes Citra #3318River City Ransomware2018-01-171-1/+1
|/ / / / | | | | | | | | Core::System().GetInstance().IsPoweredOn() -> Core::System::GetInstance().IsPoweredOn()
* | | | Merge pull request #60 from jroweboy/game-framebunnei2018-01-172-1/+4
|\ \ \ \ | |/ / / |/| | | UI: Fix frame rate perf stats
| * | | UI: Fix frame rate perf statsJames Rowe2018-01-172-1/+4
| | | | | | | | | | | | | | | | Adds in a missing EndGameFrame when nvdrv swaps buffers
* | | | Merge pull request #34 from shinyquagsire23/hid-sharedmem-layouts-circbufs-metabunnei2018-01-172-88/+125
|\ \ \ \ | |/ / / |/| | | hid: Write to all layouts, implement circular buffers, set up controller metadata.
| * | | hid: clang-formatshinyquagsire232018-01-171-3/+3
| | | |
| * | | hid: Adjust for style guideshinyquagsire232018-01-172-63/+68
| | | |
| * | | hid: Write to all layouts, implement circular buffers, set up controller metadata.shinyquagsire232018-01-162-39/+71
| | | |
* | | | acc_u0: Add IPC interface and stub InitializeApplicationInfo.bunnei2018-01-176-0/+86
| | | |
* | | | Merge pull request #55 from bunnei/subv-improvementsbunnei2018-01-1723-216/+381
|\ \ \ \ | | | | | | | | | | Improvements to IPC, AppletOE, APM, VI, SVC
| * | | | applet_oe: Fix GetOperationMode and GetPerformanceMode.bunnei2018-01-171-2/+2
| | | | |
| * | | | NV: Implemented the nvdrv service, which uses the same interface as nvdrv:aSubv2018-01-174-16/+18
| | | | |
| * | | | NV: Move the nvdrv classes into the Nvidia namespace, and move the functionality to a s single module that services call.Subv2018-01-1713-165/+95
| | | | |
| * | | | VI: Stubbed GetNativeHandle, Create/DestroyStrayLayer and CloseDisplaySubv2018-01-172-3/+85
| | | | |
| * | | | Services: Stubbed APM::OpenSession and the ISession interface.Subv2018-01-173-2/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/hle/service/am/applet_oe.cpp # src/core/hle/service/apm/apm.cpp
| * | | | AppletOE: Stub a bunch of functions required by libnx homebrew.Subv2018-01-171-4/+62
| | | | |
| * | | | SVC: Correct some return values in svcGetInfo and added TitleId and PrivilegedProcessId stubs.Subv2018-01-171-6/+21
| | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/hle/kernel/svc.cpp
| * | | | SVC: Add 4.0.0+ comment to GetInfoType enum values.Subv2018-01-171-0/+1
| | | | |
| * | | | IPC: Push domain objects as move handles when not in a domain.Subv2018-01-172-2/+28
|/ / / /
* | | | Merge pull request #52 from ogniK5377/fspbunnei2018-01-176-5/+90
|\ \ \ \ | | | | | | | | | | added more svcGetInfo pairs for 3.0.0+ support, Changed HEAP_SIZE and TLS_AREA_VADDR. changed mem usage & heap usage stub added, ISelfController, IApplication function stubs. Added SetThreadCoreMask
| * | | | Update memory.hDavid2018-01-171-2/+2
| | | | |
| * | | | SetThreadCoreMask stub, time to implement fspDavid Marcec2018-01-161-1/+6
| | | | |
| * | | | implemented more of ISelfController and IApplicationFunctionsDavid Marcec2018-01-161-0/+53
| | | | |
| * | | | Added more svcGetInfo pairsDavid Marcec2018-01-164-2/+29
| | | | |
| * | | | Increased heap size and changed tls area vaddrDavid Marcec2018-01-161-2/+2
| | |/ / | |/| |
* | | | Merge pull request #45 from FearlessTobi/patch-1bunnei2018-01-161-6/+6
|\ \ \ \ | | | | | | | | | | Implement Pull #3030 from Citra: Rename derivative class name
| * | | | Implement Pull #3030 from CitraTobias2018-01-161-6/+6
| | | | | | | | | | | | | | | citra-qt: Rename derivative class name
* | | | | Merge pull request #43 from N00byKing/3052bunnei2018-01-161-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3052 from citra: Correct spelling of searchfield in comment
| * | | | | Update game_list.cppN00byKing2018-01-161-1/+1
| | |_|_|/ | |/| | |
* | | | | Merge pull request #46 from FearlessTobi/patch-2bunnei2018-01-161-8/+8
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3034 from Citra: Change build order to check clang-format first
| * | | | | Implement Pull #3034 from CitraTobias2018-01-161-8/+8
| | |/ / / | |/| | | | | | | | Change build order to check clang-format first
* | | | | Merge pull request #53 from nkatz565/nk-fixlabelsbunnei2018-01-161-25/+52
|\ \ \ \ \ | | | | | | | | | | | | Implement Pull #3240 from Citra: Add button labels for sdl joystick mappings
| * | | | | Use static functions instead of lambdasmuemart2018-01-161-49/+46
| | | | | |
| * | | | | Add translation support for button labelsmuemart2018-01-161-14/+15
| | | | | |
| * | | | | Add button labels for sdl joystick mappingsmuemart2018-01-161-17/+46
| | |_|/ / | |/| | |
* | | | | Merge pull request #44 from Rozelette/masterbunnei2018-01-161-3/+7
|\ \ \ \ \ | | | | | | | | | | | | nso: Modify .bss size calculation logic
| * | | | | nso: Modify .bss size calculation logicRozlette2018-01-161-3/+7
| | |_|/ / | |/| | |
* | | | | Merge pull request #47 from MerryMage/build-fixesbunnei2018-01-1626-63/+55
|\ \ \ \ \ | |_|/ / / |/| | | | Misc build fixes
| * | | | clang-formatMerryMage2018-01-1625-63/+54
| | | | |
| * | | | travis: Use more recent cmake on macOSMerryMage2018-01-161-0/+1
| | |/ / | |/| |
* | | | Merge pull request #48 from spycrab/cmake_pythonbunnei2018-01-161-1/+3
|\ \ \ \ | |/ / / |/| | | CMake: Override PYTHON environment variable for libunicorn
| * | | CMake: Override PYTHON environment variable for libunicornspycrab2018-01-161-1/+3
|/ / /
* | | Update README.md to include AppVeyor build status.bunnei2018-01-161-0/+1
| | |
* | | Merge pull request #31 from jroweboy/fix-deploybunnei2018-01-169-51/+67
|\ \ \ | |/ / |/| | Build/Deploy Updates to Setup Nightly Builds
| * | Build: Automagically handle unicornJames Rowe2018-01-162-46/+48
| | | | | | | | | | | | | | | | | | | | | On MSVC if unicorn isn't found, fallback to bundled unicorn On everything else, fallback to building unicorn in externals Also fixes loading unicorn in msvc
| * | Build: Update Appveyor and Travis secret keysJames Rowe2018-01-162-2/+2
| | | | | | | | | | | | | | | The keys are github auth_tokens and are assigned to yuzubot for the yuzu-nightly repository to allow Appveyor and Travis to upload releases
| * | Build: Add unicorn as a submodule and build it if neededJames Rowe2018-01-168-27/+41
| |/ | | | | | | | | | | | | Adds a cmake custom target that will build unicorn on first compile and uses this in the build scripts as well. Updates Appveyor and Travis build scripts to work with the new unicorn build, and updates the paths to all of the different artifacts.
* | Implement Pull #3333 from citra: citra_qt: Pause emulation on CoreError (#39)N00byKing2018-01-162-0/+2
| |
* | Merge pull request #24 from nkatz565/nk-inputsbunnei2018-01-167-191/+524
|\ \ | | | | | | Adding meumart's Citra SDL Joystick support. Citra PR #3116
| * | Adding meumart's Citra SDL Joystick support. Citra PR #3116muemart2018-01-167-191/+524
| | |
* | | Merge pull request #38 from goaaats/citra_mergesbunnei2018-01-165-1/+73
|\ \ \ | |_|/ |/| | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)
| * | Merge citra-emu PR#3159 by FearlessTobi(citra-qt : Fix a bug in our fullscreen implementation)goaaats2018-01-162-15/+31
| | |
| * | Merge citra-emu PR#3001 by Styleoshin(citra-qt : Adding fullscreen mode)goaaats2018-01-165-1/+57
|/ /
* | Merge pull request #25 from chris062689/masterFlame Sage2018-01-161-1/+1
|\ \ | | | | | | Updated Discord link to match website.
| * | Updated Discord link to match website.Flame Sage2018-01-161-1/+1
|/ /
* | Merge pull request #23 from Simonx22/cmake_renamebunnei2018-01-151-6/+6
|\ \ | | | | | | CMakeList.txt: rename CITRA to YUZU
| * | rename CITRA to YUZUSimonx222018-01-151-6/+6
| |/
* / nso: Load subsdk4 if available.bunnei2018-01-151-1/+1
|/
* pctl: Clang format.bunnei2018-01-151-1/+1
|
* pctl: GetService should return an IParentalControlService interface.bunnei2018-01-151-3/+8
|
* applet_oe: Stub SetFocusHandlingMode, GetCurrentFocusState, SetTerminateResult.bunnei2018-01-151-2/+55
|
* settings: Fix button mappings array to have correct entries.bunnei2018-01-151-2/+6
|
* Merge pull request #17 from spycrab/bindirbunnei2018-01-153-4/+7
|\ | | | | CMake: Output binaries to bin/
| * CMake: Output binaries to bin/spycrab2018-01-153-4/+7
| |
* | Merge pull request #20 from Andrix44/fixesbunnei2018-01-155-73/+11
|\ \ | | | | | | Various fixes
| * | Clanggit rebase -i fixesunknown2018-01-151-10/+2
| | |
| * | Clang formatunknown2018-01-152-4/+10
| | |
| * | Change default log level to infounknown2018-01-151-1/+1
| | |
| * | Update the internal resolution settingsunknown2018-01-153-67/+7
| | |
| * | Fix some warningsunknown2018-01-151-3/+3
| | |
* | | Merge pull request #16 from shinyquagsire23/hid-sharedmem-impl-startbunnei2018-01-157-115/+688
|\ \ \ | |/ / |/| | HID Sharedmem Impl Start
| * | yuzu_cmd: Fix default ini, add screenshot buttonshinyquagsire232018-01-151-1/+2
| | |
| * | hid: Bare-minimum sharedmem inputshinyquagsire232018-01-152-2/+88
| | |
| * | hid: Remove redundant HID prefix on structs/enumsshinyquagsire232018-01-151-73/+73
| | |
| * | configure_input: update w/ Switch buttonsshinyquagsire232018-01-153-90/+221
| | |
| * | settings: Screenshot buttonshinyquagsire232018-01-151-0/+2
| | |
| * | yuzu_cmd: fix default inishinyquagsire232018-01-151-9/+17
| | |
| * | settings: adjust button configs for Switch controllersshinyquagsire232018-01-151-17/+50
| | |
| * | hid: Add sharedmem structsshinyquagsire232018-01-151-0/+312
| | |
| * | fixed build for gcc c++17 / boost.icl incompatibilityHarry Prevor2018-01-151-0/+6
| | |
* | | Merge pull request #15 from bsaleil/masterbunnei2018-01-151-0/+10
|\ \ \ | | | | | | | | vi: Add IManagerDisplayService::CloseDisplay function
| * | | vi: Add IManagerDisplayService::CloseDisplay functionbsaleil2018-01-151-0/+10
|/ / /
* | | Merge pull request #13 from hpr/fno-new-ttp-matchingbunnei2018-01-151-0/+6
|\ \ \ | |/ / |/| | Fix build for gcc c++17 / boost.icl incompatibility
| * | fixed build for gcc c++17 / boost.icl incompatibilityHarry Prevor2018-01-151-0/+6
| | |
* | | Merge pull request #14 from ogniK5377/masterbunnei2018-01-151-1/+1
|\ \ \ | | | | | | | | Changed ICommonStateGetter::ReceiveMessage to allow further execution in games
| * | | Games expect 15 for ICommonStateGetter::ReceiveMessage in order to continue executionDavid Marcec2018-01-151-1/+1
| | | |
* | | | renderer_gl: Clear screen to black before rendering framebuffer.bunnei2018-01-152-5/+8
|/ / /
* | | renderer: Render previous frame when no new one is available.bunnei2018-01-154-17/+22
| | |
* | | Update README.md with Travis link.bunnei2018-01-151-0/+2
| | |
* | | lm: Fix IPC header for Initialize.bunnei2018-01-151-1/+1
| | |
* | | time: Implement GetStandardUserSystemClock, GetCurrentTime.bunnei2018-01-156-1/+121
| | |
* | | audio: Add files to CMake.bunnei2018-01-152-1/+4
| | |
* | | hid: Remove unused registered_loggers.bunnei2018-01-151-3/+0
| | |
* | | audio: Stub out AudOutU::ListAudioOuts.bunnei2018-01-155-0/+84
| | |
* | | hid: Implement IAppletResource::GetSharedMemoryHandle.bunnei2018-01-153-14/+68
|/ /
* | Merge pull request #10 from Andrix44/mpwarningsbunnei2018-01-151-4/+4
|\ \ | | | | | | Fix some warnings in the microprofile
| * | Fix some warnings in the microprofileAndrix442018-01-151-4/+4
| |/
* | qt: Update about dialog to show license for GPLv2 only.bunnei2018-01-141-1/+1
| | | | | | | | Fixes #6.
* | shared_memory: Minor fixes and cleanup.bunnei2018-01-141-6/+6
| |
* | svc: Implement svcMapSharedMemory.bunnei2018-01-142-1/+38
| |
* | kernel: Increase default stack size to 64K.bunnei2018-01-141-1/+1
|/
* Merge pull request #7 from JayFoxRox/remove-surface-viewerbunnei2018-01-143-13/+0
|\ | | | | Remove Surface Viewer stub
| * Remove Surface Viewer stubJannik Vogel2018-01-143-13/+0
|/
* Merge pull request #4 from spycrab/aboutdialogbunnei2018-01-148-3/+250
|\ | | | | Implement "About" dialog
| * Implement "About" dialogspycrab2018-01-148-3/+250
| |
* | Merge pull request #1 from roblabla/patch-1bunnei2018-01-141-1/+1
|\ \ | | | | | | Fix compilation on case-sensitive OSX
| * | Fix compilation on case-sensitive OSXRobin Lambertz2018-01-141-1/+1
| |/ | | | | | | | | When compiling on a case-sensitive filesystem on OSX, cmake doesn't find the FindUnicorn file, because it looks for Findunicorn.cmake. We should uses the correct case to avoid this issue.
* | Merge pull request #5 from Thog/fix/loader-file-typebunnei2018-01-141-0/+8
|\ \ | |/ |/| Add missing FileType declarations in GuessFromExtension and GetFileTypeString
| * Add missing FileType declarations in GuessFromExtension and GetFileTypeStringThog2018-01-141-0/+8
|/
* externals: Remove unused repos.bunnei2018-01-144-0/+0
|
* yuzu qt copy windows deps renamedJames Rowe2018-01-141-2/+2
|
* Minor cleanupMerryMage2018-01-1410-39/+34
|
* macOS: Update Info.plistMerryMage2018-01-141-34/+34
|
* Add new icons and fix up the linux paths for installJames Rowe2018-01-137-18/+120
|
* Update dynarmic to bc73004MerryMage2018-01-132-12/+17
| | | | | | | | | | | | | | | | | | bc73004 a64_merge_interpret_blocks: Remove debug output 4e656ed tests/A64: Randomize PSTATE.<NZCV> fd9530b A64: Optimization: Merge interpret blocks 3c9eb04 testenv: Use format constants 324f3fc tests/A64: Unicorn interface fixes 98ecbe7 tests/A64: Fuzz against unicorn b1d38e7 tests/A64: Move TestEnvironment to own header 5218ad9 A64/data_processing_pcrel: bug: ADR{,P} instructions sign extend their immediate b1a8c39 A64/data_processing_addsub: bug: {ADD,SUB}S (extended register) instructions write to ZR when d = 31 64827fb a64_emit_x64: bug: A64CallSupervisor trampled callee-save registers 1bfa04d emit_x64: bug: OP m/r64, imm32 form instructions sign-extend their immediate on x64 edadeea A64 inferface: Use two argument static_assert 9ab1304 A64: Add ExceptionRaised IR instruction 6843eed Update readme 7438d07 A64/translate: Add TranslateSingleInstruction function
* Fix build on macOS and linuxMerryMage2018-01-136-10/+11
|
* Update build scriptsMerryMage2018-01-138-43/+56
|
* yuzu: Update CONTRIBUTING.md.bunnei2018-01-131-4/+4
|
* yuzu: Update README.md.bunnei2018-01-131-22/+21
|
* arm_unicorn: Log unmapped memory access address.bunnei2018-01-131-1/+1
|
* config: Default log filter to trace.bunnei2018-01-133-3/+3
|
* yuzu: Update license text to be consistent across project.bunnei2018-01-1361-61/+61
|
* Remove settings issues in sdl and fix a few files that broke in mingwJames Rowe2018-01-135-53/+1
|
* Removing unused settings and yuzu rebrandingJames Rowe2018-01-1317-485/+69
|
* Get yuzu sdl to start compilingJames Rowe2018-01-135-12/+12
|
* Remove gpu debugger and get yuzu qt to compileJames Rowe2018-01-1348-3245/+47
|
* Remove references to PICA and rasterizers in video_coreJames Rowe2018-01-1377-16444/+4
|
* Massive removal of unused modulesJames Rowe2018-01-13179-21306/+23
|
* config: Default CPU core to Unicorn.bunnei2018-01-133-3/+3
|
* CMakeLists: Use C++ 17.bunnei2018-01-131-2/+2
|
* boost: Update version.bunnei2018-01-132-1/+1
|
* core: Gut out cryptop, since it doesn't compile with C++17.bunnei2018-01-138-300/+7
|
* dynarmic: Update to 83afe435MerryMage2018-01-121-0/+0
|
* configuration: Add cpu_core configuration optionMerryMage2018-01-128-16/+40
|
* arm_dynarmic: Implement coreMerryMage2018-01-1210-66/+175
|
* core: Include <algorithm> where used.bunnei2018-01-123-0/+6
|
* renderer_opengl: Fix LOG_TRACE in LoadFBToScreenInfo.bunnei2018-01-121-1/+1
|
* nv: Fix more broken asserts.bunnei2018-01-122-3/+3
|
* nvdisp_disp0: Fix broken assert.bunnei2018-01-121-1/+1
|
* core: Fix recent GCC build breaks.bunnei2018-01-122-2/+4
|
* svc: Implement GetSystemTick.bunnei2018-01-122-2/+21
|
* nvdisp_disp0: Call SwapBuffers to render framebuffer.bunnei2018-01-111-0/+7
|
* renderer_opengl: Support rendering Switch framebuffer.bunnei2018-01-113-138/+83
|
* render_base: Add a struct describing framebuffer metadata.bunnei2018-01-111-0/+26
|
* renderer_opengl: Add MortonCopyPixels function for Switch framebuffer.bunnei2018-01-111-0/+111
|
* renderer_opengl: Update DrawScreens for Switch.bunnei2018-01-112-23/+11
|
* CMakeLists: Add framebuffer_layout.cpp.bunnei2018-01-111-0/+1
|
* frontend: Update for undocked Switch screen layout.bunnei2018-01-118-279/+43
|
* NV: Move the nv device nodes to their own directory and namespace.Subv2018-01-1111-166/+430
|
* VI: Use a Pulse event instead of OneShot for the vblank events.Subv2018-01-111-1/+1
| | | | This prevents missing frames if the vblank fires between the DequeueBuffer and Wait(vsync) calls
* vi: Use new CoreTiming::EventTypebunnei2018-01-111-1/+5
|
* NV: Expose the nvdisp_disp0 device and a weak reference to the nvdrv:a service.Subv2018-01-116-172/+252
| | | | | | NVFlinger will call into the nvdisp_disp0 device to perform screen flips, bypassing the ioctl interface. We now have the address of the framebuffer to draw, we just need to actually put it on the screen.
* NV: Determine what buffer to draw for each layer of each display.Subv2018-01-112-13/+58
| | | | | | Don't try to draw buffers that the guest application is using, only queued buffers are eligible for drawing. Drawing actual pixels is still not implemented.
* NV: Signal all display's vsync event 60 times per second.Subv2018-01-112-1/+32
|
* NV: Give each display its own vsync event.Subv2018-01-112-12/+29
|
* NV: Keep track of Displays, Layers and BufferQueues in nvflinger.Subv2018-01-114-41/+261
|
* IPC: Allow passing arguments to the Interfaces when using PushIpcInterfaceSubv2018-01-111-3/+3
|
* NV: Implemented (with stubs) the vi:m service and some of its subservices.Subv2018-01-116-0/+726
| | | | The homebrew display test application now properly writes graphics data to the graphics buffer but we still don't have a way to compose the display layers.
* NV: Implemented the nvdrv:a service and the /dev/nvmap device.Subv2018-01-114-0/+354
|
* IPC: Corrected some definitions for the buffer C descriptor flags.Subv2018-01-113-3/+10
|
* svc: Stub ResetSignal and CreateTransferMemorySubv2018-01-112-3/+28
|
* svc: Stub SetMemoryAttributeSubv2018-01-112-0/+11
|
* Threads: Added enum values for the Switch's 4 cpu cores and implemented svcGetInfo(AllowedCpuIdBitmask)Subv2018-01-105-16/+28
|
* Services: Allow lm to log single-character messages.Subv2018-01-101-7/+3
|
* SVC: Fixed WaitSynchronization with multiple handles when none is immediately ready.Subv2018-01-091-7/+18
|
* SVC: Implemented CancelSynchronization.Subv2018-01-092-1/+19
|
* ErrorCodes: Updated the InvalidHandle and Timeout kernel error codes.Subv2018-01-091-2/+7
|
* SVC: Fixed WaitSynchronization with multiple handles when at least one of them is ready.Subv2018-01-092-3/+29
|
* kernel: Rename Semaphore to ConditionVariable.bunnei2018-01-0911-171/+180
|
* mutex: Remove unused call to VerifyGuestState.bunnei2018-01-091-3/+0
|
* Kernel: Actually wake up the requested number of threads in Semaphore::Release.Subv2018-01-094-21/+18
| | | | | | Also properly keep track of data in guest memory, this fixes managing the semaphore from userland. It was found that Semaphores are actually Condition Variables, with Release(1) and Release(-1) being equivalent to notify_one and notify_all. We should change the name of the class to reflect this.
* Kernel: Properly keep track of mutex lock data in the guest memory. This fixes userland locking/unlocking.Subv2018-01-094-67/+63
|
* Kernel: Allow chaining WaitSynchronization calls inside a wakeup callback.Subv2018-01-094-30/+78
|
* cmake: Use LIBUNICORN_* on Windows.bunnei2018-01-091-2/+2
|
* fix macos buildMerryMage2018-01-094-7/+7
|
* core_timing: Use 1.020GHz for core clock rate.bunnei2018-01-091-5/+3
|
* CoreTiming: Reworked CoreTiming (cherry-picked from Citra #3119)B3n302018-01-0912-557/+638
| | | | * CoreTiming: New CoreTiming; Add Test for CoreTiming
* IPC: Make DuplicateSession return the Domain instead of the Session if the request was made on a Domain interface.Subv2018-01-072-2/+7
|
* AppletOE: Fixed command buffer structure for ReceiveMessage.Subv2018-01-071-2/+1
|
* IPC: Corrected some command headers in the IPC Controller interface.Subv2018-01-071-4/+2
|
* IPC: Corrected some command header sizes in appletOE.Subv2018-01-071-12/+21
|
* IPC: Take the number of domain objects as a parameter in MakeBuilder.Subv2018-01-072-4/+6
|
* SM: Fixed connecting to services with an 8-byte name, like appletOE.Subv2018-01-071-12/+4
|
* IPC: Fixed pushing ResultCodes into the command buffer.Subv2018-01-072-7/+9
| | | | They should have 32 bits of padding after the error code now.
* IPC: Add functions to read the input move/copy objects from an IPC request.Subv2018-01-073-2/+42
|
* IPC: Don't attempt to read the command buffer if it holds a Close request.Subv2018-01-071-0/+5
|
* IPC Cleanup: Remove 3DS-specific code and translate copy, move and domain objects in IPC requests.Subv2018-01-078-405/+118
| | | | Popping objects from the buffer is still not implemented.
* IPC: Skip the entire u64 of the command id when receiving an IPC request.Subv2018-01-072-15/+5
| | | | Service code now doesn't have to deal with this.
* IPC: Use the correct size when pushing raw data to the command buffer and fixed pushing domain objects.Subv2018-01-074-10/+29
| | | | Domain object ids are always stored immediately after the raw data.
* svc: Implement svcSignalProcessWideKey.bunnei2018-01-072-4/+23
|
* audio: Log dropping frames as trace to reduce spam.bunnei2018-01-071-1/+1
|
* semaphore: More changes for Switch.bunnei2018-01-072-11/+17
|
* wait_object: Refactor to allow waking up a single thread.bunnei2018-01-072-15/+28
|
* nso: Always load the filepath specified by the user.bunnei2018-01-071-1/+3
|
* core_timing: Increase clock speed for Switch docked.bunnei2018-01-073-3/+3
|
* svc: Implement svcWaitProcessWideKeyAtomic.bunnei2018-01-062-1/+54
|
* semaphore: Updates for Switch.bunnei2018-01-062-21/+31
|
* lm: Assert on unsupported multi-message.bunnei2018-01-061-0/+9
|
* svc: Implement WaitSynchronization for a single handle.bunnei2018-01-061-4/+24
|
* svc: Refactor LockMutex code to use WaitSynchronization1.bunnei2018-01-061-13/+45
|
* lm: Improve Log() to format a useful string.bunnei2018-01-051-10/+75
|
* cmake: Add script to find Unicorn.bunnei2018-01-051-0/+18
|
* svc: Add missing string_util include.bunnei2018-01-051-0/+1
|
* cmake: Don't compile Dynarmic as it's unused.bunnei2018-01-042-9/+2
|
* core: Increase tight_loop 100x for speed.bunnei2018-01-041-1/+1
|
* citra_qt: Remove VFP registers, since this isn't used anyways and caused an assert.bunnei2018-01-041-4/+0
|
* arm_unicorn: Load/release unicorn DLL.bunnei2018-01-041-0/+16
|
* cmake: Add CopyYuzuUnicornDeps script.bunnei2018-01-041-0/+9
|
* externals: Use unicorn DLL instead of static lib.bunnei2018-01-043-2/+7
|
* unicorn: Use for arm interface on Windows.bunnei2018-01-045-9/+273
|
* DownloadExternals: Use yuzu repo.bunnei2018-01-041-1/+1
|
* arm_dynarmic: More cleanup.bunnei2018-01-041-6/+0
|
* core: Remove unicorn_dynload.bunnei2018-01-041-2/+0
|
* arm_dynarmic: Gut interface until dynarmic is ready for general use.bunnei2018-01-042-142/+44
|
* externals: Point dynarmic at a real commit.bunnei2018-01-041-0/+0
|
* gitmodules: Fix to include lz4.bunnei2018-01-041-0/+3
|
* arm: Remove SkyEye/Dyncom code that is ARMv6-only.bunnei2018-01-0337-28101/+23
|
* vm_manager: Use a more reasonable MAX_ADDRESS size.bunnei2018-01-031-5/+4
|
* svc: Remove unnecessary "svc" prefix to naming scheme.bunnei2018-01-031-106/+106
|
* pctl: Remove duplicate InstallInterfaces function.bunnei2018-01-031-4/+0
|
* hle: Move SVC code to kernel namespace.bunnei2018-01-034-134/+121
|
* svc: Improve svcGetInfo.bunnei2018-01-012-35/+41
|
* vm_manager: Stub out a bunch of interfaces used by svcGetInfo.bunnei2018-01-012-1/+51
|
* svc: Fix string formatting for CreateThread.bunnei2018-01-011-1/+1
|
* cmake: Add missing object_address_table.bunnei2018-01-011-0/+2
|
* core/video_core: Fix a bunch of u64 -> u32 warnings.bunnei2018-01-018-26/+26
|
* svc: Stub out svcWaitSynchronization.bunnei2018-01-011-1/+9
| | | | - This does not matter until we implement other kernel objects, mutexes use svcLockMutex for waiting.
* svc: Implement svcExitProcess.bunnei2018-01-013-11/+77
|
* svc: Implement svcUnlockMutex.bunnei2018-01-011-1/+11
|
* svc: Implement svcLockMutex.bunnei2018-01-013-24/+134
|
* kernel: Add ObjectAddressTable class.bunnei2018-01-013-2/+101
|
* thread: Keep track of the initially created handle.bunnei2017-12-313-2/+7
| | | | This is kinda crufty, but we need it for now to update guest state variables.
* svc: Implement svcExitThread.bunnei2017-12-311-1/+9
|
* svc: Implement svcCreateThread.bunnei2017-12-311-2/+57
|
* svc: Cleanup svcGetThreadPriority.bunnei2017-12-311-3/+5
|
* svc: Stub out svcGetCurrentProcessorNumber.bunnei2017-12-311-1/+7
|
* errors: Define missing kernel error codes.bunnei2017-12-311-0/+3
|
* svc: Implement svcSetThreadPriority.bunnei2017-12-311-1/+30
|
* svc: Change SignalProcessWideKey to a stub.bunnei2017-12-311-2/+2
|
* function_wrappers: Cleanup, fix warnings, remove unused code.bunnei2017-12-311-187/+35
|
* svc: Implement svcUnmapMemory.bunnei2017-12-313-1/+15
|
* svc: Minor cleanups.bunnei2017-12-301-8/+9
|
* svc: Implement svcStartThread.bunnei2017-12-301-0/+16
|
* thread: Main thread should set thread handle to reg 1.bunnei2017-12-301-1/+4
|
* thread: Remove THUMB mode flag.bunnei2017-12-301-1/+1
|
* thread: Main thread should be ready by default, all others dormant.bunnei2017-12-301-4/+3
|
* kernel: Various 64-bit fixes in memory/process/threadbunnei2017-12-295-14/+14
|
* applet_oe: Stub out a bunch of interfaces necessary for boot.bunnei2017-12-292-1/+159
|
* controller: Implement DuplicateSession.bunnei2017-12-292-9/+11
|
* kernel: Fix implementation of ConvertSessionToDomain.bunnei2017-12-2910-54/+90
|
* ap, aoc_u: Minor cleanup.bunnei2017-12-293-4/+1
|
* service: Add empty interface for pctl:a.bunnei2017-12-296-0/+90
|
* kernel: Add basic support for Domain object.bunnei2017-12-295-4/+112
|
* kernel: Add SyncObject primitive, use it for ClientSession.bunnei2017-12-294-10/+41
|
* svc: Implement MapMemory.bunnei2017-12-293-4/+17
|
* process: Add method to mirror a memory region.bunnei2017-12-292-0/+27
|
* svc: Implement SetHeapSize.bunnei2017-12-282-3/+19
|
* service: Clean up apm/lm/applet_oe/controller/sm ctor/dtor.bunnei2017-12-2810-20/+10
|
* service: Halt on ReportUnimplementedFunction and improve output log.bunnei2017-12-281-4/+2
|
* service: Add empty interface for aoc:u.bunnei2017-12-284-0/+44
|
* service: Return proper result code for IPC::CommandType::Close.bunnei2017-11-014-9/+12
|
* hle: Use Switch formatted result codes.bunnei2017-11-018-346/+110
|
* externals: Update dynarmic and xbyak.bunnei2017-10-252-0/+0
|
* svc: Implement GetThreadId and GetProcessId.bunnei2017-10-232-2/+37
|
* logging: Rename category "Core_ARM11" to "Core_ARM".bunnei2017-10-2310-89/+89
|
* nso: Load more common submodules.bunnei2017-10-231-15/+11
|
* memory: Support 32-bit paging, move heap address space up.bunnei2017-10-232-3/+3
|
* hle: Fix QueryMemory response for MemoryInfo.bunnei2017-10-207-149/+31
|
* lm: Implement lm::Initialize and Logger::log.bunnei2017-10-192-3/+67
|
* hle_ipc: Only copy necessary fields for outgoing command buffer.bunnei2017-10-191-1/+1
|
* hle_ipc: Parse out buffer X/A/B/B descriptors from incoming command buffer.bunnei2017-10-192-14/+19
|
* service: Add CreatePort function (that does not register/install).bunnei2017-10-192-0/+12
|
* memory: Print addresses as 64-bit.bunnei2017-10-191-2/+2
|
* ipc_helpers: Fix alignment (was wrong as a result of a dynarmic bug).bunnei2017-10-181-3/+4
|
* service: Print correct command ID on unimplemented function.bunnei2017-10-181-1/+1
|
* hle: Implement ConvertSessionToDomain, various cleanups.bunnei2017-10-1510-33/+82
|
* core: Refactor MakeMagic usage and remove dead code.bunnei2017-10-1511-885/+18
|
* hle: Add service stubs for apm and appletOE.bunnei2017-10-1510-2/+136
|
* hle: Initial implementation of NX service framework and IPC.bunnei2017-10-1521-859/+574
|
* nso: Add a log for loading submodules.bunnei2017-10-141-0/+1
|
* svc: Some logging cleanup.bunnei2017-10-141-7/+5
|
* svc: Update MemoryInfo flags for 64-bit.bunnei2017-10-141-5/+5
|
* svc: Initial nx impl. for QueryMemory, ConnectToPort, SendSyncRequest, etc.bunnei2017-10-141-1185/+185
|
* Remove more 3DS-specific code.bunnei2017-10-135-48/+3
|
* Remove more 3DS-specific code.bunnei2017-10-137-1414/+2
|
* Remove more 3DS-specific code.bunnei2017-10-133-55/+0
|
* Remove lots more 3DS-specific code.bunnei2017-10-1350-6976/+8
|
* hle: Remove a large amount of 3ds-specific service code.bunnei2017-10-10200-22393/+2
|
* Merge remote-tracking branch 'upstream/master' into nxbunnei2017-10-10241-2730/+20955
|\ | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # Conflicts: # src/core/CMakeLists.txt # src/core/arm/dynarmic/arm_dynarmic.cpp # src/core/arm/dyncom/arm_dyncom.cpp # src/core/hle/kernel/process.cpp # src/core/hle/kernel/thread.cpp # src/core/hle/kernel/thread.h # src/core/hle/kernel/vm_manager.cpp # src/core/loader/3dsx.cpp # src/core/loader/elf.cpp # src/core/loader/ncch.cpp # src/core/memory.cpp # src/core/memory.h # src/core/memory_setup.h
| * Merge pull request #2996 from MerryMage/split-travisJames Rowe2017-10-1014-227/+233
| |\ | | | | | | travis: Split build scripts for different platforms
| | * travis: Split build scripts for different platformsMerryMage2017-10-0714-227/+233
| | | | | | | | | | | | This commit also separates clang-format from the linux build, closing #2702.
| * | Merge pull request #3002 from Dragios/nwm-cmdhdr-fixJames Rowe2017-10-091-1/+1
| |\ \ | | | | | | | | Change command header in nwm::UDS Initialize function
| | * | Change command header in nwm::UDS Initialize functionDragios2017-10-091-1/+1
| |/ /
| * | Merge pull request #2991 from Subv/getpointerSebastian Valle2017-10-083-63/+61
| |\ \ | | |/ | |/| Remove more usages of GetPointer.
| | * SVC: Removed GetPointer usage in the GetResourceLimit functions.Subv2017-10-041-10/+16
| | |
| | * SVC: Remove GetPointer usage in CreatePort.Subv2017-10-042-6/+4
| | |
| | * SVC: Replace GetPointer usage with ReadCString in ConnectToPort.Subv2017-10-042-20/+9
| | |
| | * SVC: Replace GetPointer usage with ReadBlock in OutputDebugString.Subv2017-10-042-4/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in ReplyAndReceive.Subv2017-10-042-7/+6
| | |
| | * SVC: Replace GetPointer usage with Read32 in WaitSynchronizationN.Subv2017-10-042-8/+8
| | |
| | * Memory: Remove all GetPointer usages from the GDB stub.Subv2017-10-041-8/+12
| | |
| * | Merge pull request #2975 from shinyquagsire23/archive-ncch-container-and-overrideSebastian Valle2017-10-067-78/+581
| |\ \ | | | | | | | | file_sys/archive_ncch: use NCCHs/.apps instead of .romfs files, NCCH section override
| | * | file_sys, loader: add support for reading TMDs to determine app pathsshinyquagsire232017-10-012-5/+27
| | | |
| | * | file_sys: add class for Title Metadata (TMD)shinyquagsire232017-10-013-0/+338
| | | |
| | * | file_sys/ncch_container: add RomFS, ExeFS override to allow for backward compatibility with existing .romfs system archive dumpsshinyquagsire232017-10-012-69/+206
| | | |
| | * | file_sys/archive_ncch: use NCCHContainer instead of loading .romfs filesshinyquagsire232017-10-011-6/+12
| | | |
| * | | Merge pull request #2953 from Subv/applet_launchSebastian Valle2017-10-042-30/+47
| |\ \ \ | | | | | | | | | | HLE/APT: Always set up the APT parameter when starting a library applet.
| | * | | HLE/APT: Always set up the APT parameter when starting a library applet.Subv2017-09-262-30/+47
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Only use the HLE interface if an HLE applet with the desired id was started. This commit reorganizes the APT code surrounding parameter creation and delivery to make it easier to support LLE applets in the future. As future work, the HLE applet interface can be reworked to utilize the same facilities as the LLE interface.
| * | | | Merge pull request #2985 from huwpascoe/pica_regbunnei2017-10-041-217/+222
| |\ \ \ \ | | | | | | | | | | | | Extracted the attribute setup and draw commands into their own functions
| | * | | | Extracted the attribute setup and draw commands into their own functionsHuw Pascoe2017-10-041-217/+222
| |/ / / /
| * | | | Merge pull request #2977 from Subv/shmem_createbunnei2017-10-031-15/+12
| |\ \ \ \ | | | | | | | | | | | | SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it
| | * | | | Kernel/SharedMemory: Don't take over and unmap the source memory block when creating a shared memory, just reference it.Subv2017-10-021-15/+12
| | | |/ / | | |/| | | | | | | | | | | | Also reference the right offset into the backing block for the requested address.
| * | | | Merge pull request #2982 from MerryMage/lazy-macos-optJames Rowe2017-10-032-4/+4
| |\ \ \ \ | | |_|_|/ | |/| | | macOS: Build x86_64h slice
| | * | | macOS: Build x86_64h sliceMerryMage2017-10-022-4/+4
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | This commit produces a fat-binary with two slices. The x86_64 slice is for all x64 systems, and the x86_64h slice targets x64 systems starting with Haswell. The latter allows the compiler to use newer instructions that are not available on older microarchitectures.
| * | | Merge pull request #2971 from Subv/per_process_memopsSebastian Valle2017-10-014-22/+61
| |\ \ \ | | | | | | | | | | Memory: Add overloads for ReadBlock and WriteBlock that operate on a specific process.
| | * | | Memory: Make WriteBlock take a Process parameter on which to operateSubv2017-10-012-10/+19
| | | | |
| | * | | Memory: Make ReadBlock take a Process parameter on which to operateSubv2017-10-012-12/+30
| | | | |
| | * | | Kernel/Thread: Added a helper function to get a thread's command buffer VAddr.Subv2017-10-012-0/+12
| | | | |
| * | | | Merge pull request #2974 from Subv/nim_eventSebastian Valle2017-10-013-2/+29
| |\ \ \ \ | | |_|/ / | |/| | | Services/NIM: Implement CheckForSysUpdateEvent.
| | * | | Services/NIM: Implement CheckForSysUpdateEvent.Subv2017-09-303-2/+29
| | | | | | | | | | | | | | | | | | | | | | | | | Implementation verified by reverse engineering. This lets the Home Menu boot without crashing on startup.
| * | | | Merge pull request #2973 from huwpascoe/down_countSebastian Valle2017-09-309-43/+33
| |\ \ \ \ | | |/ / / | |/| | | Moved down_count to CoreTiming
| | * | | Moved down_count to CoreTimingHuw Pascoe2017-09-309-43/+33
| |/ / /
| * | | Services/UDS: Handle the rest of the connection sequence. (#2963)B3n302017-09-303-19/+250
| | | | | | | | | | | | Services/UDS: Handle the rest of the connection sequence.
| * | | Merge pull request #2972 from Subv/ignore_.vsJames Rowe2017-09-301-0/+4
| |\ \ \ | | | | | | | | | | Add the .vs folder and the CMakeSettings.json file from Visual Studio to gitignore
| | * | | Add the .vs folder and the CMakeSettings.json file from Visual Studio to gitignore.Subv2017-09-301-0/+4
| | | | |
| * | | | Merge pull request #2946 from Subv/home_menu_aptSebastian Valle2017-09-303-8/+45
| |\ \ \ \ | | |/ / / | |/| | | Implement PrepareToStartNewestHomeMenu and fixed an APT regression.
| | * | | HLE/APT: Always return an error from PrepareToStartNewestHomeMenu so that the Home Menu doesn't try to reboot the system.Subv2017-09-243-2/+26
| | | | | | | | | | | | | | | | | | | | | | | | | As per 3dbrew: "During Home Menu start-up it uses APT:PrepareToStartNewestHomeMenu. If that doesn't return an error(normally NS returns 0xC8A0CFFC for that), Home Menu starts a hardware reboot with APT:StartNewestHomeMenu etc. "
| | * | | HLE/APT: Prepare the APT Wakeup parameter when the game calls InitializeSubv2017-09-241-6/+19
| | | |/ | | |/| | | | | | | | | | | | | We need to know what is being run so we can set the APT parameter destination AppId correctly. Delaying the preparation of the parameter until we know which AppId is running lets us support booting both the Home Menu and normal game Applications.
| * | | Merge pull request #2967 from Subv/thread_wakeup_callbacksSebastian Valle2017-09-304-17/+91
| |\ \ \ | | |_|/ | |/| | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken
| | * | Kernel/Threads: When putting a thread to wait, specify a function to execute when it is awoken.Subv2017-09-284-17/+91
| | | | | | | | | | | | | | | | | | | | | | | | This change makes for a clearer (less confusing) path of execution in the scheduler, now the code to execute when a thread awakes is closer to the code that puts the thread to sleep (WaitSynch1, WaitSynchN). It also allows us to implement the special wake up behavior of ReplyAndReceive without hacking up WaitObject::WakeupAllWaitingThreads. If savestates are desired in the future, we can change this implementation to one similar to the CoreTiming event system, where we first register the callback functions at startup and assign their identifiers to the Thread callback variable instead of directly assigning a lambda to the wake up callback variable.
| * | | Merge pull request #2962 from huwpascoe/static_castSebastian Valle2017-09-3032-91/+97
| |\ \ \ | | | | | | | | | | Fixed type conversion ambiguity
| | * | | Fixed type conversion ambiguityHuw Pascoe2017-09-3032-91/+97
| |/ / /
| * | | Merge pull request #2961 from Subv/load_titlesbunnei2017-09-2917-70/+157
| |\ \ \ | | |/ / | |/| | Loaders: Don't automatically set the current process every time we load an application.
| | * | Loaders: Don't automatically set the current process every time we load an application.Subv2017-09-278-37/+40
| | | | | | | | | | | | | | | | The loaders will now just create a Kernel::Process, construct it and return it to the caller, which is responsible for setting it as the current process and configuring the global page table.
| | * | Kernel/Thread: Allow specifying which process a thread belongs to when creating it.Subv2017-09-274-17/+22
| | | | | | | | | | | | | | | | Don't automatically assume that Thread::Create will only be called when the parent process is currently scheduled. This assumption will be broken when applets or system modules are loaded.
| | * | Tests: Added Memory::IsValidVirtualAddress tests.Subv2017-09-272-0/+57
| | | |
| | * | Tests: Fixed ARM VFP testsSubv2017-09-271-9/+13
| | | |
| | * | Memory: Allow IsValidVirtualAddress to be called with a specific process parameter.Subv2017-09-272-7/+25
| | | | | | | | | | | | | | | | There is still an overload of IsValidVirtualAddress that only takes the VAddr and will default to the current process.
| * | | Merge pull request #2907 from Subv/warnings3Sebastian Valle2017-09-272-5/+9
| |\ \ \ | | | | | | | | | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.
| | * | | Disable unary operator- on Math::Vec2/Vec3/Vec4 for unsigned types.Subv2017-09-272-5/+9
| | | | | | | | | | | | | | | | | | | | | | | | | It is unlikely we will ever use this without first doing a Cast to a signed type. Fixes 9 "unary minus operator applied to unsigned type, result still unsigned" warnings on MSVC2017.3
| * | | | Merge pull request #2954 from Subv/cache_unmapped_memJames Rowe2017-09-271-1/+16
| |\ \ \ \ | | |_|/ / | |/| | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions
| | * | | Memory/RasterizerCache: Ignore unmapped memory regions when caching physical regions.Subv2017-09-261-1/+16
| | | |/ | | |/| | | | | | | | | | | | | | | | | Not all physical regions need to be mapped into the address space of every process, for example, system modules do not have a VRAM mapping. This fixes a crash when loading applets and system modules.
| * | | Merge pull request #2958 from Subv/audio_buffer_datatypeMerry2017-09-265-7/+9
| |\ \ \ | | | | | | | | | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16)
| | * | | Audio: Use std::deque instead of std::vector for the audio buffer type (StereoBuffer16).Subv2017-09-265-7/+9
| | | |/ | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | The current code inserts and deletes elements from the beginning of the audio buffer, which is very inefficient in an std::vector. Profiling was done using VisualStudio2017's Performance Analyzer in Super Mario 3D Land. Before this change: AudioInterp::Linear had 14.14% of the runtime (inclusive) and most of that time was spent in std::vector's insert implementation. After this change: AudioInterp::Linear has 0.36% of the runtime (inclusive)
| * | | Merge pull request #2947 from Subv/selfncch_factorySebastian Valle2017-09-266-18/+65
| |\ \ \ | | |/ / | |/| | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.
| | * | HLE/Archives: Allow multiple loaded applications to access their SelfNCCH archive independently.Subv2017-09-256-18/+65
| |/ / | | | | | | | | | | | | | | | | | | | | | The loaders now register each loaded ROM with the SelfNCCH factory, which keeps the data around for the duration of the emulation session. When opening the SelfNCCH archive, the factory queries the current program's programid and uses that as a key to the map that contains the NCCHData structure (RomFS, Icon, Banner, etc). 3dsx files do not have a programid and will use a default of 0 for this value, thus, only 1 3dsx file with RomFS is loadable at the same time.
| * | Merge pull request #2952 from MerryMage/page-tablesB3n302017-09-2512-27/+56
| |\ \ | | | | | | | | Switchable Page Tables
| | * | ARM_Interface: Implement PageTableChangedMerryMage2017-09-256-6/+39
| | | |
| | * | memory: Remove GetCurrentPageTablePointersMerryMage2017-09-242-10/+0
| | | |
| | * | memory: Add GetCurrentPageTable/SetCurrentPageTableMerryMage2017-09-247-13/+19
| | | | | | | | | | | | | | | | Don't expose Memory::current_page_table as a global.
| * | | Merge pull request #2951 from huwpascoe/perf-4B3n302017-09-251-10/+4
| |\ \ \ | | | | | | | | | | Optimized Morton
| | * | | Optimized MortonHuw Pascoe2017-09-241-10/+4
| | |/ /
| * | | Merge pull request #2949 from wwylele/fix-trB3n302017-09-253-21/+22
| |\ \ \ | | | | | | | | | | citra-qt: fix some untranslated strings
| | * | | citra-qt: fix some untranslated stringswwylele2017-09-243-21/+22
| | |/ /
| * | | Merge pull request #2948 from Subv/register_serviceB3n302017-09-254-1/+33
| |\ \ \ | | | | | | | | | | HLE/SRV: Implemented RegisterService.
| | * | | HLE/SRV: Implemented RegisterService.Subv2017-09-244-1/+33
| | | |/ | | |/| | | | | | | | | Now system modules can do more than just crash immediately on startup.
| * | | Loader/NCCH: Add support for loading application updates (#2927)Max Thomas2017-09-258-439/+670
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * loader/ncch: split NCCH parsing into its own file * loader/ncch: add support for loading update NCCHs from the SD card * loader/ncch: fix formatting * file_sys/ncch_container: Return a value for OpenFile * loader/ncch: cleanup, always instantiate overlay_ncch to base_ncch * file_sys/ncch_container: better encryption checks, allow non-app NCCHs to load properly and for the existence of NCCH structures to be checked * file_sys/ncch_container: pass filepath as a const reference
| * | | Services/UDS: Added a function to send EAPoL-Start packets (#2920)B3n302017-09-255-88/+250
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Added a function to generate the EAPoL-Start packet body. * Services/UDS: Added filter for beacons. * Services/UDS: Lock a mutex when accessing connection_status from both the emulation and network thread. * Services/UDS: Handle the Association Response frame and respond with the EAPoL-Start frame. * fixup: make use of current_node, changed received_beacons into a list, mutex and assert corrections * fixup: fix damn clang-format
| * | | Merge pull request #2944 from huwpascoe/perf-3Weiyi Wang2017-09-251-11/+7
| |\ \ \ | | |_|/ | |/| | Optimized Float<M,E> multiplication
| | * | Optimized Float<M,E> multiplicationHuw Pascoe2017-09-251-11/+7
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Before: ucomiss xmm1, xmm1 jp .L9 pxor xmm2, xmm2 mov edx, 1 ucomiss xmm0, xmm2 setp al cmovne eax, edx test al, al jne .L9 .L3: movaps xmm0, xmm2 ret .L9: ucomiss xmm0, xmm0 jp .L10 pxor xmm2, xmm2 mov edx, 1 ucomiss xmm1, xmm2 setp al cmovne eax, edx test al, al je .L3 After: movaps xmm2, xmm1 mulss xmm2, xmm0 ucomiss xmm2, xmm2 jnp .L3 ucomiss xmm1, xmm0 jnp .L11 .L3: movaps xmm0, xmm2 ret .L11: pxor xmm2, xmm2 jmp .L3
| * | Merge pull request #2921 from jroweboy/batch-fix-2James Rowe2017-09-241-12/+17
| |\ \ | | |/ | |/| GPU: Add draw for immediate and batch modes
| | * Remove pipeline.gpu_mode and fix minor issuesJames Rowe2017-09-231-12/+2
| | |
| | * GPU: Add draw for immediate and batch modesJames Rowe2017-09-111-2/+17
| | | | | | | | | | | | | | | | | | | | | | | | PR #1461 introduced a regression where some games would change configuration even while in the poorly named "drawing" mode, which broke the heuristic citra was using to determine when to draw the batch. This change adds back in a draw call for batching, and also adds in a draw call in immediate mode each time it adds a triangle.
| * | Merge pull request #2928 from huwpascoe/masterYuri Kunde Schlesner2017-09-221-7/+18
| |\ \ | | | | | | | | Fixed framebuffer warning
| | * | Fixed framebuffer warningHuw Pascoe2017-09-171-7/+18
| | | |
| * | | Merge pull request #2933 from huwpascoe/perf-1bunnei2017-09-191-1/+2
| |\ \ \ | | | | | | | | | | Improved performance of FromAttributeBuffer
| | * | | Improved performance of FromAttributeBufferHuw Pascoe2017-09-171-1/+2
| | |/ / | | | | | | | | | | | | | | | | | | | | | | | | Ternary operator is optimized by the compiler whereas std::min() is meant to return a value. I've noticed a 5%-10% emulation speed increase.
| * | | Merge pull request #2936 from B3n30/system_curl_linuxWeiyi Wang2017-09-191-1/+1
| |\ \ \ | | | | | | | | | | WebService: Set USE_SYSTEM_CURL for travis linux builds
| | * | | WebService: Set USE_SYSTEM_CURL for travis linux buildsB3n302017-09-191-1/+1
| |/ / /
| * / / WebService: Verify username and token (#2930)B3n302017-09-1918-38/+322
| |/ / | | | | | | | | | | | | | | | | | | | | | | | | | | | * WebService: Verify username and token; Log errors in PostJson * Fixup: added docstrings to the functions * Webservice: Added Icons to the verification, imrpved error detection in cpr, fixup nits * fixup: fmt warning
| * | Merge pull request #2906 from Subv/ns_new_frameworkYuri Kunde Schlesner2017-09-167-42/+77
| |\ \ | | | | | | | | Services/NS: Port ns:s to the new service framework.
| | * | Services/NS: Port ns:s to the new service framework.Subv2017-09-167-42/+77
| | | |
| * | | Merge pull request #2900 from wwylele/clip-2Yuri Kunde Schlesner2017-09-165-46/+116
| |\ \ \ | | | | | | | | | | PICA: implement custom clip plane
| | * | | SwRasterizer/Clipper: flip the sign convention to match PICA and OpenGLwwylele2017-08-251-9/+9
| | | | |
| | * | | gl_rasterizer: implement custom clip planewwylele2017-08-253-34/+83
| | | | |
| | * | | SwRasterizer: implement custom clip planewwylele2017-08-242-4/+25
| | | | |
| * | | | Merge pull request #2842 from Subv/switchable_page_tableB3n302017-09-1514-123/+191
| |\ \ \ \ | | | | | | | | | | | | Kernel/Memory: Give each process its own page table and allow switching the current page table upon reschedule
| | * | | | CPU/Dynarmic: Disable the fast page-table access in dynarmic until it supports switching page tables at runtime.Subv2017-09-151-1/+3
| | | | | |
| | * | | | Tests/VFP: Use a standalone pagetable for the TestEnvironment memory operations.Subv2017-09-151-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | This fixes building the tests
| | * | | | Kernel/Memory: Make IsValidPhysicalAddress not go through the current process' virtual memory mapping.Subv2017-09-151-2/+1
| | | | | |
| | * | | | Kernel/Threads: Don't clear the CPU instruction cache when performing a context switch from an idle thread into a thread in the same process.Subv2017-09-151-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | We were unnecessarily clearing the cache when going from Process A -> Idle -> Process A, this caused extreme performance regressions.
| | * | | | Kernel/Memory: Changed GetPhysicalPointer so that it doesn't go through the current process' page table to obtain a pointer.Subv2017-09-154-30/+69
| | | | | |
| | * | | | Kernel/Memory: Switch the current page table when a new process is scheduled.Subv2017-09-101-0/+10
| | | | | |
| | * | | | Kernel/Memory: Give each Process its own page table.Subv2017-09-109-87/+93
| | | | | | | | | | | | | | | | | | | | | | | | The loader is in charge of setting the newly created process's page table as the main one during the loading process.
| * | | | | Merge pull request #2915 from wwylele/font-archive-2bunnei2017-09-123-135/+155
| |\ \ \ \ \ | | | | | | | | | | | | | | APT: load different shared font depending on the region
| | * | | | | APT: load different shared font depending on the regionwwylele2017-09-033-135/+155
| | | | | | |
| * | | | | | Merge pull request #2922 from jroweboy/mingw-telemetrybunnei2017-09-114-27/+49
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Build: Enable SSL in mingw by linking against WinSSL
| | * | | | | | Build: Enable SSL in mingw by linking against WinSSLJames Rowe2017-09-114-27/+49
| | | |_|_|_|/ | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The mingw builds aren't submitting telemetry because the curl library they are linked against is configured to use openSSL and openSSL looks for the certificates in the users home folder. This keeps it from contacting web services because it can't communicate over SSL. This commit adds a download in mingw builds that will download a precompiled curl for mingw linked against winssl and sspi.
| * | | | | | Merge pull request #2923 from B3n30/system_curl_osxJames Rowe2017-09-101-1/+1
| |\ \ \ \ \ \ | | |/ / / / / | |/| | | | | travis_OSX: build with system curl
| | * | | | | trvis_OSX: build with system curlB3n302017-09-091-1/+1
| |/ / / / /
| * | | | | Merge pull request #2865 from wwylele/gs++bunnei2017-09-0815-37/+594
| |\ \ \ \ \ | | | | | | | | | | | | | | PICA: implemented geometry shader
| | * | | | | pica/command_processor: build geometry pipeline and run geometry shaderwwylele2017-08-196-28/+383
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The geometry pipeline manages data transfer between VS, GS and primitive assembler. It has known four modes: - no GS mode: sends VS output directly to the primitive assembler (what citra currently does) - GS mode 0: sends VS output to GS input registers, and sends GS output to primitive assembler - GS mode 1: sends VS output to GS uniform registers, and sends GS output to primitive assembler. It also takes an index from the index buffer at the beginning of each primitive for determine the primitive size. - GS mode 2: similar to mode 1, but doesn't take the index and uses a fixed primitive size. hwtest shows that immediate mode also supports GS (at least for mode 0), so the geometry pipeline gets refactored into its own class for supporting both drawing mode. In the immediate mode, some games don't set the pipeline registers to a valid value until the first attribute input, so a geometry pipeline reset flag is set in `pipeline.vs_default_attributes_setup.index` trigger, and the actual pipeline reconfigure is triggered in the first attribute input. In the normal drawing mode with index buffer, the vertex cache is a little bit modified to support the geometry pipeline. Instead of OutputVertex, it now holds AttributeBuffer, which is the input to the geometry pipeline. The AttributeBuffer->OutputVertex conversion is done inside the pipeline vertex handler. The actual hardware vertex cache is believed to be implemented in a similar way (because this is the only way that makes sense). Both geometry pipeline and GS unit rely on states preservation across drawing call, so they are put into the global state. In the future, the other three vertex shader units should be also placed in the global state, and a scheduler should be implemented on top of the four units. Note that the current gs_unit already allows running VS on it in the future.
| | * | | | | pica/shader/jit: implement SETEMIT and EMITwwylele2017-08-192-2/+49
| | | | | | |
| | * | | | | pica/primitive_assembly: Handle winding for GS primitivewwylele2017-08-192-3/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | hwtest shows that, although GS always emit a group of three vertices as one primitive, it still respects to the topology type, as if the three vertices are input into the primitive assembler independently and sequentially. It is also shown that the winding flag in SETEMIT only takes effect for Shader topology type, which is believed to be the actual difference between List and Shader (hence removed the TODO). However, only Shader topology type is observed in official games when GS is in use, so the other mode seems to be just unintended usage.
| | * | | | | correct constnesswwylele2017-08-192-2/+4
| | | | | | |
| | * | | | | pica/shader/interpreter: implement SETEMIT and EMITwwylele2017-08-191-0/+16
| | | | | | |
| | * | | | | pica/shader: extend UnitState for GSwwylele2017-08-192-0/+84
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Among four shader units in pica, a special unit can be configured to run both VS and GS program. GSUnitState represents this unit, which extends UnitState (which represents the other three normal units) with extra state for primitive emitting. It uses lots of raw pointers to represent internal structure in order to keep it standard layout type for JIT to access. This unit doesn't handle triangle winding (inverting) itself; instead, it calls a WindingSetter handler. This will be explained in the following commits
| | * | | | | pica/regs: layout geometry shader configuration regswwylele2017-08-102-2/+39
| | | | | | | | | | | | | | | | | | | | | | | | | | | | All the register meanings are derived from ctrulib (3dbrew is outdated for most of them)
| * | | | | | Merge pull request #2918 from jroweboy/remove-debugJames Rowe2017-09-061-0/+6
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove excess debug dlls for mingw build
| | * | | | | | Remove excess debug dlls for mingw buildJames Rowe2017-09-061-0/+6
| |/ / / / / /
| * | | | | | Merge pull request #2914 from wwylele/fresnel-fixbunnei2017-09-052-7/+9
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | pica/lighting: only apply Fresnel factor for the last light
| | * | | | | | pica/lighting: only apply Fresnel factor for the last lightwwylele2017-09-032-7/+9
| | | | | | | |
| * | | | | | | Merge pull request #2831 from Subv/uds_authWeiyi Wang2017-09-057-53/+289
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Services/UDS: Handle beacon frames and the basic AP connection sequence frames.
| | * | | | | | | Services/UDS: Remove an old duplicated declaration of WifiPacket.Subv2017-08-272-22/+0
| | | | | | | | |
| | * | | | | | | Services/UDS: Handle the connection sequence packets.Subv2017-08-271-17/+83
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There is currently no stage tracking, a client is considered "Connected" when it receives the EAPoL Logoff packet from the server, this is not yet implemented.
| | * | | | | | | Services/UDS: Store the received beacon frames until RecvBeaconBroadcastData is called, up to 15 beacons at the same time, removing any older beacon frames when the limit is exceeded.Subv2017-08-271-3/+62
| | | | | | | | |
| | * | | | | | | Services/UDS: Add functions to generate 802.11 auth and assoc response frames.Subv2017-08-275-11/+144
| | | | | | | | |
| * | | | | | | | Merge pull request #2876 from mailwl/mii-struWeiyi Wang2017-09-052-34/+29
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Mii Selector Applet: update Mii structures
| | * | | | | | | | Remove _flag in var namesmailwl2017-09-041-6/+6
| | | | | | | | | |
| | * | | | | | | | Mii Selector Applet: update Mii structuresmailwl2017-09-042-34/+29
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2917 from jroweboy/icon_fixWeiyi Wang2017-09-041-1/+3
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix icon for citra qt
| | * | | | | | | | Fix icon for citra qtJames Rowe2017-09-031-1/+3
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2911 from DaMan69/masterJames Rowe2017-09-034-2/+42
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Add manifest
| | * | | | | | | | Add manifestDaMan2017-09-034-2/+42
| | | |_|_|/ / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2912 from jroweboy/mingw-masterJames Rowe2017-09-021-40/+123
| |\ \ \ \ \ \ \ \ | | |/ / / / / / / | |/| | | | | | | Build: Add mingw64 compile support to appveyor
| | * | | | | | | Build: Add mingw64 compile support to appveyorJames Rowe2017-09-011-40/+123
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Releases will be built with both mingw and msvc and the binaries of both builds will be uploaded to github releases
| * | | | | | | | Merge pull request #2909 from wwylele/telemetry-gasbunnei2017-08-311-0/+6
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | video_core: report telemetry for gas mode
| | * | | | | | | | video_core: report telemetry for gas modewwylele2017-08-311-0/+6
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2858 from MerryMage/interp-on-a-frame-basisbunnei2017-08-313-88/+74
| |\ \ \ \ \ \ \ \ | | |/ / / / / / / | |/| | | | | | | interpolate: Interpolate on a frame-by-frame basis
| | * | | | | | | interpolate: Interpolate on a frame-by-frame basisMerryMage2017-08-283-88/+74
| | | | | | | | |
| * | | | | | | | Merge pull request #2891 from wwylele/sw-bumpbunnei2017-08-314-10/+40
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | SwRasterizer/Lighting: implement bump mapping
| | * | | | | | | gl_rasterizer/lighting: more accurate CP formulawwylele2017-08-221-2/+2
| | | | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement LUT input CPwwylele2017-08-221-0/+11
| | | | | | | | |
| | * | | | | | | SwRasterizer/Lighting: implement bump mappingwwylele2017-08-223-8/+27
| | | | | | | | |
| * | | | | | | | Merge pull request #2899 from wwylele/touch-refactorbunnei2017-08-298-43/+87
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Refactor touch input into a TouchDevice
| | * | | | | | | | EmuWindow: refactor touch input into a TouchDevicewwylele2017-08-245-39/+72
| | | | | | | | | |
| | * | | | | | | | HID: use TouchDevice for touch padwwylele2017-08-243-4/+15
| | | |_|_|_|_|/ / | | |/| | | | | |
| * | | | | | | | Merge pull request #2905 from danzel/fix-2902Sebastian Valle2017-08-294-5/+5
| |\ \ \ \ \ \ \ \ | | |_|_|_|_|_|_|/ | |/| | | | | | | Use recursive_mutex instead of mutex to fix #2902
| | * | | | | | | Use recursive_mutex instead of mutex to fix #2902danzel2017-08-294-5/+5
| | |/ / / / / /
| * | | | | | | Merge pull request #2901 from stone3311/masterWeiyi Wang2017-08-281-1/+1
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix info about TODO list
| | * | | | | | | Fix info about TODO liststone33112017-08-261-1/+1
| | | | | | | | |
| * | | | | | | | Merge pull request #2892 from Subv/warnings2Weiyi Wang2017-08-283-6/+10
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Warnings: Fixed a few missing-return warnings in video_core.
| | * | | | | | | | Warnings: Fixed a few missing-return warnings in video_core.Subv2017-08-263-6/+10
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2897 from bunnei/telemetry-uibunnei2017-08-2720-48/+446
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | Telemetry UI and final touches
| | * | | | | | | web_backend: Fix CPR bug where Winsock is not properly initializing.bunnei2017-08-271-15/+27
| | | | | | | | |
| | * | | | | | | web_backend: Fix asynchronous JSON post by spawning new thread.bunnei2017-08-261-9/+18
| | | | | | | | |
| | * | | | | | | web_services: Refactor to remove dependency on Core.bunnei2017-08-265-20/+35
| | | | | | | | |
| | * | | | | | | qt: Add an option to view/regenerate telemetry ID.bunnei2017-08-264-7/+40
| | | | | | | | |
| | * | | | | | | default_ini: Use correct telemetry endpoint URL.bunnei2017-08-261-1/+1
| | | | | | | | |
| | * | | | | | | # This is a combination of 2 commits.bunnei2017-08-261-3/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | # This is the 1st commit message: qt: Add web configuration tab. # The commit message #2 will be skipped: # fixup! qt: Add web configuration tab.
| | * | | | | | | qt: Add web configuration tab.bunnei2017-08-266-2/+217
| | | | | | | | |
| | * | | | | | | web_backend: User config for username and token, support anonymous post.bunnei2017-08-262-40/+17
| | | | | | | | |
| | * | | | | | | telemetry: Log frontend type.bunnei2017-08-262-0/+4
| | | | | | | | |
| | * | | | | | | settings: Add enable_telemetry, citra_username, and citra_token.bunnei2017-08-264-0/+20
| | | | | | | | |
| | * | | | | | | telemetry_session: Log telemetry ID.bunnei2017-08-261-0/+36
| | | | | | | | |
| | * | | | | | | citra_qt: Show one-time callout messages to user.bunnei2017-08-264-0/+50
| |/ / / / / / /
| * | / / / / / SidebySide Layout (#2859)ThaMighty902017-08-256-7/+61
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * added a SidebySide Layout * Reworked, so both screen have the same height and cleaned up screen translates. * added the option in the UI, hope this is the right way to do it. formated framebuffer_layout.cpp * delete the x64 files * deleted ui_configure_graphics.h * added Option for the Layout in the xml * got rid of SIDE_BY_SIDE_ASPECT_RATIO because it was useless. pulled translate into variables * changed shift variables to u32 and moved them in their respective branch. remove notr="true" for the Screen layout drop down * reworked intends :). changed function description for SideFrameLayout * some description reworking
| * | | | | | Merge pull request #2839 from Subv/global_kernel_lockJames Rowe2017-08-246-4/+46
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).
| | * | | | | | Kernel/Memory: Acquire the global HLE lock when a memory read/write operation falls outside of the fast path, for it might perform an MMIO operation.Subv2017-08-221-1/+8
| | | | | | | |
| | * | | | | | Kernel/HLE: Use a mutex to synchronize access to the HLE kernel state between the cpu thread and any other possible threads that might touch the kernel (network thread, etc).Subv2017-08-225-3/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This mutex is acquired in SVC::CallSVC, ie, as soon as the guest application enters the HLE kernel, and should be acquired by the aforementioned threads before modifying kernel structures.
| * | | | | | | Merge pull request #2893 from Subv/not_schedule_main_threadbunnei2017-08-221-5/+1
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.
| | * | | | | | | Kernel/Threads: Don't immediately switch to the new main thread when loading a new process.Subv2017-08-221-5/+1
| | | |/ / / / / | | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is necessary for loading multiple processes at the same time. The main thread will be automatically scheduled when necessary once the scheduler runs.
| * | | | | | | Merge pull request #2888 from Subv/warningsJames Rowe2017-08-2211-17/+22
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fixed some warnings in the core project.
| | * | | | | | | GPU/Warnings: Explicitly cast the screen refresh ticks to u64.Subv2017-08-211-1/+1
| | | | | | | | |
| | * | | | | | | Warnings: Add UNREACHABLE macros to switches that contemplate all possible values.Subv2017-08-213-2/+7
| | | | | | | | |
| | * | | | | | | HLE/Applets: Fixed some conversion warnings when creating the framebuffer shared memory objects.Subv2017-08-214-8/+8
| | | | | | | | |
| | * | | | | | | CPU/Dynarmic: Fixed a warning when incrementing the number of ticks in ExecuteInstructions.Subv2017-08-211-1/+1
| | | | | | | | |
| | * | | | | | | Dyncom: Use size_t instead of int to store the instruction offsets in the instruction cache.Subv2017-08-212-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes a few warnings.
| | * | | | | | | Dyncom: Fixed a conversion warning when decoding thumb instructions.Subv2017-08-211-1/+1
| | |/ / / / / /
| * | | | | | | Merge pull request #2894 from wwylele/motion-emu-fixbunnei2017-08-221-1/+4
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | motion_emu: fix initialization order
| | * | | | | | | motion_emu: fix initialization orderwwylele2017-08-221-1/+4
| |/ / / / / / /
| * | | | | | | Merge pull request #2884 from wwylele/clipbunnei2017-08-216-10/+28
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICA
| | * | | | | | | swrasterizer: remove invalid TODOwwylele2017-08-211-4/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function is called in clipping, before the pespective divide, and is not used in later rasterization. Thus it doesn't need perspective correction.
| | * | | | | | | swrasterizer/clipper: remove tested TODOwwylele2017-08-211-4/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | hwtested. Current implementation is the correct behavior
| | * | | | | | | gl_shader_gen: simplify and clarify the depth transformation between vertex shader and fragment shaderwwylele2017-08-211-2/+5
| | | | | | | | |
| | * | | | | | | gl_rasterizer: add clipping plane z<=0 defined in PICAwwylele2017-08-214-0/+21
| | |/ / / / / /
| * | | | | | | Merge pull request #2889 from Schplee/updated-logo-svgbunnei2017-08-214-79/+1
| |\ \ \ \ \ \ \ | | |/ / / / / / | |/| | | | | | Updated master logo to new logo svg
| | * | | | | | Updated master logo to new logo svgSchplee2017-08-204-79/+1
| | | |_|_|_|/ | | |/| | | |
| * | | | | | Merge pull request #2872 from wwylele/sw-geo-factorYuri Kunde Schlesner2017-08-211-4/+16
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | SwRasterizer/Lighting: implement geometric factor
| | * | | | | | SwRasterizer/Lighting: implement geometric factorwwylele2017-08-111-4/+16
| | | | | | | |
| * | | | | | | Merge branch 'update-soundtouch' (PR #2885)Yuri Kunde Schlesner2017-08-211-0/+0
| |\ \ \ \ \ \ \
| | * | | | | | | externals: Update soundtouchMerryMage2017-08-211-0/+0
| | | | | | | | |
| * | | | | | | | Merge pull request #2861 from wwylele/motion-refactorJames Rowe2017-08-2020-277/+302
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Refactor MotionEmu into a InputDevice
| | * | | | | | | | HID: fix a comment and a warningwwylele2017-08-201-2/+2
| | | | | | | | | |
| | * | | | | | | | motion_emu: no need to include thread in headerwwylele2017-08-192-2/+7
| | | | | | | | | |
| | * | | | | | | | move MotionEmu from core/frontend to input_common as a InputDevicewwylele2017-08-1117-244/+221
| | | | | | | | | |
| | * | | | | | | | HID: use MotionDevice for Accelerometer and Gyroscopewwylele2017-08-113-5/+48
| | | | | | | | | |
| * | | | | | | | | Merge pull request #2871 from wwylele/sw-spotlightJames Rowe2017-08-201-3/+19
| |\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / / | |/| | | | | | | | SwRasterizer/Lighting: implement spot light
| | * | | | | | | | SwRasterizer/Lighting: implement spot lightwwylele2017-08-111-3/+19
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Added missing parts in libnetwork (#2838)B3n302017-08-199-37/+310
| | |_|/ / / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Network: Set and send the game information over enet Added Callbacks for RoomMember and GetMemberList to Room in preparation for web_services.
| * | | | | | | Merge pull request #2881 from MerryMage/dsp-firm-checkYuri Kunde Schlesner2017-08-161-3/+4
| |\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | dsp_dsp: Remove size assertion in LoadComponent
| | * | | | | | | dsp_dsp: Remove size assertion in LoadComponentMerryMage2017-08-151-3/+4
| | | | | | | | |
| * | | | | | | | Merge pull request #2879 from danzel/patch-1bunnei2017-08-141-1/+1
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix Spelling/English mistakes
| | * | | | | | | | Fix Spelling/English mistakesDave Leaver2017-08-131-1/+1
| |/ / / / / / / /
| * | | | | | | | Merge pull request #2843 from Subv/applet_slotsSebastian Valle2017-08-122-35/+200
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System)
| | * | | | | | | | Services/APT: Use the AppletAttributes union directly when dealing with applet attrs.Subv2017-08-071-19/+15
| | | | | | | | | |
| | * | | | | | | | Services/APT: Use an array to hold data about the 4 possible concurrent applet types (Application, Library, HomeMenu, System).Subv2017-08-072-35/+204
| | |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | This gives each applet type its own set of events as per the real NS module.
| * | | | | | | | Merge pull request #2875 from wwylele/bump-skipWeiyi Wang2017-08-121-4/+5
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | gl_shader_gen: don't call SampleTexture when bump map is not used
| | * | | | | | | | gl_shader_gen: don't call SampleTexture when bump map is not usedwwylele2017-08-111-4/+5
| | | |_|/ / / / / | | |/| | | | | |
| * | | | | | | | Merge pull request #2869 from j-selby/docker-buildJames Rowe2017-08-114-50/+26
| |\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Travis: Use Docker to build for Linux
| | * | | | | | | | Travis: Use Docker to build for LinuxJames2017-08-104-50/+26
| | | | | | | | | |
| * | | | | | | | | Merge pull request #2867 from j-selby/tag-namingJames Rowe2017-08-112-8/+23
| |\ \ \ \ \ \ \ \ \ | | |_|/ / / / / / / | |/| | | | | | | | Implement correct folder structure for CI builds
| | * | | | | | | | Implement correct folder structure for CI buildsj-selby2017-08-102-8/+23
| | | | | | | | | |
| * | | | | | | | | Merge pull request #2874 from danzel/spelling-1Weiyi Wang2017-08-112-4/+4
| |\ \ \ \ \ \ \ \ \ | | |_|_|_|/ / / / / | |/| | | | | | | | Fix some spelling mistakes
| | * | | | | | | | Fix some spelling mistakesdanzel2017-08-112-4/+4
| | |/ / / / / / /
| * | | | | | | | Merge pull request #2863 from wwylele/pad-state-zeroWeiyi Wang2017-08-102-2/+2
| |\ \ \ \ \ \ \ \ | | |_|/ / / / / / | |/| | | | | | | HID: zero unused PadState bits
| | * | | | | | | HID: zero unused PadState bitswwylele2017-08-102-2/+2
| | | |/ / / / / | | |/| | | | |
| * | | | | | | Merge pull request #2868 from wwylele/swr-tupleWeiyi Wang2017-08-101-1/+1
| |\ \ \ \ \ \ \ | | |_|/ / / / / | |/| | | | | | SwRasterizer/Lighting: use make_tuple instead of constructor
| | * | | | | | SwRasterizer/Lighting: use make_tuple instead of constructorwwylele2017-08-101-1/+1
| |/ / / / / / | | | | | | | | | | | | | | | | | | | | | implicit tuple constructor is a c++17 thing, which is not supported by some not-so-old libraries. Play safe for now
| * | | | | | Merge pull request #2857 from j-selby/deploy-fixJames Rowe2017-08-103-126/+116
| |\ \ \ \ \ \ | | |_|_|_|_|/ | |/| | | | | Travis/AppVeyor: Deploy based upon tags
| | * | | | | Travis/AppVeyor: Deploy based upon tagsj-selby2017-08-063-126/+116
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2862 from j-selby/update-cryptoppbunnei2017-08-092-1/+1
| |\ \ \ \ \ | | | | | | | | | | | | | | Update CryptoPP (byte ambiguity)
| | * | | | | Update cryptoppJames2017-08-082-1/+1
| | | |/ / / | | |/| | |
| * | | | | Merge pull request #2822 from wwylele/sw_lighting-2Weiyi Wang2017-08-098-9/+315
| |\ \ \ \ \ | | | | | | | | | | | | | | Implement fragment lighting in the sw renderer (take 2)
| | * | | | | SwRasterizer/Lighting: shorten file namewwylele2017-08-034-4/+4
| | | | | | |
| | * | | | | SwRasterizer/Lighting: move to its own filewwylele2017-08-024-240/+271
| | | | | | |
| | * | | | | SwRasterizer/Lighting: reduce confusionwwylele2017-08-021-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: move quaternion normalization to the callerwwylele2017-08-021-3/+3
| | | | | | |
| | * | | | | SwRasterizer/Lighting: dist atten lut input need to be clampwwylele2017-07-111-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: unify float suffixwwylele2017-07-111-11/+13
| | | | | | |
| | * | | | | SwRasterizer/Lighting: get rid of nested returnwwylele2017-07-111-10/+11
| | | | | | |
| | * | | | | SwRasterizer/Lighting: refactor GetLutValue into a function.wwylele2017-07-111-83/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | merging similar pattern. Also makes the code more similar to the gl one
| | * | | | | SwRasterizer: only interpolate quat and view when lighting is enabledwwylele2017-07-111-14/+14
| | | | | | |
| | * | | | | vector_math: remove dead template parameterwwylele2017-07-111-1/+1
| | | | | | |
| | * | | | | SwRasterizer/Lighting: pass lighting state as parameterwwylele2017-07-111-13/+13
| | | | | | |
| | * | | | | vector_math: remove broken SFINAE stuffwwylele2017-07-111-3/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | this was originally added to eliminate warnings on MSVC, but it doesn't work for custom types.
| | * | | | | SwRasterizer/Lighting: Move the clamp highlight calculation to the end of the per-light loop body.Subv2017-07-111-17/+17
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Move the lighting enable check outside the ComputeFragmentsColors function.Subv2017-07-111-7/+6
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Do not use global registers state in ComputeFragmentsColors.Subv2017-07-111-3/+3
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Do not use global state in LookupLightingLut.Subv2017-07-112-13/+22
| | | | | | |
| | * | | | | SwRasterizer/Lighting: Fixed a bug where the distance attenuation bias was being set to the dist atten scale.Subv2017-07-111-3/+2
| | | | | | |
| | * | | | | SwRasterizer: Fixed a few conversion warnings and moved per-light values into the per-light loop.Subv2017-07-111-5/+6
| | | | | | |
| | * | | | | SwRasterizer: Run clang-formatSubv2017-07-111-45/+83
| | | | | | |
| | * | | | | SwRasterizer: Flip the vertex quaternions before clipping (if necessary).Subv2017-07-113-21/+16
| | | | | | |
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-111-6/+7
| | | | | | |
| | * | | | | SwRasterizer: Corrected the light LUT lookups.Subv2017-07-112-33/+48
| | | | | | |
| | * | | | | SwRasterizer: Fixed the lighting lut lookup function.Subv2017-07-111-2/+4
| | | | | | |
| | * | | | | SwRasterizer: Calculate fresnel for fragment lighting.Subv2017-07-111-1/+25
| | | | | | |
| | * | | | | SwRasterizer: Calculate specular_1 for fragment lighting.Subv2017-07-111-3/+59
| | | | | | |
| | * | | | | SwRasterizer: Calculate specular_0 for fragment lighting.Subv2017-07-111-13/+94
| | | | | | |
| | * | | | | SwRasterizer: Implement primary fragment color.Subv2017-07-111-4/+113
| | | | | | |
| * | | | | | Merge pull request #2856 from wwylele/shader-shareWeiyi Wang2017-08-092-26/+45
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | pica: upload shared shader code & swizzle to both unit
| | * | | | | | pica: upload shared shader code to both unitwwylele2017-08-072-26/+45
| | | | | | | |
| * | | | | | | Merge pull request #2864 from mailwl/dlp-updatebunnei2017-08-093-4/+44
| |\ \ \ \ \ \ \ | | |_|_|/ / / / | |/| | | | | | Service/dlp: Update function tables according 3dbrew
| | * | | | | | Service/dlp: Update function tables according 3dbrewmailwl2017-08-093-4/+44
| |/ / / / / /
| * | | | | | Merge pull request #2860 from anodium/patch-1James Rowe2017-08-051-1/+1
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Quickfix typo in OpenGL 3.3 error message
| | * | | | | | Quickfix typo in OpenGL 3.3 error messageAndrea Pascal2017-08-051-1/+1
| |/ / / / / / | | | | | | | | | | | | | | User pointed out on the Discord server that "nothave" is erroneously concatenated. Added a space to prevent it.
| * | | | | | Merge pull request #2855 from bunnei/telemetry-additional-fieldsJames Rowe2017-08-049-17/+68
| |\ \ \ \ \ \ | | |_|_|/ / / | |/| | | | | Telemetry: Add several more useful fields
| | * | | | | telemetry: Add field for OsPlatform.bunnei2017-08-041-0/+9
| | | | | | |
| | * | | | | telemetry: Add field for BuildName.bunnei2017-08-041-0/+1
| | | | | | |
| | * | | | | telemetry: Add field for RequiresSharedFont.bunnei2017-08-041-0/+4
| | | | | | |
| | * | | | | telemetry_session: Log BuildDate and ProgramName fields.bunnei2017-08-041-0/+7
| | | | | | |
| | * | | | | common: Add build timestamp to scm_rev.bunnei2017-08-043-1/+11
| | | | | | |
| | * | | | | core: Expose AppLoader as a public interface.bunnei2017-08-041-4/+5
| | | | | | |
| | * | | | | loader: Expose program title.bunnei2017-08-043-12/+31
| |/ / / / /
| * | | | | Merge pull request #2850 from j-selby/fix_invalid_pathsYuri Kunde Schlesner2017-08-012-4/+78
| |\ \ \ \ \ | | |/ / / / | |/| | | | Handle invalid filenames when renaming files/directories
| | * | | | Handle invalid filenames when renaming files/directoriesJames2017-07-312-4/+78
| |/ / / /
| * | | | Merge pull request #2848 from wwylele/shader-loop-fixWeiyi Wang2017-07-291-1/+1
| |\ \ \ \ | | | | | | | | | | | | pica/shader_interpreter: fix off-by-one in LOOP
| | * | | | pica/shader_interpreter: fix off-by-one in LOOPwwylele2017-07-271-1/+1
| | | | | |
| * | | | | Merge pull request #2849 from j-selby/masterJames Rowe2017-07-294-4/+21
| |\ \ \ \ \ | | | | | | | | | | | | | | Produce 7zip artifacts on Travis and Appveyor
| | * | | | | Produce 7zip artifacts on Travis and Appveyorj-selby2017-07-284-4/+21
| |/ / / / /
| * | | | | Merge pull request #2679 from MerryMage/interp-testsbunnei2017-07-276-1/+13717
| |\ \ \ \ \ | | | | | | | | | | | | | | DynCom VFP tests
| | * | | | | tests: Add tests for vaddMerryMage2017-07-236-3/+13511
| | | | | | |
| | * | | | | tests: Arm testing frameworkMerryMage2017-07-233-0/+208
| | |/ / / /
| * | | | | Merge pull request #2840 from Subv/apt_parameterbunnei2017-07-272-33/+105
| |\ \ \ \ \ | | | | | | | | | | | | | | Services/APT: Corrected the behavior of the Receive/Send/Glance/CancelParameter functions
| | * | | | | Service/APT: Log Send/Cancel/Receive/GlanceParameter calls even if they return an error.Subv2017-07-211-7/+9
| | | | | | |
| | * | | | | Services/APT: Return the proper error code when calling SendParameter with an outstanding parameter already in memory.Subv2017-07-212-4/+17
| | | | | | |
| | * | | | | Services/APT: Reset the APT parameter inside CancelParameter if the conditions are met.Subv2017-07-211-6/+23
| | | | | | |
| | * | | | | Services/APT: Properly clear the apt parameter after a successful ReceiveParameter call.Subv2017-07-211-2/+8
| | | | | | |
| | * | | | | Services/APT: Use the right error codes in ReceiveParameter and GlanceParameter when the parameter doesn't exist.Subv2017-07-211-0/+28
| | | | | | |
| | * | | | | Services/APT: Use boost::optional for the APT parameter structure.Subv2017-07-211-20/+26
| | | |_|/ / | | |/| | |
| * | | | | Merge pull request #2837 from wwylele/shader-debugger-fixbunnei2017-07-261-23/+18
| |\ \ \ \ \ | | | | | | | | | | | | | | Misc shader debugger fixes
| | * | | | | debugger/shader: display LOOPwwylele2017-07-201-1/+3
| | | | | | |
| | * | | | | debugger/shader: print the invert flag for JMPUwwylele2017-07-201-0/+4
| | | | | | |
| | * | | | | debugger/shader: fix address register for reverted arithmetic opwwylele2017-07-201-20/+9
| | | | | | |
| | * | | | | debugger/shader: fix inverted uniform flow controlwwylele2017-07-201-2/+2
| | | | | | |
| * | | | | | Merge pull request #2847 from B3n30/network_linux_fixbunnei2017-07-262-3/+4
| |\ \ \ \ \ \ | | | | | | | | | | | | | | | | Fixed build error "too many initializers for ‘const MacAddress"
| | * | | | | | Network: Moved NintendoOUI initalization to RoomMember constructorB3n302017-07-262-3/+4
| |/ / / / / /
* | | | | | | loader: Various improvements for NSO/NRO loaders.bunnei2017-10-108-58/+40
| | | | | | |
* | | | | | | loader: Add support for NRO, as well as various fixes and shared linker.bunnei2017-10-069-146/+434
| | | | | | |
* | | | | | | nso: Fixes to support homebrew NSOs without a MOD header.bunnei2017-10-042-17/+23
| | | | | | |
* | | | | | | arm_interface: Set TLS address for dynarmic core.bunnei2017-09-305-0/+32
| | | | | | |
* | | | | | | nso: Refactor and allocate .bss section.bunnei2017-09-309-132/+162
| | | | | | |
* | | | | | | process: Support loading multiple codesets.bunnei2017-09-302-20/+27
| | | | | | |
* | | | | | | loader: Add support for loading an NSO.bunnei2017-09-305-0/+342
| | | | | | |
* | | | | | | externals: Add lz4.bunnei2017-09-303-1/+6
| | | | | | |
* | | | | | | memory: Log with 64-bit values.bunnei2017-09-301-8/+8
| | | | | | |
* | | | | | | kernel: Various threading fixes to support 64-bit addressing.bunnei2017-09-302-8/+8
| | | | | | |
* | | | | | | core: Various changes to support 64-bit addressing.bunnei2017-09-305-54/+54
| | | | | | |
* | | | | | | arm: Use 64-bit addressing in a bunch of places.bunnei2017-09-309-80/+113
| | | | | | |
* | | | | | | elf: Check if machine is ARM.bunnei2017-09-301-2/+9
|/ / / / / /
* | | | | | Merge pull request #2844 from jroweboy/nightlyfixWeiyi Wang2017-07-241-1/+1
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Use WinSSPI instead of OpenSSL
| * | | | | Use WinSSPI instead of OpenSSLJames Rowe2017-07-241-1/+1
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | Appveyor has OpenSSL installed, so cURL tries to link against it. This causes dll not found errors because we would also need to ship OpenSSL, so we link against Windows SSPI instead.
* | | | | Merge pull request #2816 from wwylele/proctex-lutlutlutSebastian Valle2017-07-235-70/+80
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer: use texture buffer for proctex LUT
| * | | | | gl_rasterizer: use texture buffer for proctex LUTwwylele2017-07-015-70/+80
| | | | | |
* | | | | | Merge pull request #2834 from wwylele/depth-enable-fixSebastian Valle2017-07-231-4/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer_cache: fix using_depth_fb
| * | | | | | gl_rasterizer_cache: depth write is disabled if allow_depth_stencil_write is falsewwylele2017-06-101-4/+5
| | | | | | |
* | | | | | | Merge pull request #2799 from yuriks/virtual-cached-range-flushWeiyi Wang2017-07-226-68/+113
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | Add address conversion functions returning optional, Add function to flush virtual region from rasterizer cache
| * | | | | | Memory: Add function to flush a virtual range from the rasterizer cacheYuri Kunde Schlesner2017-06-224-47/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is slightly more ergonomic to use, correctly handles virtual regions which are disjoint in physical addressing space, and checks only regions which can be cached by the rasterizer.
| * | | | | | Memory: Add TryVirtualToPhysicalAddress, returning a boost::optionalYuri Kunde Schlesner2017-06-222-7/+23
| | | | | | |
| * | | | | | Memory: Make PhysicalToVirtualAddress return a boost::optionalYuri Kunde Schlesner2017-06-224-14/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | | And fix a few places in the code to take advantage of that.
* | | | | | | Merge pull request #2833 from j-selby/single-header-jsonbunnei2017-07-185-4/+14524
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Don't pull in entire JSON repo for single header file
| * | | | | | | Add description of upstream repoJames2017-07-181-0/+7
| | | | | | | |
| * | | | | | | Don't pull in entire JSON repo for single header fileJames2017-07-184-4/+14517
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #2823 from bunnei/telemetry-databunnei2017-07-185-18/+96
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | telemetry: Log performance, configuration, and system data.
| * | | | | | telemetry: Log performance, configuration, and system data.bunnei2017-07-185-18/+96
|/ / / / / /
* | | | | | Merge pull request #2804 from Kloen/themingbunnei2017-07-1849-2/+1387
|\ \ \ \ \ \ | | | | | | | | | | | | | | citra-qt: UI Themes
| * | | | | | citra-qt: Add option to configure the UI themeKloen2017-06-242-0/+37
| | | | | | |
| * | | | | | citra-qt: load ui theme at startup and config change.Kloen2017-06-242-0/+22
| | | | | | |
| * | | | | | citra-qt: Add Dark theme from https://github.com/ColinDuquesnoy/QDarkStyleSheetKloen2017-06-2443-2/+1319
| | | | | | |
| * | | | | | citra-qt: add new uisetting->themeKloen2017-06-242-0/+9
| | | | | | |
* | | | | | | Merge pull request #2818 from B3n30/networkWeiyi Wang2017-07-179-21/+1206
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Enable data transfer over ENet
| * | | | | | | Network: Changed timeout for receiving packets to 100msB3n302017-07-165-43/+50
| | | | | | | |
| * | | | | | | Network: Propagate Room closing to connected membersB3n302017-07-163-3/+28
| | | | | | | |
| * | | | | | | Network: Made send async in RoomMemberB3n302017-07-164-25/+70
| | | | | | | |
| * | | | | | | Network: Send the game titleB3n302017-07-166-114/+185
| | | | | | | |
| * | | | | | | Network: Enable sending and receiving chat messagesB3n302017-07-163-0/+79
| | | | | | | |
| * | | | | | | Network: Handle the disconnect of a clientB3n302017-07-161-1/+18
| | | | | | | |
| * | | | | | | Network: Enable to send WifiPacketsB3n302017-07-163-1/+82
| | | | | | | |
| * | | | | | | Network: Init Network in SDL and QTB3n302017-07-162-1/+5
| | | | | | | |
| * | | | | | | Network: Send JoinRequest and handle the answer in RoomMemberB3n302017-07-162-2/+125
| | | | | | | |
| * | | | | | | Network: Handle join request in RoomB3n302017-07-162-1/+205
| | | | | | | |
| * | | | | | | Network: Added Packet class for serializationB3n302017-07-163-0/+423
| | | | | | | |
| * | | | | | | Network: Threads for Room and RoomMemberB3n302017-07-164-13/+119
| | | | | | | |
* | | | | | | | Merge pull request #2829 from MerryMage/check_submodules_presentbunnei2017-07-171-0/+15
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | CMakeLists: Check that all submodules are present
| * | | | | | | | CMakeLists: Check that all submodules are presentMerryMage2017-07-161-0/+15
| | | | | | | | |
* | | | | | | | | stubbed frd::UnscrambleLocalFriendCode (#2827)B3n302017-07-173-1/+57
| | | | | | | | |
* | | | | | | | | Merge pull request #2830 from linkmauve/masterJames Rowe2017-07-171-1/+1
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Make enet use the same convention as other submodules
| * | | | | | | | .gitmodules: Make enet use the same convention as other submodules.Emmanuel Gil Peyrot2017-07-161-1/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | This makes it easier for packagers to preload all submodules.
* | | | | | | | Merge pull request #2784 from wwylele/font-archiveWeiyi Wang2017-07-165-22/+264
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | load shared font from system archive
| * | | | | | | apt: load shared font from system archivewwylele2017-06-264-20/+260
| | | | | | | |
| * | | | | | | apt/shared_font: don't relocate zero offsetwwylele2017-06-251-2/+4
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2824 from jroweboy/mingw_compile_testWeiyi Wang2017-07-131-0/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Update enet submodule
| * | | | | | | Update enet submoduleJames Rowe2017-07-131-0/+0
| | |_|_|_|/ / | |/| | | | | | | | | | | | | | | | | | | This includes a fix merged upstream to support mingw compilation
* | | | | | | Merge pull request #2819 from bunnei/telemetry-submitbunnei2017-07-1319-3/+301
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Telemetry: Submit logged data to the Citra service
| * | | | | | web_backend: Specify api-version on JSON post.bunnei2017-07-121-1/+3
| | | | | | |
| * | | | | | web_service: Add CMake flag to enable.bunnei2017-07-125-14/+32
| | | | | | |
| * | | | | | telemetry_session: Use TelemetryJson to submit real telemetry.bunnei2017-07-123-5/+3
| | | | | | |
| * | | | | | web_service: Implement JSON serialization of telemetry data.bunnei2017-07-122-0/+125
| | | | | | |
| * | | | | | web_backend: Add initial interface to POST data to Citra Web Services.bunnei2017-07-122-0/+63
| | | | | | |
| * | | | | | web_service: Add skeleton project.bunnei2017-07-107-1/+52
| | | | | | |
| * | | | | | settings: Add telemetry endpoint URL.bunnei2017-07-104-0/+23
| | | | | | |
| * | | | | | logging: Add WebService as a log cateogry.bunnei2017-07-102-1/+3
| | | | | | |
| * | | | | | externals: Add JSON as a submodule.bunnei2017-07-103-0/+7
| | | | | | |
| * | | | | | externals: Add CPR as a submodule.bunnei2017-07-093-0/+9
|/ / / / / /
* | | | | | Merge pull request #2815 from mailwl/bosspSebastian Valle2017-07-081-0/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | Service/boss:P: Add some functions to FunctionTable
| * | | | | | Service/boss:P: Add some functions to FunctionTablemailwl2017-07-011-0/+3
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2797 from yuriks/cached-vma-free-crashbunnei2017-07-081-5/+20
|\ \ \ \ \ \ | | | | | | | | | | | | | | Memory: Fix crash when unmapping a VMA covering cached surfaces
| * | | | | | Memory: Fix crash when unmapping a VMA covering cached surfacesYuri Kunde Schlesner2017-06-221-5/+20
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Unmapping pages tries to flush any cached GPU surfaces touching that region. When a cached page is invalidated, GetPointerFromVMA() is used to restore the original pagetable pointer. However, since that VMA has already been deleted, this hits an UNREACHABLE case in that function. Now when this happens, just set the page type to Unmapped and continue, which arrives at the correct end result.
* | | | | | Implement basic virtual Room support based on enet (#2803)B3n302017-07-0715-1/+364
| |_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added support for network with ENet lib, connecting is possible, but data can't be sent, yet. * fixup! Added support for network with ENet lib, * fixup! CLang * fixup! Added support for network with ENet lib, * fixup! Added support for network with ENet lib, * fixup! Clang format * More fixups! * Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Clang again * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes * fixup! Moved ENetHost* and ENetPeer* into pimpl classes
* | | | | Merge pull request #2814 from Kloen/macro-removeJames Rowe2017-07-011-1/+0
|\ \ \ \ \ | |_|/ / / |/| | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definition
| * | | | Remove unnecessary WIN32_LEAN_AND_MEAN macro definitionKloen2017-06-301-1/+0
|/ / / /
* | | | Merge pull request #2793 from Subv/replyandreceiveSebastian Valle2017-06-306-23/+161
|\ \ \ \ | | | | | | | | | | Kernel/SVC: Partially implemented svcReplyAndReceive
| * | | | Kernel/SVC: Pass the current thread as a parameter to ClientSession::SendSyncRequest.Subv2017-06-293-4/+7
| | | | |
| * | | | Kernel/Sessions: Clean up the list of pending request threads of a session when the client endpoint is closed.Subv2017-06-261-0/+5
| | | | |
| * | | | Kernel/SVC: Partially implemented svcReplyAndReceive.Subv2017-06-262-11/+121
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It behaves mostly as WaitSynchronizationN with wait_all = false, except for IPC buffer translation. The target thread of an IPC response will now wake up when responding. IPC buffer translation is currently not implemented. Error passing back to svcSendSyncRequest is currently not implemented.
| * | | | Kernel/ServerSession: Keep track of which threads have issued sync requests.Subv2017-06-253-9/+29
| | | | |
* | | | | Merge pull request #2809 from wwylele/texture-copy-fixYuri Kunde Schlesner2017-06-292-19/+24
|\ \ \ \ \ | | | | | | | | | | | | gpu: fix edge cases for TextureCopy
| * | | | | gpu: add comments for TextureCopywwylele2017-06-292-8/+8
| | | | | |
| * | | | | gpu: fix edge cases for TextureCopywwylele2017-06-271-18/+23
| | | | | |
* | | | | | Merge pull request #2800 from wwylele/fog-lutlutlutYuri Kunde Schlesner2017-06-297-31/+34
|\ \ \ \ \ \ | | | | | | | | | | | | | | gl_rasterizer: use texture buffer for fog LUT
| * | | | | | gl_rasterizer: use texture buffer for fog LUTwwylele2017-06-227-29/+32
| | | | | | |
| * | | | | | gl_rasterizer: create the texture before applying the statewwylele2017-06-221-2/+2
| | |_|/ / / | |/| | | | | | | | | | | | | | | | this is a rebasing error from #2792. It doesn't affect much though, because the later more Apply() call fixes/hides it
* | | | | | Merge pull request #2811 from MerryMage/qtdebugJames Rowe2017-06-281-0/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled …
| * | | | | | configure_debug: Add label warning that CPU JIT needs to be disabled for gdbstub to workMerryMage2017-06-281-0/+7
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2812 from tiagmoraismorgado/patch-1James Rowe2017-06-281-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | fixing a couple of typos
| * | | | | fixing a couple of typosTiago Morais Morgado2017-06-281-2/+2
|/ / / / /
* | | | | Merge pull request #2778 from Subv/uds_moreSebastian Valle2017-06-275-1/+436
|\ \ \ \ \ | | | | | | | | | | | | Services/UDS: Stub SendTo to generate the unencrypted data frames with the right headers
| * | | | | UDS: Use the ToDS and FromDS fields to properly calculate the AAD used during encryption.Subv2017-06-261-15/+32
| | | | | |
| * | | | | UDS: Move the UDS keyslot used to generate the CCMP key to the AES::KeySlotID enum.Subv2017-06-262-4/+3
| | | | | |
| * | | | | UDS: Run clang-format.Subv2017-06-263-51/+55
| | | | | |
| * | | | | UDS: Added functions to encrypt and decrypt the data frames.Subv2017-06-263-12/+156
| | | | | | | | | | | | | | | | | | | | | | | | The responsibility of encryption and encapsulation into an 802.11 MAC frame will fall into the callers of GenerateDataPayload.
| * | | | | UDS: Clarify comment about the first 4 bytes of the SecureData header.Subv2017-06-152-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | It is likely that these 4 bytes are actually a different header, part of some protocol that encapsulates the SecureData protocol.
| * | | | | UDS: Return the correct error messages in SendTo when not connected to a network or trying to send to itself.Subv2017-06-151-6/+13
| | | | | |
| * | | | | UDS: Stub SendTo to generate the unencrypted data frame with the right headers.Subv2017-06-154-1/+261
| | |/ / / | |/| | |
* | | | | externals: silence warning C4390 on MSVC for cryptopp (#2805)Klöen Lansfiel2017-06-251-0/+5
| | | | |
* | | | | Set global definition WIN32_LEAN_AND_MEAN (#2807)B3n302017-06-252-0/+5
| | | | | | | | | | | | | | | Set definition WIN32_LEAN_AND_MEAN to avoid windows.h including a lot of libs that are usually not used.
* | | | | Merge pull request #2801 from yuriks/session-svcsYuri Kunde Schlesner2017-06-245-7/+52
|\ \ \ \ \ | |_|_|/ / |/| | | | Implement CreateSessionToPort and AcceptSession; fix CreatePort
| * | | | Kernel: Implement AcceptSession SVCYuri Kunde Schlesner2017-06-234-3/+38
| | | | |
| * | | | Kernel: Fix SVC wrapper for CreatePortYuri Kunde Schlesner2017-06-231-3/+2
| | | | | | | | | | | | | | | | | | | | The return parameters were flipped.
| * | | | Kernel: Implement CreateSessionToPort SVCYuri Kunde Schlesner2017-06-231-1/+12
|/ / / /
* | | | Merge pull request #2798 from yuriks/svc-create-sessionYuri Kunde Schlesner2017-06-232-3/+26
|\ \ \ \ | | | | | | | | | | Kernel: Implement CreateSession SVC
| * | | | Kernel: Implement CreateSession SVCYuri Kunde Schlesner2017-06-222-3/+26
| | |/ / | |/| |
* | | | Merge pull request #2795 from chris062689/masterbunnei2017-06-232-6/+6
|\ \ \ \ | | | | | | | | | | Change default UI background from white to black.
| * | | | Changing default values for bg_red, bg_green, and bg_blue from 1.0 to 0.0.chris0626892017-06-212-6/+6
| | | | |
* | | | | Merge pull request #2796 from yuriks/hle-null-handlesbunnei2017-06-232-8/+36
|\ \ \ \ \ | |_|/ / / |/| | | | Kernel/IPC: Support translation of null handles
| * | | | Kernel: Fix typo in test nameYuri Kunde Schlesner2017-06-221-1/+1
| | | | |
| * | | | Kernel/IPC: Support translation of null handlesYuri Kunde Schlesner2017-06-212-7/+35
| | | | | | | | | | | | | | | | | | | | | | | | | Missed this in my first implementation. Thanks to @wwylele for pointing out that this was missing.
* | | | | Merge pull request #2792 from wwylele/lutlutlutYuri Kunde Schlesner2017-06-217-151/+175
|\ \ \ \ \ | |/ / / / |/| | | | gl_rasterizer: fix lighting LUT interpolation
| * | | | gl_state: reset 1d textureswwylele2017-06-211-0/+14
| | | | |
| * | | | gl_rasterizer: fix glGetUniformLocation typewwylele2017-06-211-8/+8
| | | | |
| * | | | gl_rasterizer: manage texture ids in one placewwylele2017-06-213-31/+55
| | | | |
| * | | | gl_rasterizer/lighting: fix LUT interpolationwwylele2017-06-217-116/+102
| | | | |
* | | | | Merge pull request #2789 from yuriks/misc-kernelWeiyi Wang2017-06-212-1/+5
|\ \ \ \ \ | |_|/ / / |/| | | | Trivial no-op additions
| * | | | Memory: Add enum definitions for the n3DS FCRAM sizeYuri Kunde Schlesner2017-06-211-1/+3
| | | | |
| * | | | Kernel: Add comment about the extended linear heap areaYuri Kunde Schlesner2017-06-191-0/+2
| |/ / /
* | | | Merge pull request #2790 from yuriks/remove-movefromYuri Kunde Schlesner2017-06-2124-56/+57
|\ \ \ \ | | | | | | | | | | Remove ResultVal::MoveFrom
| * | | | ResultVal: Remove MoveFrom()Yuri Kunde Schlesner2017-06-1924-57/+53
| | | | | | | | | | | | | | | | | | | | | | | | | Replace it with std::move(result_val).Unwrap(), or Foo().Unwrap() in case you already have an rvalue.
| * | | | ResultVal: Add an rvalue overload of Unwrap()Yuri Kunde Schlesner2017-06-191-1/+6
| |/ / /
* | | | Merge pull request #2779 from Subv/uds_more2Sebastian Valle2017-06-211-0/+36
|\ \ \ \ | | | | | | | | | | UDS: Added a hook for updating the connection status when a client connects to the network.
| * | | | UDS: Added a hook for updating the connection status when a client connects to the network.Subv2017-06-151-0/+36
| | |/ / | |/| |
* | | | Merge pull request #2787 from yuriks/hle-ipc-testsYuri Kunde Schlesner2017-06-205-7/+206
|\ \ \ \ | |_|/ / |/| | | Kernel/IPC: Add tests for HLERequestContext buffer translation
| * | | Kernel/IPC: Add tests for HLERequestContext buffer translationYuri Kunde Schlesner2017-06-192-2/+196
| | | |
| * | | Kernel/IPC: Make HLERequestContext usable from outside kernelYuri Kunde Schlesner2017-06-193-5/+10
|/ / /
* | | Merge pull request #2776 from wwylele/geo-factorYuri Kunde Schlesner2017-06-183-7/+26
|\ \ \ | | | | | | | | Fragment lighting: implement geometric factor
| * | | gl_rasterizer/lighting: use the formula from the paper for germetic factorwwylele2017-06-181-8/+8
| | | |
| * | | gl_rasterizer/lighting: implement geometric factorwwylele2017-06-153-1/+20
| | | |
* | | | Merge pull request #2785 from yuriks/compile-flagsYuri Kunde Schlesner2017-06-184-19/+20
|\ \ \ \ | |/ / / |/| | | CMake: Set MSVC flags for improved C++ standards conformance
| * | | CMake: Set MSVC flags for improved C++ standards conformanceYuri Kunde Schlesner2017-06-171-3/+6
| | | | | | | | | | | | | | | | This makes the compiler stricter and also enables small optimizations.
| * | | Stop using reserved operator names (and/or/xor) with XbyakYuri Kunde Schlesner2017-06-173-16/+14
|/ / / | | | | | | | | | Also has the Dynarmic upgrade with the same change
* | | Merge pull request #2762 from wwylele/light-cp-tangentYuri Kunde Schlesner2017-06-152-10/+38
|\ \ \ | | | | | | | | Fragment lighting: implement lut input 5 (CP) and tangent mapping
| * | | gl_rasterizer/lighting: Implement tangent mappingwwylele2017-06-111-7/+12
| | | |
| * | | gl_rasterizer/lighting: implement lut input 5 (CP)wwylele2017-06-112-3/+26
| | | |
* | | | Merge pull request #2743 from wwylele/wrap-fixYuri Kunde Schlesner2017-06-144-12/+48
|\ \ \ \ | |_|/ / |/| | | pica/rasterizer: implement/stub texture wrap mode 4-7
| * | | pica/rasterizer: implement/stub texture wrap mode 4-7wwylele2017-06-044-12/+48
| | | |
* | | | Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. (#2738)Sebastian Valle2017-06-133-5/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Services/UDS: Set the proper bit in the ConnectionStatus structure when creating a network. This lets the application know that the host was successfully added to the session. * Services/UDS: Reset the connection status when destroying the network * Services/UDS: Reset the connection status's bitmask of changed nodes after reporting it to the game.
* | | | Merge pull request #2767 from yuriks/quaternion-flip-commentYuri Kunde Schlesner2017-06-131-8/+11
|\ \ \ \ | | | | | | | | | | OpenGL: Update comment on AreQuaternionsOpposite with new information
| * | | | OpenGL: Update comment on AreQuaternionsOpposite with new informationYuri Kunde Schlesner2017-06-101-8/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | While debugging the software renderer implementation, it was noticed that this is actually exactly what the hardware does, upgrading the status of this "hack" to being a proper implementation. And there was much rejoicing.
* | | | | Merge pull request #2774 from yuriks/hle-handlesYuri Kunde Schlesner2017-06-127-69/+360
|\ \ \ \ \ | |_|_|/ / |/| | | | Add basic support for IPC translation for HLE services
| * | | | Kernel/IPC: Use boost::small_vector for HLE context objectsYuri Kunde Schlesner2017-06-121-1/+3
| | | | |
| * | | | Externals: Upgrade bundled Boost to 1.64Yuri Kunde Schlesner2017-06-111-0/+0
| | | | |
| * | | | Kernel: Allow clearing request_objects to re-use buffer spaceYuri Kunde Schlesner2017-06-113-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | Reduces the necessary allocation to max(in_handles, out_handles) rather than (in_handles + out_handles).
| * | | | Kernel: Basic support for IPC translation for HLE servicesYuri Kunde Schlesner2017-06-113-18/+130
| | | | |
| * | | | Service/sm: Convert srv: to use IPC helpersYuri Kunde Schlesner2017-06-111-49/+56
| | | | |
| * | | | IPC: Add Pop/PushObjects methods to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-10/+103
| | | | | | | | | | | | | | | | | | | | | | | | | These use the context functions to create and look-up handles for the user.
| * | | | IPC: Add basic HLERequestContext support to RequestParser/BuilderYuri Kunde Schlesner2017-06-111-1/+32
| | | | |
| * | | | Kernel: Add methods in HLERequestContext abstracting handle creationYuri Kunde Schlesner2017-06-112-0/+12
| | | | |
| * | | | ServiceFramework: Use separate copy of command bufferYuri Kunde Schlesner2017-06-113-9/+29
| |/ / / | | | | | | | | | | | | | | | | | | | | Copy the IPC command buffer to/from the request context before/after the handler is invoked. This is part of a move away from using global data for handling IPC requests.
* | | | Merge pull request #2727 from wwylele/spot-lightSebastian Valle2017-06-115-28/+128
|\ \ \ \ | |/ / / |/| | | Fragment lighting: implement spot light
| * | | gl_rasterizer: implement spot lightwwylele2017-05-301-6/+24
| | | |
| * | | gl_rasterizer: sync spot light statuswwylele2017-05-304-2/+61
| | | |
| * | | pica: prepare registers for spotlightwwylele2017-05-301-20/+43
| | | |
* | | | Remove unused import in break_points.cpp (#2763)Kloen Lansfiel2017-06-091-1/+0
| | | |
* | | | Merge pull request #2756 from yuriks/service-frameworkYuri Kunde Schlesner2017-06-099-64/+355
|\ \ \ \ | | | | | | | | | | New service framework
| * | | | Service/sm: Convert 'srv:' to ServiceFrameworkYuri Kunde Schlesner2017-06-095-51/+75
| | | | |
| * | | | Service: Remove a few redundant namespace qualifiersYuri Kunde Schlesner2017-06-081-5/+5
| | | | |
| * | | | Service: Add new ServiceFramework framework for writing HLE servicesYuri Kunde Schlesner2017-06-085-4/+269
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The old "Interface" class had a few problems such as using free functions (Which didn't allow you to write the service handler as if it were a regular class.) which weren't very extensible. (Only received one parameter with a pointer to the Interface object.) The new ServiceFramework aims to solve these problems by working with member functions and passing a generic context struct as parameter. This struct can be extended in the future without having to update all existing service implementations.
| * | | | Kernel: Remove some unnecessary namespace qualificationsYuri Kunde Schlesner2017-06-061-4/+6
| | | | |
* | | | | Merge pull request #2761 from yuriks/session-referencesYuri Kunde Schlesner2017-06-083-9/+15
|\ \ \ \ \ | |_|_|_|/ |/| | | | Kernel: Ensure objects are kept alive during ClientSession disconnection
| * | | | Session: Remove/add some forward declarationsYuri Kunde Schlesner2017-06-083-2/+2
| | | | |
| * | | | Kernel: Ensure objects are kept alive during ClientSession disconnectionYuri Kunde Schlesner2017-06-081-7/+13
|/ / / / | | | | | | | | | | | | Fixes #2760
* | | | Merge pull request #2737 from Subv/decryptbeacondataJames Rowe2017-06-071-1/+97
|\ \ \ \ | | | | | | | | | | Services/UDS: Implement DecryptBeaconData.
| * | | | Services/UDS: Implement DecryptBeaconData.Subv2017-06-061-1/+97
| | | | | | | | | | | | | | | | | | | | This function decrypts the encrypted data tags contained in the 802.11 beacon frames.
* | | | | Merge pull request #2755 from yuriks/service-includesYuri Kunde Schlesner2017-06-0632-12/+80
|\ \ \ \ \ | | |/ / / | |/| | | Service: Remove unnecessary includes from service.h
| * | | | Service: Remove unnecessary includes from service.hYuri Kunde Schlesner2017-06-0632-12/+80
| | | | | | | | | | | | | | | | | | | | | | | | | This has a huge fallout in terms of needing to fix other files because all service implementations included that file.
* | | | | Merge pull request #2754 from yuriks/sm-implYuri Kunde Schlesner2017-06-067-41/+166
|\| | | | | | | | | | | | | | Handle service registrations using sm/srv
| * | | | Service: Make service registration part of the sm implementationYuri Kunde Schlesner2017-06-066-24/+147
| | | | | | | | | | | | | | | | | | | | Also enhances the GetServiceHandle implementation to be more accurate.
| * | | | Service/sm: Use an actual semaphore for the notification semaphoreYuri Kunde Schlesner2017-06-061-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | An Event was used way back then when we didn't have proper working semaphores. Our Semaphore implementation is good enough now.
| * | | | Service: Move SRV interface to a new sm/ subdirectoryYuri Kunde Schlesner2017-06-064-9/+10
| | | | | | | | | | | | | | | | | | | | | | | | | This will contain the implementation of the sm (Service Manager) system module.
* | | | | Merge pull request #2753 from yuriks/set-hle-handlerYuri Kunde Schlesner2017-06-0612-62/+92
|\| | | | | | | | | | | | | | Add SetHleHandler to ServerPort/ServerSession
| * | | | Kernel: Add a dedicated SetHleHandler method to ServerPort/ServerSessionYuri Kunde Schlesner2017-06-0611-62/+73
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows attaching a HLE handle to a ServerPort at any point after it is created, allowing port/session creation to be generic between HLE and regular services.
| * | | | ResultVal: Add more convenience utils for creating and cascading resultsYuri Kunde Schlesner2017-06-061-0/+19
| | | | |
* | | | | Merge pull request #2752 from yuriks/move-session-request-handlerYuri Kunde Schlesner2017-06-0614-73/+100
|\| | | | | | | | | | | | | | HLE: Move SessionRequestHandler from Service:: to Kernel::
| * | | | HLE: Move SessionRequestHandler from Service:: to Kernel::Yuri Kunde Schlesner2017-06-0614-73/+100
|/ / / / | | | | | | | | | | | | | | | | Most of the code that works with this is or will be in the kernel, so it's a more appropriate place for it to be.
* | | | Merge pull request #2747 from atouchet/readme-urlJames Rowe2017-06-041-1/+1
|\ \ \ \ | | | | | | | | | | Fix FAQ Link in Readme
| * | | | Fix FAQ Link in ReadmeAlex Touchet2017-06-041-1/+1
|/ / / /
* | | | Edit Citra URLs (#2728)Alex Touchet2017-06-032-3/+3
| | | |
* | | | Merge pull request #2746 from Kloen/just-whyJames Rowe2017-06-031-2/+0
|\ \ \ \ | | | | | | | | | | Remove unused imports in game_list_p.h
| * | | | Remove unused imports in game_list_p.hKloen2017-06-031-2/+0
|/ / / /
* | | | Merge pull request #2611 from TheKoopaKingdom/missing-file-dialogsbunnei2017-06-0314-41/+212
|\ \ \ \ | | | | | | | | | | Display QMessageBox Dialogs For Errors
| * | | | Addressed Bunnei's review comments, and made some other tweaks:TheKoopaKingdom2017-06-037-29/+32
| | | | | | | | | | | | | | | | | | | | | | | | | - Deleted GetStatus() because it wasn't used anywhere outside of Core::System. - Fixed design flaw where the message bar status could be set despite the game being stopped.
| * | | | Fixed wiki URLs.TheKoopaKingdom2017-06-031-6/+8
| | | | |
| * | | | Switched to the ERROR_NOT_FOUND constant from errors.h.TheKoopaKingdom2017-06-032-4/+3
| | | | |
| * | | | Moved whitelist checks from FS_User to the Archive_NCCH handler.TheKoopaKingdom2017-06-032-53/+37
| | | | |
| * | | | Created a whitelist of system archives to prevent false positives creating dialogs.TheKoopaKingdom2017-06-039-35/+70
| | | | |
| * | | | Optimized messages that were repetitive and added ability for core errors to specify more details optionally.TheKoopaKingdom2017-06-035-39/+70
| | | | |
| * | | | Added message to status bar to show core errors ignored by the user.TheKoopaKingdom2017-06-032-1/+11
| | | | |
| * | | | Made some changes from review comments:TheKoopaKingdom2017-06-0310-53/+55
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Made LoadKernelSystemMode return a pair consisting of a system mode and a result code (Could use review). - Deleted ErrorOpenGL error code in favor of just having ErrorVideoCore. - Made dialog messages more clear. - Compared archive ID in fs_user.cpp to ArchiveIdCode::NCCH as opposed to hex magic. - Cleaned up some other stuff.
| * | | | Added system for handling core errors in citra-qt.TheKoopaKingdom2017-06-039-26/+121
| | | | |
| * | | | Fixed encrypted ROM error messages.TheKoopaKingdom2017-06-033-9/+19
|/ / / /
* | | | Merge pull request #2722 from wwylele/cam-ipc-helperbunnei2017-06-012-293/+265
|\ \ \ \ | | | | | | | | | | CAM: use IPCHelper
| * | | | fixup!cam: use IPCHelperwwylele2017-05-272-30/+43
| | | | |
| * | | | cam: move u32->u8 trancation to IPCHelperwwylele2017-05-241-34/+33
| | | | |
| * | | | cam: use IPCHelperwwylele2017-05-241-278/+238
| | | | |
* | | | | Merge pull request #2739 from yuriks/kernel-reorgbunnei2017-06-0127-344/+430
|\ \ \ \ \ | | | | | | | | | | | | Split-up kernel.h
| * | | | | Kernel: Move HandleTable to a separate fileYuri Kunde Schlesner2017-05-3018-203/+242
| | | | | |
| * | | | | Kernel: Move WaitObject to a separate fileYuri Kunde Schlesner2017-05-3015-135/+178
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now that HandleTable doesn't directly depend on WaitObject anymore, this can be separated from the main kernel.h header.
| * | | | | Kernel: Removed HandleTable::GetWaitObjectYuri Kunde Schlesner2017-05-302-11/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This isn't necessary anymore since plain Get works correctly for WaitObjects.
| * | | | | Kernel: Extract dynamic Object pointer cast into its own functionYuri Kunde Schlesner2017-05-291-11/+24
| | |/ / / | |/| | |
* | | | | Merge pull request #2721 from wwylele/texture-cubebunnei2017-05-302-3/+77
|\ \ \ \ \ | |_|_|_|/ |/| | | | swrasterizer: implemented TextureCube
| * | | | swrasterizer: implement TextureCubewwylele2017-05-291-2/+51
| | | | |
| * | | | pica: add registers for texture cubewwylele2017-05-291-1/+26
| | | | |
* | | | | Merge pull request #2734 from yuriks/cmake-imported-libsYuri Kunde Schlesner2017-05-3014-120/+160
|\ \ \ \ \ | |_|/ / / |/| | | | CMake: Use CMake target properties for all libraries
| * | | | CMake: Re-organize root CMakeLists.txt fileYuri Kunde Schlesner2017-05-281-56/+78
| | | | | | | | | | | | | | | | | | | | Separates the file into sections and re-orders things to fit in them
| * | | | CMake: Move definitions of externals to the CMakeLists in that directoryYuri Kunde Schlesner2017-05-282-32/+47
| | | | |
| * | | | CMake: Create an INTERFACE target for CatchYuri Kunde Schlesner2017-05-282-4/+6
| | | | |
| * | | | CMake: Create INTERFACE targets for microprofile and nihstroYuri Kunde Schlesner2017-05-284-5/+9
| | | | |
| * | | | CMake: Remove unnecessary include_directories for dynarmicYuri Kunde Schlesner2017-05-281-3/+0
| | | | | | | | | | | | | | | | | | | | Dynarmic already adds the correct include paths to the library target.
| * | | | CMake: Add cryptopp include path to target propertyYuri Kunde Schlesner2017-05-282-3/+4
| | | | |
| * | | | CMake: Add SoundTouch include path to target propertyYuri Kunde Schlesner2017-05-282-2/+2
| | | | |
| * | | | CMake: Use target properties to add inih include pathsYuri Kunde Schlesner2017-05-282-3/+2
| | | | |
| * | | | CMake: Define an interface target for SDL2 definitionsYuri Kunde Schlesner2017-05-284-8/+11
| | | | |
| * | | | CMake: Remove CITRA_QT_LIBS varYuri Kunde Schlesner2017-05-282-2/+1
| | | | | | | | | | | | | | | | | | | | | | | | | This used to be required to support both Qt4 and Qt5, but we dropped Qt4 so it's not needed anymore.
| * | | | CMake: Stop using FindOpenGL, which seems to not be required anymoreYuri Kunde Schlesner2017-05-284-6/+4
| | | | |
| * | | | CMake: Use append instead of set to modify listYuri Kunde Schlesner2017-05-281-1/+1
| | | | |
| * | | | CMake: Use IMPORTED target for BoostYuri Kunde Schlesner2017-05-284-8/+11
| | | | |
| * | | | CMake: Use IMPORTED target for libpngYuri Kunde Schlesner2017-05-282-8/+5
| | | | |
| * | | | Travis: Upgrade to CMake 3.6.3Yuri Kunde Schlesner2017-05-281-1/+1
| | | | |
* | | | | Merge pull request #2729 from yuriks/quaternion-fixYuri Kunde Schlesner2017-05-281-3/+5
|\ \ \ \ \ | | | | | | | | | | | | OpenGL: Improve accuracy of quaternion interpolation
| * | | | | OpenGL: Improve accuracy of quaternion interpolationYuri Kunde Schlesner2017-05-271-3/+5
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | Current order of operations (rotate then normalize) seems to produce a lot more distortion than normalizing and then rotating. This makes Citra results match pretty closesly with hardware, and indicates that hardware may also be using lerp instead of slerp to interpolate the quaternions.
* | | | | Merge pull request #2733 from yuriks/cmake-cleanupYuri Kunde Schlesner2017-05-2832-104/+111
|\ \ \ \ \ | | |/ / / | |/| | | Dependencies and build system cleanup
| * | | | CMake: Correct inter-module dependencies and library visibilityYuri Kunde Schlesner2017-05-288-23/+27
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Modules didn't correctly define their dependencies before, which relied on the frontends implicitly including every module for linking to succeed. Also changed every target_link_libraries call to specify visibility of dependencies to avoid leaking definitions to dependents when not necessary.
| * | | | Citra: Convert include into forward declarationYuri Kunde Schlesner2017-05-282-2/+6
| | | | |
| * | | | Remove some unnecessary inclusions of video_core.hYuri Kunde Schlesner2017-05-284-4/+0
| | | | |
| * | | | Move screen size constants from video_core to coreYuri Kunde Schlesner2017-05-289-51/+63
| | | | | | | | | | | | | | | | | | | | | | | | | video_core didn't even properly use them, and they were the source of many otherwise-unnecessary dependencies from core to video_core.
| * | | | OpenGL: Remove unused RendererOpenGL fieldsYuri Kunde Schlesner2017-05-282-11/+2
| | | | |
| * | | | Core: Fix some out-of-style includesYuri Kunde Schlesner2017-05-284-4/+4
| | | | |
| * | | | Common: Fix some out-of-style includesYuri Kunde Schlesner2017-05-283-5/+5
| | | | |
| * | | | Move framebuffer_layout from Common to CoreYuri Kunde Schlesner2017-05-285-4/+4
|/ / / / | | | | | | | | | | | | | | | | | | | | This removes a dependency inversion between core and common. It's also the proper place for the file since it makes screen layout decisions specific to the 3DS.
* | | | Merge pull request #2732 from yuriks/add-fmtYuri Kunde Schlesner2017-05-285-0/+5
|\ \ \ \ | |_|/ / |/| | | Add the fmt string formatting library
| * | | Add the fmt string formatting libraryYuri Kunde Schlesner2017-05-274-0/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | More info at http://fmtlib.net/ This commit was based on @jroweboy's work on his spdlog branch, but with modifications.
| * | | Update dynarmicYuri Kunde Schlesner2017-05-271-0/+0
|/ / / | | | | | | | | | | | | Updated to incorporate fix from MerryMage/dynarmic#106 which is required for using fmt in Citra.
* | | Merge pull request #2725 from wwylele/texture-samplerYuri Kunde Schlesner2017-05-271-40/+39
|\ \ \ | | | | | | | | gl_shader: refactor texture sampler into its own function
| * | | gl_shader: refactor texture sampler into its own functionwwylele2017-05-271-40/+39
| |/ /
* | | Merge pull request #2716 from yuriks/decentralized-resultbunnei2017-05-2633-300/+385
|\ \ \ | |/ / |/| | Decentralize ResultCode
| * | FS: Remove unused result definitionYuri Kunde Schlesner2017-05-251-5/+0
| | |
| * | Common: Clean up meta-template logic in BitFieldYuri Kunde Schlesner2017-05-251-3/+3
| | |
| * | Kernel: Centralize error definitions in errors.hYuri Kunde Schlesner2017-05-2523-132/+178
| | |
| * | GSP_GPU: Move error codes from result.h to local fileYuri Kunde Schlesner2017-05-252-17/+23
| | |
| * | FileSys: Move all result description to errors.hYuri Kunde Schlesner2017-05-2510-105/+115
| | |
| * | result: Make error description a generic integerYuri Kunde Schlesner2017-05-253-6/+18
| | | | | | | | | | | | | | | | | | | | | | | | | | | It is now known that result code description vary depending on the module, and so they're best defined on a per-module basis. To support this, allow passing in an arbitrary integer instead of limiting to the ones in the ErrorDescription enum. These will be gradually migrated to their individual users, but a few will be kept as "common" codes shared by all modules.
| * | Make BitField and ResultCode constexpr-initializableYuri Kunde Schlesner2017-05-252-41/+57
| | |
* | | Merge pull request #2697 from wwylele/proctexYuri Kunde Schlesner2017-05-2515-11/+1048
|\ \ \ | | | | | | | | Implemented Procedural Texture (Texture Unit 3)
| * | | gl_rasterizer: implement procedural texturewwylele2017-05-206-7/+600
| | | |
| * | | pica/swrasterizer: implement procedural texturewwylele2017-05-209-4/+448
| | | |
* | | | Merge pull request #2683 from bunnei/telemetry-frameworkbunnei2017-05-259-0/+342
|\ \ \ \ | |_|_|/ |/| | | Telemetry framework Part 1
| * | | telemetry: Log a few simple data fields throughout core.bunnei2017-05-253-1/+22
| | | |
| * | | core: Keep track of telemetry for the current emulation session.bunnei2017-05-255-0/+83
| | | |
| * | | common: Add a generic interface for logging telemetry fields.bunnei2017-05-253-0/+238
|/ / /
* | | Merge pull request #2692 from Subv/vfp_ftzSebastian Valle2017-05-222-0/+26
|\ \ \ | |_|/ |/| | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.
| * | fixup! Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-222-4/+0
| | |
| * | Dyncom/VFP: Convert denormal outputs into 0 when the FTZ flag is enabled.Subv2017-05-082-0/+30
| | | | | | | | | | | | Inputs are still not flushed to 0 if they are denormals.
* | | Merge pull request #2406 from Subv/session_disconnectYuri Kunde Schlesner2017-05-228-51/+84
|\ \ \ | | | | | | | | Kernel: Properly update port counters on session disconnection.
| * | | Kernel/Sessions: Remove the ClientSession::Create function.Subv2017-05-223-16/+3
| | | | | | | | | | | | | | | | It is not meant to be used by anything other than CreateSessionPair.
| * | | Kernel: Remove a now unused enum and variable regarding a session's status.Subv2017-05-152-8/+0
| | | |
| * | | Kernel: Use a Session object to keep track of the status of a Client/Server session pair.Subv2017-05-158-32/+86
| | | | | | | | | | | | | | | | Reduce the associated port's connection count when a ServerSession is destroyed.
* | | | Merge pull request #2694 from Subv/vfp_vsub_ftzMerry2017-05-221-2/+12
|\ \ \ \ | | | | | | | | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.
| * | | | Dyncom/VFP: Perform flush-to-zero on the second operand of vsub before sending it to vadd.Subv2017-05-141-2/+12
| | |/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously we were letting vadd flush the value to positive 0, but there are cases where this behavior is wrong, for example, vsub: -0 - +0 = -0 vadd: -0 + +0 = +0 Now we'll flush the value to +0 inside vsub, and then negate it.
* | | | Merge pull request #2719 from lioncash/catchYuri Kunde Schlesner2017-05-221-0/+0
|\ \ \ \ | | | | | | | | | | externals: Update catch to 1.9.4
| * | | | externals: Update catch to 1.9.4Lioncash2017-05-221-0/+0
|/ / / /
* | | | Merge pull request #2718 from citra-emu/appveyor-vs2017James Rowe2017-05-221-4/+2
|\ \ \ \ | | | | | | | | | | Upgrade AppVeyor to Visual Studio 2017
| * | | | Remove "Xamarin logspam" workaroundYuri Kunde Schlesner2017-05-221-2/+0
| | | | | | | | | | | | | | | The file does not seem to exist anymore in the VS 2017 environment.
| * | | | Upgrade AppVeyor to Visual Studio 2017Yuri Kunde Schlesner2017-05-221-3/+3
|/ / / / | | | | | | | | More C++14/17 goodness!
* | | | Merge pull request #2713 from wwylele/where-is-my-tc0_wYuri Kunde Schlesner2017-05-212-5/+8
|\ \ \ \ | | | | | | | | | | swrasterizer: add missing tc0_w attribute processing
| * | | | swrasterizer: add missing tc0_w and fragment lighting attribute processingwwylele2017-05-212-5/+8
|/ / / /
* | | | Merge pull request #2661 from Subv/uds5bunnei2017-05-195-33/+602
|\ \ \ \ | | | | | | | | | | Services/UDS: Generate 802.11 beacon frames when a network is open.
| * | | | Services/UDS: Use the new IPC helper functions.Subv2017-05-151-21/+10
| | | | |
| * | | | Services/UDS: Implement RecvBeaconBroadcastData.Subv2017-05-151-19/+69
| | | | | | | | | | | | | | | | | | | | | | | | | This allows the applications to retrieve 802.11 beacon frames from nearby UDS networks. Note that the networks are still not announced anywhere.
| * | | | Services/UDS: Generate the UDS beacons when the beacon callback fires.Subv2017-05-155-7/+537
| | | | |
* | | | | Merge pull request #2710 from emmauss/ptm_ipcbunnei2017-05-193-31/+45
|\ \ \ \ \ | | | | | | | | | | | | use IPCHelper for PTM services
| * | | | | use IPCHelper for PTM servicesemmaus2017-05-193-31/+45
| | | | | |
* | | | | | Merge pull request #2709 from wwylele/pica-masked-valueYuri Kunde Schlesner2017-05-181-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | pica: use correct register value for shader bool_uniforms
| * | | | | pica: use correct register value for shader bool_uniformswwylele2017-05-171-2/+2
|/ / / / / | | | | | | | | | | | | | | | variable value is not masked. the masked and combined register value should be used instead
* | | | | Merge pull request #2703 from wwylele/pica-reg-reviseYuri Kunde Schlesner2017-05-164-17/+25
|\ \ \ \ \ | | | | | | | | | | | | pica: correct bit field length for some registers
| * | | | | pica: correct bit field length for some registerswwylele2017-05-164-17/+25
| | | | | |
* | | | | | Merge pull request #2687 from yuriks/address-mappingsYuri Kunde Schlesner2017-05-1411-80/+157
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel: Map special regions according to ExHeader
| * | | | | | Kernel: Map special regions according to ExHeaderYuri Kunde Schlesner2017-05-105-52/+105
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This replaces the hardcoded VRAM/DSP mappings with ones made based on the ExHeader ARM11 Kernel caps list. While this has no visible effect for most applications (since they use a standard set of mappings) it does improve support for system modules and n3DS exclusives.
| * | | | | | DSP: Create backing memory for entire DSP RAMYuri Kunde Schlesner2017-05-105-32/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Also move address space mapping out of video_core.
| * | | | | | Memory: Add constants for the n3DS additional RAMYuri Kunde Schlesner2017-05-102-2/+16
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | This is 4MB of extra, separate memory that was added on the New 3DS.
* | | | | | Merge pull request #2695 from JayFoxRox/gs-regsWeiyi Wang2017-05-126-70/+171
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Prepare Pica registers for Geometry Shaders
| * | | | | Pica: Write GS registersJannik Vogel2017-05-121-0/+52
| | | | | | | | | | | | | | | | | | | | | | | | This adds the handlers for the geometry shader register writes which will call the functions from the previous commit to update registers for the GS.
| * | | | | Pica: Write shader registers in functionsJannik Vogel2017-05-121-57/+103
| | | | | | | | | | | | | | | | | | | | | | | | The commit after this one adds GS register writes, so this moves the VS handlers into functions so they can be re-used and extended more easily.
| * | | | | Pica: Set program code / swizzle data limit to 4096Jannik Vogel2017-05-115-13/+16
| | |_|/ / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | One of the later commits will enable writing to GS regs. It turns out that on startup, most games will write 4096 GS program words. The current limit of 1024 would hence result in 3072 (4096 - 1024) error messages: ``` HW.GPU <Error> video_core/shader/shader.cpp:WriteProgramCode:229: Invalid GS program offset 1024 ``` New constants have been introduced to represent these limits. The swizzle data size has also been raised. This matches the given field sizes of [GPUREG_SH_OPDESCS_INDEX](https://3dbrew.org/wiki/GPU/Internal_Registers#GPUREG_SH_OPDESCS_INDEX) and [GPUREG_SH_CODETRANSFER_INDEX](https://www.3dbrew.org/wiki/GPU/Internal_Registers#GPUREG_SH_CODETRANSFER_INDEX) (12 bit = [0; 4095]).
* | | | | Merge pull request #2669 from jroweboy/async_file_watcherYuri Kunde Schlesner2017-05-113-46/+35
|\ \ \ \ \ | | | | | | | | | | | | Frontend: Prevent FileSystemWatcher from blocking UI thread
| * | | | | Frontend: Prevent FileSystemWatcher from blocking UI threadJames Rowe2017-05-103-46/+35
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Instead of tying the QFileSystemWatcher to the GameList and updating in the UI thread, this change moves it to the worker thread. Since it gets deleted and recreated as part of the worker thread, this prevents it from ever getting used from multiple threads (which is why it was originally done on the UI thread)
* | | | | | Merge pull request #2676 from wwylele/irrstbunnei2017-05-109-24/+208
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | ir: implement new 3ds HID via ir:rst
| * | | | | fixup!ir: implement new 3ds HID via ir:rstwwylele2017-05-071-31/+32
| | | | | |
| * | | | | ir: implement new 3ds HID via ir:rstwwylele2017-05-049-24/+207
| | | | | |
* | | | | | Merge pull request #2696 from Subv/vfp_revertYuri Kunde Schlesner2017-05-093-59/+30
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Dyncom/VFP: Revert edf30d8 and fix the FPSCR getting invalid values.
| * | | | | Dyncom/VFP: Strip the VFP_NAN_FLAG sentinel value when setting vfp exceptions.Subv2017-05-092-2/+2
| | | | | |
| * | | | | Revert "Remove `exceptions` parameter from `normaliseround` VFP functions"Subv2017-05-093-57/+28
| | |/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This reverts commit edf30d84cc0e8299d61c98f5bb40a6428d1576bc. Conflicts: src/core/arm/skyeye_common/vfp/vfp_helper.h src/core/arm/skyeye_common/vfp/vfpdouble.cpp src/core/arm/skyeye_common/vfp/vfpsingle.cpp
* | | | | Merge pull request #2689 from yuriks/remove-disassemblerbunnei2017-05-0823-2389/+11
|\ \ \ \ \ | |/ / / / |/| | | | Remove built-in disassembler and related code
| * | | | Dyncom: Remove disassembler codeYuri Kunde Schlesner2017-05-084-1589/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Had licensing issue around it, in addition to several bugs. Closes #1632, #1280
| * | | | Dyncom: Tweak types and log formattingYuri Kunde Schlesner2017-05-083-8/+10
| | | | |
| * | | | Remove unused symbols codeYuri Kunde Schlesner2017-05-086-124/+0
| | | | |
| * | | | Remove ability to load symbol mapsYuri Kunde Schlesner2017-05-085-55/+2
| | | | | | | | | | | | | | | | | | | | | | | | | This was now mostly unused except by thread creation, which used a symbol of the entrypoint, if available, to name the thread.
| * | | | citra-qt: Remove callstack widgetYuri Kunde Schlesner2017-05-086-168/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Appears to be currently broken, and given the complexity of doing this for ARM code without debugging information, should probably be left to an external tool or library. Use the GDB stub instead. Closes #586
| * | | | citra-qt: Remove disassembler widgetYuri Kunde Schlesner2017-05-086-448/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It has performance problems, a very misleading UI, and is broken in general. It has essentially been superceded by the GDB stub, but if we wanted a built-in disassembler in the future it'd essentially need to be rewritten from scratch anyway. Closes #427, #1480
* | | | Merge pull request #2682 from nicoboss/filterYuri Kunde Schlesner2017-05-072-30/+35
|\ \ \ \ | | | | | | | | | | citra-qt: game list search function fixed minor mistakes
| * | | | Don’t focus the search field if the game is emptyNico Bosshard2017-05-061-3/+6
| | | | |
| * | | | Fixed some more typosNico Bosshard2017-05-032-4/+4
| | | | |
| * | | | citra-qt: game list search function fixed minor mistakesNico Bosshard2017-05-021-24/+26
| | | | |
* | | | | Merge pull request #2686 from wwylele/tex-coord-regYuri Kunde Schlesner2017-05-066-10/+32
|\ \ \ \ \ | | | | | | | | | | | | pica: use correct coordinates for texture 2
| * | | | | pica: shader_dirty if texture2 coord changedwwylele2017-05-055-7/+12
| | | | | |
| * | | | | pica: use correct coordinates for texture 2wwylele2017-05-034-5/+22
| |/ / / /
* | / / / Create a random console_unique_id (#2668)B3n302017-05-065-7/+123
| |/ / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Create a random console_id when config save_file is created Added button in system config to refresh the console unique id * Moved the connect for the button from .ui file to constructor of ConfigureSystem * Added warning and info dialog Fixup: Make use of qt5 style connects, renamed the refresh button, removed some duplicate code, changed random device and moved all to the generate function * Changed the random generator to reflect what a real 3DS stores as console unique id Fixup: Changed the warning message * Fixup: Set and Create * Fixup: Added console id label, therfore removed second message box * Fixup: fixed the endianess * Fixup: more endianness fixes * Fixup: Endianness the 3rd
* | | | Merge pull request #2606 from wwylele/irbunnei2017-05-047-51/+762
|\ \ \ \ | |/ / / |/| | | ir: implement circle pad pro
| * | | ir: implement circle pad prowwylele2017-05-036-44/+761
| | | |
| * | | qt: enable config for circle pad prowwylele2017-04-091-7/+1
| | | |
* | | | citra-qt: game list search function (#2673)Nico Bosshard2017-04-307-19/+299
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * citra-qt: game list search function * Empty search field during game list refresh * Code improvements * Code formatting * Autofocus search field * JayFoxRox's recommendations * lioncash's review
* | | | Merge pull request #2671 from wwylele/dot3-rgbabunnei2017-04-214-22/+39
|\ \ \ \ | | | | | | | | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)
| * | | | gl_shader_gen: remove TODO about Lerp behaviour verification. The implementation is verified against hardwarewwylele2017-04-201-2/+0
| | | | |
| * | | | rasterizer: implement combiner operation 7 (Dot3_RGBA)wwylele2017-04-194-20/+39
| | |_|/ | |/| |
* | | | Merge pull request #2666 from yuriks/gl-cleanupsYuri Kunde Schlesner2017-04-205-214/+215
|\ \ \ \ | | | | | | | | | | PicaShaderConfig cleanups
| * | | | OpenGL: Pass Pica regs via parameterYuri Kunde Schlesner2017-04-173-7/+5
| | | | |
| * | | | OpenGL: Move PicaShaderConfig to gl_shader_gen.hYuri Kunde Schlesner2017-04-174-202/+206
| | | | | | | | | | | | | | | | | | | | Also move the implementation of CurrentConfig to the cpp file.
| * | | | OpenGL: Move Attributes enum to a more appropriate fileYuri Kunde Schlesner2017-04-173-12/+11
| |/ / /
* | | | Merge pull request #2532 from wwylele/ldrro-ipcYuri Kunde Schlesner2017-04-181-193/+138
|\ \ \ \ | | | | | | | | | | ldr_ro: use IPC helper
| * | | | ldr_ro: use IPC helperwwylele2017-04-171-193/+138
| | |/ / | |/| |
* | | | Merge pull request #2667 from wwylele/button_from_axisbunnei2017-04-182-4/+59
|\ \ \ \ | |_|/ / |/| | | input_common/sdl: add support for binding button to axis
| * | | input_common/sdl: add support for binding button to axiswwylele2017-04-172-4/+59
|/ / /
* | | Merge pull request #2659 from MerryMage/dsp_dsp-correctionbunnei2017-04-131-0/+18
|\ \ \ | | | | | | | | dsp_dsp: Messages are modified by service before being sent to DSP
| * | | dsp_dsp: Messages are modified by service before being sent to DSPMerryMage2017-04-121-0/+18
| | | |
* | | | Better looking status bar under Linux Ubuntu (#2662)Cereal-Killa2017-04-131-0/+1
| |_|/ |/| | | | | | | | | | | * Remove borders from status bar items On Ubuntu the status bar didn't look as good as on Windows due to some border being drawn around each status bar cell.
* | | Merge pull request #2628 from Subv/udsSebastian Valle2017-04-122-45/+388
|\ \ \ | | | | | | | | Services/UDS: Initial support for hosting local-wlan networks.
| * | | Services/UDS: Fixed a style mistake in GetChannel.Sebastian Valle2017-03-271-2/+1
| | | |
| * | | Services/UDS: Use consistent spelling for WiFi and simplify the GetChannel function.Subv2017-03-261-4/+4
| | | |
| * | | Services/UDS: Signal the connection event when closing down the network.Subv2017-03-261-0/+1
| | | |
| * | | Services/UDS: Do not allow trying to start up a network that only the host can connect to.Subv2017-03-261-0/+3
| | | |
| * | | Service/UDS: Schedule an event to broadcast the beacon frames every 102.4ms.Subv2017-03-262-2/+58
| | | |
| * | | Services/UDS: Store the entire NetworkInfo structure that was used to create the network.Subv2017-03-261-13/+5
| | | | | | | | | | | | | | | | It will be needed when generating the beacon frames.
| * | | Services/UDS: Initial support for hosting local-wlan networks.Subv2017-03-262-44/+336
| | | | | | | | | | | | | | | | Currently it will let games create a network as hosts, but will not broadcast it anywhere and will not allow clients to connect.
* | | | Merge pull request #2658 from JayFoxRox/blend-equation-fixJames Rowe2017-04-091-2/+2
|\ \ \ \ | |_|_|/ |/| | | Pica/Regs: Correct bit width for blend-equations
| * | | Pica/Regs: Correct bit width for blend-equationsJannik Vogel2017-04-081-2/+2
|/ / /
* | | Merge pull request #2533 from Lectem/apt_ipchelperbunnei2017-04-066-257/+386
|\ \ \ | | | | | | | | IpcHelper enhancement and APT refactor
| * | | hopefully fix clang-format issues with old versionLectem2017-03-201-3/+2
| | | |
| * | | address more commentsLectem2017-03-191-20/+20
| | | |
| * | | Cast size_t to u32 for PushStaticBuffer usagesLectem2017-03-181-2/+2
| | | |
| * | | IPCHelper Skip method + address comments for aptLectem2017-03-183-38/+46
| | | |
| * | | fix #2560 and other commentsLectem2017-03-183-22/+22
| | | |
| * | | move push out of class body and add u8 u16 bool specializationsLectem2017-03-184-55/+114
| | | |
| * | | refactor APT service to use the new IPC helpersLectem2017-03-184-195/+258
| | | |
* | | | Merge pull request #2634 from wwylele/batterybunnei2017-04-062-1/+16
|\ \ \ \ | | | | | | | | | | shared_page: stub battery state
| * | | | shared_page: stub battery statewwylele2017-03-212-1/+16
| | | | |
* | | | | Merge pull request #2651 from jroweboy/configmovedMat M2017-04-0425-41/+41
|\ \ \ \ \ | | | | | | | | | | | | citra-qt: Move config dialog code to its own directory
| * | | | | citra-qt: Move config dialog code to its own directoryLioncash2017-04-0425-41/+41
|/ / / / /
* | | | | Merge pull request #2622 from jfmherokiller/socufixbunnei2017-04-041-39/+32
|\ \ \ \ \ | | | | | | | | | | | | error conversion fixes for soc_u
| * | | | | error conversion fixes for soc_unoah the goodra2017-04-031-39/+32
|/ / / / /
* | | | | Merge pull request #2648 from mtheall/masterbunnei2017-04-032-4/+4
|\ \ \ \ \ | | | | | | | | | | | | Fix OutputDebugString syscall
| * | | | | Fix OutputDebugString syscallMichael Theall2017-04-012-4/+4
|/ / / / /
* | | | | Merge pull request #2639 from wwylele/fix-ptm-fsbunnei2017-03-251-1/+1
|\ \ \ \ \ | | | | | | | | | | | | ptm: create SharedExtSave file before openning it
| * | | | | ptm: create SharedExtSave file before openning itwwylele2017-03-251-1/+1
|/ / / / /
* | | | | Merge pull request #2512 from SonofUgly/custom-layoutbunnei2017-03-229-13/+104
|\ \ \ \ \ | |/ / / / |/| | | | Add custom layout settings.
| * | | | Add custom layout settings.SonofUgly2017-02-239-13/+104
| | | | |
* | | | | Removed a linebreak from the README.Christopher J. Gilbert2017-03-211-1/+0
| | | | |
* | | | | Adding a linebreak to the README file.Christopher J. Gilbert2017-03-211-0/+1
| | | | |
* | | | | Merge pull request #2630 from wwylele/qt-focus-loss-2bunnei2017-03-205-3/+18
|\ \ \ \ \ | | | | | | | | | | | | Qt: Release all pressed buttons when window focus is lost [rebased]
| * | | | | citra-qt: remove dead codewwylele2017-03-173-5/+0
| | | | | |
| * | | | | citra-qt: release all buttons when render window focus is lostwwylele2017-03-174-0/+20
| | |/ / / | |/| | | | | | | | | | | | | credit to @Hawkheart for the original idea
* | | | | Merge pull request #2631 from wwylele/fix-unwrapWeiyi Wang2017-03-181-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | apt: fix RequestBuilder parameters for Unwrap
| * | | | apt: fix RequestBuilder parameters for Unwrapwwylele2017-03-181-1/+1
|/ / / /
* | | | Merge pull request #2497 from wwylele/input-2bunnei2017-03-1740-574/+1244
|\ \ \ \ | | | | | | | | | | Refactor input emulation & add SDL gamepad support
| * | | | qt/config_input: don't connect for null buttonwwylele2017-03-021-4/+7
| | | | |
| * | | | citra: update default ini with new input systemwwylele2017-03-011-28/+41
| | | | |
| * | | | Input: remove unused stuff & clean upwwylele2017-03-019-412/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 1. removed zl, zr and c-stick from HID::PadState. They are handled by IR, not HID 2. removed button handling in EmuWindow 3. removed key_map 4. cleanup #include
| * | | | Qt: rework input configuration for new input systemwwylele2017-03-012-68/+144
| | | | |
| * | | | InputCommon: add SDL joystick supportwwylele2017-03-014-0/+241
| | | | |
| * | | | InputCommon: add AnalogFromButtonwwylele2017-03-018-0/+162
| | | | |
| * | | | InputCommon: add Keyboardwwylele2017-03-0117-85/+254
| | | | |
| * | | | HID: use AnalogDevicewwylele2017-03-013-2/+30
| | | | |
| * | | | HID: use ButtonDevicewwylele2017-03-015-1/+100
| | | | |
| * | | | Input: add device and factory templatewwylele2017-03-014-0/+100
| | | | |
| * | | | Common: add ParamPackagewwylele2017-03-015-0/+188
| | | | |
* | | | | Merge pull request #2618 from wwylele/log-less-filenamebunnei2017-03-177-17/+20
|\ \ \ \ \ | | | | | | | | | | | | Reduce host file name and path logging
| * | | | | file_util: Log when using local user directorywwylele2017-03-111-0/+2
| | | | | |
| * | | | | file_sys: lower log level for setting host pathwwylele2017-03-084-4/+4
| | | | | |
| * | | | | file_util: lower logging level for harmless caseswwylele2017-03-081-9/+7
| | | | | |
| * | | | | loader/ncch: less verbose log for loading game list. only log program ID when bootingwwylele2017-03-081-3/+6
| | | | | |
| * | | | | loader: lower file name logging levelwwylele2017-03-081-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #2468 from Kloen/xamarin-pls-stopbunnei2017-03-161-0/+2
|\ \ \ \ \ | | | | | | | | | | | | appveyor: workaround for unnecesary Xamarin log spam
| * | | | | appveyor: workaround for unnecesary Xamarin log spamKloen2017-01-231-0/+2
| | | | | |
* | | | | | Merge pull request #2620 from FernandoS27/syscore_errorbunnei2017-03-161-5/+15
|\ \ \ \ \ \ | | | | | | | | | | | | | | Refined thread launch on syscore error messages
| * | | | | | Refined thread launch on syscore error messagesFernando Sahmkow2017-03-091-5/+15
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #2625 from wwylele/hash-console-uniquebunnei2017-03-161-7/+24
|\ \ \ \ \ \ | | | | | | | | | | | | | | cfg: correctly implement GenHashConsoleUnique
| * | | | | | cfg: implement GenHashConsoleUniquewwylele2017-03-121-7/+24
| |/ / / / /
* | | | | | Merge pull request #2626 from yuriks/msvc2017bunnei2017-03-162-5/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix building with MSVC 2017
| * | | | | externals: Update to boost v1.63.0Yuri Kunde Schlesner2017-03-131-0/+0
| | | | | |
| * | | | | common/cpu_detect: Add missing include and fix namespace scopeYuri Kunde Schlesner2017-03-131-5/+7
|/ / / / /
* | | | | Merge pull request #2614 from Schplee/patch-1Christopher J. Gilbert2017-03-061-2/+1
|\ \ \ \ \ | | | | | | | | | | | | Fixes typo on Citra forum link.
| * | | | | Fixes typo on Citra forum link.Schplee2017-03-061-2/+1
| | |/ / / | |/| | | | | | | | An extra ".citra-emu.org," was left when the link was changed to the current forum URL, so I fixed that.
* | | | | Merge pull request #2615 from Schplee/patch-2Christopher J. Gilbert2017-03-061-2/+2
|\ \ \ \ \ | |/ / / / |/| | | | New website link updates.
| * | | | New website link updates.Schplee2017-03-061-2/+2
|/ / / / | | | | | | | | Fixed the broken links that were a result of the updated website.
* | | | Merge pull request #2603 from wwylele/please-signalbunnei2017-02-271-0/+2
|\ \ \ \ | | | | | | | | | | Timer: restore missing signaled=true from #2421
| * | | | Timer: restore missing signaled=true from #2421wwylele2017-02-271-0/+2
|/ / / /
* | | | Merge pull request #2594 from wwylele/ir-separatebunnei2017-02-276-147/+159
|\ \ \ \ | | | | | | | | | | IR: separate functions of each port to their own files
| * | | | IR: separate functions of each port to their own fileswwylele2017-02-266-147/+159
| | | | |
* | | | | Fix log entry in timer::signal (#2600)B3n302017-02-271-1/+1
| | | | |
* | | | | Doxygen: Amend minor issues (#2593)Mat M2017-02-2718-23/+31
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Corrects a few issues with regards to Doxygen documentation, for example: - Incorrect parameter referencing. - Missing @param tags. - Typos in @param tags. and a few minor other issues.
* | | | | Merge pull request #2587 from yuriks/status-barYuri Kunde Schlesner2017-02-2728-449/+321
|\ \ \ \ \ | | | | | | | | | | | | Replace built-in Profiler with indicators in status bar
| * | | | | PerfStats: Re-order and document members betterYuri Kunde Schlesner2017-02-272-5/+14
| | | | | |
| * | | | | Qt: Tweak status bar stylingYuri Kunde Schlesner2017-02-271-0/+2
| | | | | |
| * | | | | Qt: Increase status bar update interval to 2 secondsYuri Kunde Schlesner2017-02-271-1/+1
| | | | | |
| * | | | | Core: Re-write frame limiterYuri Kunde Schlesner2017-02-275-42/+53
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Now based on std::chrono, and also works in terms of emulated time instead of frames, so we can in the future frame-limit even when the display is disabled, etc. The frame limiter can also be enabled along with v-sync now, which should be useful for those with displays running at more than 60 Hz.
| * | | | | Core: Make PerfStats internally lockedYuri Kunde Schlesner2017-02-277-16/+25
| | | | | | | | | | | | | | | | | | | | | | | | More ergonomic to use and will be required for upcoming changes.
| * | | | | Qt: Add tooltips to status bar displaysYuri Kunde Schlesner2017-02-271-0/+7
| | | | | |
| * | | | | Qt: Don't show fractional figures in the status barYuri Kunde Schlesner2017-02-271-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | They're not very important and this makes the display changes less often, making it less distracting.
| * | | | | Remove built-in (non-Microprofile) profilerYuri Kunde Schlesner2017-02-279-382/+2
| | | | | |
| * | | | | PerfStats: Add method to get the instantaneous time ratioYuri Kunde Schlesner2017-02-273-7/+22
| | | | | |
| * | | | | Add performance statistics to status barYuri Kunde Schlesner2017-02-2711-3/+159
| | | | | |
| * | | | | SynchronizedWrapper: Add Lock convenience methodYuri Kunde Schlesner2017-02-271-18/+25
| | | | | |
| * | | | | Qt: Add (empty) status barYuri Kunde Schlesner2017-02-276-1/+35
| | | | | |
| * | | | | Core: Remove unnecessary include in thread.hYuri Kunde Schlesner2017-02-274-1/+3
| | | | | |
* | | | | | Merge pull request #2595 from jroweboy/patchbunnei2017-02-251-1/+3
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Change travis tar command to specify compression format
| * | | | | Change travis tar command to specify compression formatJames Rowe2017-02-251-1/+3
|/ / / / / | | | | | | | | | | | | | | | | | | | | macOS uses bsdtar which doesn't have the -a flag which determines compression based on file extension.
* | | | | Merge pull request #2569 from wwylele/wrap-unwrapbunnei2017-02-2517-14/+568
|\ \ \ \ \ | | | | | | | | | | | | APT: implemented Wrap and Unwrap
| * | | | | externals: remove -march=native for crypto++wwylele2017-02-211-8/+1
| | | | | |
| * | | | | APT: implement Wrap and Unwrapwwylele2017-02-215-6/+149
| | | | | |
| * | | | | HW: add AES engine & implement AES-CCMwwylele2017-02-2112-0/+418
| | | | | |
* | | | | | Merge pull request #2421 from Subv/timersYuri Kunde Schlesner2017-02-253-16/+36
|\ \ \ \ \ \ | | | | | | | | | | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0
| * | | | | | Timers: Return an error when calling SetTimer with negative timeouts.Subv2017-02-221-0/+5
| | | | | | |
| * | | | | | Timers: Immediately signal the timer if it was started with an initial value of 0.Subv2017-02-222-16/+31
| | | | | | |
* | | | | | | Fixes file upload pattern in the travis.yml to include macOS releases (#2592)James Rowe2017-02-251-2/+2
| | | | | | |
* | | | | | | Merge pull request #2590 from jroweboy/mac-gzipYuri Kunde Schlesner2017-02-241-2/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Use gzip instead of lzma on macOS releases
| * | | | | | | Revert use gzip for linuxJames Rowe2017-02-231-2/+3
| | | | | | | | | | | | | | | | | | | | | | | | Uses tar -a flag to determine compression algorithm based off file extension (so linux will continue to use xz and macOS can use gzip)
| * | | | | | | Use gzip instead of lzma on macOS and linux releasesJames Rowe2017-02-231-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A common report from macOS users is they can't figure out how to unzip the program. This will allow them to double click to unzip the archive which is what users on macOS expect.
* | | | | | | | Use QFileSystemWatcher to reload the game list when a change is detected. (#2555)James Rowe2017-02-232-1/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Added a refresh game directory option to the file menu * Make the game list watcher recursive and have it start watching from the initial load * Rework game list watcher to be thread safe * Fix code style issues
* | | | | | | | Merge pull request #2441 from jroweboy/titlebarbunnei2017-02-236-5/+32
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Gui: Change title bar to include build name
| * | | | | | | Gui: Change title bar to include build nameJames Rowe2017-02-236-5/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Nightly builds now have "Citra Nightly" in the titlebar Bleeding edge builds now have "Citra Bleeding Edge" in the titlebar
* | | | | | | | [UI] Modify recursive scanning label (#2589)Anthony2017-02-231-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2579 from wwylele/no-clang-format-checkbunnei2017-02-211-17/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | hook: remove clang-format check
| * | | | | | | hook: remove clang-format checkwwylele2017-02-171-17/+0
| | | | | | | |
* | | | | | | | Merge pull request #2585 from MerryMage/sxtb16-sxtab16bunnei2017-02-201-4/+4
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | dyncom: Correct SXTAB16 and SXTB16
| * | | | | | | dyncom: Correct SXTAB16 and SXTB16MerryMage2017-02-181-4/+4
| | | | | | | |
* | | | | | | | Merge pull request #2580 from yuriks/qt-cleanup2Yuri Kunde Schlesner2017-02-194-96/+83
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | Qt cleanups 2
| * | | | | | | Qt: Move some connections from .ui file to codeYuri Kunde Schlesner2017-02-182-38/+3
| | | | | | | |
| * | | | | | | Qt: Reorganize connection of menu eventsYuri Kunde Schlesner2017-02-182-13/+23
| | | | | | | |
| * | | | | | | Qt: Re-organize setup of debugging widgetsYuri Kunde Schlesner2017-02-184-39/+51
| | | | | | | |
| * | | | | | | Qt: Fix action name to match conventionsYuri Kunde Schlesner2017-02-182-6/+6
| | | | | | | |
* | | | | | | | OpenGL: Check if uniform block exists before updating it (#2581)Jannik Vogel2017-02-181-29/+30
| | | | | | | |
* | | | | | | | dynarmic: Update the submodule.Emmanuel Gil Peyrot2017-02-181-0/+0
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes a build issue on gcc 6 due to -Werror and a warning caused by boost::optional, see: https://github.com/MerryMage/dynarmic/issues/83
* | | | | | | Merge pull request #2577 from yuriks/qt-cleanupYuri Kunde Schlesner2017-02-182-23/+19
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Qt cleanup
| * | | | | | Qt: Make IsSingleFileDropEvent staticYuri Kunde Schlesner2017-02-181-1/+1
| | | | | | |
| * | | | | | Qt: Allow any file extension in Open dialogYuri Kunde Schlesner2017-02-181-2/+3
| | | | | | |
| * | | | | | Qt: Remove orpahned function declarationYuri Kunde Schlesner2017-02-181-6/+0
| | | | | | |
| * | | | | | Qt: Remove unnecessary std::string usageYuri Kunde Schlesner2017-02-182-14/+15
|/ / / / / /
* | | | | | HID: move enable_accelerometer/gyroscope_count initialization into Init() (#2574)Weiyi Wang2017-02-171-2/+5
| | | | | | | | | | | | | | | | | | Fixes #2556
* | | | | | Merge pull request #2573 from jfmherokiller/dragndropbunnei2017-02-172-1/+41
|\ \ \ \ \ \ | | | | | | | | | | | | | | Added drag and drop feature to the code
| * | | | | | added drag n drop featurenoah the goodra2017-02-162-1/+41
|/ / / / / /
* | | | | | Merge pull request #2571 from wwylele/missing-fileMat M2017-02-151-0/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: add missing errors.h in CMakeLists.txt
| * | | | | | core: add missing errors.h in CMakeLists.txtwwylele2017-02-151-0/+1
| | | | | | |
* | | | | | | video_core: remove #pragma once in cpp file (#2570)Weiyi Wang2017-02-152-4/+0
|/ / / / / /
* | | | | | Merge pull request #2566 from yuriks/file-extension-suffixWeiyi Wang2017-02-141-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Qt/GameList: Use suffix() to parse the file extension
| * | | | | | Qt/GameList: Use suffix() to parse the file extensionYuri Kunde Schlesner2017-02-141-1/+1
| | |/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | completeSuffix returns everything after the first period, which means that a file such as `foo.bar.3ds` would not get recognized.
* | | | | | HLE/IPC: Fix uninitialized variables in helpers (#2568)Yuri Kunde Schlesner2017-02-141-3/+3
| | | | | | | | | | | | | | | | | | Fixes #2567
* | | | | | Merge pull request #2542 from jfmherokiller/httpsvclogYuri Kunde Schlesner2017-02-144-2/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | added http service enum to the log.h file
| * | | | | applied the change suggested by @wwylelenoah the goodra2017-02-141-0/+1
| | | | | |
| * | | | | NWM changed to NIMnoah the goodra2017-02-141-1/+1
| | | | | |
| * | | | | turned clang format back onnoah the goodra2017-02-141-1/+1
| | | | | |
| * | | | | added http service enum to the log.h filenoah the goodra2017-02-141-0/+1
|/ / / / /
* | | | | Merge pull request #2562 from yuriks/pica-refactor3Yuri Kunde Schlesner2017-02-1312-563/+661
|\ \ \ \ \ | | | | | | | | | | | | Re-organize software rasterizer code
| * | | | | SWRasterizer: Move more framebuffer functions to fileYuri Kunde Schlesner2017-02-133-100/+105
| | | | | |
| * | | | | SWRasterizer: Move texturing functions to their own fileYuri Kunde Schlesner2017-02-134-210/+259
| | | | | |
| * | | | | SWRasterizer: Convert large no-capture lambdas to standalone functionsYuri Kunde Schlesner2017-02-131-315/+310
| | | | | |
| * | | | | SWRasterizer: Move framebuffer operation functions to their own fileYuri Kunde Schlesner2017-02-134-236/+285
| | | | | |
| * | | | | VideoCore: Move software rasterizer files to sub-directoryYuri Kunde Schlesner2017-02-138-12/+12
| | | | | |
* | | | | | Core: add cryptopp library (#2412)Weiyi Wang2017-02-135-1/+176
| | | | | |
* | | | | | Merge pull request #2561 from wwylele/fs-romYuri Kunde Schlesner2017-02-139-60/+295
|\ \ \ \ \ \ | |/ / / / / |/| | | | | file_sys: change RomFS archive to Self NCCH archive
| * | | | | loader: use self NCCH archivewwylele2017-02-136-90/+7
| | | | | |
| * | | | | file_sys: add Self NCCH archivewwylele2017-02-135-0/+318
| |/ / / /
* | | | | video_core/shader: Document sanitized MUL operationYuri Kunde Schlesner2017-02-121-0/+8
| | | | |
* | | | | Merge pull request #2550 from yuriks/pica-refactor2Yuri Kunde Schlesner2017-02-1219-140/+133
|\ \ \ \ \ | | | | | | | | | | | | Small VideoCore cleanups
| * | | | | VideoCore: Split u64 Pica reg unions into 2 separate u32 unionsYuri Kunde Schlesner2017-02-091-36/+42
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This eliminates UB when aliasing it with the array of u32 regs, and is compatible with non-LE architectures.
| * | | | | VideoCore: Force enum sizes to u32 in LightingRegsYuri Kunde Schlesner2017-02-091-4/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All enums that are used with BitField must have their type forced to u32 to ensure correctness.
| * | | | | OpenGL: Remove unused duplicate of IsPassThroughTevStageYuri Kunde Schlesner2017-02-091-12/+0
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This copy was left behind when the shader generation code was moved to a separate file.
| * | | | | VideoCore: Split regs.h inclusionsYuri Kunde Schlesner2017-02-0914-25/+47
| | | | | |
| * | | | | Pica/Regs: Use binary search to look up reg namesYuri Kunde Schlesner2017-02-093-16/+11
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This gets rid of the static unordered_map. Also changes the return type const char*, avoiding unnecessary allocations (the result was only used by calling .c_str() on it.)
| * | | | | VideoCore: Use union to index into Regs structYuri Kunde Schlesner2017-02-092-46/+28
| |/ / / / | | | | | | | | | | | | | | | Also remove some unused members.
* | | | | citra-qt: Don't attempt to scan files with unsupported extensions (#2402)Kloen Lansfiel2017-02-123-4/+20
| | | | |
* | | | | core: Free AppLoader on shutdown to release file (#2558)Yuri Kunde Schlesner2017-02-111-9/+2
| | | | | | | | | | | | | | | Fixes #2455
* | | | | hid: remove the touch field from PadState (#2557)Weiyi Wang2017-02-112-6/+0
| | | | |
* | | | | video_core: Fix benign out-of-bounds indexing of array (#2553)Yuri Kunde Schlesner2017-02-111-2/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | The resulting pointer wasn't written to unless the index was verified as valid, but that's still UB and triggered debug checks in MSVC. Reported by garrettboast on IRC
* | | | Merge pull request #2482 from yuriks/pica-refactorYuri Kunde Schlesner2017-02-0937-2427/+2635
|\ \ \ \ | | | | | | | | | | Split up monolithic Regs struct
| * | | | VideoCore: Move Regs to its own fileYuri Kunde Schlesner2017-02-0426-662/+681
| | | | |
| * | | | VideoCore: Split shader regs from Regs structYuri Kunde Schlesner2017-02-049-102/+116
| | | | |
| * | | | VideoCore: Split geometry pipeline regs from Regs structYuri Kunde Schlesner2017-02-049-264/+292
| | | | |
| * | | | VideoCore: Split lighting regs from Regs structYuri Kunde Schlesner2017-02-046-312/+341
| | | | |
| * | | | VideoCore: Split framebuffer regs from Regs structYuri Kunde Schlesner2017-02-0411-457/+503
| | | | |
| * | | | VideoCore: Split texturing regs from Regs structYuri Kunde Schlesner2017-02-0417-507/+548
| | | | |
| * | | | VideoCore: Split rasterizer regs from Regs structYuri Kunde Schlesner2017-02-0414-188/+219
| | | | |
* | | | | Merge pull request #2539 from Kloen/re-killing-warningsbunnei2017-02-061-0/+0
|\ \ \ \ \ | | | | | | | | | | | | externals: nihstro, update to latest master. Again.
| * | | | | externals: nihstro, update to latest masterKloen2017-02-061-0/+0
|/ / / / /
* | | | | Merge pull request #2534 from Lectem/fix_etc1_msvc15Mat M2017-02-051-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Use std::array<u8,2> instead of u8[2] to fix MSVC build
| * | | | | Use std::array<u8,2> instead of u8[2] to fix MSVC buildLectem2017-02-051-1/+1
|/ / / / /
* | | | | Merge pull request #2027 from Lectem/ipcrefactorWeiyi Wang2017-02-056-68/+364
|\ \ \ \ \ | | | | | | | | | | | | IPC helper
| * | | | | fix wwylele's comment and use typename in templatesLectem2017-02-051-4/+4
| | | | | |
| * | | | | fix comments alignmentLectem2016-12-301-22/+22
| | | | | |
| * | | | | move Pop methods out of class bodyLectem2016-12-261-72/+88
| | | | | |
| * | | | | IPC helpers exampleLectem2016-12-263-35/+40
| | | | | |
| * | | | | IPC helpersLectem2016-12-263-48/+323
| | | | | |
* | | | | | Fix Microprofile in MinGW (#2530)Fernando Sahmkow2017-02-052-3/+1
| |/ / / / |/| | | |
* | | | | Merge pull request #2476 from yuriks/shader-refactor3Yuri Kunde Schlesner2017-02-0420-181/+185
|\ \ \ \ \ | | | | | | | | | | | | Oh No! More shader changes!
| * | | | | VideoCore: Make PrimitiveAssembler const-correctYuri Kunde Schlesner2017-01-302-3/+4
| | | | | |
| * | | | | VideoCore: Extract swrast-specific data from OutputVertexYuri Kunde Schlesner2017-01-305-58/+64
| | | | | |
| * | | | | VideoCore/Shader: Clean up OutputVertex::FromAttributeBufferYuri Kunde Schlesner2017-01-302-10/+16
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This also fixes a long-standing but neverthless harmless memory corruption bug, whech the padding of the OutputVertex struct would get corrupted by unused attributes.
| * | | | | Common: Optimize BitSet iteratorYuri Kunde Schlesner2017-01-301-14/+19
| | | | | |
| * | | | | VideoCore: Split shader output writing from semantic loadingYuri Kunde Schlesner2017-01-303-24/+24
| | | | | |
| * | | | | VideoCore: Consistently use shader configuration to load attributesYuri Kunde Schlesner2017-01-307-47/+26
| | | | | |
| * | | | | VideoCore: Use correct register for immediate mode attribute countYuri Kunde Schlesner2017-01-302-7/+13
| | | | | |
| * | | | | VideoCore: Rename some types to more accurate namesYuri Kunde Schlesner2017-01-3010-21/+21
| | | | | |
| * | | | | VideoCore: Change misleading register namesYuri Kunde Schlesner2017-01-304-8/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | A few registers had names such as "count" or "number" when they actually contained the maximum (that is, count - 1). This can easily lead to hard to notice off by one errors.
* | | | | | Merge pull request #2414 from yuriks/texture-decodeYuri Kunde Schlesner2017-02-0412-318/+482
|\ \ \ \ \ \ | | | | | | | | | | | | | | Texture decoding cleanups
| * | | | | | Pica/Texture: Move part of ETC1 decoding to new file and cleanupsYuri Kunde Schlesner2017-02-044-110/+159
| | | | | | |
| * | | | | | Pica/Texture: Simplify/cleanup texture tile addressingYuri Kunde Schlesner2017-02-045-44/+117
| | | | | | |
| * | | | | | VideoCore: Move LookupTexture out of debug_utils.hYuri Kunde Schlesner2017-02-049-308/+350
| | | | | | |
* | | | | | | changed the WIN32 macro in microprofileui (#2528)noah the goodra2017-02-041-1/+1
|/ / / / / / | | | | | | | | | | | | | | | | | | I changed the macro in microprofileui.h from WIN32 to _WIN32 so that it would correctly dectect that its being compiled on a windows platform
* | | | | | Merge pull request #2496 from mailwl/cfg-memYuri Kunde Schlesner2017-02-041-5/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | Core: update Kernel Config Memory to latest version (11.2)
| * | | | | | Core: update Kernel Config Memory to latest version (11.2)mailwl2017-01-301-5/+8
| | | | | | |
* | | | | | | Merge pull request #2520 from wwylele/shader-stack-boundaryYuri Kunde Schlesner2017-02-041-2/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ShaderJIT: add 16 dummy bytes at the bottom of the stack
| * | | | | | | ShaderJIT: add 16 dummy bytes at the bottom of the stackwwylele2017-02-031-2/+5
| | | | | | | |
* | | | | | | | Merge pull request #2518 from MerryMage/coprocYuri Kunde Schlesner2017-02-047-15/+140
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | arm_dynarmic: Coprocessor support
| * | | | | | | | arm_dynarmic: Update memory interfaceMerryMage2017-02-032-10/+10
| | | | | | | | |
| * | | | | | | | arm_dynarmic: CP15 supportMerryMage2017-02-037-5/+130
| | |_|_|_|_|_|/ | |/| | | | | |
* | | | | | | | Merge pull request #2509 from jfmherokiller/settingscastpatchbunnei2017-02-031-1/+1
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | removed the possibly uneeded cast on values.gdbstub_port
| * | | | | | | | removed the possibly uneeded cast on values.gdbstub_portnoah the goodra2017-01-311-1/+1
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | as far as i could tell this cast is unneeded because [GDBStub::SetServerPort](https://github.com/citra-emu/citra/blob/master/src/core/gdbstub/gdbstub.cpp#L897) takes a u16 and [values.gdbstub_port](https://github.com/citra-emu/citra/blob/master/src/core/settings.h#L116) is already a u16
* | | | | | | | Merge pull request #2507 from jfmherokiller/keyidchangebunnei2017-02-031-1/+0
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | removal of the -1 case in the configure_input switch
| * | | | | | | | removal of the -1 case in the configure_input switchnoah the goodra2017-01-311-1/+0
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | this case is unneeded because no enumeration value can possibly correspond to it
* / / / / / / / GSP_GPU::StoreDataCache stubbed (#2428)mailwl2017-02-031-1/+28
|/ / / / / / /
* | | | | | | HLE/Applets: Stub Mint (eShop) Applet (#2463)mailwl2017-01-314-0/+108
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows Phoenix Wright - Dual Destinies to boot.
* | | | | | | Common/x64: remove legacy emitter and abi (#2504)Weiyi Wang2017-01-316-4202/+1
| | | | | | | | | | | | | | | | | | | | | These are not used any more since we moved shader JIT to xbyak.
* | | | | | | shader_jit_x64_compiler: esi and edi should be persistent (#2500)Merry2017-01-311-0/+2
| | | | | | |
* | | | | | | file_util: Fixed implicit type conversion warning (#2503)noah the goodra2017-01-311-2/+2
|/ / / / / /
* / / / / / Support looping HLE audio (#2422)Jake Merdich2017-01-302-11/+35
|/ / / / / | | | | | | | | | | | | | | | | | | | | * Support looping HLE audio * DSP: Fix dirty bit clears, handle nonmonotonically incrementing IDs * DSP: Add start offset support
* | | | | Merge pull request #2368 from wwylele/camera-2Yuri Kunde Schlesner2017-01-3014-172/+1520
|\ \ \ \ \ | | | | | | | | | | | | CAM: build the service framework with a dummy implementation
| * | | | | CAM: implement basic camera functions with a blank camerawwylele2017-01-1114-172/+1520
| | |/ / / | |/| | |
* | | | | Merge pull request #2429 from wwylele/auto-language-fixYuri Kunde Schlesner2017-01-301-36/+38
|\ \ \ \ \ | | | | | | | | | | | | CFG: move language override to the boot process
| * | | | | CFG: override language setting on bootwwylele2017-01-191-36/+38
| | | | | |
* | | | | | Merge pull request #2495 from Kloen/killing-warnings-chain-of-memoriesYuri Kunde Schlesner2017-01-302-3/+0
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | video_core: Removed unused type alias
| * | | | | video_core: gl_rasterizer_cache.cpp removed unused type aliasKloen2017-01-301-1/+0
| | | | | |
| * | | | | video_core: gl_rasterizer.cpp removed unused type aliasKloen2017-01-301-2/+0
|/ / / / /
* | | | | Merge pull request #2494 from Kloen/killing-warnings-2-final-mixYuri Kunde Schlesner2017-01-301-1/+1
|\ \ \ \ \ | | | | | | | | | | | | core: inline CPU, 132 warnings fixed on GCC
| * | | | | core: inline CPU, 132 warnings fixed on GCCKloen2017-01-301-1/+1
| | | | | |
* | | | | | Merge pull request #2492 from Kloen/killing-warnings-HD1.5ReMIXYuri Kunde Schlesner2017-01-305-0/+48
|\ \ \ \ \ \ | | | | | | | | | | | | | | Fix OSX build warnings about unhandled enumeration values.
| * | | | | | citra: add missing control paths for ResultStatus on rom load. Fix warning about unhandled enumeration values on OSXKloen2017-01-291-0/+20
| | | | | | |
| * | | | | | core: fix err_f.cpp warning about unhandled enumeration value on OSXKloen2017-01-291-0/+2
| | | | | | |
| * | | | | | core: fix savedata_archive.cpp warnings about unhandled enumeration values on OSXKloen2017-01-291-0/+12
| | | | | | |
| * | | | | | core: fix archive_sdmc.cpp warnings about unhandled enumeration value on OSXKloen2017-01-291-0/+12
| | | | | | |
| * | | | | | core: fix archive_extsavedata.cpp warning on OSXKloen2017-01-291-0/+2
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #2493 from Kloen/killing-warnings-final-mixYuri Kunde Schlesner2017-01-301-0/+7
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | video_core: silence unused-local-typedef boost related warnings on GCC
| * | | | | video_core: silence unused-local-typedef boost related warning on GCCKloen2017-01-291-0/+7
| |/ / / /
* | | | | Merge pull request #2491 from Kloen/killing-warnings-2.5HDRemixYuri Kunde Schlesner2017-01-291-6/+6
|\ \ \ \ \ | |/ / / / |/| | | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVC
| * | | | core: emu_window.cpp, fix conversion warnings from float to s16 on MSVCKloen2017-01-291-6/+6
|/ / / /
* | | | Merge pull request #2485 from Kloen/killing-warnings-computehash64Yuri Kunde Schlesner2017-01-282-6/+7
|\ \ \ \ | | | | | | | | | | Switch ComputeHash64 len param to size_t instead of int
| * | | | common: add <cstddef> to hash.hKloen2017-01-281-0/+1
| | | | |
| * | | | common: switch ComputeHash64 len param to size_t instead of int, fix warning on MSVC on dsp_dsp.cppKloen2017-01-282-6/+6
| | | | |
* | | | | Merge pull request #2484 from Kloen/killing-warnings-nihstroYuri Kunde Schlesner2017-01-281-0/+0
|\ \ \ \ \ | |/ / / / |/| | | | Updated nihstro to latest master. Fix warning on MSVC
| * | | | externals: Updated nihstro to latest master. Fix warning on MSVCKloen2017-01-281-0/+0
|/ / / /
* | | | Merge pull request #2478 from jfmherokiller/masterJames Rowe2017-01-271-1/+1
|\ \ \ \ | | | | | | | | | | fixed the override warning
| * | | | fixed the override warningnoah the goodra2017-01-271-1/+1
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ``` In file included from citra/src/audio_core/sink_details.cpp:11: citra/src/./audio_core/sdl2_sink.h:25:10: warning: 'SetDevice' overrides a member function but is not marked 'override' [-Winconsistent-missing-override] void SetDevice(int device_id); ^ citra/src/./audio_core/sink.h:39:18: note: overridden virtual function is here virtual void SetDevice(int device_id) = 0; ^ ```
* | | | Merge pull request #2346 from yuriks/shader-refactor2Yuri Kunde Schlesner2017-01-2713-1110/+1189
|\ \ \ \ | | | | | | | | | | More shader refactoring
| * | | | VideoCore/Shader: Move entry_point to SetupBatchYuri Kunde Schlesner2017-01-267-29/+29
| | | | |
| * | | | VideoCore/Shader: Move per-batch ShaderEngine state into ShaderSetupYuri Kunde Schlesner2017-01-267-46/+43
| | | | |
| * | | | Shader: Remove OutputRegisters structYuri Kunde Schlesner2017-01-264-22/+17
| | | | |
| * | | | Shader: Initialize conditional_code in interpreterYuri Kunde Schlesner2017-01-262-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This doesn't belong in LoadInputVertex because it also happens for non-VS invocations. Since it's not used by the JIT it seems adequate to initialize it in the interpreter which is the only thing that cares about them.
| * | | | Shader: Don't read ShaderSetup from global stateYuri Kunde Schlesner2017-01-261-3/+3
| | | | |
| * | | | shader_jit_x64: Don't read program from global stateYuri Kunde Schlesner2017-01-263-22/+22
| | | | |
| * | | | VideoCore/Shader: Move ProduceDebugInfo to InterpreterEngineYuri Kunde Schlesner2017-01-265-19/+11
| | | | |
| * | | | Debugger: Always use interpreter for shader debuggingYuri Kunde Schlesner2017-01-261-3/+5
| | | | |
| * | | | VideoCore/Shader: Split interpreter and JIT into separate ShaderEnginesYuri Kunde Schlesner2017-01-268-97/+153
| | | | |
| * | | | VideoCore/Shader: Rename shader_jit_x64{ => _compiler}.{cpp,h}Yuri Kunde Schlesner2017-01-264-4/+4
| | | | |
| * | | | VideoCore/Shader: Split shader uniform state and shader engineYuri Kunde Schlesner2017-01-265-22/+57
| | | | | | | | | | | | | | | | | | | | | | | | | Currently there's only a single dummy implementation, which will be split in a following commit.
| * | | | VideoCore/Shader: Add constness to methodsYuri Kunde Schlesner2017-01-262-4/+4
| | | | |
| * | | | VideoCore/Shader: Use only entry_point as ShaderSetup paramYuri Kunde Schlesner2017-01-264-12/+14
| | | | | | | | | | | | | | | | | | | | | | | | | This removes all implicit dependency of ShaderState on global PICA state.
| * | | | VideoCore/Shader: Use self instead of g_state.vs in ShaderSetupYuri Kunde Schlesner2017-01-263-13/+9
| | | | |
| * | | | VideoCore/Shader: Extract input vertex loading code into functionYuri Kunde Schlesner2017-01-263-22/+26
| | | | |
* | | | | SDL: Select audio device (#2403)Kloen Lansfiel2017-01-2614-18/+129
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Initial Commit Added Device logic to Sinks Started on UI for selecting devices Removed redundant import * Audio Core: Complete Device Switching Complete the device switching implementation by allowing the output device to be loaded, changed and saved through the configurations menu. Worked with the Sink abstraction and tuned the "Device Selection" configuration so that the Device List is automatically populated when the Sink is changed. This hopefully addresses the concerns and recommendations mentioned in the comments of the PR. * Clean original implementation. * Refactor GetSinkDetails
* | | | Merge pull request #2434 from mailwl/nfc-amiiboYuri Kunde Schlesner2017-01-264-20/+249
|\ \ \ \ | | | | | | | | | | Service/NFC: stub some functions
| * | | | Service/NFC: stub some functionsmailwl2017-01-144-20/+249
| | | | | | | | | | | | | | | | | | | | Tested on: Mini-Mario & Friends - amiibo Challenge
* | | | | Merge pull request #2469 from Kloen/killing-warningsYuri Kunde Schlesner2017-01-254-8/+9
|\ \ \ \ \ | | | | | | | | | | | | Fixing some MSVC warnings
| * | | | | video_core: fix shader.cpp signed / unsigned warningKloen2017-01-231-2/+2
| | | | | |
| * | | | | video_core: gl_rasterizer float to int warningKloen2017-01-231-1/+2
| | | | | |
| * | | | | video_core: fix gl_rasterizer warning on MSVCKloen2017-01-231-1/+1
| | | | | |
| * | | | | core: fix mic_u warnings on MSVCKloen2017-01-231-4/+4
| | |_|_|/ | |/| | |
* / | | | github: fixed issue template forum links (#2470)Kloen Lansfiel2017-01-241-2/+2
|/ / / /
* | | | Changed FAQ link (#2462)3dsemu2017-01-231-1/+1
| | | | | | | | | | | | | | | | Changed the FAQ link so it leads to the FAQ on the Citra website, instead of the FAQ hosted on GitHub
* | | | Merge pull request #2466 from Kloen/we-dont-need-thisbunnei2017-01-2315-2385/+2
|\ \ \ \ | | | | | | | | | | Removed unused and outdated external qhexedit
| * | | | Removed unused and outdated external qhexeditKloen2017-01-2213-2353/+2
| | | | |
| * | | | citra-qt: Removed unused and unimplemented ramview files.Kloen2017-01-224-32/+0
|/ / / /
* | | | Merge pull request #2458 from wwylele/reset-accel-gyrobunnei2017-01-211-0/+2
|\ \ \ \ | | | | | | | | | | HID: reset acceleroeter and gyroscope index in Init
| * | | | HID: reset acceleroeter and gyroscope index in Initwwylele2017-01-201-0/+2
| | | | |
* | | | | Merge pull request #2459 from 3ds-emu/patch-1bunnei2017-01-211-1/+2
|\ \ \ \ \ | |/ / / / |/| | | | Updated Citra forum link
| * | | | Updated Citra forum link3ds-emu2017-01-211-1/+2
|/ / / / | | | | | | | | | | | | | | | | The Citra forum (discuss.citra-emu.org) has recently been down. The link that has been added in this file now leads to an error pages. I update updated the link so it now leads to Citra's new forum.
* | | | Merge pull request #2450 from Xtansia/masterYuri Kunde Schlesner2017-01-191-9/+25
|\ \ \ \ | | | | | | | | | | loader: Add support for 3DSX special relocation types
| * | | | loader: Add support for 3DSX special relocation types, fixes citra-emu/citra#2449Thomas Farr2017-01-181-9/+25
|/ / / / | | | | | | | | | | | | As per devkitPro/3dstools@47bea18
* | | | Merge pull request #2442 from wwylele/hid-signalYuri Kunde Schlesner2017-01-165-64/+96
|\ \ \ \ | |/ / / |/| | | HID: manages updating itself using correct ticks
| * | | CoreTiming: use named constant for ARM11 clock ratewwylele2017-01-164-5/+6
| | | |
| * | | HID: manages updating itself using correct tickswwylele2017-01-163-62/+93
|/ / /
* | | Merge pull request #2435 from mailwl/gsp-maskYuri Kunde Schlesner2017-01-141-1/+1
|\ \ \ | | | | | | | | GSP::WriteHWRegsWithMask: fix register mask
| * | | GSP::WriteHWRegsWithMask: fix register maskmailwl2017-01-141-1/+1
|/ / /
* | | Merge pull request #2423 from Kloen/floats-should-be-floatbunnei2017-01-131-1/+2
|\ \ \ | |/ / |/| | SDL2: Config, fix double to float warning
| * | SDL2: Config.cpp fix double to float warningKloen2017-01-111-1/+2
| | |
* | | Merge pull request #2424 from Kloen/qt-ui-warnings-reallybunnei2017-01-123-24/+23
|\ \ \ | | | | | | | | Qt: Fix UI related warnings and bonus ui file format
| * | | QT: Fix ui file formatKloen2017-01-111-20/+20
| | | |
| * | | QT: Fix some UI related warningsKloen2017-01-112-4/+3
| |/ /
* | | Merge pull request #2425 from Subv/cleanup_todosbunnei2017-01-124-32/+30
|\ \ \ | | | | | | | | Implement some TODOs in the code.
| * | | Threads: Check the process' resource limit for the max allowed priority when creating a thread and remove the priority clamping code.Subv2017-01-112-13/+9
| | | |
| * | | Thread: Added priority range checking to svcSetThreadPriority and removed priority clamping code from Thread::SetPriority.Subv2017-01-113-18/+18
| | | |
| * | | Y2R: Use the proper error code when GetStandardCoefficient receives an invalid value.Subv2017-01-111-1/+3
| |/ /
* | | Merge pull request #2308 from mailwl/ac-ibunnei2017-01-129-297/+424
|\ \ \ | |/ / |/| | Service/AC: add ac:i service
| * | Service/AC: add ac:i servicemailwl2016-12-309-297/+424
| | |
* | | Merge pull request #2397 from Subv/pulsebunnei2017-01-105-13/+20
|\ \ \ | | | | | | | | Kernel: Implemented Pulse event and timers.
| * | | Kernel: Implemented Pulse event and timers.Subv2017-01-055-13/+20
| | | | | | | | | | | | | | | | Closes #1904
* | | | Merge pull request #2418 from jroweboy/appveyor_masterJames Rowe2017-01-081-0/+1
|\ \ \ \ | | | | | | | | | | Prevents appveyor from attempting to deploy except on the nightly repo
| * | | | Prevents appveyor from attempting to deploy except on the nightly repoJames Rowe2017-01-081-0/+1
|/ / / /
* | | | Merge pull request #2384 from bunnei/internal-res-optionbunnei2017-01-0810-25/+170
|\ \ \ \ | | | | | | | | | | config: Add option for specifying screen resolution scale factor.
| * | | | config: Add option for specifying screen resolution scale factor.bunnei2017-01-0710-25/+170
| | | | |
* | | | | Merge pull request #1951 from wwylele/motion-sensorbunnei2017-01-0714-16/+321
|\ \ \ \ \ | |/ / / / |/| | | | Emulate motion sensor in frontend
| * | | | Frontend: make motion sensor interfaced thread-safewwylele2016-12-292-2/+8
| | | | |
| * | | | Frontend: emulate motion sensorwwylele2016-12-269-16/+239
| | | | |
| * | | | Common: add Quaternionwwylele2016-12-262-0/+45
| | | | |
| * | | | vector math: add implementation of Length and Normalizewwylele2016-12-261-0/+19
| | | | |
| * | | | MathUtil: add PI constantwwylele2016-12-261-0/+2
| | | | |
| * | | | Common::Event: add WaitUntilwwylele2016-12-261-0/+10
| | |_|/ | |/| |
* | | | Merge pull request #2410 from Subv/sleepthreadbunnei2017-01-073-0/+14
|\ \ \ \ | | | | | | | | | | Don't yield execution in SleepThread(0) if there are no available threads to run
| * | | | Kernel: Don't attempt to yield execution in SleepThread(0) if there are no available threads to run.Subv2017-01-063-0/+14
| | | | | | | | | | | | | | | | | | | | With this we avoid an useless temporary deschedule of the current thread.
* | | | | Merge pull request #2396 from Subv/sema_acquirebunnei2017-01-071-1/+2
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.
| * | | | | Kernel/Semaphore: Fixed a regression in semaphore waits.Subv2017-01-051-1/+2
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | The regression was caused by a missing check in #2260. The new behavior is consistent with the real kernel.
* | | | | Kernel: Fix SharedMemory objects always returning error when addr = 0 (#2404)Hyper2017-01-061-1/+5
| | | | | | | | | | | | | | | Closes #2400
* | | | | Merge pull request #2408 from Subv/priority_boostingbunnei2017-01-061-27/+0
|\ \ \ \ \ | | | | | | | | | | | | Kernel: Removed the priority boost code for starved threads.
| * | | | | Kernel: Removed the priority boost code for starved threads.Subv2017-01-051-27/+0
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | After hwtesting and reverse engineering the kernel, it was found that the CTROS scheduler performs no priority boosting for threads like this, although some other forms of scheduling priority-starved threads might take place. For example, it was found that hardware interrupts might cause low-priority threads to run if the CPU is preempted in the middle of an SVC handler that deschedules the current (high priority) thread before scheduling it again.
* | | | | Merge pull request #2409 from Subv/unused_funcsSebastian Valle2017-01-052-32/+0
|\ \ \ \ \ | |/ / / / |/| | | | Kernel: Remove some unused functions.
| * | | | Kernel: Remove some unused functions.Subv2017-01-052-32/+0
|/ / / /
* | | | Merge pull request #2393 from Subv/synchSebastian Valle2017-01-0518-162/+227
|\ \ \ \ | | | | | | | | | | Kernel: Mutex priority inheritance and synchronization improvements.
| * | | | Kernel: Add some asserts to enforce the invariants in the scheduler.Subv2017-01-052-2/+13
| | | | |
| * | | | Kernel: Remove a thread from all of its waiting objects' waiting_threads list when it is awoken.Subv2017-01-051-18/+4
| | | | | | | | | | | | | | | | | | | | This fixes a potential bug where threads would not get removed from said list if they awoke after waiting with WaitSynchronizationN with wait_all = false
| * | | | Kernel: Remove Thread::wait_objects_index and use wait_objects to hold all the objects that a thread is waiting on.Subv2017-01-054-21/+22
| | | | |
| * | | | Kernel: Use different thread statuses when a thread calls WaitSynchronization1 and WaitSynchronizationN with wait_all = true.Subv2017-01-044-19/+26
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit removes the overly general THREADSTATUS_WAIT_SYNCH and replaces it with two more granular statuses: THREADSTATUS_WAIT_SYNCH_ANY when a thread waits on objects via WaitSynchronization1 or WaitSynchronizationN with wait_all = false. THREADSTATUS_WAIT_SYNCH_ALL when a thread waits on objects via WaitSynchronizationN with wait_all = true.
| * | | | Kernel/Mutex: Propagate thread priority changes to other threads inheriting the priority via mutexesSubv2017-01-045-42/+60
| | | | |
| * | | | Kernel/Mutex: Update a mutex priority when a thread stops waiting on it.Subv2017-01-045-24/+42
| | | | |
| * | | | Kernel/Mutex: Implemented priority inheritance.Subv2017-01-045-31/+51
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The implementation is based on reverse engineering of the 3DS's kernel. A mutex holder's priority will be temporarily boosted to the best priority among any threads that want to acquire any of its held mutexes. When the holder releases the mutex, it's priority will be boosted to the best priority among the threads that want to acquire any of its remaining held mutexes.
| * | | | Kernel: Object ShouldWait and Acquire calls now take a thread as a parameter.Subv2017-01-0417-68/+56
| | | | | | | | | | | | | | | | | | | | This will be useful when implementing mutex priority inheritance.
| * | | | Kernel/Synch: Do not attempt a reschedule on every syscall.Subv2017-01-042-2/+18
| | | | | | | | | | | | | | | | | | | | Not all syscalls should cause reschedules, this commit attempts to remedy that, however, it still does not cover all cases.
* | | | | Merge pull request #2407 from jroweboy/nightly-deployJames Rowe2017-01-052-2/+7
|\ \ \ \ \ | | | | | | | | | | | | Change travis to deploy on push to citra-nightly.
| * | | | | Change travis to deploy on push to citra-nightly. Add more information to the releases pageJames Rowe2017-01-052-2/+7
|/ / / / /
* | | | | Merge pull request #2405 from jroweboy/nightly-deployJames Rowe2017-01-054-42/+14
|\ \ \ \ \ | | | | | | | | | | | | Change deploy to use github releases instead
| * | | | | Change deploy to use github releases instead, but only for the citra-nightly repoJames Rowe2017-01-054-42/+14
|/ / / / /
* | | | | Fix some warnings (#2399)Jonathan Hao2017-01-0413-35/+9
| | | | |
* | | | | Update .travis.ymlbunnei2017-01-041-1/+1
| | | | |
* | | | | Merge pull request #2401 from jroweboy/travis-keyJames Rowe2017-01-041-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Try a different travis key
| * | | | | Try a different travis keyJames Rowe2017-01-041-1/+1
|/ / / / /
* | | | | Merge pull request #2382 from mailwl/nfcYuri Kunde Schlesner2017-01-037-0/+44
|\ \ \ \ \ | |_|_|/ / |/| | | | Service/NFC: stub GetTagInRangeEvent
| * | | | Service/NFC: stub GetTagInRangeEventmailwl2016-12-307-0/+44
| | |_|/ | |/| | | | | | | | | | Fix Fatal Error in Mini-Mario & Friends - amiibo Challenge
* | | | Merge pull request #2390 from jroweboy/bintrayJames Rowe2017-01-012-2/+3
|\ \ \ \ | | |/ / | |/| | Try a different encrypted bintray api key for travis.
| * | | Try a different encrypted bintray api key for travis. Change appveyor to upload to a long git hash (since travis is stuck uploading to the full hash name)James Rowe2017-01-012-2/+3
| | | |
* | | | Merge pull request #2254 from jroweboy/bintrayJames Rowe2017-01-016-51/+86
|\| | | | | | | | | | | Add deploy to bintray for builds to master
| * | | Trying to make a consistent nightly versioningJames Rowe2017-01-012-2/+4
| | | |
| * | | Add deploy to bintray for builds to masterJames Rowe2016-12-316-51/+84
|/ / /
* | | Merge pull request #2386 from bunnei/fix-bg-colorSebastian Valle2016-12-301-6/+6
|\ \ \ | |/ / |/| | config: SDL: Move background color setting to correct section.
| * | config: SDL: Move background color setting to correct section.bunnei2016-12-301-6/+6
| | |
* | | Merge pull request #2240 from wwylele/auto-regionbunnei2016-12-3011-7/+108
|\ \ \ | |/ / |/| | Config: auto-select region and language
| * | Config: auto-select region and languagewwylele2016-12-0711-7/+108
| | |
* | | Merge pull request #2367 from JayFoxRox/lighting-lut-quickfixbunnei2016-12-291-10/+9
|\ \ \ | | | | | | | | Lighting LUT Quickfix
| * | | Minor cleanup in GLSL codeJannik Vogel2016-12-251-3/+2
| | | |
| * | | Offset lighting LUT samples correctlyJannik Vogel2016-12-251-7/+7
| | | |
* | | | Merge pull request #2376 from wwylele/remove-unusedbunnei2016-12-271-58/+0
|\ \ \ \ | | | | | | | | | | Core: remove unused hle.cpp
| * | | | Core: remove unused hle.cppwwylele2016-12-271-58/+0
|/ / / /
* | | | Merge pull request #2374 from wwylele/whats-going-on-with-that-prbunnei2016-12-271-0/+1
|\ \ \ \ | |_|_|/ |/| | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properly
| * | | Core: reset cpu_core in Shutdown to make IsPoweredOn work properlywwylele2016-12-241-0/+1
|/ / /
* | | Merge pull request #2369 from MerryMage/core-frontendbunnei2016-12-2314-16/+16
|\ \ \ | | | | | | | | core: Move emu_window and key_map into core
| * | | core: Move emu_window and key_map into coreMerryMage2016-12-2314-16/+16
| | | | | | | | | | | | | | | | * Removes circular dependences (common should not depend on core)
* | | | Merge pull request #2370 from wwylele/where-is-my-shared-fontYuri Kunde Schlesner2016-12-231-3/+1
|\ \ \ \ | |/ / / |/| | | file_util: fix missing sysdata path
| * | | file_util: fix missing sysdata pathwwylele2016-12-231-3/+1
| |/ /
* | | Merge pull request #2364 from mailwl/nwm-servicesbunnei2016-12-2318-10/+317
|\ \ \ | |/ / |/| | Service/NWM: add nwm services
| * | Service/NWM: add nwm servicesmailwl2016-12-2218-10/+317
|/ /
* | Merge pull request #2366 from MerryMage/MemoryReadCodebunnei2016-12-222-0/+1
|\ \ | | | | | | arm_dynarmic: Provide MemoryReadCode callback
| * | arm_dynarmic: Provide MemoryReadCode callbackMerryMage2016-12-222-0/+1
| | | | | | | | | | | | Change of interface in dynarmic 36082087ded632079b16d24137fdd0c450ce82ea
* | | Merge pull request #2343 from bunnei/core-cleanupbunnei2016-12-2245-591/+435
|\ \ \ | |/ / |/| | Core: Top-level consolidate & misc cleanup
| * | ThreadContext: Move from "core" to "arm_interface".bunnei2016-12-228-37/+26
| | |
| * | core: Replace "AppCore" nomenclature with just "CPU".bunnei2016-12-2211-105/+103
| | |
| * | Address clang-format issues.bunnei2016-12-228-49/+49
| | |
| * | core: Remove HLE module, consolidate code & various cleanups.bunnei2016-12-2219-107/+94
| | |
| * | core: Consolidate core and system state, remove system module & cleanups.bunnei2016-12-2222-336/+284
| | |
| * | file_util: Remove unused paths.bunnei2016-12-223-87/+3
| | |
| * | core: Consolidate top-level system state into a singleton.bunnei2016-12-228-103/+164
| | |
| * | loader: Remove duplicate docstrings.bunnei2016-12-223-56/+0
| | |
* | | Merge pull request #2285 from mailwl/csnd-formatbunnei2016-12-224-49/+94
|\ \ \ | | | | | | | | csnd:SND: Reformat source code
| * | | csnd:SND reformat source codemailwl2016-12-124-49/+94
| | | |
* | | | Merge pull request #2361 from lioncash/disasmbunnei2016-12-221-3/+1
|\ \ \ \ | |_|/ / |/| | | disassembler: Remove mutable specifier from breakpoints member variable
| * | | disassembler: Remove mutable specifier from breakpoints member variableLioncash2016-12-211-3/+1
| | | | | | | | | | | | | | | | | | | | Breakpoints has been const correct with regards to what the DisassmblerModel needs for quite a while now.
* | | | Merge pull request #2362 from lioncash/graphicsbunnei2016-12-2217-32/+32
|\ \ \ \ | |/ / / |/| | | citra-qt: Move graphics debugging code into its own folder
| * | | citra-qt: Move graphics debugging code into its own folderLioncash2016-12-2117-32/+32
|/ / / | | | | | | | | | | | | Keeps all graphics debugging stuff from cluttering up the root debugger folder
* | | Merge pull request #2319 from yuriks/profile-scopesbunnei2016-12-212-0/+15
|\ \ \ | | | | | | | | VideoCore: Make profiling scope more representative
| * | | VideoCore: Make profiling scope more representativeYuri Kunde Schlesner2016-12-152-0/+15
| | | |
* | | | Merge pull request #2357 from lioncash/uibunnei2016-12-212-67/+100
|\ \ \ \ | | | | | | | | | | citra-qt: Move bits of constructor behavior to named functions
| * | | | citra-qt: Move bits of constructor behavior to named functionsLioncash2016-12-192-67/+100
| | | | | | | | | | | | | | | | | | | | | | | | | Makes the initialization process a tad easier to grok, since the constructor isn't just a glob of random unrelated behaviors.
* | | | | Merge pull request #2356 from Chainsawkitten/GLbooleanbunnei2016-12-211-4/+4
|\ \ \ \ \ | |/ / / / |/| | | | Use GL_TRUE when setting color_mask
| * | | | Use GL_TRUE when setting color_maskAlbin Bernhardsson2016-12-191-4/+4
|/ / / /
* | | | Merge pull request #2318 from yuriks/trace-optbunnei2016-12-193-16/+15
|\ \ \ \ | | | | | | | | | | VideoCore: Inline IsPicaTracing
| * | | | VideoCore: Inline IsPicaTracingYuri Kunde Schlesner2016-12-153-16/+15
| |/ / / | | | | | | | | | | | | Speeds up ALBW main menu slightly (~3%)
* | | | Merge pull request #2351 from CaptV0rt3x/masterbunnei2016-12-181-0/+1
|\ \ \ \ | | | | | | | | | | Fixed game_list focus issue.
| * | | | Fixed game_list focusing issue.Vamsi Krishna2016-12-181-0/+1
| | | | | | | | | | | | | | | | | | | | added line render_window->setFocus();
* | | | | Merge pull request #2347 from citra-emu/revert-2321-flush-pagesbunnei2016-12-181-10/+0
|\ \ \ \ \ | | | | | | | | | | | | Revert "Memory: Always flush whole pages from surface cache"
| * | | | | Revert "Memory: Always flush whole pages from surface cache"bunnei2016-12-181-10/+0
| |/ / / /
* | | | | Merge pull request #2353 from CaptV0rt3x/code-cleanupbunnei2016-12-183-7/+2
|\ \ \ \ \ | |/ / / / |/| | | | Code cleanup
| * | | | line fixup for travis ciCaptV0rt3x2016-12-181-1/+0
| | | | |
| * | | | screen swap - Hotkey mappingVamsi Krishna2016-12-182-5/+1
| | | | |
| * | | | Fixed GPLv2 license text in the start.Vamsi Krishna2016-12-181-1/+1
|/ / / /
* | | | Merge pull request #2345 from wwylele/no-zombie-threadbunnei2016-12-173-3/+15
|\ \ \ \ | | | | | | | | | | Thread: remove the thread from the thread list when exiting
| * | | | Thread: remove the thread from the thread list when exitingwwylele2016-12-173-3/+15
|/ / / /
* | | | Merge pull request #2335 from yuriks/shader-refactorYuri Kunde Schlesner2016-12-179-338/+336
|\ \ \ \ | | | | | | | | | | Misc. Shader refactors
| * | | | VideoCore/Shader: Extract DebugData out from UnitStateYuri Kunde Schlesner2016-12-168-103/+99
| | | | |
| * | | | Remove unnecessary castYuri Kunde Schlesner2016-12-161-3/+1
| | | | |
| * | | | VideoCore/Shader: Extract evaluate_condition lambda to function scopeYuri Kunde Schlesner2016-12-161-26/+24
| | | | |
| * | | | VideoCore/Shader: Extract call lambda up a scope and remove unused paramYuri Kunde Schlesner2016-12-161-21/+17
| | | | |
| * | | | VideoCore/Shader: Remove dynamic control flow in (Get)UniformOffsetYuri Kunde Schlesner2016-12-162-18/+11
| | | | |
| * | | | VideoCore/Shader: Move DebugData to a separate fileYuri Kunde Schlesner2016-12-164-172/+189
| | | | |
* | | | | Merge pull request #2303 from freiro/citra-qt_missing_sdl2_dllbunnei2016-12-165-30/+33
|\ \ \ \ \ | | | | | | | | | | | | Copy SDL2.dll when compiling citra-qt with msvc
| * | | | | Modularized Qt and SDL file copyingfreiro2016-12-134-14/+16
| | | | | | | | | | | | | | | | | | | | | | | | Now cmake relies on two submodules to copy the libraries in the proper folders
| * | | | | Modularization of copy_msvc_libraries cmake functfreiro2016-12-113-20/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Created a new folder in Citra's root called CMakeModules that should contain cmake functions used by the various CMakeLists.txt.
| * | | | | Removed redundant Qt check and other fixesfreiro2016-12-111-20/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This removes a redundant check and moves part of the code to a separate function.
| * | | | | [MSVC] Copy SDL2.dll to build folderfreiro2016-12-111-20/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | CMake now copies SDL2.dll when compiling citra with citra-qt as a target on MSVC.
* | | | | | Merge pull request #2337 from lioncash/gdbbunnei2016-12-161-9/+8
|\ \ \ \ \ \ | | | | | | | | | | | | | | gdbstub: const correctness changes
| * | | | | | gdbstub: const correctness changesLioncash2016-12-161-9/+8
| | |/ / / / | |/| | | | | | | | | | | | | | | | Also uses size_t as the length indicator type, as is common with buffers.
* | | | | | Merge pull request #2322 from MerryMage/ctx-mnuMerry2016-12-1610-4/+87
|\ \ \ \ \ \ | | | | | | | | | | | | | | game_list: Add a context menu with "Open Save Location" option
| * | | | | | main: Open folder when open save folder location context menu is clickedMerryMage2016-12-152-0/+20
| | | | | | |
| * | | | | | game_list: Implement context menu for items in listMerryMage2016-12-153-4/+32
| | | | | | | | | | | | | | | | | | | | | | | | | | | | * Add a context menu with a "Open Save Data Location" action
| * | | | | | loader: Implement ReadProgramIdMerryMage2016-12-153-0/+28
| | | | | | |
| * | | | | | archive_source_sd_savedata: Add static method to get a specific save data pathMerryMage2016-12-152-0/+7
| | | | | | |
* | | | | | | Merge pull request #2338 from wwylele/fix-deadSebastian Valle2016-12-161-1/+2
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Kernel: remove object's waiting thread if it is dead
| * | | | | | Kernel: remove object's waiting thread if it is deadwwylele2016-12-161-1/+2
|/ / / / / /
* | | | | | Merge pull request #2260 from Subv/schedulingbunnei2016-12-168-196/+211
|\ \ \ \ \ \ | | | | | | | | | | | | | | Threading: Reworked the way our scheduler works.
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-144-28/+41
| | | | | | |
| * | | | | | Properly remove a thread from its wait_objects' waitlist when it is awoken by a timeout.Subv2016-12-103-2/+11
| | | | | | |
| * | | | | | WaitSynch: Removed unused variables and reduced SharedPtr copies.Subv2016-12-095-74/+57
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Define a variable with the value of the sync timeout error code. Use a boost::flat_map instead of an unordered_map to hold the equivalence of objects and wait indices in a WaitSynchN call.
| * | | | | | Use boost remove_erase_if instead of the erase-remove idiomSubv2016-12-071-2/+3
| | | | | | |
| * | | | | | Improved the algorithm for GetHighestPriorityReadyThread.Subv2016-12-071-14/+13
| | | | | | |
| * | | | | | Threading: Added some utility functions and const correctness.Subv2016-12-044-16/+36
| | | | | | |
| * | | | | | Threading: Reworked the way our scheduler works.Subv2016-12-048-190/+180
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Threads will now be awakened when the objects they're waiting on are signaled, instead of repeating the WaitSynchronization call every now and then. The scheduler is now called once after every SVC call, and once after a thread is awakened from sleep by its timeout callback. This new implementation is based off reverse-engineering of the real kernel. See https://gist.github.com/Subv/02f29bd9f1e5deb7aceea1e8f019c8f4 for a more detailed description of how the real kernel handles rescheduling.
* | | | | | | Merge pull request #2316 from endrift/macos-gccbunnei2016-12-161-0/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Common: Fix gcc build on macOS
| * | | | | | | Common: Fix gcc build on macOSJeffrey Pfau2016-12-131-0/+11
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #2328 from wwylele/fix-traceYuri Kunde Schlesner2016-12-161-11/+9
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix debug build from #2249
| * | | | | | | FS: fix debug build from #2249wwylele2016-12-151-11/+9
| | | | | | | |
* | | | | | | | Merge pull request #2332 from lioncash/gdbYuri Kunde Schlesner2016-12-165-16/+23
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | gdbstub: Remove global variable from public interface
| * | | | | | | | gdbstub: Remove global variable from public interfaceLioncash2016-12-155-16/+23
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Currently, this is only ever queried, so adding a function to check if the server is enabled is more sensible. If directly modifying this externally is ever desirable, it should be done by adding a function to the interface, rather than exposing implementation details directly.
* | | | | | | | | Merge pull request #2320 from mailwl/cecd-updateYuri Kunde Schlesner2016-12-168-13/+81
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Service/CECD: Add cecd:ndm service
| * | | | | | | | | Service/CECD: Add cecd:ndm servicemailwl2016-12-158-13/+81
| | |_|_|_|_|/ / / | |/| | | | | | |
* | | | | | | | | Merge pull request #2331 from lioncash/truncbunnei2016-12-151-1/+2
|\ \ \ \ \ \ \ \ \ | |_|/ / / / / / / |/| | | | | | | | hid: Get rid of a double -> float truncation warning
| * | | | | | | | hid: Get rid of a double -> float truncation warningLioncash2016-12-151-1/+2
| | |/ / / / / / | |/| | | | | | | | | | | | | | | | | | | | | | float literals need to have the 'f' prefix.
* | | | | | | | Merge pull request #2330 from lioncash/pragmaSebastian Valle2016-12-153-0/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | core: Add missing #pragma once directives where applicable
| * | | | | | | | core: Add missing #pragma once directives where applicableLioncash2016-12-153-0/+6
| |/ / / / / / /
* | | | | | | | Merge pull request #2327 from lioncash/typobunnei2016-12-151-1/+1
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | act: Fix docstring typo
| * | | | | | | act: Fix docstring typoLioncash2016-12-151-1/+1
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | These aren't the AM services.
* | | | | | | Merge pull request #2325 from yuriks/fix-indexYuri Kunde Schlesner2016-12-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | shader_jit_x64: Use LOOPCOUNT_REG as a 64-bit reg when indexing
| * | | | | | | shader_jit_x64: Use LOOPCOUNT_REG as a 64-bit reg when indexingYuri Kunde Schlesner2016-12-151-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #2314 from mailwl/accountbunnei2016-12-158-10/+44
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Service/ACT: move ACT services to folder
| * | | | | | | Service/ACT: move ACT services to foldermailwl2016-12-148-10/+44
| | | | | | | |
* | | | | | | | Merge pull request #2321 from yuriks/flush-pagesbunnei2016-12-151-0/+10
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Memory: Always flush whole pages from surface cache
| * | | | | | | Memory: Always flush whole pages from surface cacheYuri Kunde Schlesner2016-12-151-0/+10
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | This prevents individual writes touching a cached page, but which don't overlap the surface, from constantly hitting the surface cache lookup.
* | | | | | | Merge pull request #2317 from yuriks/vertex-copySebastian Valle2016-12-153-5/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | VideoCore: Eliminate an unnecessary copy in the drawcall loop
| * | | | | | | VideoCore: Eliminate an unnecessary copy in the drawcall loopYuri Kunde Schlesner2016-12-153-5/+3
|/ / / / / / /
* | | | | | | Merge pull request #2309 from yuriks/shader-jit-xbyakYuri Kunde Schlesner2016-12-1511-224/+475
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Convert shader JIT to Xbyak
| * | | | | | | shader_jit_x64: Use Reg32 for LOOP* registers, eliminating castsYuri Kunde Schlesner2016-12-151-16/+16
| | | | | | | |
| * | | | | | | VideoCore: Convert x64 shader JIT to use Xbyak for assemblyYuri Kunde Schlesner2016-12-156-224/+462
| | | | | | | |
| * | | | | | | Externals: Add XbyakYuri Kunde Schlesner2016-12-154-0/+13
| | | | | | | |
| * | | | | | | externals: Update DynarmicYuri Kunde Schlesner2016-12-151-0/+0
| | |/ / / / / | |/| | | | | | | | | | | | | | | | | | | Required to be able to use Xbyak in Citra without header conflicts.
* | | | | | | Merge pull request #2249 from Subv/sessions_v3Yuri Kunde Schlesner2016-12-1525-171/+591
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.
| * | | | | | Fixed the codestyle to match our clang-format rules.Subv2016-12-1416-68/+108
| | | | | | |
| * | | | | | Moved the HLE command buffer translation task to ServerSession instead of the HLE handler superclass.Subv2016-12-096-47/+38
| | | | | | |
| * | | | | | Kernel/IPC: Small codestyle cleanupSubv2016-12-092-3/+1
| | | | | | |
| * | | | | | Added a framework for partially handling Session disconnections.Subv2016-12-088-9/+67
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Further implementation will happen in a future commit. Fixes a regression.
| * | | | | | Use std::move where appropriate.Subv2016-12-0812-177/+187
| | | | | | |
| * | | | | | Return an error code when connecting to a saturated port.Subv2016-12-055-7/+20
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The error code was taken from the 3DS kernel.
| * | | | | | HLE: Use a member variable instead of a virtual function to retrieve the max number of sessions that can be connected to an HLE service at the same time.Subv2016-12-055-8/+18
| | | | | | |
| * | | | | | Split SessionRequestHandler::HandleSyncRequest into HandleSyncRequest, TranslateRequest and HandleSyncRequestImpl.Subv2016-12-056-22/+59
| | | | | | | | | | | | | | | | | | | | | | | | | | | | HandleSyncRequest now takes care of calling the command buffer translate function before actually invoking the command handler for HLE services.
| * | | | | | Kernel: Remove the Redirection handle type.Subv2016-12-051-2/+0
| | | | | | |
| * | | | | | KServerPorts now have an HLE handler "template", which is inherited by all ServerSessions created from it.Subv2016-12-0512-69/+86
| | | | | | |
| * | | | | | Declare empty ServerSession and ClientSession constructors as default.Subv2016-12-032-4/+4
| | | | | | |
| * | | | | | Threads do not wait for the server endpoint to call AcceptSession before returning from a ConnectToPort or GetServiceHandle call.Subv2016-12-012-3/+5
| | | | | | |
| * | | | | | Fixed the rebase mistakes.Subv2016-12-0111-83/+76
| | | | | | |
| * | | | | | A bit of a redesign.Subv2016-12-0113-263/+266
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Sessions and Ports are now detached from each other. HLE services are handled by means of a SessionRequestHandler class, Interface now inherits from this class. The File and Directory classes are no longer kernel objects, but SessionRequestHandlers instead, bound to a ServerSession when requested. File::OpenLinkFile now creates a new session pair and binds the File instance to it.
| * | | | | | IPC/HLE: Associate the ClientSessions with their parent port's HLE interface if it exists.Subv2016-12-016-26/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Pass the triggering ServerSession to the HLE command handler to differentiate which session caused the request.
| * | | | | | Kernel/HLE: Service::Interface no longer inherits from any Kernel object, and is now its own standalone class.Subv2016-12-014-24/+52
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Interface is now used by aggregation in ClientPort, to forward service commands to their HLE implementation if needed.
| * | | | | | fixup! Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-014-5/+6
| | | | | | |
| * | | | | | Kernel/IPC: Use Ports and Sessions as the fundamental building block of Inter Process Communication.Subv2016-12-0116-88/+314
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | All handles obtained via srv::GetServiceHandle or svcConnectToPort are references to ClientSessions. Service modules will wait on the counterpart of those ClientSessions (Called ServerSessions) using svcReplyAndReceive or svcWaitSynchronization[1|N], and will be awoken when a SyncRequest is performed. HLE Interfaces are now ClientPorts which override the HandleSyncRequest virtual member function to perform command handling immediately.
* | | | | | | Merge pull request #2166 from endrift/clang-detectSebastian Valle2016-12-131-2/+4
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | CMakeLists: Autodetect clang and only then use libc++
| * | | | | | CMakeLists: Autodetect clang and only then use libc++Jeffrey Pfau2016-12-131-2/+4
|/ / / / / /
* | | | | | Merge pull request #2315 from JamePeng/fix-gsp_gpu-codeSebastian Valle2016-12-131-3/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo code
| * | | | | | Minor amendment of GSP_GPU::ImportDisplayCaptureInfo codeJamePeng2016-12-131-3/+5
|/ / / / / /
* | | | | | Merge pull request #2312 from lioncash/guardYuri Kunde Schlesner2016-12-131-0/+2
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | time_stretch: Add missing #pragma once directive
| * | | | | time_stretch: Add missing #pragma once directiveLioncash2016-12-131-0/+2
| | | | | |
* | | | | | Merge pull request #2275 from jbeich/pthreadSebastian Valle2016-12-111-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Unbreak QT-only build after 75ee2f8c6702
| * | | | | | tests: add missing libcore dependency after 75ee2f8c6702Jan Beich2016-12-071-1/+1
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | $ (cmake -DENABLE_SDL2:BOOL=false /path/to/citra; gmake) [...] [ 85%] Linking CXX executable tests ../common/libcommon.a(microprofile.cpp.o): In function `MicroProfileThreadStart(pthread**, void* (*)(void*))': src/common/microprofile.cpp:(.text+0x41): undefined reference to `pthread_create' c++: error: linker command failed with exit code 1 (use -v to see invocation)
* | | | | | Merge pull request #2267 from JayFoxRox/fix-mingw-ccSebastian Valle2016-12-119-10/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | Support mingw cross-compilation
| * | | | | | gdbstub: Remove unused includeJannik Vogel2016-12-051-1/+0
| | | | | | |
| * | | | | | Unify Windows ICON resource nameJannik Vogel2016-12-052-2/+2
| | | | | | |
| * | | | | | Support mingw cross-compileJannik Vogel2016-12-059-9/+11
| | | | | | |
* | | | | | | Merge pull request #2154 from mailwl/apt-getstartupargumentSebastian Valle2016-12-112-5/+11
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | APT::GetStartupArgument: force clear startup argument
| * | | | | | | APT::GetStartupArgument: force clear startup argumentmailwl2016-12-112-5/+11
|/ / / / / / /
* | | / / / / citra-qt: Make constructors explicit where applicableLioncash2016-12-1115-32/+35
| |_|/ / / / |/| | | | |
* | | | | | citra-qt: Add missing #pragma once directivesLioncash2016-12-115-0/+10
| | | | | |
* | | | | | game_list: Make slots private functionsLioncash2016-12-111-7/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The new Qt event syntax allows for regular member functions to be used in connect(), so explicitly indicating slots isn't necessary.
* | | | | | game_list: Make the constructor explicitLioncash2016-12-111-1/+1
| | | | | |
* | | | | | game_list: Make the AddEntry argument a const referenceLioncash2016-12-112-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | appendRow takes a QList by const reference, so it doesn't need to be modifiable.
* | | | | | game_list: Replace 0 literals with nullptrLioncash2016-12-111-1/+1
| | | | | |
* | | | | | game_list: Use QT5's new event connection syntaxLioncash2016-12-111-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | Makes for more compact code in most places.
* | | | | | game_list: Pass the parent constructor argument to the QWidget base classLioncash2016-12-111-1/+1
| |_|_|_|/ |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If the control was ever passed an explicit parent, a potential memory leak would happen, as the game list wouldn't be freed. However, in our case, the game list was placed within a layout, which automatically performs reparenting, avoiding this issue.
* | | | | Merge pull request #2300 from lioncash/qtYuri Kunde Schlesner2016-12-111-18/+24
|\ \ \ \ \ | | | | | | | | | | | | graphics_cmdlist: Minor changes
| * | | | | graphics_cmdlists: Get rid of variable shadowingLioncash2016-12-111-14/+18
| | | | | |
| * | | | | graphics_cmdlists: Get rid of an unused variableLioncash2016-12-111-1/+0
| | | | | |
| * | | | | graphics_cmdlists: Make LoadTexture and TextureInfoWidget src arguments constLioncash2016-12-111-3/+4
| | | | | |
| * | | | | graphics_cmdlists: Make LoadImage internally linkedLioncash2016-12-111-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Puts the TextureInfoWidget definition in the anonymous namespace as well, as it's only used in the translation unit as well.
* | | | | | Core: Add a forgotten #include <cstring> for memcpy.Emmanuel Gil Peyrot2016-12-111-0/+1
|/ / / / /
* | | | | Add all services to the Service namespaceLioncash2016-12-1150-499/+408
| | | | | | | | | | | | | | | | | | | | | | | | | Previously there was a split where some of the services were in the Service namespace and others were not.
* | | | | configure_input: Modernize and cleanup input configuration tabMerryMage2016-12-112-115/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Removed use of raw QTimer* pointer. * Update to use type-safe QObject::connect. * getKeyName can be a static local function. * Prefer to use function arguments instead of member variables. * Store Qt::Key instead of converting string back into keycode.
* | | | | Merge pull request #2296 from MerryMage/auto_is_autoYuri Kunde Schlesner2016-12-101-12/+7
|\ \ \ \ \ | | | | | | | | | | | | audio_core: SelectSink should default to auto if sink_id is invalid
| * | | | | audio_core: SelectSink should default to auto if sink_id is invalidMerryMage2016-12-101-12/+7
| | | | | |
* | | | | | Merge pull request #2291 from lioncash/svcbunnei2016-12-0910-12/+61
|\ \ \ \ \ \ | | | | | | | | | | | | | | service: Add the cfg:nor service
| * | | | | | service: Add cfg:nor serviceLioncash2016-12-094-0/+49
| | | | | | |
| * | | | | | service: Drop '_Interface' from cfg service namesLioncash2016-12-097-12/+12
| | | | | | |
* | | | | | | Merge pull request #2292 from lioncash/boolYuri Kunde Schlesner2016-12-091-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ptm: Use boolean instead of integral value
| * | | | | | | ptm: Use boolean instead of integral valueLioncash2016-12-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The third parameter of Write is actually a bool type, not an int.
* | | | | | | | Merge pull request #2202 from j-selby/man-docsYuri Kunde Schlesner2016-12-093-0/+101
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Add man documentation
| * | | | | | | Add man documentationJames2016-11-263-0/+101
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Includes both SDL and QT frontends
* | | | | | | | Merge pull request #2287 from lioncash/svcYuri Kunde Schlesner2016-12-0912-12/+170
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Minor PTM changes
| * | | | | | | | service: Add the ptm:s serviceLioncash2016-12-083-0/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew documents this as being the exact same as ptm:sysm
| * | | | | | | | service: Add common ptm:u commands to other ptm servicesLioncash2016-12-084-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew indicates that all services have access to these commands except for ptm:sets.
| * | | | | | | | service: Drop '_Interface' in ptm service class namesLioncash2016-12-087-14/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Inheriting from Service::Interface makes this obvious.
| * | | | | | | | service: Add ptm::gets and ptm::sets servicesLioncash2016-12-086-0/+90
| | | | | | | | |
* | | | | | | | | Merge pull request #2280 from Subv/citrace_sizeSebastian Valle2016-12-081-2/+2
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Fixed the gpu command list size when creating CiTraces.
| * | | | | | | | Fixed the gpu command list size when creating CiTraces.Subv2016-12-081-2/+2
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #2286 from lioncash/svcYuri Kunde Schlesner2016-12-0814-0/+271
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Add mvd and qtm services
| * | | | | | | | service: Add mvd and qtm servicesLioncash2016-12-0814-0/+271
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Adds the two New3DS-only modules. 3dbrew was used for command information.
* | | | | | | | | Merge pull request #2274 from degasus/masterYuri Kunde Schlesner2016-12-085-47/+8
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | Drop framebuffer completeness check.
| * | | | | | | | OpenGL: Drop framebuffer completeness check.Markus Wick2016-12-075-47/+8
| | |_|_|_|/ / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This OpenGL call synchronize the worker thread of the nvidia blob. It can be verified on linux with the __GL_THREADED_OPTIMIZATIONS=1 environment variable. Those errors should not happen on tested drivers. It was used as a workaround for https://bugs.freedesktop.org/show_bug.cgi?id=94148
* | | | | | | | Merge pull request #2284 from lioncash/svcYuri Kunde Schlesner2016-12-088-30/+199
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Add nfc services
| * | | | | | | | service: Add nfc servicesLioncash2016-12-088-30/+199
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 3dbrew was used for the command information.
* | | | | | | | | Merge pull request #2277 from lioncash/explicitYuri Kunde Schlesner2016-12-088-10/+10
|\ \ \ \ \ \ \ \ \ | |/ / / / / / / / |/| | | | | | | | file_sys: Make a few single-argument constructors explicit
| * | | | | | | | file_sys: Make a few single-argument constructors explicitLioncash2016-12-078-10/+10
| |/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | Prevents implicit conversions.
* | | | | | | | Merge pull request #2283 from lioncash/svcYuri Kunde Schlesner2016-12-0821-28/+212
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | service: Update function tables
| * | | | | | | | ssl_c: Update function tableLioncash2016-12-081-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | | | | | ptm: Update ptm_sysm function tableLioncash2016-12-083-6/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | pm_app: Update function tableLioncash2016-12-081-6/+9
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | nwm_uds: Update function tableLioncash2016-12-081-5/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | nim: Update function tablesLioncash2016-12-082-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | http_c: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | gsp_lcd: Update function tableLioncash2016-12-081-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | fs_user: Update function tableLioncash2016-12-081-0/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | dlp_srvr: Update function tableLioncash2016-12-081-0/+7
| | | | | | | | |
| * | | | | | | | cfg: Update function tablesLioncash2016-12-083-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew
| * | | | | | | | cecd_u: Update function tableLioncash2016-12-081-1/+13
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | boss_p: Update function tableLioncash2016-12-081-3/+68
| | | | | | | | |
| * | | | | | | | act: Update function tablesLioncash2016-12-082-0/+10
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
| * | | | | | | | apt: Update apt function tablesLioncash2016-12-082-7/+73
| | |_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | | | | | Merge pull request #2281 from lioncash/appletYuri Kunde Schlesner2016-12-088-30/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | applet: minor interface changes
| * | | | | | | applet: Move common IsRunning underlying variable to the Applet classLioncash2016-12-078-28/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Gets rid of basic duplication.
| * | | | | | | applet: Make virtual destructor defaultedLioncash2016-12-071-1/+1
| | | | | | | |
| * | | | | | | applet: Make constructor protectedLioncash2016-12-071-1/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Considering the class is abstract, there's no need to make the constructor public.
* | | | | | | | Merge pull request #2282 from lioncash/svcMat M2016-12-086-113/+246
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Update AM service function tables
| * | | | | | | Update AM service function tablesLioncash2016-12-086-113/+246
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | Updated based off information from 3dbrew.
* | | | | | | Merge pull request #2232 from wwylele/other-savebunnei2016-12-0711-80/+351
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | FS: implement archives for other game save data
| * | | | | | FileSys: Implement OtherSaveDatawwylele2016-11-297-0/+214
| | | | | | |
| * | | | | | FS: add missing MediaTypewwylele2016-11-291-1/+1
| | | | | | |
| * | | | | | FileSys: abstract SD save data archive sourcewwylele2016-11-296-79/+136
| | | | | | |
* | | | | | | Implement Frame rate limiter (#2223)emmauss2016-12-0610-0/+54
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * implement frame limiter * fixes
* | | | | | | Merge pull request #2264 from JayFoxRox/print-shaderYuri Kunde Schlesner2016-12-062-4/+14
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Print shaders in case of error
| * | | | | | | ASSERT that shader was linked successfullyJannik Vogel2016-12-051-0/+2
| | | | | | | |
| * | | | | | | Report shader uniform block size in case of mismatchJannik Vogel2016-12-051-1/+3
| | | | | | | |
| * | | | | | | Print broken shader code to logJannik Vogel2016-12-051-3/+9
|/ / / / / / /
* | | | | | | Merge pull request #2200 from j-selby/fix-mingw-crashYuri Kunde Schlesner2016-12-051-0/+3
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Disable Microprofile on Mingw builds
| * | | | | | Disable Microprofile on Mingw buildsJames2016-12-051-0/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes a crash when starting games
* | | | | | | Merge pull request #2269 from Subv/update_dynarmicYuri Kunde Schlesner2016-12-051-0/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Dynarmic: Update dynarmic to version 54d051977f7a6af9c7596ba6a4e6eb467bd1e0bc
| * | | | | | Dynarmic: Update dynarmic to versionSubv2016-12-051-0/+0
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | 54d051977f7a6af9c7596ba6a4e6eb467bd1e0bc dynarmic log: 54d0519 emit_x64: Use movdqa instead of movaps in EmitPackedSubU8 52e1445 Implement USUB8:33 2016 +0000 5c1aab1 Implement CLZ 1a1646d Implement UADD8 7cad694 IR: Implement new pseudo-operation GetGEFromOp 370f654 fuzz_arm: Add tests for parallel add/subtract (modulo) 25f21b5 emit_x64: Inline nzcv computation into EmitFPCompare32 and EmitFPCompare64 52fdec5 CMakeLists: Add support for LLVM on Windows cede5e4 emit_x64: Use xorps/xorpd when argument to TransferToFP32/TransferToFP64 is an immediate zero e166965 Implement VCMP2:33 2016 +0000 f2fe376 Support 64-bit immediates ff00b8c Document register allocator and return stack buffer optimization 95f34c6 reg_alloc: Remove unnecessary breaks after returns (#54) dc9707e externals: Update xbyak to 5.32 de1f831 microinstruction: Make use_count private (#53) 3621a92 reg_alloc: Register allocator related constraints belong with the rest of the register allocator
* | | | | | Merge pull request #2266 from yuriks/fix-displaytransferYuri Kunde Schlesner2016-12-044-19/+29
|\ \ \ \ \ \ | | | | | | | | | | | | | | OpenGL: Fix DisplayTransfer accel when input width != output width
| * | | | | | GSP: Downgrade log severity of SetAxiConfigQoSModeYuri Kunde Schlesner2016-12-041-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This function doesn't need to do anything for HLE and some games call it quite often, spamming up the logs.
| * | | | | | OpenGL: Non-zero stride only makes sense for linear buffersYuri Kunde Schlesner2016-12-043-7/+11
| | | | | | |
| * | | | | | OpenGL: Ensure framebuffer binding is restored if completion check failsYuri Kunde Schlesner2016-12-041-10/+7
| | | | | | |
| * | | | | | OpenGL: Fix DisplayTransfer accel when input width != output widthYuri Kunde Schlesner2016-12-041-1/+10
|/ / / / / / | | | | | | | | | | | | | | | | | | Fixes #2246, #2261
* | | | | | Merge pull request #2259 from JayFoxRox/fix-fallbackYuri Kunde Schlesner2016-12-041-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | shader_jit: Fix non-SSE4.1 path where FLR would not truncate
| * | | | | | shader_jit: Fix non-SSE4.1 path where FLR would not truncateJannik Vogel2016-12-041-1/+1
| | | | | | |
* | | | | | | Merge pull request #2257 from citra-emu/fix-clang-formatYuri Kunde Schlesner2016-12-044-5/+10
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Travis: Use a stable version of clang-format
| * | | | | | clang-format: Fix coding styleYuri Kunde Schlesner2016-12-031-1/+1
| | | | | | |
| * | | | | | Travis: Use a stable version of clang-formatYuri Kunde Schlesner2016-12-033-4/+9
|/ / / / / /
* | | | | | Merge pull request #2255 from JayFoxRox/lsl4Yuri Kunde Schlesner2016-12-031-6/+9
|\ \ \ \ \ \ | |/ / / / / |/| | | | | shader_jit: Load LOOPCOUNT_REG and LOOPINC 4 bit left-shifted
| * | | | | shader_jit: Load LOOPCOUNT_REG and LOOPINC 4 bit left-shiftedJannik Vogel2016-12-021-6/+9
|/ / / / /
* | | | | Merge pull request #2251 from JayFoxRox/remove-versionMat M2016-12-012-12/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | Remove unused version.h in citra_qt
| * | | | Remove unused version.hJannik Vogel2016-12-012-12/+0
|/ / / /
* | | | Merge pull request #2228 from freiro/winver_fixYuri Kunde Schlesner2016-12-012-11/+8
|\ \ \ \ | | | | | | | | | | Move WINVER definition to cmake and a bit of cleanup
| * | | | Appending PLATFORM_LIBRARIES instead of redefining themfreiro2016-11-301-3/+3
| | | | |
| * | | | WINVER definition moved to CMake and cleanupfreiro2016-11-302-11/+8
| | | | |
* | | | | Merge pull request #2243 from MerryMage/r15Sebastian Valle2016-11-301-0/+0
|\ \ \ \ \ | |_|_|_|/ |/| | | | dynarmic: Fix ABI violation
| * | | | dynarmic: Fix ABI violationMerryMage2016-11-301-0/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | Caused by not saving/restoring the x64 r15 register on entry/exit from JITted code. Closes #2224.
* | | | Merge pull request #2241 from Subv/clang_formatwwylele2016-11-302-6/+10
|\ \ \ \ | | | | | | | | | | ClangFormat: Fixed the clang-format errors
| * | | | ClangFormat: Fixed the clang-format errorsSubv2016-11-302-6/+10
|/ / / /
* | | | Merge pull request #1820 from mailwl/service-verSebastian Valle2016-11-308-16/+88
|\ \ \ \ | |/ / / |/| | | Set client SDK version to Service APIs
| * | | Set client SDK version to Service APIsmailwl2016-11-308-16/+88
|/ / /
* | | Merge pull request #2233 from Subv/warningsbunnei2016-11-303-11/+11
|\ \ \ | | | | | | | | Build: Fixed a few warnings.
| * | | Build: Fixed a few warnings.Subv2016-11-293-11/+11
| |/ /
* / / Update dynarmic to the latest version (#2234)James Rowe2016-11-301-0/+0
|/ /
* | Merge pull request #2196 from Subv/system_modeYuri Kunde Schlesner2016-11-2810-21/+66
|\ \ | | | | | | Kernel/Loader: Grab the system mode from the NCCH ExHeader.
| * | Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-285-27/+27
| | | | | | | | | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
| * | Kernel/Loader: Grab the system mode from the NCCH ExHeader.Subv2016-11-2010-22/+67
| | | | | | | | | | | | | | | | | | | | | 3dsx and elf files default to system mode 2 (96MB allocated to the application). This allows Home Menu to boot without modifications. Closes #1849
* | | Merge pull request #2222 from linkmauve/die-frameskip-dieYuri Kunde Schlesner2016-11-287-33/+1
|\ \ \ | | | | | | | | Remove the broken frame_skip option
| * | | GPU: Remove the broken frame_skip option.Emmanuel Gil Peyrot2016-11-277-33/+1
| | | | | | | | | | | | | | | | Fixes #1960.
* | | | Merge pull request #2132 from wwylele/fix-fs-errSebastian Valle2016-11-2830-304/+1234
|\ \ \ \ | | | | | | | | | | Correct FS error codes & add path boundary checks
| * | | | tests: add a work-around for macOS linking errorwwylele2016-11-192-0/+15
| | | | |
| * | | | FileSys: rename SaveDataCheck archive to NCCH archivewwylele2016-11-195-23/+22
| | | | | | | | | | | | | | | | | | | | According to the observation from game and 3dbrew "Used for accessing general NCCH data"
| * | | | FileSys: remove unused DiskArchivewwylele2016-11-192-179/+0
| | | | | | | | | | | | | | | | | | | | All "subclasses" of DiskArchive are splitted out. This class is useless
| * | | | PTM & CFG: use the correct path and error code according to the new FileSys policywwylele2016-11-192-5/+6
| | | | |
| * | | | FileSys: w->rw permission lift only happens in SDMC archivewwylele2016-11-194-2/+14
| | | | |
| * | | | FileSys: add SDMCWriteOnlyArchivewwylele2016-11-196-0/+140
| | | | |
| * | | | FileSys: add SDMCArchivewwylele2016-11-193-1/+301
| | | | | | | | | | | | | | | | | | | | Now DiskArchive only serves for SDMC, then it should be just a "SDMCArchive"
| * | | | FileSys: add ExtSaveDataArchivewwylele2016-11-192-1/+115
| | | | | | | | | | | | | | | | | | | | ExtSaveData is more similar to SaveData, so let it be a subclass of SaveData
| * | | | FileSys: add SaveDataArchivewwylele2016-11-197-4/+368
| | | | | | | | | | | | | | | | | | | | The error checking of SaveDataArchive is completely different from DiskArchive, so it has to be a new class instead of a subclass of DiskArchive.
| * | | | FileSys: remove Open from FileBackendwwylele2016-11-194-64/+44
| | | | | | | | | | | | | | | | | | | | Same as directory, file shouldn't expose Open either.
| * | | | FileSys: remove Open from DirectoryBackendwwylele2016-11-194-25/+5
| | | | | | | | | | | | | | | | | | | | Open should not be an interface exposed by Directory because it is the Archive thats implement the methed to open the directory. The service API of 3DS also implies this - Open is not a function of directory service, but is of FS main service
| * | | | FileSys: add PathParserwwylele2016-11-195-0/+200
| | | | |
| * | | | FileSys: make Archive interfaces return error codewwylele2016-11-016-87/+91
| | | | | | | | | | | | | | | | | | | | and make the mode parameter a reference since it is a BitField union
* | | | | Merge pull request #2218 from Subv/stencil_linesYuri Kunde Schlesner2016-11-272-5/+5
|\ \ \ \ \ | |_|/ / / |/| | | | Rasterizer/Memfill: Set the correct stencil write mask when clearing the stencil buffer.
| * | | | RasterizerGL: Use GL_TRUE and 0xFF in the stencil and depth masks instead of simply true and -1Subv2016-11-272-4/+4
| | | | |
| * | | | Rasterizer/Memfill: Set the correct stencil write mask when clearing the stencil buffer.Subv2016-11-271-1/+1
|/ / / /
* | | | Merge pull request #2168 from mailwl/micSebastian Valle2016-11-274-16/+309
|\ \ \ \ | | | | | | | | | | MIC_U: Stub service funcions
| * | | | Output parameters to logmailwl2016-11-251-4/+6
| | | | |
| * | | | MIC_U: Stub service funcionsmailwl2016-11-254-16/+307
| | |_|/ | |/| |
* | | | Merge pull request #2185 from freiro/local_folderYuri Kunde Schlesner2016-11-263-1/+18
|\ \ \ \ | | | | | | | | | | Change "user" folder default location to AppData/Roaming/ on Windows systems
| * | | | Move to AppData/Roaming/Citra/freiro2016-11-261-1/+1
| | | | |
| * | | | Removed /user/ from pathfreiro2016-11-261-2/+1
| | | | |
| * | | | Switch to AppData/Roamingfreiro2016-11-242-4/+4
| | | | |
| * | | | Return by value and other fixesfreiro2016-11-192-14/+8
| | | | |
| * | | | Win32 move default user folder location to AppDatafreiro2016-11-192-0/+24
| | |_|/ | |/| |
* | | | Merge pull request #2215 from MerryMage/ticks_executedYuri Kunde Schlesner2016-11-261-2/+2
|\ \ \ \ | |_|/ / |/| | | dynarmic: Add ticks based on ticks executed, not ticks requested
| * | | dynarmic: Add ticks based on ticks executed, not ticks requestedMerryMage2016-11-261-2/+2
|/ / /
* | | Merge pull request #2210 from jroweboy/pagetablesYuri Kunde Schlesner2016-11-253-6/+18
|\ \ \ | | | | | | | | Expose page table to dynarmic for optimized reads and writes to the JIT
| * | | Expose page table to dynarmic for optimized reads and writes to the JITJames Rowe2016-11-253-6/+18
| | | |
* | | | Merge pull request #2211 from yuriks/travis-no-uploadYuri Kunde Schlesner2016-11-252-3/+0
|\ \ \ \ | | | | | | | | | | Travis: Remove build uploading
| * | | | Travis: Remove build uploadingYuri Kunde Schlesner2016-11-252-3/+0
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | @archshift has been MIA for a while, so our builds server is currently down. Furthermore, uploading is broken in both Linux and macOS: - The version of lftp in Trusty doesn't support the sftp:auto-confirm option, which means that uploading would hang, even if the server weren't down. It currently tries to connect forever and fails the build with a timeout. - lftp was removed from Homebrew, so it wasn't being installed on macOS and invoking it just failed.
* | | | Merge pull request #2208 from freiro/libsdl205Yuri Kunde Schlesner2016-11-242-3/+3
|\ \ \ \ | |/ / / |/| | | Windows, move to SDL2-2.0.5
| * | | Move to SDL2-2.0.5freiro2016-11-222-3/+3
| | | |
* | | | Cache Vertices instead of Output registers (#2165)jphalimi2016-11-241-6/+7
| | | | | | | | | | | | | | | | This patch brings +3% performance improvement on average. It removes ToVertex() as an important hotspot of the emulator.
* | | | Bravely Default/Second stuck #1822 (#2188)pippo29312016-11-244-2/+22
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Bravely Default/Second stuck #1822 CancelLibraryApplet stub * Log parameter. * Taking care of comments * Sync with 3DBrew * White space ? * lower case
* | | | Merge pull request #2175 from PEmu1/macosYuri Kunde Schlesner2016-11-241-2/+2
|\ \ \ \ | | | | | | | | | | Change "OS X" to "macOS" in the Readme
| * | | | Change "OS X" to "macOS" in the ReadmePringo2016-11-141-2/+2
| | | | |
* | | | | Merge pull request #2186 from wwylele/config9Yuri Kunde Schlesner2016-11-241-2/+8
|\ \ \ \ \ | | | | | | | | | | | | cfg: add config block 0x00090000
| * | | | | cfg: add config block 0x00090000wwylele2016-11-171-2/+8
| | | | | |
* | | | | | Merge pull request #1654 from JamePeng/errdispYuri Kunde Schlesner2016-11-241-118/+198
|\ \ \ \ \ \ | | | | | | | | | | | | | | Rework the code of err:f service!
| * | | | | | Rework the code of err:f serviceJamePeng2016-10-061-118/+198
| | | | | | |
* | | | | | | Merge pull request #2207 from wwylele/fix-2195James Rowe2016-11-221-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix format error from #2195
| * | | | | | | Fix format error from #2195wwylele2016-11-221-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #2206 from freiro/SDL_Audio_Errorwwylele2016-11-221-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Improve verbosity of audio errors
| * | | | | | | Improve verbosity of audio errors with SDL_GetError()freiro2016-11-221-2/+2
| | |_|_|/ / / | |/| | | | |
* / | | | | | Improve MIME description and add French translationcoc4tm2016-11-201-12/+12
|/ / / / / /
* | | | | | Merge pull request #2195 from Subv/factor_checkbunnei2016-11-201-6/+5
|\ \ \ \ \ \ | | | | | | | | | | | | | | GPU/CiTrace: Avoid calling GetTextures() when not necessary.
| * | | | | | GPU/CiTrace: Avoid calling GetTextures() when not necessary.Subv2016-11-201-6/+5
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #2193 from Subv/pulse_eventsbunnei2016-11-202-0/+10
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers
| * | | | | | Kernel/Events: Log an error when trying to create Pulse events and timers.Subv2016-11-192-0/+10
| |/ / / / / | | | | | | | | | | | | | | | | | | Related to #1904
* | | | | | Merge pull request #2192 from Subv/applet_enumsSebastian Valle2016-11-205-16/+27
|\ \ \ \ \ \ | | | | | | | | | | | | | | APT/Applets: Renamed the members of the SignalType enum.
| * | | | | | APT/Applets: Renamed the members of the SignalType enum.Subv2016-11-195-16/+27
| |/ / / / / | | | | | | | | | | | | | | | | | | Names now make sense and match 3dbrew.
* | | | | | Merge pull request #2194 from jroweboy/extremely-minor-clangformat-changeJames Rowe2016-11-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Minor formatting change
| * | | | | Minor formatting changeJames Rowe2016-11-191-1/+1
| | |/ / / | |/| | |
* | | | | Merge pull request #2172 from jroweboy/fix-mingwbunnei2016-11-165-6/+20
|\ \ \ \ \ | | | | | | | | | | | | Fix mingw compilation support
| * | | | | Add mingw compile supportJames Rowe2016-11-145-6/+20
| |/ / / /
* | | | | Merge pull request #1753 from jroweboy/frame_layoutsbunnei2016-11-1619-127/+368
|\ \ \ \ \ | |/ / / / |/| | | | Support additional screen layouts.
| * | | | Round the rectangle size to prevent float to int casting issuesJames Rowe2016-11-123-8/+9
| | | | | | | | | | | | | | | | | | | | And other minor style changes
| * | | | Add default hotkey to swap primary screens.James Rowe2016-11-0510-13/+27
| | | | | | | | | | | | | | | | | | | | Also minor style changes
| * | | | Rework frame layouts to use a max rectangle instead of hardcoded calculationsJames Rowe2016-11-052-250/+100
| | | | |
| * | | | LargeFrameLayout + SwappedSonofUgly2016-11-051-50/+36
| | | | | | | | | | | | | | | Make small screen stay at 1x, and large screen maintain its aspect ratio.
| * | | | Support additional screen layouts.James Rowe2016-11-0516-127/+517
| | | | | | | | | | | | | | | | | | | | | | | | | Allows users to choose a single screen layout or a large screen layout. Adds a configuration option to change the prominent screen.
* | | | | Merge pull request #2171 from jroweboy/fix-mac-buildbunnei2016-11-121-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Fix Travis build issue on mac
| * | | | | Remove cmake from the install list. Its now up to date on the new travis mac imageJames Rowe2016-11-111-1/+1
|/ / / / /
* | | | | Merge pull request #2170 from Pringo/masterYuri Kunde Schlesner2016-11-112-2/+2
|\ \ \ \ \ | |/ / / / |/| | / / | | |/ / | |/| | Minor Menu Fixes
| * | | Minor Menu FixesPringo2016-11-112-2/+2
|/ / /
* | | Update CONTRIBUTING.mdbunnei2016-11-051-1/+1
| | |
* | | Update CONTRIBUTING.mdbunnei2016-11-051-4/+4
| | |
* | | Update CONTRIBUTING.mdbunnei2016-11-051-2/+4
| | |
* | | Merge pull request #2142 from mailwl/acu-updatebunnei2016-11-052-14/+194
|\ \ \ | |_|/ |/| | AC_U: Stub functions, used if EULA agreed
| * | Style fixmailwl2016-11-021-2/+2
| | |
| * | Rename AcConfig, change types u8 to u32mailwl2016-11-021-21/+25
| | |
| * | AC_U: Stub functions, used if EULA agreedmailwl2016-11-022-14/+190
|/ /
* | Merge pull request #2147 from Pringo/readme-donatebunnei2016-11-011-2/+1
|\ \ | | | | | | Update Donation Info in Readme
| * | Link to Donation Page in ReadmePringo2016-11-011-2/+1
| | | | | | | | | Link main site donation page in readme instead of providing further donation info there.
| * | Update Donation Info in ReadmePringo2016-10-291-2/+2
| | |
* | | Merge pull request #2126 from wwylele/stub-nwmbunnei2016-10-311-0/+11
|\ \ \ | | | | | | | | NWM: stub Initialize with an error
| * | | NWM: stub Initialize with an errorwwylele2016-10-121-0/+11
| | |/ | |/|
* | | Merge pull request #2149 from wwylele/fix-contributingbunnei2016-10-311-13/+8
|\ \ \ | | | | | | | | Update CONTRIBUTING.md
| * | | Update CONTRIBUTING.mdwwylele2016-10-311-13/+8
| | | |
* | | | Merge pull request #2123 from jbeich/freebsdbunnei2016-10-3111-37/+68
|\ \ \ \ | |_|_|/ |/| | | Fix build on DragonFly and FreeBSD
| * | | build: don't install freedesktop.org metadata for SDL2-only buildsJan Beich2016-10-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Citra SDL2 doesn't have a launcher, and citra.desktop tries to execute citra-qt which is N/A unless built with ENABLE_QT. Limiting installed files to one of the options also makes it easier to split them into separate non-conflicting packages downstream.
| * | | build: add default install for DragonFly, Solaris, etc.Jan Beich2016-10-283-3/+3
| | | |
| * | | build: clock_gettime() is in libc on BSDsJan Beich2016-10-281-1/+1
| | | |
| * | | build: libc may not provide iconv() on UnixJan Beich2016-10-281-3/+10
| | | | | | | | | | | | | | | | /usr/bin/ld: ../common/libcommon.a(string_util.cpp.o): undefined reference to symbol 'libiconv_open'
| * | | microprofile: unbreak on POSIX systemsJan Beich2016-10-282-4/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In file included from src/common/microprofile.cpp:7: In file included from src/./common/microprofile.h:23: externals/microprofile/microprofile.h:830:5: error: use of undeclared identifier 'MP_BREAK' MP_ASSERT(t == nBegin); ^ externals/microprofile/microprofile.h:238:34: note: expanded from macro 'MP_ASSERT' ^ externals/microprofile/microprofile.h:831:5: error: use of undeclared identifier 'MP_BREAK' MP_ASSERT(nTimerIndex == (nToken&0x3fff)); ^ externals/microprofile/microprofile.h:238:34: note: expanded from macro 'MP_ASSERT' ^ [...]
| * | | core: some errno values are uncommon on UnixJan Beich2016-10-281-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/core/hle/service/soc_u.cpp:107:6: error: 'ENODATA' was not declared in this scope {ENODATA, 43}, ^ src/core/hle/service/soc_u.cpp:117:6: error: 'ENOSR' was not declared in this scope {ENOSR, 53}, ^ src/core/hle/service/soc_u.cpp:118:6: error: 'ENOSTR' was not declared in this scope {ENOSTR, 54}, ^ src/core/hle/service/soc_u.cpp:139:6: error: 'ETIME' was not declared in this scope {ETIME, 75}, ^
| * | | common: use system bswap* functions on more BSDsJan Beich2016-10-281-2/+5
| | | |
| * | | common: use system CPUID routine on DragonFly as wellJan Beich2016-10-281-2/+2
| | | |
| * | | common: some FreeBSD headers are incomplete to avoid namespace pollutionJan Beich2016-10-281-1/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In file included from src/common/x64/cpu_detect.cpp:16: /usr/include/machine/cpufunc.h:66:17: error: unknown type name 'u_int' static __inline u_int ^ /usr/include/machine/cpufunc.h:67:6: error: unknown type name 'u_int' bsfl(u_int mask) ^ /usr/include/machine/cpufunc.h:69:2: error: unknown type name 'u_int' u_int result; ^ /usr/include/machine/cpufunc.h:75:17: error: unknown type name 'u_long'; did you mean 'long'? static __inline u_long ^ /usr/include/machine/cpufunc.h:76:6: error: unknown type name 'u_long'; did you mean 'long'? bsfq(u_long mask) ^ /usr/include/machine/cpufunc.h:78:2: error: use of undeclared identifier 'u_long'; did you mean 'long'? u_long result; ^ [...]
| * | | common: convert to standard stat()/fstat() interfacesAnthony J. Bentley2016-10-282-15/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Most modern Unix environments use 64-bit off_t by default: OpenBSD, FreeBSD, OS X, and Linux libc implementations such as Musl. glibc is the lone exception; it can default to 32 bits but this is configurable by setting _FILE_OFFSET_BITS. Avoiding the stat64()/fstat64() interfaces is desirable because they are nonstandard and not implemented on many systems (including OpenBSD and FreeBSD), and using 64 bits for stat()/fstat() is either the default or trivial to set up.
| * | | common: stat64 is non-standard, hide on a random UnixJan Beich2016-10-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/file_util.cpp:79:19: error: variable has incomplete type 'struct stat64' struct stat64 file_info; ^ src/common/file_util.cpp:79:12: note: forward declaration of 'stat64' struct stat64 file_info; ^ src/common/file_util.cpp:99:19: error: variable has incomplete type 'struct stat64' struct stat64 file_info; ^ src/common/file_util.cpp:99:12: note: forward declaration of 'stat64' struct stat64 file_info; ^ src/common/file_util.cpp:342:19: error: variable has incomplete type 'struct stat64' struct stat64 buf; ^ src/common/file_util.cpp:342:12: note: forward declaration of 'stat64' struct stat64 buf; ^ src/common/file_util.cpp:359:19: error: variable has incomplete type 'struct stat64' struct stat64 buf; ^ src/common/file_util.cpp:359:12: note: forward declaration of 'stat64' struct stat64 buf; ^ 4 errors generated.
| * | | common: only FreeBSD has thread affinity compatible with LinuxJan Beich2016-10-281-1/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/thread.cpp:90:5: error: unknown type name 'cpu_set_t'; did you mean 'cpuset_t'? cpu_set_t cpu_set; ^~~~~~~~~ cpuset_t /usr/include/sys/_cpuset.h:48:24: note: 'cpuset_t' declared here typedef struct _cpuset cpuset_t; ^ 1 error generated.
| * | | common: define routines to set thread name on more BSDsJan Beich2016-10-281-2/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | | src/common/thread.cpp:123:5: error: use of undeclared identifier 'pthread_setname_np' pthread_setname_np(pthread_self(), szThreadName); ^ 1 error generated.
| * | | hooks: convert pre-commit to POSIX syntaxJan Beich2016-10-281-3/+3
| |/ /
* | | Merge pull request #2146 from mailwl/gdbstub-ida-regsbunnei2016-10-291-1/+1
|\ \ \ | |/ / |/| | Small fix to let IDA see target.xml
| * | Small fix to let IDA see target.xmlmailwl2016-10-281-1/+1
|/ /
* | Travis: only upload for push (#2134)wwylele2016-10-271-1/+1
| |
* | Merge pull request #2139 from mailwl/frd-fixwwylele2016-10-251-1/+1
|\ \ | | | | | | FRD: fix GetMyFriendKey
| * | FRD: fix GetMyFriendKeymailwl2016-10-251-1/+1
|/ /
* | Merge pull request #2131 from ricardotk/typoswwylele2016-10-2115-18/+18
|\ \ | | | | | | Fix typos
| * | Fix typosRicardo de Almeida Gonzaga2016-10-2015-18/+18
|/ /
* | Merge pull request #2024 from JamePeng/update-boss-codebunnei2016-10-085-4/+1810
|\ \ | | | | | | Update the stub code of BOSS
| * | Update the stub code of BOSSJamePeng2016-10-025-4/+1810
| | |
* | | Merge pull request #2082 from yuriks/shader-interp-crashbunnei2016-10-073-38/+43
|\ \ \ | |_|/ |/| | Fix/mask crash in shader debugger in Mii Maker
| * | VideoCore: Shader interpreter cleanupsYuri Kunde Schlesner2016-09-301-32/+42
| | |
| * | Common: Remove dangerous Vec[234] array constructorsYuri Kunde Schlesner2016-09-301-3/+0
| | | | | | | | | | | | | | | They're not currently used, and it's easy to accidentally pass a single pointer argument to them, causing an out-of-bounds read.
| * | VideoCore: Fix out-of-bounds read in ShaderSetup::ProduceDebugInfoYuri Kunde Schlesner2016-09-301-3/+1
| |/ | | | | | | | | | | As far as I can tell, memset was replaced by a fill without correcting the parameter type, causing an out-of-bounds array read in the Vec4 constructor.
* | Merge pull request #1652 from wwylele/kernal-toolbunnei2016-10-0512-7/+646
|\ \ | | | | | | Debugger: implement wait tree widget
| * | move ResetType to kernel.hwwylele2016-09-223-7/+6
| | |
| * | name objectswwylele2016-09-221-0/+4
| | |
| * | implement wait tree widgetwwylele2016-09-229-0/+636
| | |
* | | Merge pull request #2106 from wwylele/delete-recursivebunnei2016-10-048-22/+93
|\ \ \ | | | | | | | | FS: implement DeleteDirectoryRecursively
| * | | fs: clean up log formatwwylele2016-10-021-22/+24
| | | |
| * | | fs: implement DeleteDirectoryRecursivelywwylele2016-10-028-1/+70
| | |/ | |/|
* | | Merge pull request #2103 from wwylele/gpu-reg-cleanupbunnei2016-10-045-247/+347
|\ \ \ | |/ / |/| | GPU: DisplayTransfer & MemoryFill cleanup and param check
| * | gpu: DisplayTransfer: a less amazing algorithm for flipwwylele2016-09-291-8/+11
| | | | | | | | | | | | the old implementation modifies the loop variable in the loop. Though it actually works, it is really confusing. Makes it morereadable now.
| * | gpu: keep the old signal strategy for null pointerwwylele2016-09-291-4/+8
| | | | | | | | | | | | | | | previous commits changes the behaviour of interrupt when meeting invalid params. Regresses to the same behaviour as before needs more hwtest
| * | gpu: add validity check for TextureCopy, DisplayTransfer and FillMemorywwylele2016-09-291-6/+88
| | | | | | | | | | | | | | | prevent further operation with invalid values which may cause assertion failure or divided by zero. needs more hwtest
| * | memory: fix IsValidVirtualAddress for RasterizerCachedMemorywwylele2016-09-291-0/+3
| | | | | | | | | | | | RasterizerCachedMemory doesn't has pointer but should be considered as valid
| * | gpu: move MemoryFill, TextureCopy and DisplayTransfer into functionswwylele2016-09-291-247/+249
| | | | | | | | | | | | The old code indented too much to read. Split into functions and do general cleanup.
| * | rasterizer: separate TextureCopy from DisplayTransferwwylele2016-09-293-6/+12
| |/
* | Merge pull request #2083 from yuriks/opengl-scissor-cached-rectYuri Kunde Schlesner2016-09-303-29/+25
|\ \ | | | | | | OpenGL: Take cached viewport sub-rect into account for scissor
| * | OpenGL: Take cached viewport sub-rect into account for scissorYuri Kunde Schlesner2016-09-303-29/+25
|/ / | | | | | | Fixes #1938
* | Merge pull request #2100 from wwylele/fix-load-assertbunnei2016-09-231-2/+3
|\ \ | |/ |/| Qt: shutdown system if error on loading ROM
| * qt: shutdown system if errorwwylele2016-09-221-2/+3
|/
* Merge pull request #2099 from citra-emu/fix-clang-formatwwylele2016-09-221-2/+2
|\ | | | | Fix clang-format lint
| * travis: fix clang-format lintwwylele2016-09-221-2/+2
|/
* Merge pull request #2086 from linkmauve/clang-formatYuri Kunde Schlesner2016-09-21401-18173/+19275
|\ | | | | Add clang-format as part of our {commit,travis}-time checks
| * Fix Travis clang-format checkYuri Kunde Schlesner2016-09-212-15/+31
| |
| * Remove special rules for Windows.h and library includesYuri Kunde Schlesner2016-09-216-10/+8
| |
| * Use negative priorities to avoid special-casing the self-includeYuri Kunde Schlesner2016-09-21164-168/+170
| |
| * Remove empty newlines in #include blocks.Emmanuel Gil Peyrot2016-09-21289-731/+214
| | | | | | | | | | | | | | This makes clang-format useful on those. Also add a bunch of forgotten transitive includes, which otherwise prevented compilation.
| * Manually tweak source formatting and then re-run clang-formatYuri Kunde Schlesner2016-09-19169-812/+808
| |
| * Tweak formatting settingsYuri Kunde Schlesner2016-09-191-4/+3
| |
| * Sources: Run clang-format on everything.Emmanuel Gil Peyrot2016-09-18386-17707/+19187
| |
| * Travis: Import Dolphin’s clang-format hook.Emmanuel Gil Peyrot2016-09-181-1/+20
| |
| * Git hook: Remove trailing semicolons wrecking vim’s syntax highlighting.Emmanuel Gil Peyrot2016-09-181-2/+2
| |
| * Git hook: Import Dolphin’s clang-format hook.Emmanuel Gil Peyrot2016-09-181-1/+18
| |
| * Dyncom: Disable clang-format on the decoding table.Emmanuel Gil Peyrot2016-09-181-0/+3
| |
| * Sources: Add a .clang-format configuration file.Emmanuel Gil Peyrot2016-09-181-0/+89
| |
* | README: Specify master branch for Travis CI badgeYuri Kunde Schlesner2016-09-211-1/+1
| |
* | Merge pull request #2097 from citra-emu/fix-travisYuri Kunde Schlesner2016-09-211-2/+1
|\ \ | |/ |/| Travis: Fix OS X build
| * Travis: Fix OS X buildYuri Kunde Schlesner2016-09-211-2/+1
|/ | | | | | | Probably due to additional Travis caching, cmake is now already installed when the script runs. This causes the unlink to remove the symlink to the executable, which is then not re-added by the install (since it's already installed).
* Merge pull request #2080 from yuriks/shader-interp-crashYuri Kunde Schlesner2016-09-161-1/+1
|\ | | | | VideoCore: Fix dangling lambda context in shader interpreter
| * VideoCore: Fix dangling lambda context in shader interpreterYuri Kunde Schlesner2016-09-161-1/+1
|/ | | | | | The static meant that after the first execution, these lambda context would be pointing to a random location on the stack. Fixes a random crash when using the interpreter.
* Merge pull request #2042 from bunnei/dynarmicYuri Kunde Schlesner2016-09-1619-47/+317
|\ | | | | Interface ARM CPU JIT (Dynarmic)
| * arm_dynarmic: Implement GetVFPSystemReg/SetVFPSystemReg.bunnei2016-09-151-5/+12
| |
| * microprofile: Double buffer size to 16MB.bunnei2016-09-151-1/+1
| |
| * arm: ResetContext shouldn't be part of ARM_Interface.bunnei2016-09-156-30/+17
| |
| * arm_dynarmic/arm_dyncom: Remove unnecessary "virtual" keyword.bunnei2016-09-152-2/+2
| |
| * dyncom: Use VFP_FPSCR/VFP_FPEXC.bunnei2016-09-151-4/+4
| |
| * qt: Add UI configuration option to enable CPU JIT.bunnei2016-09-152-0/+25
| |
| * core: Add configuration option for CPU JIT.bunnei2016-09-155-7/+20
| |
| * dynarmic: Implement ARM CPU interface.bunnei2016-09-153-0/+233
| |
| * dynarmic: Add new submodule.bunnei2016-09-153-10/+16
| |
| * CMakeLists: Set Boost_INCLUDE_DIR.bunnei2016-09-151-4/+3
| |
| * externals/boost: Use latest upstream with variant.bunnei2016-09-151-0/+0
|/
* Merge pull request #2064 from linkmauve/remove-readdir_rYuri Kunde Schlesner2016-09-131-6/+2
|\ | | | | Switch to readdir() from readdir_r()
| * Common: readdir_r() is deprecated, switch to readdir().Emmanuel Gil Peyrot2016-09-131-6/+2
| |
* | Merge pull request #2069 from wwylele/fix-birthdayYuri Kunde Schlesner2016-09-131-2/+3
|\ \ | | | | | | Qt: fix birthday combo box updating
| * | Qt: fix birthday combo box updatingwwylele2016-09-131-2/+3
|/ /
* | Merge pull request #2059 from MerryMage/tweak-audio-latencybunnei2016-09-112-2/+2
|\ \ | |/ |/| audio_core: Tweak audio latency
| * audio_core: Tweak audio latencyMerryMage2016-09-072-2/+2
| |
* | travis cache for cmake and sdl2 (#2060)Lectem2016-09-082-4/+17
|/
* Merge pull request #2050 from MerryMage/adpcmYuri Kunde Schlesner2016-09-031-2/+2
|\ | | | | codec: Fix ADPCM distortion caused by incorrect nibble order
| * codec: Fix ADPCM distortion caused by incorrect nibble orderfincs2016-09-031-2/+2
| | | | | | | | | | | | Closes #2049. Signed-off-by: MerryMage <MerryMage@users.noreply.github.com>
* | Merge pull request #2045 from MerryMage/travisbunnei2016-09-033-3/+4
|\ \ | | | | | | travis: Update to XCode 7.3.1
| * | travis: Update to XCode 7.3.1MerryMage2016-09-023-3/+4
| |/
* | Merge pull request #2044 from wwylele/system-setting-fixbunnei2016-09-025-12/+9
|\ \ | | | | | | Qt: unify running detection of system settings configure
| * | Qt: unify running detectionwwylele2016-09-025-12/+9
|/ /
* | Merge pull request #2040 from citra-emu/revert-2037-msvc-relwithdebinfobunnei2016-09-011-11/+7
|\ \ | | | | | | Revert "MSVC: Add RelWithDebInfo and removing debugging from Release."
| * | Revert "MSVC: Add RelWithDebInfo and removing debugging from Release."bunnei2016-09-011-11/+7
|/ /
* | Merge pull request #2037 from jroweboy/msvc-relwithdebinfobunnei2016-09-011-7/+11
|\ \ | | | | | | MSVC: Add RelWithDebInfo and removing debugging from Release.
| * | MSVC: Add RelWithDebInfo and removing debugging from Release.James Rowe2016-09-011-7/+11
| | | | | | | | | | | | This should reduce build size on windows from roughly 12MB compressed to 7MB
* | | Merge pull request #2039 from jroweboy/remove-pdbbunnei2016-09-011-0/+6
|\ \ \ | | | | | | | | Create a separate archive for debug symbols on windows
| * | | Create a separate archive for debugsymbols on windowsJames Rowe2016-09-011-0/+6
|/ / / | | | | | | | | | | | | This reduces the main download size and uploads the symbols to a different directory
* | | Merge pull request #2038 from MerryMage/rm-testsbunnei2016-09-011-0/+4
|\ \ \ | |_|/ |/| | appveyor: Remove tests.exe and tests.pdb from archive
| * | appveyor: Remove tests.exe and tests.pdb from archiveMerryMage2016-09-011-0/+4
|/ /
* | Merge pull request #2032 from bunnei/qt-graphicsbunnei2016-09-0121-82/+251
|\ \ | | | | | | Qt graphics configure & V-Sync option
| * | qt: Rename all "toogle" to "toggle".bunnei2016-09-016-24/+24
| | |
| * | qt: Add an option to settings for enabling V-Sync.bunnei2016-08-301-0/+4
| | |
| * | qt: Recreate GL context on startup to support changing V-Sync.bunnei2016-08-303-25/+39
| | |
| * | system: Add a function to see if the emulator is running.bunnei2016-08-302-0/+11
| | |
| * | config: Add a setting for graphics V-Sync.bunnei2016-08-309-1/+20
| | |
| * | qt: Add a configuration tab for Graphics and move relevant fields.bunnei2016-08-308-48/+169
| | |
* | | Merge pull request #2035 from MerryMage/disable-stretchbunnei2016-09-0115-16/+83
|\ \ \ | |_|/ |/| | User-configurable option to enable/disable time-stretching of audio
| * | configure_audio: User-configuratble option to enable/disable audio stretchingMerryMage2016-08-317-0/+24
| | |
| * | audio_core: Add EnableStretching to interface so that one can toggle stretching on and offMerryMage2016-08-314-9/+52
| | |
| * | sink: Change EnqueueSamples to take a pointer to a buffer instead of a std::vectorMerryMage2016-08-315-9/+9
|/ /
* | Merge pull request #2034 from JayFoxRox/avoid-glsl-errorbunnei2016-08-311-0/+1
|\ \ | | | | | | OpenGL: Avoid error on unsupported lighting LUT
| * | OpenGL: Avoid error on unsupported lighting LUTJannik Vogel2016-08-301-0/+1
|/ /
* | Merge pull request #2023 from yuriks/autobase-bcfntbunnei2016-08-303-30/+68
|\ \ | |/ |/| Auto-detect original shared_font.bin memory base
| * Auto-detect original shared_font.bin memory baseYuri Kunde Schlesner2016-08-273-30/+68
| | | | | | | | | | This allows a file dumped from either an o3DS or a n3DS (and potentially even an original unrebased file) to be used.
* | Merge pull request #2029 from JayFoxRox/appveyor-cachebunnei2016-08-291-0/+4
|\ \ | | | | | | AppVeyor: Cache chocolatey packages
| * | AppVeyor: Cache chocolatey packagesJannik Vogel2016-08-291-0/+4
|/ /
* | Merge pull request #1948 from wwylele/cro++Yuri Kunde Schlesner2016-08-2914-99/+3041
|\ \ | | | | | | Implemented CRO
| * | LDR: Implement CROwwylele2016-08-279-99/+3013
| | |
| * | ARM: add ClearInstructionCache functionwwylele2016-08-273-0/+11
| | |
| * | Memory: add ReadCString functionwwylele2016-08-272-0/+17
| |/
* | Merge pull request #1987 from Lectem/ipcdescriptorsYuri Kunde Schlesner2016-08-275-22/+110
|\ \ | |/ |/| fix #1942 and add a few IPC functions for descriptors
| * fix #1942 and adds a few IPC functions for descriptorsLectem2016-08-025-22/+110
| |
* | Merge pull request #2022 from MerryMage/issue-tplbunnei2016-08-261-0/+25
|\ \ | | | | | | .github: Add ISSUE_TEMPLATE.md
| * | .github: Add ISSUE_TEMPLATE.mdMerryMage2016-08-261-0/+25
| | |
* | | Merge pull request #2015 from MerryMage/upstream-smlabunnei2016-08-231-2/+4
|\ \ \ | | | | | | | | dyncom: Read-after-write in SMLA
| * | | dyncom: Read-after-write in SMLAMerryMage2016-08-221-2/+4
|/ / / | | | | | | | | | | | | In the case when RD === RN, RD was updated before AddOverflow was called to check for an overflow, resulting in an incorrect state of the Q flag.
* | | citra: Default to HW renderer.bunnei2016-08-163-4/+4
| | |
* | | qt: Use 5.7 on Windows.bunnei2016-08-161-1/+1
| | |
* | | Merge pull request #2004 from MerryMage/stmYuri Kunde Schlesner2016-08-151-3/+4
|\ \ \ | | | | | | | | Dyncom: Correct implementation of STM for R15
| * | | Dyncom: Correct implementation of STM for R15MerryMage2016-08-141-3/+4
|/ / /
* | | Merge pull request #1936 from jroweboy/qt5.7-fixbunnei2016-08-082-6/+8
|\ \ \ | |_|/ |/| | CMake: Fix for QT 5.7 overwriting -std=c++1y flag
| * | CMake: Fix for QT 5.7 overwriting -std=c++1y flagJames Rowe2016-08-052-6/+8
|/ / | | | | | | | | | | | | In QT 5.7 they added a new check for CXX features which appends a minimum required standard to the CXX_FLAGS. Because we were writing the flag directly previously, cmake assumed it needed to add a c++11 flag to the build. This tells cmake to use c++14 on every build.
* | Input GUI: Add tab to remap controls (#1900)Anon2016-07-299-8/+825
| |
* | Merge pull request #1950 from JamePeng/fix-apt-0x0055004-and-0x00560000bunnei2016-07-295-22/+31
|\ \ | | | | | | Correct APT::0x00550040 and APT::0x00560000 function
| * | Correct APT::0x00550040 and APT::0x00560000 functionJamePeng2016-07-155-22/+31
| | |
* | | Merge pull request #1983 from hrydgard/font-reminderbunnei2016-07-281-0/+7
|\ \ \ | | | | | | | | Shared font file: Instead of segfaulting, log an error to remind the user to dump it
| * | | Instead of segfaulting, log an error to remind the user to dump the shared font fileHenrik Rydgard2016-07-281-0/+7
|/ / /
* | | Merge pull request #1959 from MerryMage/revsh-upstreambunnei2016-07-281-4/+13
|\ \ \ | | | | | | | | dyncom: Fix translation of thumb REVSH
| * | | dyncom: Fix translation of thumb REVSHMerryMage2016-07-281-4/+13
| | |/ | |/|
* | | Merge pull request #1966 from dwhinham/info_plist_fixbunnei2016-07-261-1/+1
|\ \ \ | | | | | | | | CMake: Fix Info.plist template for citra_qt/OSX
| * | | CMake: Fix Info.plist template for citra_qt/OSXDale Whinham2016-07-211-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The Info.plist template incorrectly uses parentheses instead of curly braces, which means that building the .app bundle using regular 'make' results in the variable not being replaced, and hence the app bundle won't start because the executable name is incorrect. This commit fixes this issue.
* | | | Travis Build: OS X Startup Crash Fix (#1962)Andy Tran2016-07-261-0/+91
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Travis: Mac OS X Build Fix Addresses the issue of the nightly builds crashing on OS X. In short, the changes needed were to rename the references within the binaries in order to make the app “self-contained”. * Travis: Mac OS X Terminal Launches citra with a terminal (instead of going straight for the QT application, skipping the debugging terminal). * Travis: Clean Up Lines * Travis: Fix of EOL Issue * Travis: Merge Fixes from Build Branch * Travis: Forward OS X Arguments * Travis: Forward OS X Arg x2 The issue is, is that sure “open citra-qt.app —args test” works, but drag and drop doesn’t! * Travis: Something needed to be escaped
* | | | Merge pull request #1974 from LittleWhite-tb/crash_invalid_sizebunnei2016-07-251-4/+3
|\ \ \ \ | | | | | | | | | | Protection against a resize of size 0
| * | | | Protection against a resize of size 0Alexandre LittleWhite Laurent2016-07-231-4/+3
| | | | |
* | | | | Merge pull request #1973 from linkmauve/no-sse4.1Yuri Kunde Schlesner2016-07-231-5/+0
|\ \ \ \ \ | |/ / / / |/| | | | Remove the -msse4.1 on ¬MSVC
| * | | | Remove the -msse4.1 on ¬MSVC.Emmanuel Gil Peyrot2016-07-231-5/+0
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | This option makes the generated binary crash with an illegal instruction when the target CPU doesn’t support the SSE4.1 extension (see #1968), with no noticeable performance increase compared to a generic build.
* | | | Merge pull request #1963 from wwylele/rtcYuri Kunde Schlesner2016-07-233-3/+61
|\ \ \ \ | |/ / / |/| | | Implement actual system time
| * | | CoreTiming: avoid overflowwwylele2016-07-231-1/+1
| | | |
| * | | HLE: implement system timewwylele2016-07-232-2/+60
|/ / /
* | | Merge pull request #1964 from Lectem/sdl2_dll_copy_fixbunnei2016-07-211-0/+9
|\ \ \ | |_|/ |/| | Fixes SDL2.dll copy to bindir on windows
| * | Fixes SDL2.dll copy to bindir on windowsLectem2016-07-211-0/+9
|/ /
* | Merge pull request #1890 from LFsWang/fix-encode-problembunnei2016-07-151-0/+22
|\ \ | | | | | | Fix boot_filename encode on Windows
| * | Fix boot_filename encode on WindowsLFsWang2016-06-081-0/+22
| | |
* | | Merge pull request #1894 from wwylele/set-config-blockYuri Kunde Schlesner2016-07-1014-41/+703
|\ \ \ | | | | | | | | Implement config savegame editing & clean up
| * | | Qt: add system settings config tabwwylele2016-07-108-4/+450
| | | |
| * | | Service::CFG/FS: add and refactor out utilities for front-endwwylele2016-07-034-15/+146
| | | |
| * | | Service::CFG: move known block ID to an enumwwylele2016-07-031-11/+25
| | | |
| * | | Service::CFG: add SetConfigInfoBlk4wwylele2016-07-034-8/+73
| | | |
| * | | Service::CFG: add missing languagewwylele2016-07-021-1/+2
| | | |
| * | | Service::CFG: name sound output modeswwylele2016-07-022-2/+7
| | |/ | |/|
* | | Merge pull request #1940 from JamePeng/fix-archive-error-codebunnei2016-07-072-10/+15
|\ \ \ | | | | | | | | Fix the errorcode of archive handle
| * | | Fix the errorcode of archive handleJamePeng2016-07-042-10/+15
| | | |
* | | | Merge pull request #1921 from Subv/fs_funcsSebastian Valle2016-07-051-11/+42
|\ \ \ \ | | | | | | | | | | HLE/FS: Document some command parameters and implemented command 0x08560240
| * | | | HLE/FS: Document some command parameters and implemented command 0x08560240 (CreateLegacySystemSaveData)Subv2016-07-031-11/+42
| | | | |
* | | | | Merge pull request #1850 from mailwl/erreulaSebastian Valle2016-07-045-0/+118
|\ \ \ \ \ | |_|/ / / |/| | | | HLE/Applets: Implement ErrEula applet
| * | | | HLE/Applets: Implement ErrEula appletmailwl2016-07-045-0/+118
|/ / / /
* | | | Merge pull request #1935 from wwylele/fix-result-moduleSebastian Valle2016-07-031-6/+19
|\ \ \ \ | | | | | | | | | | Result: Update the ErrorModule enum
| * | | | Result: fix and update ErrorModulewwylele2016-06-301-6/+19
| | |/ / | |/| |
* | | | Merge pull request #1933 from yuriks/scissorYuri Kunde Schlesner2016-07-026-3/+112
|\ \ \ \ | |/ / / |/| | | PICA: Implement scissor test
| * | | OpenGL: Add scaled resolution support to scissorYuri Kunde Schlesner2016-06-284-3/+16
| | | |
| * | | PICA: Scissor fixes and cleanupsYuri Kunde Schlesner2016-06-285-45/+39
| | | |
| * | | PICA: Implement scissor testSubv2016-06-285-3/+105
| | | |
* | | | Merge pull request #1869 from wwylele/dont-be-lazyYuri Kunde Schlesner2016-06-291-2/+6
|\ \ \ \ | | | | | | | | | | Switch context to the same thread if necessary
| * | | | Switch context on the same thread if necessarywwylele2016-05-301-2/+6
| | | | |
* | | | | Merge pull request #1867 from mailwl/srv-updatebunnei2016-06-292-15/+125
|\ \ \ \ \ | |_|/ / / |/| | | | srv: Update according 3dbrew
| * | | | Fix parameter name in EnableNotificationmailwl2016-05-312-2/+6
| | | | |
| * | | | Fix mistakes, add output header codesmailwl2016-05-311-8/+24
| | | | |
| * | | | remove ugly functionmailwl2016-05-311-35/+3
| | | | |
| * | | | srv: Update according 3dbrewmailwl2016-05-311-15/+137
| | | | |
* | | | | Merge pull request #1930 from scurest/superfluous-movesYuri Kunde Schlesner2016-06-252-2/+2
|\ \ \ \ \ | | | | | | | | | | | | Remove superfluous std::move in return std::move(local_var)
| * | | | | Remove superfluous std::move in return std::move(local_var)scurest2016-06-252-2/+2
|/ / / / /
* | | | | Merge pull request #1926 from JayFoxRox/gplbunnei2016-06-243-4/+10
|\ \ \ \ \ | | | | | | | | | | | | Add GPL license.txt and README.md to builds
| * | | | | Add GPL license.txt and README.md to buildsJannik Vogel2016-06-213-4/+10
| | | | | |
* | | | | | Merge pull request #1923 from yuriks/fix-recursivebunnei2016-06-223-22/+15
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Fix recursive scanning of directories
| * | | | | Fix recursive scanning of directoriesYuri Kunde Schlesner2016-06-193-22/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ForeachDirectoryEntry didn't actually do anything with the `recursive` parameter, and the corresponding callback parameter was shadowing the actual recursion counters in the user functions.
* | | | | | Merge pull request #1922 from yuriks/microprofile-dpi-fixbunnei2016-06-211-7/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Qt: Fix MicroProfile dpi scaling
| * | | | | Qt: Fix MicroProfile dpi scalingYuri Kunde Schlesner2016-06-191-7/+6
|/ / / / /
* | | | | Merge pull request #1877 from wwylele/wait-fix-timeoutbunnei2016-06-181-0/+49
|\ \ \ \ \ | | | | | | | | | | | | Thread: update timeout when reruning WaitSynch
| * | | | | Thread: update timeout when rerunning WaitSynchwwylele2016-06-041-0/+49
| | | | | |
* | | | | | Merge pull request #1917 from lioncash/cibunnei2016-06-174-24/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | CI: Use Qt 5 and GCC 6 on Ubuntu CI builds
| * | | | | | CMakeLists: Drop support for Qt 4Lioncash2016-06-171-11/+2
| | | | | | |
| * | | | | | travis: Use GCC 6 on Ubuntu CI buildsLioncash2016-06-173-6/+6
| | | | | | |
| * | | | | | travis: Use Qt 5 on Ubuntu CI buildsLioncash2016-06-172-7/+11
|/ / / / / /
* | | | | | Merge pull request #1898 from archshift/interpreter-split-take2bunnei2016-06-165-2727/+2729
|\ \ \ \ \ \ | | | | | | | | | | | | | | Refactor arm_dyncom_interpreter into several files (take 2)
| * | | | | | Make arm_dyncom_trans* into a fully fledged compilation unitarchshift2016-06-124-53/+73
| | | | | | |
| * | | | | | arm_dyncom_interpreter: slightly change AllocBuffer to be intuitivearchshift2016-06-121-15/+15
| | | | | | |
| * | | | | | arm_dyncom_interpreter: Add specialized GetAddressingOpLoadStoreT funcarchshift2016-06-112-39/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows us to get the addressing operation for STRT, LDRT, STRBT, and LDRBT. We do this so that translation functions don't need to see the addressing ops directly.
| * | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-112-34/+34
| | | | | | |
| * | | | | | arm_dyncom_interpreter: Rename anonymous enum to TransExtDataarchshift2016-06-114-166/+164
| | | | | | |
| * | | | | | arm_dyncom_interpreter.cpp: #include translation info from inc filesarchshift2016-06-113-2648/+2652
| | | | | | |
* | | | | | | Merge pull request #1912 from yuriks/fix-win-deploybunnei2016-06-151-5/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix AppVeyor WinSCP download
| * | | | | | | Fix AppVeyor WinSCP downloadYuri Kunde Schlesner2016-06-151-5/+3
| | |_|_|_|/ / | |/| | | | |
* | | | | | | Merge pull request #1875 from JayFoxRox/fogbunnei2016-06-159-48/+253
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Implement standard fog (fog mode 5)
| * | | | | | OpenGL: Implement fogJannik Vogel2016-06-075-7/+124
| | | | | | |
| * | | | | | Rasterizer: Implement fogJannik Vogel2016-06-071-21/+52
| | | | | | |
| * | | | | | Pica: Add fog stateJannik Vogel2016-06-073-14/+69
| | | | | | |
| * | | | | | OpenGL: Avoid undefined behaviour for UNIFORM_BLOCK_DATA_SIZEJannik Vogel2016-06-072-6/+8
| | |_|_|_|/ | |/| | | |
* | | | | | Merge pull request #1842 from Subv/portsbunnei2016-06-128-3/+178
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel: Added ClientPort and ServerPort classes, along with svcCreatePort.
| * | | | | | Kernel/SVC: Implemented svcCreatePort.Subv2016-06-116-3/+41
| | | | | | |
| * | | | | | Kernel: Added ClientPort and ServerPort classes.Subv2016-06-056-2/+139
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This is part of an ongoing effort to implement support for multiple processes.
* | | | | | | Merge pull request #1899 from wwylele/hid-cmathbunnei2016-06-111-0/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | HID: add missing header
| * | | | | | | hid: add missing headerwwylele2016-06-111-0/+2
|/ / / / / / /
* | | | | | | Merge pull request #1897 from linkmauve/sdl2-config-fixMat M2016-06-111-1/+5
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | SDL2: Add forgotten default config changes from 7129611e65096ba2cbe8266f6cb068a9b18981d8
| * | | | | | | SDL2: Add forgotten default config changes from 7129611e65096ba2cbe8266f6cb068a9b18981d8.Emmanuel Gil Peyrot2016-06-111-1/+5
| | | | | | | |
* | | | | | | | Merge pull request #1789 from wwylele/input-refactorbunnei2016-06-1112-75/+315
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Refactor input mapping & implement circle pad modifier
| * | | | | | | fixup! fixup! Refactor input systemwwylele2016-05-153-8/+8
| | | | | | | |
| * | | | | | | fixup! Refactor input systemwwylele2016-05-152-20/+24
| | | | | | | |
| * | | | | | | implement circle pad modifierwwylele2016-05-156-5/+37
| | | | | | | |
| * | | | | | | Refactor input subsystemwwylele2016-05-1512-75/+279
| | | | | | | |
* | | | | | | | Merge pull request #1896 from citra-emu/revert-1893-interpreter-splitarchshift2016-06-115-2731/+2727
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"
| * | | | | | | | Revert "Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)"archshift2016-06-115-2731/+2727
|/ / / / / / / /
* | | | | | | | Merge pull request #1893 from archshift/interpreter-splitMat M2016-06-095-2727/+2731
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | Split huge interpreter source file into translation info and interpreter (+ some tiny misc style fixes)
| * | | | | | | arm_dyncom_interpreter: rename operation functions to fit style guidearchshift2016-06-092-42/+42
| | | | | | | |
| * | | | | | | arm_dyncom_interpreter.cpp: Split by translation and interpreter logicarchshift2016-06-095-2727/+2731
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | To facilitate the split, some small changes were made to names of various structures and functions.
* | | | | | | Merge pull request #1891 from shinyquagsire23/gdb-E0-fixTony Wasserka2016-06-081-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gdbstub: E0 should be E00
| * | | | | | | gdbstub: E0 should be E00shinyquagsire232016-06-081-1/+1
|/ / / / / / /
* | | | | | | Merge pull request #1765 from JayFoxRox/debug-surface-viewerbunnei2016-06-089-583/+876
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Debugger: Pica surface viewer
| * | | | | | citra_qt: Replace 'Pica Framebuffer Debugger' with 'Pica Surface Viewer'Jannik Vogel2016-05-079-583/+876
| | | | | | |
* | | | | | | Merge pull request #1873 from archshift/remove-configbunnei2016-06-066-671/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Remove unused and bitrotted "controller config" files
| * | | | | | | Remove unused and bitrotted "controller config" filesarchshift2016-06-026-671/+0
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1884 from lioncash/dlpbunnei2016-06-0610-23/+150
|\ \ \ \ \ \ \ | |_|_|_|/ / / |/| | | | | | service: Add other DLP services
| * | | | | | service: Add other DLP servicesLioncash2016-06-0510-23/+150
|/ / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Specifically, dlp::CLNT and dlp::FKCL Moves them to their own folder like with other services.
* | | | | | Merge pull request #1863 from mailwl/gpu-threadid-resetbunnei2016-06-033-16/+23
|\ \ \ \ \ \ | |/ / / / / |/| | | | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueue
| * | | | | gsp::gpu: Reset g_thread_id in UnregisterInterruptRelayQueuemailwl2016-06-013-16/+23
| | | | | |
* | | | | | Merge pull request #1871 from LFsWang/prevent-load-warn-msgbunnei2016-06-021-3/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | AddFstEntriesToGameList - prevent loading a directory as a file
| * | | | | AddFstEntriesToGameList - prevent loading a directoryLFsWang2016-06-011-3/+3
|/ / / / /
* | | | | Merge pull request #1812 from JayFoxRox/refactor-shaderbunnei2016-06-014-64/+81
|\ \ \ \ \ | |_|_|/ / |/| | | | Retrieve shader result from new OutputRegisters-type
| * | | | Retrieve shader result from new OutputRegisters-typeJannik Vogel2016-05-164-64/+81
| | | | |
* | | | | Merge pull request #1751 from linkmauve/no-recursive-readdirbunnei2016-05-314-30/+43
|\ \ \ \ \ | |_|_|_|/ |/| | | | Make recursive FileUtil functions take a maximum recursion
| * | | | Common: Make recursive FileUtil functions take a maximum recursionEmmanuel Gil Peyrot2016-05-214-30/+43
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Fixes #1115. Also improves the performances of DiskArchive’s directory implementation a lot, simply by not going through the entire tree instead of just listing the first level files. Thanks to JayRoxFox for rebasing this on current master!
* | | | | Merge pull request #1692 from Subv/rm_getpointer2bunnei2016-05-3018-139/+458
|\ \ \ \ \ | | | | | | | | | | | | Memory: Remove most usages of GetPointer
| * | | | | Memory: Handle RasterizerCachedMemory and RasterizerCachedSpecial page types in the memory block manipulation functions.Subv2016-05-282-2/+60
| | | | | |
| * | | | | Memory: Make ReadBlock and WriteBlock accept void pointers.Subv2016-05-285-21/+19
| | | | | |
| * | | | | SOC_U: Remove usage of GetPointerSubv2016-05-281-27/+73
| | | | | |
| * | | | | SSL_C: Remove use of Memory::GetPointerMerryMage2016-05-281-4/+3
| | | | | |
| * | | | | GSP_GPU: Remove use of Memory::GetPointerMerryMage2016-05-281-33/+50
| | | | | |
| * | | | | Memory: CopyBlockMerryMage2016-05-282-2/+43
| | | | | |
| * | | | | DSP_DSP: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+10
| | | | | |
| * | | | | FS/Archive: Remove use of Memory::GetPointerMerryMage2016-05-281-7/+14
| | | | | |
| * | | | | CFG: Remove use of Memory::GetPointerMerryMage2016-05-211-6/+10
| | | | | |
| * | | | | APT: Remove use of Memory::GetPointerMerryMage2016-05-215-35/+36
| | | | | |
| * | | | | Kernel/Thread: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | | | | |
| * | | | | Applets/swkdb: Remove use of Memory::GetPointerMerryMage2016-05-211-1/+1
| | | | | |
| * | | | | Memory: ZeroBlockMerryMage2016-05-212-0/+39
| | | | | |
| * | | | | FileSys/Path: Replace Memory::GetPointer with Memory::ReadBlockMerryMage2016-05-211-6/+6
| | | | | |
| * | | | | Debugger/Callstack: Replace Memory::GetPointer with Memory::IsValidVirtualAddressMerryMage2016-05-211-1/+4
| | | | | |
| * | | | | Memory: ReadBlock/WriteBlockMerryMage2016-05-213-4/+81
| | | | | |
| * | | | | Memory: IsValidVirtualAddress/IsValidPhysicalAddressMerryMage2016-05-213-0/+26
| |/ / / /
* | | | | Merge pull request #1756 from wwylele/config-cleanupbunnei2016-05-291-29/+13
|\ \ \ \ \ | | | | | | | | | | | | Config block: clean up
| * | | | | clean up config blockwwylele2016-05-031-29/+13
| | | | | |
* | | | | | Merge pull request #1857 from MerryMage/rotr-rotlbunnei2016-05-281-12/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | common_funcs: Provide rotr and rotl for MSVC
| * | | | | | common_funcs: Provide rotr and rotl for MSVCMerryMage2016-05-271-12/+18
| | | | | | |
* | | | | | | Merge pull request #1568 from JayFoxRox/fix-printfMat M2016-05-273-26/+61
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix ftoi and disable VFPv3
| * | | | | | | Fix ftoi behaviourJannik Vogel2016-05-162-22/+53
| | | | | | | |
| * | | | | | | Respect fpscr in ftoizJannik Vogel2016-05-162-4/+4
| | | | | | | |
| * | | | | | | Disable VFP3 instructionsJannik Vogel2016-05-161-0/+4
| | | | | | | |
* | | | | | | | Merge pull request #1810 from JayFoxRox/fix-float-exceptionsbunnei2016-05-273-91/+130
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Fix float exceptions
| * | | | | | | | Remove `exceptions` parameter from `normaliseround` VFP functionsJannik Vogel2016-05-183-28/+57
| | | | | | | | |
| * | | | | | | | Fix exception propagation for VFP single precisionJannik Vogel2016-05-182-33/+38
| | | | | | | | |
| * | | | | | | | Fix exception propagation for VFP double precisionJannik Vogel2016-05-182-34/+39
| | | | | | | | |
* | | | | | | | | Merge pull request #1846 from JayFoxRox/missing-dirty-lightingbunnei2016-05-264-43/+140
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | OpenGL: Set shader_dirty on lighting changes
| * | | | | | | | | OpenGL: Set shader_dirty on lighting changesJannik Vogel2016-05-231-0/+23
| | | | | | | | | |
| * | | | | | | | | Pica: Name LightSrc.config registerJannik Vogel2016-05-232-17/+15
| | | | | | | | | |
| * | | | | | | | | Pica: Name lighting.config0 and .config1 registersJannik Vogel2016-05-232-18/+18
| | | | | | | | | |
| * | | | | | | | | OpenGL: Use uniforms for dist_atten_bias and dist_atten_scaleJannik Vogel2016-05-233-8/+84
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1855 from MerryMage/memory-headers-20160526Mat M2016-05-262-1/+2
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Memory: Added necessary headers and removed unnecessary header
| * | | | | | | | | | Memory: Added necessary headers and removed unnecessary headerMerryMage2016-05-262-1/+2
| | |_|_|/ / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1817 from linkmauve/smdh-stuffbunnei2016-05-2514-167/+229
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Improve SMDH support in loaders and frontends
| * | | | | | | | | | Loader: Split SMDH into its own header and import helpers from QGameListEmmanuel Gil Peyrot2016-05-215-89/+149
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also rewrite Qt wrappers to use those.
| * | | | | | | | | | CitraQt: Simplify the game list loader codeEmmanuel Gil Peyrot2016-05-215-34/+18
| | | | | | | | | | |
| * | | | | | | | | | Loader: Add a GetFileType method to get the type of a loaded fileEmmanuel Gil Peyrot2016-05-214-0/+30
| | | | | | | | | | |
| * | | | | | | | | | Loader, Frontends: Refactor loader creation and game loadingEmmanuel Gil Peyrot2016-05-216-49/+37
| | |_|_|_|_|/ / / / | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows frontends to keep a single loader and use it multiple times e.g. for code loading and SMDH parsing.
* | | | | | | | | | New3DS: Minor style cleanup to #1520.bunnei2016-05-244-6/+6
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1520 from JamePeng/checknew3dsbunnei2016-05-2411-14/+145
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Implement CheckNew3DS and CheckNew3DSApp
| * | | | | | | | | | Implement CheckNew3DS and CheckNew3DSAppJamePeng2016-04-2011-14/+145
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Append an item[is_new3ds] to config file[System] group Implement APT::SetNSStateField,it will update the unknown NS_state_field
* | | | | | | | | | | Merge pull request #1733 from lioncash/vert_loaderbunnei2016-05-243-11/+23
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|_|/ / / / / / / |/| | | | | | | | | | VertexLoader: Minor changes
| * | | | | | | | | | vertex_loader: Correct forward declaration of InputVertexLioncash2016-05-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | It's actually a struct, not a class.
| * | | | | | | | | | vertex_loader: Provide an assertion for ensuring the loader has been setupLioncash2016-05-092-0/+7
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also adds an assert to ensure that Setup is not called more than once during a VertexLoader's lifetime.
| * | | | | | | | | | vertex_loader: Add constructors to facilitate immediate and two-step initializationLioncash2016-05-092-2/+6
| | | | | | | | | | |
| * | | | | | | | | | vertex_loader: initialize_num_total_attributes.Lioncash2016-05-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Keeps the public API sane.
| * | | | | | | | | | vertex_loader: Use std::array instead of raw C arraysLioncash2016-05-091-6/+7
| | | | | | | | | | |
| * | | | | | | | | | vertex_loader: Correct header orderingLioncash2016-05-091-1/+1
| | | | | | | | | | |
* | | | | | | | | | | Merge pull request #1837 from wwylele/sync-trapbunnei2016-05-231-2/+3
|\ \ \ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / / / |/| | | | | | | | | | SVC::WaitSynchronizationN: Reschedule at the end
| * | | | | | | | | | SVC::WaitSynchronizationN: Reschedule at the endwwylele2016-05-211-2/+3
| | | | | | | | | | |
* | | | | | | | | | | Appveyor: Restore working directory after test_script (#1835)Maribel2016-05-211-1/+1
| |_|_|/ / / / / / / |/| | | | | | | | |
* | | | | | | | | | Merge pull request #1564 from MerryMage/this-is-only-a-testbunnei2016-05-218-2/+47
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | tests: Infrastructure for unit tests
| * | | | | | | | | | Tests: Run tests on CIMerryMage2016-05-194-2/+16
| | | | | | | | | | |
| * | | | | | | | | | tests: Infrastructure for unit testsMerryMage2016-05-196-0/+31
| | |_|_|_|_|_|_|_|/ | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1816 from JayFoxRox/refactor-tev-dumpbunnei2016-05-212-91/+114
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | Refactor Tev dump
| * | | | | | | | | | Refactor Tev stage dumperJannik Vogel2016-05-212-115/+114
| | | | | | | | | | |
| * | | | | | | | | | Extend Tev stage dumperJannik Vogel2016-05-211-14/+38
|/ / / / / / / / / /
* | / / / / / / / / Config: Restore previously selected audio sink option (#1824)James Rowe2016-05-201-3/+3
| |/ / / / / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1797 from MerryMage/audio-mixerbunnei2016-05-205-10/+317
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | DSP/HLE: Implement mixer processing
| * | | | | | | | | DSP/HLE: Audio outputMerryMage2016-05-191-0/+7
| | | | | | | | | |
| * | | | | | | | | DSP/HLE: Implement mixer processingMerryMage2016-05-195-11/+311
| |/ / / / / / / /
* | | | | | | | | Merge pull request #1785 from MerryMage/mp-dpibunnei2016-05-191-4/+12
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Microprofile: DPI-aware drawing
| * | | | | | | | | Microprofile: DPI-aware drawingMerryMage2016-05-121-4/+12
| | | | | | | | | |
* | | | | | | | | | Config: Audio sink configuration (#1798)Maribel2016-05-196-0/+134
| |_|_|_|/ / / / / |/| | | | | | | |
* | | | | | | | | Merge pull request #1814 from JayFoxRox/fix-read-after-writeMat M2016-05-181-4/+8
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSD
| * | | | | | | | | Fix read-after-write in SMUAD, SMLAD, SMUSD, SMLSDJannik Vogel2016-05-181-4/+8
|/ / / / / / / / /
* | | | | | | | | Update ACT:U and create ACT:A (#1809)András Domonkos2016-05-185-0/+56
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Update ACT_U * Create act_a.h * Create act_a.cpp * Add service ACT:A * Add ACT:A source and header * Fix wrong header
* | | | | | | | | Merge pull request #1800 from JayFoxRox/set-fpscrbunnei2016-05-183-0/+6
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Set fpscr for new threads
| * | | | | | | | | Set fpscr for new threadsJannik Vogel2016-05-173-0/+6
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1786 from JayFoxRox/blend-equationbunnei2016-05-174-0/+31
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|_|_|/ / |/| | | | | | | | | OpenGL: Support blend equation
| * | | | | | | | | OpenGL: Support blend equationJannik Vogel2016-05-124-0/+31
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1787 from JayFoxRox/refactor-jitlinkmauve2016-05-166-32/+50
|\ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / |/| | | | | | | | Refactor JIT
| * | | | | | | | Use new shader-jit signature for interpreterJannik Vogel2016-05-133-8/+8
| | | | | | | | |
| * | | | | | | | Refactor access to state in shader-jitJannik Vogel2016-05-134-24/+42
| | | | | | | | |
* | | | | | | | | Merge pull request #1792 from JayFoxRox/avoid-uninitialisedbunnei2016-05-162-11/+24
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Avoid uninitialised in hw renderer + Only sync depth if necessary
| * | | | | | | | | OpenGL: Only update depth uniforms if the depth changedJannik Vogel2016-05-142-9/+22
| | | | | | | | | |
| * | | | | | | | | OpenGL: value-initialize variables which cause uninitialised access otherwiseJannik Vogel2016-05-141-2/+2
| | |_|/ / / / / / | |/| | | | | | |
* | | | | | | | | DSP_DSP: Remove GetHeadphoneStatus logspam (#1799)Maribel2016-05-161-2/+2
| |_|_|/ / / / / |/| | | | | | |
* | | | | | | | AudioCore: Implement time stretcher (#1737)Maribel2016-05-154-0/+219
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * AudioCore: Implement time stretcher * fixup! AudioCore: Implement time stretcher * fixup! fixup! AudioCore: Implement time stretcher * fixup! fixup! fixup! AudioCore: Implement time stretcher * fixup! fixup! fixup! fixup! AudioCore: Implement time stretcher * fixup! fixup! fixup! fixup! fixup! AudioCore: Implement time stretcher
* | | | | | | | Merge pull request #1794 from Subv/regression_fixbunnei2016-05-141-0/+3
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Memory: Fixed a regression caused by #1695 and #1689.
| * | | | | | | Memory: Fixed a regression caused by #1695 and #1689.Subv2016-05-141-0/+3
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Reserve enough space in the vector that holds the linear heap memory to prevent relocations of the backing memory when growing too much. Closes #1790
* | | | | | | Merge pull request #1689 from Subv/shmembunnei2016-05-1318-128/+417
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Kernel: Implemented shared memory.
| * | | | | | | HLE/Applets: Give each applet its own block of heap memory, and use that when creating the framebuffer shared memory block.Subv2016-05-135-5/+44
| | | | | | | |
| * | | | | | | Kernel: Account for automatically-allocated shared memories in the amount of used linear heap memory.Subv2016-05-131-0/+5
| | | | | | | |
| * | | | | | | APT: Move the shared font loading and relocation functions to their own subdirectory services/apt/bcfnt.Subv2016-05-134-66/+167
| | | | | | | |
| * | | | | | | Kernel/SharedMemory: Log an error when Map fails.Subv2016-05-131-1/+10
| | | | | | | |
| * | | | | | | Kernel: Implemented shared memory permissions.Subv2016-05-134-9/+50
| | | | | | | |
| * | | | | | | APT: Implement relocating the shared font to its true address.Subv2016-05-131-9/+74
| | | | | | | |
| * | | | | | | Kernel/Memory: Remove the Shared Memory region from the legacy memory map.Subv2016-05-131-1/+0
| | | | | | | |
| * | | | | | | Kernel/SharedMemory: Properly implemented shared memory support.Subv2016-05-1310-118/+147
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Applications can request the kernel to allocate a piece of the linear heap for them when creating a shared memory object. Shared memory areas are now properly mapped into the target processes when calling svcMapMemoryBlock. Removed the APT Shared Font hack as it is no longer needed.
| * | | | | | | Kernel/SVC: Fixed the register order for svcCreateMemoryBlock.Subv2016-05-132-2/+3
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | R0 is used as the last parameter instead of R4.
* | | | | | | Merge pull request #1788 from MerryMage/ext-soundtouchTony Wasserka2016-05-131-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | gitmodules: citra-emu/soundtouch → citra-emu/ext-soundtouch
| * | | | | | gitmodules: citra-emu/soundtouch → citra-emu/ext-soundtouchMerryMage2016-05-131-1/+1
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1695 from Subv/tls_allocbunnei2016-05-135-28/+74
|\ \ \ \ \ \ | | | | | | | | | | | | | | Kernel/Threads: Dynamically allocate the TLS region for threads.
| * | | | | | Kernel/Threads: Dynamically allocate the TLS region for threads in the BASE region of the linear heap.Subv2016-05-075-28/+74
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Each thread gets a 0x200-byte area from the 0x1000-sized page, when all 8 thread slots in a single page are used up, the kernel allocates a new page to hold another 8 entries. This is consistent with what the real kernel does.
* | | | | | | Merge pull request #1783 from JayFoxRox/cleanup-shadersetupbunnei2016-05-137-50/+47
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Cleanup ShaderSetup (Part 1)
| * | | | | | Move program_counter and call_stack from UnitState to interpreterJannik Vogel2016-05-123-45/+42
| | | | | | |
| * | | | | | Move default_attributes into Pica stateJannik Vogel2016-05-125-5/+5
|/ / / / / /
* | | | | | Merge pull request #1690 from JayFoxRox/tex-type-3bunnei2016-05-127-38/+106
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: Implement texture type 3 (Projection2D)
| * | | | | | OpenGL: Implement texture type 3Jannik Vogel2016-05-114-35/+67
| | | | | | |
| * | | | | | Rasterizer: Implement texture type 3Jannik Vogel2016-05-111-2/+27
| | | | | | |
| * | | | | | Pica: Add tc0.w to OutputVertexJannik Vogel2016-05-111-1/+2
| | | | | | |
| * | | | | | Pica: Add texture type to stateJannik Vogel2016-05-111-0/+10
| | | | | | |
* | | | | | | Merge pull request #1780 from JayFoxRox/shadersetup-classbunnei2016-05-125-58/+59
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Turn ShaderSetup into a class
| * | | | | | Turn ShaderSetup into structJannik Vogel2016-05-115-58/+59
|/ / / / / /
* | | | | | Merge pull request #1621 from JayFoxRox/w-bufferbunnei2016-05-116-14/+65
|\ \ \ \ \ \ | | | | | | | | | | | | | | Implement W-buffer and fix depth-mapping
| * | | | | | OpenGL: Implement W-Buffers and fix depth-mappingJannik Vogel2016-05-103-4/+23
| | | | | | |
| * | | | | | Pica: Implement W-Buffer in SW rasterizerJannik Vogel2016-05-104-11/+43
| | | | | | |
* | | | | | | Merge pull request #1774 from lioncash/warnbunnei2016-05-101-3/+3
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | gdbstub: Silence missing prototype warnings
| * | | | | | | gdbstub: Silence missing prototype warningsLioncash2016-05-101-3/+3
| |/ / / / / /
* | | | | | | Merge pull request #1773 from lioncash/debug-buildMat M2016-05-101-1/+1
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | gl_rasterizer: Fix compilation for debug builds
| * | | | | | gl_rasterizer: Fix compilation for debug buildsLioncash2016-05-101-1/+1
|/ / / / / /
* | | | | | Merge pull request #1704 from JayFoxRox/pod-configlinkmauve2016-05-103-122/+164
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: PicaShaderConfig is TC and cleared before use
| * | | | | | Pica: Use a union for PicaShaderConfigJannik Vogel2016-05-033-125/+139
| | | | | | |
| * | | | | | Pica: Add TevStageConfigRaw to PicaShaderConfig (MSVC workaround)Jannik Vogel2016-05-032-2/+23
| | | | | | |
| * | | | | | Pica: Make PicaShaderConfig trivially_copyable and clear it before useJannik Vogel2016-05-031-21/+28
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1771 from lioncash/userbunnei2016-05-101-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | dyncom: Reset the context into user mode correctly
| * | | | | | dyncom: Reset the context into user mode correctlyLioncash2016-05-091-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | The other mode was system mode.
* | | | | | | Merge pull request #1770 from lioncash/formatbunnei2016-05-091-2/+2
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | source: Fix missing logging arguments
| * | | | | | source: Fix missing logging argumentsLioncash2016-05-091-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | Silences two warnings on OSX.
* | | | | | Merge pull request #1768 from lioncash/swapbunnei2016-05-091-46/+22
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | Swap: Minor changes
| * | | | | swap: Get rid of pointer casting for swapping structsLioncash2016-05-091-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | These shouldn't haphazardly convert types
| * | | | | swap: Get rid of undefined behavior in swapf and swapdLioncash2016-05-091-14/+18
| | | | | | | | | | | | | | | | | | | | | | | | This isn't well-defined in C++.
| * | | | | swap: Remove unused methodsLioncash2016-05-091-28/+0
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also gets rid of pointer data variants as this prevents the use of the regular swapping routines as unary predicates in std lib functions. They also cast to stricter alignment types, which is undefined behavior.
* | | | | Merge pull request #1766 from Subv/log_cpubunnei2016-05-083-0/+10
|\ \ \ \ \ | | | | | | | | | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1)
| * | | | | Kernel/Threading: Warn when a thread can be scheduled in the Syscore (Core 1).Subv2016-05-073-0/+10
| | |/ / / | |/| | | | | | | | | | | | | We do not currently implement any cores other than the AppCore (Core 0).
* | | | | Merge pull request #1718 from alex-laties/fixup-type-conversionsbunnei2016-05-0714-45/+55
|\ \ \ \ \ | | | | | | | | | | | | fixup simple type conversions where possible
| * | | | | fixup simple type conversions where possibleAlexander Laties2016-05-0714-45/+55
| | | | | |
* | | | | | Merge pull request #1761 from Subv/applets_fbbunnei2016-05-075-23/+44
|\ \ \ \ \ \ | |/ / / / / |/| | | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory
| * | | | | HLE/Applets: Use the correct size for the framebuffer SharedMemory in the swkbd and MiiSelector applets.Subv2016-05-075-23/+44
| | |/ / / | |/| | |
* | | | | Merge pull request #1736 from MerryMage/sdl2-sinkbunnei2016-05-079-3/+182
|\ \ \ \ \ | | | | | | | | | | | | AudioCore: SDL2 Sink
| * | | | | AudioCore: SDL2 SinkMerryMage2016-05-079-3/+182
| | | | | |
* | | | | | HLE: Fix recent DSP change for Visual Studio.bunnei2016-05-071-4/+2
| | | | | |
* | | | | | Merge pull request #1544 from linkmauve/move-glad-initbunnei2016-05-073-6/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | Move glad initialisation to the frontend
| * | | | | | Frontends, VideoCore: Move glad initialisation to the frontendEmmanuel Gil Peyrot2016-05-063-6/+18
| | |_|_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | On SDL2 this allows it to use SDL_GL_GetProcAddress() instead of the default function loader, and fixes a crash when using apitrace with an EGL context. On Qt we will need to migrate from QGLWidget to QOpenGLWidget and QOpenGLContext before we can use gladLoadGLLoader() instead of gladLoadGL(), since the former doesn’t expose a function loader.
* | | | | | Merge pull request #1764 from wwylele/how-can-i-find-this-if-i-have-only-decrypted-rombunnei2016-05-061-2/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | fix loader: return proper result
| * | | | | fix:return proper errorwwylele2016-05-061-2/+3
|/ / / / /
* | | | | Merge pull request #1762 from bunnei/globalbunnei2016-05-064-8/+21
|\ \ \ \ \ | | | | | | | | | | | | hle: Get rid of direct global access to g_reschedule
| * | | | | HLE: Rename RescheduleIsPending to IsReschedulePending.bunnei2016-05-063-3/+3
| | | | | |
| * | | | | hle: Get rid of global access to g_rescheduleLioncash2016-03-214-8/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This shouldn't be directly exposed if there's already a partial API that operates on it. We can just provide the rest of that API.
* | | | | | Merge pull request #1700 from wwylele/gamelist-iconbunnei2016-05-0610-37/+260
|\ \ \ \ \ \ | | | | | | | | | | | | | | Qt: display game icon and title in the game list
| * | | | | | add missing headerwwylele2016-05-041-0/+1
| | | | | | |
| * | | | | | make the name column larger as defaultwwylele2016-05-041-1/+5
| | | | | | |
| * | | | | | add icon & title to game listwwylele2016-05-049-36/+254
| | | | | | |
* | | | | | | Merge pull request #1706 from mailwl/mii-selectorSebastian Valle2016-05-052-0/+49
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Layout Mii parameters input/output, and return success as result of applet work
| * | | | | | | Layout Mii parameters input/output, and return success as result of applet workmailwl2016-05-052-0/+49
|/ / / / / / /
* | | | | | | Merge pull request #1757 from JayFoxRox/rename-vertexloaded-bpbunnei2016-05-054-10/+8
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Pica: Rename VertexLoaded breakpoint to VertexShaderInvocation
| * | | | | | | Pica: Rename VertexLoaded breakpoint to VertexShaderInvocationJannik Vogel2016-05-044-10/+8
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1734 from MerryMage/dsp-hle-sourcebunnei2016-05-047-5/+496
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | DSP/HLE: Implement Source processing
| * | | | | | DSP/HLE: Implement Source processingMerryMage2016-05-037-5/+496
| | |_|/ / / | |/| | | |
* | | | | | Merge pull request #1754 from JayFoxRox/fix-const_color-revertbunnei2016-05-031-2/+3
|\ \ \ \ \ \ | | | | | | | | | | | | | | OpenGL: Don't copy const_color (Reverts #1745)
| * | | | | | OpenGL: Don't copy const_color (Reverts #1745)Jannik Vogel2016-05-031-2/+3
|/ / / / / /
* | | | | | Merge pull request #1750 from JayFoxRox/cleanup-shader-inputbunnei2016-05-031-34/+4
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: Replace logic in shader.cpp with loop
| * | | | | | Pica: Replace logic in shader.cpp with loopJannik Vogel2016-05-031-34/+4
| | | | | | |
* | | | | | | Merge pull request #1732 from wwylele/config00170000bunnei2016-05-032-13/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | add config block 0x00170000; remove duplicated content
| * | | | | | remove duplicated function declarationwwylele2016-05-011-13/+0
| | | | | | |
| * | | | | | add config block 0x00170000wwylele2016-04-291-0/+4
| | | | | | |
* | | | | | | Merge pull request #1741 from linkmauve/iwyu-video_corebunnei2016-05-0146-88/+234
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix video_core includes (and dependencies) using include-what-you-use
| * | | | | | | VideoCore: Run include-what-you-use and fix most includes.Emmanuel Gil Peyrot2016-04-3045-86/+234
| | | | | | | |
| * | | | | | | LCD: Remove unneeded #undef with no matching #define.Emmanuel Gil Peyrot2016-04-301-2/+0
| | | | | | | |
* | | | | | | | Merge pull request #1745 from JayFoxRox/fix-const_colorbunnei2016-05-011-30/+11
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | OpenGL: Copy TevStageConfig using a loop. Fixes bug: const_color not copied
| * | | | | | | | OpenGL: Copy TevStageConfig using a loop. Fixes bug: const_color not copiedJannik Vogel2016-05-011-30/+11
|/ / / / / / / /
* / / / / / / / OpenGL: border_color was never set. Fixed. (#1740)Jannik Vogel2016-04-301-0/+1
|/ / / / / / /
* | | | | | | Merge pull request #1735 from JayFoxRox/remove-tgalinkmauve2016-04-303-62/+0
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Remove TGA dumper
| * | | | | | Remove TGA dumperJannik Vogel2016-04-303-62/+0
| | | | | | |
* | | | | | | Merge pull request #1729 from MerryMage/null-sinkbunnei2016-04-3013-4/+155
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Audio Config: Implement null sink and implement sink configuration
| * | | | | | Audio: Add sink selection to configuration filesMerryMage2016-04-3010-4/+79
| | | | | | |
| * | | | | | AudioCore: List of sink typesMerryMage2016-04-303-0/+46
| | | | | | |
| * | | | | | AudioCore: Implement NullSinkMerryMage2016-04-302-0/+30
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1650 from JamePeng/update-the-ndm-codebunnei2016-04-303-27/+420
|\ \ \ \ \ \ | | | | | | | | | | | | | | Update the stub code of NDM service!
| * | | | | | Update the stub code of NDM service!JamePeng2016-04-203-27/+420
| | | | | | |
* | | | | | | Merge pull request #1647 from mailwl/acu-closeasyncbunnei2016-04-302-1/+29
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | ac:u: stub CloseAsync; align memory size in svc:GetProcessInfo(type=2)
| * | | | | | | ac:u: stub CloseAsync; check memory size aling in svc:GetProcessInfo(type=2)mailwl2016-04-212-1/+29
| | | | | | | |
* | | | | | | | Merge pull request #1699 from mailwl/gpu-rightsbunnei2016-04-301-2/+38
|\ \ \ \ \ \ \ \ | |_|_|/ / / / / |/| | | | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functions
| * | | | | | | return checks if event and memory createdmailwl2016-04-231-1/+8
| | | | | | | |
| * | | | | | | gsp::Gpu: implement AcquireRight, ReleaseRight functionsmailwl2016-04-221-8/+37
| | | | | | | |
* | | | | | | | Merge pull request #1726 from MerryMage/read-write-regionbunnei2016-04-293-26/+31
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | AudioCore: CurrentRegion() -> ReadRegion(), WriteRegion()
| * | | | | | | | AudioCore: CurrentRegion() -> ReadRegion(), WriteRegion()MerryMage2016-04-293-26/+31
| | | | | | | | |
* | | | | | | | | Merge pull request #1723 from MerryMage/audio-interpbunnei2016-04-293-0/+128
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | AudioCore: Implement interpolation
| * | | | | | | | | AudioCore: Implement interpolationMerryMage2016-04-293-0/+128
| | | | | | | | | |
* | | | | | | | | | Merge pull request #1730 from hrydgard/vertex-loaderbunnei2016-04-296-121/+210
|\ \ \ \ \ \ \ \ \ \ | |_|_|_|_|_|/ / / / |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Remove late accesses to attribute_config * Refactor: Extract VertexLoader from command_processor.cpp. Preparation for a similar concept to Dolphin or PPSSPP. These can be JIT-ed and cached. * Move "&" to their proper place, add missing includes and make some properly relative. * Don't keep base_address in the loader, it doesn't belong there (with it, the loader can't be cached). * Optimize the vertex loader, nearly doubling its speed. * Debugger fix * Move and rename the MemoryAccesses class to MemoryAccessTracker.
| * | | | | | | | | Move and rename the MemoryAccesses class to MemoryAccessTracker.Henrik Rydgard2016-04-294-32/+35
| | | | | | | | | |
| * | | | | | | | | Debugger fixHenrik Rydgard2016-04-281-2/+2
| | | | | | | | | |
| * | | | | | | | | Optimize the vertex loader, nearly doubling its speed.Henrik Rydgard2016-04-282-32/+54
| | | | | | | | | |
| * | | | | | | | | Don't keep base_address in the loader, it doesn't belong there (with it, the loader can't be cached).Henrik Rydgard2016-04-283-11/+10
| | | | | | | | | |
| * | | | | | | | | Move "&" to their proper place, add missing includes and make some properly relative.Henrik Rydgard2016-04-282-8/+11
| | | | | | | | | |
| * | | | | | | | | Refactor: Extract VertexLoader from command_processor.cpp.Henrik Rydgard2016-04-285-125/+185
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Preparation for a similar concept to Dolphin or PPSSPP. These can be JIT-ed and cached.
| * | | | | | | | | Remove late accesses to attribute_configHenrik Rydgard2016-04-281-5/+7
| | | | | | | | | |
* | | | | | | | | | Common: Remove section measurement from profiler (#1731)Yuri Kunde Schlesner2016-04-2913-306/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This has been entirely superseded by MicroProfile. The rest of the code can go when a simpler frametime/FPS meter is added to the GUI.
* | | | | | | | | | Make Citra build with MICROPROFILE_ENABLED set to 0 (#1709)Henrik Rydgård2016-04-295-1/+30
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | * Make Citra build with MICROPROFILE_ENABLED set to 0 * Buildfix with microprofile kept on * moc did not like a dialog to conditionally exist. * Cleanup * Fix end of line
* | | | | | | | | | Merge pull request #1727 from MerryMage/minor-commitbunnei2016-04-283-12/+11
|\ \ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | | | AudioCore: Move samples_per_frame and num_sources into hle/common.h
| * | | | | | | | | | AudioCore: Move samples_per_frame and num_sources into hle/common.hMerryMage2016-04-283-12/+11
| | |_|/ / / / / / / | |/| | | | | | | |
* | | | | | | | | | Merge pull request #1722 from MerryMage/soundtouchbunnei2016-04-284-1/+10
|\ \ \ \ \ \ \ \ \ \ | |/ / / / / / / / / |/| | | | | | | | | Externals: Add soundtouch
| * | | | | | | | | Externals: Add soundtouchMerryMage2016-04-284-1/+10
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1708 from MerryMage/dsp_dspbunnei2016-04-276-76/+180
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | DSP Service: Cleanup
| * | | | | | | | | DSP_DSP: Fix log format strings and argumentsMerryMage2016-04-271-12/+20
| | | | | | | | | |
| * | | | | | | | | AudioCore: Hack to prevent regressions: Trigger Binary pipe interrupt every audio frameMerryMage2016-04-271-0/+2
| | | | | | | | | |
| * | | | | | | | | DSP_DSP: Add return IPC headersMerryMage2016-04-272-4/+27
| | | | | | | | | |
| * | | | | | | | | DSP_DSP: Updated interrupt implementationMerryMage2016-04-274-46/+113
| | | | | | | | | |
| * | | | | | | | | DSP/Pipe: There are 8 pipesMerryMage2016-04-252-13/+19
| | | | | | | | | |
| * | | | | | | | | DSP_DSP: Remove unused variableMerryMage2016-04-241-2/+0
| | |/ / / / / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1721 from bunnei/cleanup-pr-1447bunnei2016-04-271-52/+89
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | y2r_u: Cleanup some formatting.
| * | | | | | | | | y2r_u: Cleanup some formatting.bunnei2016-04-271-52/+89
|/ / / / / / / / /
* | | | | | | | | Merge pull request #1447 from JamePeng/update-y2r-servicebunnei2016-04-272-32/+357
|\ \ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | | | Update the code of service y2r!
| * | | | | | | | | Update the code of service y2r!JamePeng2016-04-202-32/+357
| | |_|_|_|/ / / / | |/| | | | | | |
* | | | | | | | | Merge pull request #1720 from linkmauve/fix-qtlinkmauve2016-04-261-1/+1
|\ \ \ \ \ \ \ \ \ | |_|_|/ / / / / / |/| | | | | | | | Qt Frontend: Add Threads::Threads import in CMakeLists.txt
| * | | | | | | | Qt Frontend: Add Threads::Threads import in CMakeLists.txt.Emmanuel Gil Peyrot2016-04-261-1/+1
|/ / / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This had been forgotten in df81fa11fc8972a5775a57ccde1e0ef8d7fbfe64. Fixes #1711.
* | | | | | | | Merge pull request #1710 from hrydgard/optimize-event-breakpointsbunnei2016-04-263-9/+16
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Replace std::map with std::array for graphics event breakpoints
| * | | | | | | | Replace std::map with std::array for graphics event breakpoints, and allow the compiler to inline. Saves 1%+ in vertex heavy situations.Henrik Rydgard2016-04-243-9/+16
| | |/ / / / / / | |/| | | | | |
* | | | | | | | Merge pull request #1714 from smspillaz/fix-1711bunnei2016-04-256-10/+15
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Fixes for #1711 and other compilation errors.
| * | | | | | | travis: Install cmake 3.1Sam Spilsbury2016-04-251-2/+3
| | | | | | | |
| * | | | | | | shader: Shader size is long uint, not uint.Sam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | shader: Handle non-CALL opcodes with a breakSam Spilsbury2016-04-241-0/+2
| | | | | | | |
| * | | | | | | shader: Format string must be provided inline and not as a variableSam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | am: title_id is long long uintSam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | assert: Allow UNREACHABLE_MSG to have just one argumentSam Spilsbury2016-04-241-1/+1
| | | | | | | |
| * | | | | | | CMakeLists: Use imported version of Threads::ThreadsSam Spilsbury2016-04-242-4/+6
|/ / / / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This requires bumping up to a minimum of CMake 3.1. The benefit of using the imported target is that you can switch to the -pthread compiler flag on request, which may be necessary for some systems if available.
* | | | | | | Merge pull request #1576 from smspillaz/fix-build-errors-03272016bunnei2016-04-249-9/+29
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Fix various build errors encountered on Clang 3.9 on OS X
| * | | | | | | assert: Add _MSG variations for UNREACHABLE and UNIMPLEMENTEDSam Spilsbury2016-04-231-0/+2
| | | | | | | |
| * | | | | | | pica: Handle default lighting caseSam Spilsbury2016-04-231-1/+6
| | | | | | | |
| * | | | | | | ncch: Use correct format specifier (for long long uint)Sam Spilsbury2016-04-231-1/+1
| | | | | | | |
| * | | | | | | fs: Fix what appears to be a typo (filename_size / file_size)Sam Spilsbury2016-04-231-1/+1
| | | | | | | |
| * | | | | | | gdbstub: Don't check if unsigned int is > 0Sam Spilsbury2016-04-231-2/+2
| | | | | | | |
| * | | | | | | debugger: Warn if we reach an unreachable formatSam Spilsbury2016-04-231-0/+6
| | | | | | | |
| * | | | | | | microprofileui: Use correct printf specifierSam Spilsbury2016-04-231-0/+5
| | | | | | | |
| * | | | | | | microprofile: Use std::absSam Spilsbury2016-04-231-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using the global-namespace C function will cause the wrong overload to get picked
| * | | | | | | CMakeLists: Use CMAKE_THREAD_LIBS_INITSam Spilsbury2016-04-232-3/+5
| | |/ / / / / | |/| | | | |
* | | | | | | Merge pull request #1705 from LittleWhite-tb/compat_gcc49bunnei2016-04-231-0/+4
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Protect use of std::is_trivially_copyable to compile with GCC 4.9
| * | | | | | Protect use of std::is_trivially_copyable to compile with GCC 4.9LittleWhite2016-04-231-0/+4
|/ / / / / /
* | | | | | Merge pull request #1697 from tfarley/hw-lighting-syncbunnei2016-04-222-9/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | HWRasterizer: Lighting Sync + Cleanup
| * | | | | | HWRasterizer: reorder declarations to match defstfarley2016-04-221-9/+9
| | | | | | |
| * | | | | | HWRasterizer: sync specular uniform for new shaderstfarley2016-04-221-0/+2
|/ / / / / /
* | | | | | Merge pull request #1436 from tfarley/hw-tex-forwardingbunnei2016-04-2230-941/+1739
|\ \ \ \ \ \ | | | | | | | | | | | | | | Hardware Renderer Texture Forwarding
| * | | | | | HWRasterizer: Texture forwardingtfarley2016-04-2120-940/+1719
| | | | | | |
| * | | | | | Config: Add scaled resolution optiontfarley2016-04-219-1/+20
| | | | | | |
| * | | | | | Update to ext-boost with interval_maptfarley2016-04-211-0/+0
| | |/ / / / | |/| | | |
* | | | | | Merge pull request #1655 from JayFoxRox/hw-dot3bunnei2016-04-211-0/+3
|\ \ \ \ \ \ | |/ / / / / |/| | | | | OpenGL: Implement color combiner Operation::Dot3_RGB
| * | | | | OpenGL: Implement color combiner Operation::Dot3_RGBJannik Vogel2016-04-101-0/+3
| | | | | |
* | | | | | Merge pull request #1691 from linkmauve/improve-sdl-optionsbunnei2016-04-201-9/+20
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | SDL2 Frontend: Use argv[0], add a --version, and reorder options
| * | | | | SDL2 Frontend: Use argv[0], add a --version, and reorder options.Emmanuel Gil Peyrot2016-04-201-9/+20
|/ / / / /
* | | | | Merge pull request #1672 from wwylele/win-driver-fixbunnei2016-04-191-3/+12
|\ \ \ \ \ | | | | | | | | | | | | Fix driver root identification on Windows
| * | | | | fix driver root identification on Windowswwylele2016-04-151-3/+12
| | | | | |
* | | | | | Merge pull request #1612 from ObsidianX/get-set-sockoptbunnei2016-04-191-3/+97
|\ \ \ \ \ \ | | | | | | | | | | | | | | SOC:U GetSockOpt/SetSockOpt
| * | | | | | Rework sockopt translation to match the error translation code already in placeRyan Loebs2016-04-021-22/+30
| | | | | | |
| * | | | | | Code styleRyan Loebs2016-03-301-2/+2
| | | | | | |
| * | | | | | Added GetSockOptNameRyan Loebs2016-03-301-15/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Filter out and translate invalid sockopt names.
| * | | | | | Derp: win32: typedef int socklen_t;Ryan Loebs2016-03-291-4/+0
| | | | | | |
| * | | | | | But of course, Windows uses 'int' while Linux uses 'socklen_t'Ryan Loebs2016-03-291-0/+4
| | | | | | |
| * | | | | | Compiling on Windows nowRyan Loebs2016-03-291-3/+3
| | | | | | |
| * | | | | | Formatting...Ryan Loebs2016-03-291-1/+1
| | | | | | |
| * | | | | | Addressing PR commentsRyan Loebs2016-03-291-4/+4
| | | | | | |
| * | | | | | SOC UpdatesRyan Loebs2016-03-291-3/+46
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | -Implement GetSockOpt / SetSockOpt -Fix bug in RecvFrom where sending from localhost does not fill in src_addr/src_addr_len on Linux
* | | | | | | Merge pull request #1625 from JayFoxRox/sw-blend-funcbunnei2016-04-181-57/+42
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | Rasterizer: Allow all blend factors for alpha blend-func
| * | | | | | Rasterizer: Allow all blend factors for alpha blend-funcJannik Vogel2016-04-171-57/+42
| | | | | | |
* | | | | | | Merge pull request #1685 from lioncash/hdrbunnei2016-04-163-14/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | core: Clean out some unnecessary header includes
| * | | | | | | core: Clean out some unnecessary header includesLioncash2016-04-163-14/+1
|/ / / / / / /
* | | | | | | Merge pull request #1667 from wwylele/ncch-loader-fixbunnei2016-04-151-2/+2
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | loader: only decompress code section
| * | | | | | | ncch:only decompress .code sectionwwylele2016-04-141-2/+2
| | |_|/ / / / | |/| | | | |
* | | | | | | Merge pull request #1673 from MerryMage/config-minimumSizebunnei2016-04-151-12/+0
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Configure Dialog: Remove minimumSize property
| * | | | | | | Configure Dialog: Remove minimumSize propertyMerryMage2016-04-151-12/+0
| |/ / / / / /
* | | | | | | Merge pull request #1671 from lioncash/memMathew Maidment2016-04-151-1/+1
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | debug_utils: use std::make_unique for initializing PicaTrace
| * | | | | | | debug_utils: use std::make_unique for initializing PicaTraceLioncash2016-04-151-1/+1
| | | | | | | |
* | | | | | | | Y2R: num_tiles should be allowed when its value is 128 (#1669)JamePeng2016-04-151-1/+1
| | | | | | | |
* | | | | | | | Merge pull request #1666 from MerryMage/barrierbunnei2016-04-151-24/+22
|\ \ \ \ \ \ \ \ | |/ / / / / / / |/| | | | | | | Thread: Correct Common::Barrier implementation
| * | | | | | | Thread: Make Barrier reusableMerryMage2016-04-141-5/+5
| | | | | | | |
| * | | | | | | common/thread: Correct code styleMerryMage2016-04-141-21/+19
| |/ / / / / /
* | | | | | | Merge pull request #1665 from lioncash/filebunnei2016-04-143-48/+38
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | IOFile: Minor API changes
| * | | | | | | file_util: In-class initialize data membersLioncash2016-04-142-6/+4
| | | | | | | |
| * | | | | | | file_util: const qualify IOFile's Tell and GetSize functionsLioncash2016-04-142-8/+8
| | | | | | | |
| * | | | | | | file_util: Don't expose IOFile internals through the APILioncash2016-04-143-31/+20
| | | | | | | |
| * | | | | | | file_util: Check for is_trivially_copyableLioncash2016-04-141-3/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also applies the template checks to ReadArray as well.
| * | | | | | | file_util: Make IOFile data members privateLioncash2016-04-141-0/+1
| |/ / / / / /
* | | | | | | Merge pull request #1546 from bunnei/refactor-shader-jitbunnei2016-04-147-161/+270
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Shader JIT Part 2
| * | | | | | shader_jit_x64: Rename RuntimeAssert to Compile_Assert.bunnei2016-04-142-5/+5
| | | | | | |
| * | | | | | shader_jit_x64.cpp: Rename JitCompiler to JitShader.bunnei2016-04-143-92/+92
| | | | | | |
| * | | | | | shader_jit_x64: Free memory that's no longer needed after compilation.bunnei2016-04-141-0/+6
| | | | | | |
| * | | | | | shader_jit_x64: Use a sorted vector instead of a set for keeping track of return addresses.bunnei2016-04-142-5/+8
| | | | | | |
| * | | | | | shader_jit_x64: Use CALL/RET instead of JMP for subroutines.bunnei2016-04-141-17/+7
| | | | | | |
| * | | | | | emitter: Add CALL that can be fixed up.bunnei2016-04-142-0/+13
| | | | | | |
| * | | | | | shader_jit_x64: Separate initialization and code generation for readability.bunnei2016-04-141-9/+8
| | | | | | |
| * | | | | | shader_jit_x64: Get rid of unnecessary last_program_counter variable.bunnei2016-04-142-6/+2
| | | | | | |
| * | | | | | shader_jit_x64: Execute certain asserts at runtime.bunnei2016-04-142-5/+19
| | | | | | | | | | | | | | | | | | | | | | | | | | | | - This is because we compile the full shader code space, and therefore its common to compile malformed instructions.
| * | | | | | shader: Remove unused 'state' argument from 'Setup' function.bunnei2016-04-143-5/+4
| | | | | | |
| * | | | | | shader_jit_x64: Specify shader main offset at runtime.bunnei2016-04-143-10/+6
| | | | | | |
| * | | | | | shader_jit_x64: Allocate each program independently and persist for emu session.bunnei2016-04-143-38/+28
| | | | | | |
| * | | | | | shader_jit_x64: Rewrite flow control to support arbitrary CALL and JMP instructions.bunnei2016-04-142-35/+119
| | | | | | |
| * | | | | | shader_jit_x64: Fix strict memory aliasing issues.bunnei2016-04-141-1/+3
| | | | | | |
| * | | | | | emitter: Support arbitrary FixupBranch targets.bunnei2016-04-142-0/+17
|/ / / / / /
* | | | | | Merge pull request #1660 from MerryMage/file_utilbunnei2016-04-121-6/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | FileUtil: Missing #include, Add const to IOFile methods
| * | | | | | FileUtil: Missing #include, Add const to IOFile methodsMerryMage2016-04-121-6/+7
|/ / / / / /
* | | | | | Merge pull request #1613 from mailwl/anpbunnei2016-04-112-2/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | Set Kernel config "Hardware Inited" to 1 (true)
| * | | | | | Set Kernel config "Unknown Value" to 0x1mailwl2016-04-112-2/+7
| |/ / / / /
* | | | | | Merge pull request #1659 from JayFoxRox/apply-configYuri Kunde Schlesner2016-04-117-17/+23
|\ \ \ \ \ \ | |/ / / / / |/| | | | | CitraQt: Apply config at startup
| * | | | | Use Settings::Apply in SDL frontendJannik Vogel2016-04-111-5/+4
| | | | | |
| * | | | | CitraQt: Apply config at startupJannik Vogel2016-04-116-12/+19
|/ / / / /
* | | | | Merge pull request #1657 from JayFoxRox/remove-dump-geometryYuri Kunde Schlesner2016-04-114-71/+0
|\ \ \ \ \ | | | | | | | | | | | | Pica: Remove geometry dumper (PICA_DUMP_GEOMETRY)
| * | | | | Pica: Remove geometry dumper (PICA_DUMP_GEOMETRY)Jannik Vogel2016-04-104-71/+0
| | |/ / / | |/| | |
* | | | | Merge pull request #1368 from LittleWhite-tb/configure-widgetbunnei2016-04-1121-262/+807
|\ \ \ \ \ | |/ / / / |/| | | | Implementation for a configure widget
| * | | | Add more stuff to configure.LittleWhite2016-03-2215-120/+211
| | | | |
| * | | | Whole config is handled by Config class.LittleWhite2016-03-218-118/+181
| | | | | | | | | | | | | | | | | | | | This also means : we have only one config file, now
| * | | | Add Configure widgetLittleWhite2016-03-2118-142/+533
| | | | |
* | | | | Merge pull request #1653 from mailwl/blx-lrMathew Maidment2016-04-091-2/+3
|\ \ \ \ \ | | | | | | | | | | | | Fix BLX LR opcode interpretation
| * | | | | Fix BLX LR opcode interpretationmailwl2016-04-091-2/+3
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1624 from JayFoxRox/buffer-allow-writebunnei2016-04-094-12/+78
|\ \ \ \ \ | |/ / / / |/| | | | Implement buffer-write allow registers
| * | | | OpenGL: Respect buffer-write allow registersJannik Vogel2016-04-081-6/+28
| | | | |
| * | | | OpenGL: Split buffer-write mask sync into seperate functionsJannik Vogel2016-04-082-8/+39
| | | | |
| * | | | Rasterizer: Respect buffer-write allow registersJannik Vogel2016-04-082-4/+16
| | | | |
| * | | | OpenGL: Keep stencil-test and framebuffer.depth_format in syncJannik Vogel2016-04-081-0/+1
| | | | |
* | | | | Merge pull request #1644 from polaris-/gdb-fixesbunnei2016-04-082-28/+107
|\ \ \ \ \ | | | | | | | | | | | | Adopted WinterMute's gdbstub changes
| * | | | | Default to settings from ini for gdbstubpolaris-2016-04-071-6/+6
| | | | | |
| * | | | | Adopted WinterMute's gdbstub changespolaris-2016-04-062-27/+106
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This fixes the comments left on the PR (whitespace, SO_REUSEADDR, comment changes).
* | | | | | update the code of AM service! (#1623)JamePeng2016-04-086-51/+289
| | | | | |
* | | | | | cecd:u: stub GetCecStateAbbreviated (#1648)mailwl2016-04-084-1/+29
| |/ / / / |/| | | |
* | | | | Merge pull request #1651 from mailwl/thread-init-thumbMathew Maidment2016-04-081-1/+1
|\ \ \ \ \ | | | | | | | | | | | | Update cpsr (T)humb bit while creating thread
| * | | | | Update cpsr (T)humb bit while creating threadmailwl2016-04-081-1/+1
|/ / / / /
* | | | | Merge pull request #1639 from linkmauve/fix-double-framebuffer-checkbunnei2016-04-081-4/+6
|\ \ \ \ \ | | | | | | | | | | | | OpenGL: Fix a double framebuffer completeness checks.
| * | | | | OpenGL: Fix a double framebuffer completeness checks.Emmanuel Gil Peyrot2016-04-031-4/+6
| | | | | |
* | | | | | Merge pull request #1577 from JamePeng/update-apta-funcbunnei2016-04-075-8/+47
|\ \ \ \ \ \ | | | | | | | | | | | | | | Append the missing function name"GetAppletInfo", "SetAppCpuTimeLimit" and "GetAppCpuTimeLimit" to APT:A
| * | | | | | append SetAppCpuTimeLimit and GetAppCpuTimeLimit to APT:AJamePeng2016-04-063-13/+16
| | | | | | |
| * | | | | | implement APT::GetStartupArgumentJamePeng2016-04-045-2/+37
| | | | | | |
| * | | | | | Append the missing function name"GetAppletInfo" to APT:AJamePeng2016-04-041-1/+2
| | | | | | |
* | | | | | | Merge pull request #1645 from mailwl/thumb_pcMathew Maidment2016-04-061-6/+2
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Fix thumb ADR instruction alignment
| * | | | | | Fix thumb ADR instruction alignmentmailwl2016-04-061-6/+2
|/ / / / / /
* | | | | | Merge pull request #1435 from mailwl/frd_ubunnei2016-04-066-55/+236
|\ \ \ \ \ \ | | | | | | | | | | | | | | frd:u: Initial stub some functions
| * | | | | | frd:u: Initial stub some functionsmailwl2016-03-276-55/+236
| | | | | | |
* | | | | | | Merge pull request #1643 from MerryMage/make_uniqueMathew Maidment2016-04-0624-73/+46
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Common: Remove Common::make_unique, use std::make_unique
| * | | | | | | Common: Remove Common::make_unique, use std::make_uniqueMerryMage2016-04-0524-73/+46
| | |_|_|_|_|/ | |/| | | | |
* | | | | | | Merge pull request #1620 from LFsWang/pathbunnei2016-04-056-33/+50
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | Fix filename&path encode problem on Windows
| * | | | | | remove debug codeLFsWang2016-03-312-2/+2
| | | | | | |
| * | | | | | fix unicode url problem on windowsLFsWang2016-03-311-6/+18
| | | | | | |
| * | | | | | Fix encode problem On WindowsLFsWang2016-03-315-27/+32
| | | | | | |
* | | | | | | Merge pull request #1640 from lioncash/cpp14Yuri Kunde Schlesner2016-04-034-7/+7
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | CMakeFiles: Compile as C++14
| * | | | | | | travis: Update dependenciesLioncash2016-04-033-6/+6
| | | | | | | |
| * | | | | | | CMakeFiles: Compile as C++14Lioncash2016-04-031-1/+1
| | |_|_|/ / / | |/| | | | |
* | | | | | | Merge pull request #1638 from JayFoxRox/check-fb-completelinkmauve2016-04-031-0/+3
|\| | | | | | | | | | | | | | | | | | | | OpenGL: Check for framebuffer completeness
| * | | | | | OpenGL: Check for framebuffer completenessJannik Vogel2016-04-031-0/+3
|/ / / / / /
* | | | | | Merge pull request #1616 from exhalatio/dlp_dummybunnei2016-04-036-0/+65
|\ \ \ \ \ \ | | | | | | | | | | | | | | Dummy implementation dlp:SRVR Service.
| * | | | | | Dummy implementation dlp:SRVR Service.exhalatio2016-04-026-0/+65
| | | | | | |
* | | | | | | Merge pull request #1619 from mailwl/cecdbunnei2016-04-025-3/+56
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandle
| * | | | | | | cecd:u: stub GetCecInfoEventHandle, GetChangeStateEventHandlemailwl2016-03-315-3/+56
| | | | | | | |
* | | | | | | | Merge pull request #1390 from purpasmart96/citra_gsp_error_codesbunnei2016-04-013-80/+97
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | GSP: Return proper error codes for register writes
| * | | | | | | | GSP: Return proper error codes for register writespurpasmart962016-03-313-80/+97
| |/ / / / / / /
* | | | | | | | Merge pull request #1622 from JayFoxRox/fix-warningsMathew Maidment2016-04-011-6/+6
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Avoid warnings by casting to size_t for ARRAY_SIZE() comparisons
| * | | | | | | | Avoid warnings by casting to size_t for ARRAY_SIZE() comparisonsJannik Vogel2016-04-011-6/+6
|/ / / / / / / /
* | | | | | | | Merge pull request #1618 from MerryMage/one-stepMathew Maidment2016-03-311-26/+57
|\ \ \ \ \ \ \ \ | | | | | | | | | | | | | | | | | | Prevent cache overflow when single stepping
| * | | | | | | | DynCom: Optimize single steppingMerryMage2016-03-301-26/+57
| | |_|_|/ / / / | |/| | | | | |
* | | | | | | | Merge pull request #1419 from mailwl/branch-gspbunnei2016-03-311-6/+41
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueue
| * | | | | | | Add gsp functions: SetAxiConfigQoSMode, UnregisterInterruptRelayQueuemailwl2016-03-311-6/+41
| | | | | | | |
* | | | | | | | Merge pull request #1572 from MerryMage/audio-filterbunnei2016-03-315-7/+275
|\ \ \ \ \ \ \ \ | |_|_|_|/ / / / |/| | | | | | | DSP: Implement audio filters (simple, biquad)
| * | | | | | | DSP: Implement audio filters (simple, biquad)MerryMage2016-03-285-7/+275
| | | | | | | |
* | | | | | | | Merge pull request #1611 from ObsidianX/cfg-common-fixbunnei2016-03-293-0/+21
|\ \ \ \ \ \ \ \ | |_|_|_|_|_|_|/ |/| | | | | | | Add common methods to all cfg:* ports
| * | | | | | | Add common methods to all cfg:* portsRyan Loebs2016-03-293-0/+21
|/ / / / / / /
* | | | | | | Merge pull request #1589 from LittleWhite-tb/compil-fixbunnei2016-03-281-1/+1
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | Compilation fix
| * | | | | | Compilation fixLittleWhite2016-03-281-1/+1
|/ / / / / /
* | | | | | Merge pull request #1541 from LFsWang/pathbunnei2016-03-282-3/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | Fix Qt string encode problem on Windows
| * | | | | Fix Qt chinese words encode problem on WindowsLFsWang2016-03-172-3/+3
| | | | | |
* | | | | | Merge pull request #1573 from wwylele/input_fixbunnei2016-03-262-11/+11
|\ \ \ \ \ \ | | | | | | | | | | | | | | Remove unnecessary const & replace pointer with reference
| * | | | | | use reference instead of pointerwwylele2016-03-261-9/+9
| | | | | | |
| * | | | | | remove unnecessary constwwylele2016-03-261-2/+2
|/ / / / / /
* | | | | | Merge pull request #1549 from wwylele/acc_gyrobunnei2016-03-265-23/+235
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | hid: implement accelerometer and gyroscope back-end
| * | | | | implement GyroscopeCalibrateParamwwylele2016-03-252-9/+20
| | | | | |
| * | | | | implement accel and gyro backendwwylele2016-03-225-23/+224
| | | | | |
* | | | | | Merge pull request #1566 from MerryMage/audio-codecbunnei2016-03-243-0/+174
|\ \ \ \ \ \ | | |_|/ / / | |/| | | | DSP: Implement audio codecs (PCM8, PCM16, ADPCM)
| * | | | | DSP: Implement audio codecs (PCM8, PCM16, ADPCM)MerryMage2016-03-243-0/+174
| | |_|/ / | |/| | |
* | | | | Merge pull request #1461 from yuriks/imm-mode2Yuri Kunde Schlesner2016-03-246-29/+59
|\ \ \ \ \ | | | | | | | | | | | | Immediate-mode improvements
| * | | | | Pica: Improve accuracy of immediate-mode supportYuri Kunde Schlesner2016-03-245-29/+56
| | | | | | | | | | | | | | | | | | | | | | | | This partially fixes Etrian Odyssey IV.
| * | | | | OpenGL: Don't attempt to draw empty triangle batchesYuri Kunde Schlesner2016-03-241-0/+3
|/ / / / / | | | | | | | | | | | | | | | | | | | | Our code did not handle this well, causing random crashes in some situations.
* | | | | Merge pull request #1517 from Lectem/fixSDLcmakebunnei2016-03-231-1/+7
|\ \ \ \ \ | | | | | | | | | | | | fix SDL2 detection for Visual
| * | | | | fix SDL2 detection for VisualLectem2016-03-141-1/+7
| | | | | |
* | | | | | Merge pull request #1508 from JayFoxRox/vs-output-mapbunnei2016-03-222-7/+19
|\ \ \ \ \ \ | | | | | | | | | | | | | | Respect vs output map
| * | | | | | Respect vs output mapJannik Vogel2016-03-142-7/+19
| |/ / / / /
* | | | | | Merge pull request #1560 from lioncash/savedatabunnei2016-03-221-1/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | archive_extsavedata: Fix member initialization order
| * | | | | | archive_extsavedata: Fix member initialization orderLioncash2016-03-211-1/+2
| | |/ / / / | |/| | | | | | | | | | | | | | | | shared appears in the initializer list before mount_point
* | | | | | Merge pull request #1563 from lioncash/lolfiqbunnei2016-03-221-4/+3
|\ \ \ \ \ \ | |_|_|_|_|/ |/| | | | | armstate: Correct FIQ register banking
| * | | | | armstate: Correct FIQ register bankingLioncash2016-03-211-4/+3
| |/ / / / | | | | | | | | | | | | | | | FIQ has seven banked registers (R8 to R14), not two.
* | | | | Merge pull request #1559 from lioncash/vecbunnei2016-03-211-8/+5
|\ \ \ \ \ | | | | | | | | | | | | soc_u: Get rid of explicit delete and new
| * | | | | soc_u: Get rid of explicit delete and newLioncash2016-03-211-8/+5
| |/ / / /
* | | | | Merge pull request #1562 from lioncash/constexprbunnei2016-03-212-7/+7
|\ \ \ \ \ | |/ / / / |/| | | | core: Mark some helper functions as constexpr
| * | | | session: Make helper functions constexprLioncash2016-03-211-6/+6
| | | | |
| * | | | loader: Make MakeMagic constexprLioncash2016-03-211-1/+1
|/ / / /
* | | | Merge pull request #1302 from Subv/save_fixbunnei2016-03-2024-143/+400
|\ \ \ \ | | | | | | | | | | HLE/FS: Fixed many corner cases in our file handling
| * | | | HLE/FS: Change the error code returned when an ExtSaveData archive is not found.Subv2016-03-205-33/+45
| | | | | | | | | | | | | | | | | | | | This allows Fire Emblem to boot again.
| * | | | HLE/FS: Corrected some style concerns.Subv2016-03-208-14/+12
| | | | |
| * | | | HLE/FS: Fixed creating the config savefile when it doesn't exist.Subv2016-03-201-1/+1
| | | | | | | | | | | | | | | | | | | | This fixes a regression.
| * | | | HLE/FS: Implemented GetFormatInfoSubv2016-03-2019-62/+257
| | | | | | | | | | | | | | | | | | | | Format information is currently only implemented for the ExtSaveData, SharedExtSaveData and SaveData archives, the information is stored in a file alongside the root folder of the archive.
| * | | | HLE/FS: Don't return an error when deleting the ExtSaveData if it does not exist.Subv2016-03-201-1/+1
| | | | |
| * | | | HLE/FS: Return the proper error codes when opening files.Subv2016-03-207-28/+43
| | | | |
| * | | | HLE/FS: Fixed the OpenDirectory error codeSubv2016-03-201-1/+1
| | | | |
| * | | | HLE/FS: Return the proper error codes on file Read/Write operations.Subv2016-03-207-18/+40
| | | | | | | | | | | | | | | | | | | | These operations are limited by the open flags specified while opening the file.
| * | | | HLE/FS: Corrected the error codes for DeleteFileSubv2016-03-206-12/+22
| | | | |
| * | | | HLE/FS: Corrected the error codes for CreateFileSubv2016-03-202-2/+7
| | | | |
| * | | | HLE/FS: FS::CreateFile takes an u64 for the file size.Subv2016-03-208-10/+10
| | | | |
* | | | | Merge pull request #1550 from LittleWhite-tb/gdbstub_include_fixbunnei2016-03-201-0/+2
|\ \ \ \ \ | |/ / / / |/| | | | Fix missing header
| * | | | Fix missing headerLittleWhite2016-03-201-0/+2
|/ / / /
* | | | Merge pull request #1538 from lioncash/dotbunnei2016-03-201-5/+3
|\ \ \ \ | | | | | | | | | | shader_interpreter: use std::inner_product for the dot product
| * | | | shader_interpreter: use std::inner_product for the dot productLioncash2016-03-171-5/+3
| | | | | | | | | | | | | | | | | | | | Same thing, less code.
* | | | | Merge pull request #1522 from MerryMage/dylibbundlerbunnei2016-03-192-1/+4
|\ \ \ \ \ | |_|_|/ / |/| | | | OS X: Use dylibbundler to include dylibs required by citra in nightly build
| * | | | OS X: Use dylibbundler to include dylibs required by citra in nightly archiveMerryMage2016-03-152-1/+4
| | | | |
* | | | | Merge pull request #1543 from lioncash/zerobunnei2016-03-181-1/+4
|\ \ \ \ \ | | | | | | | | | | | | vector_math: Add missing member in Vec4's SetZero function
| * | | | | vector_math: Add missing member in Vec4's SetZero functionLioncash2016-03-181-1/+4
| | | | | |
* | | | | | Merge pull request #1505 from pippo2931/fefbunnei2016-03-181-1/+25
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GetArchiveResource stub
| * | | | | Fix headerpippo29312016-03-121-1/+1
| | | | | |
| * | | | | GetArchiveResource stubpippo29312016-03-121-1/+25
| | | | | |
* | | | | | Merge pull request #1535 from JayFoxRox/fix-alignbunnei2016-03-181-6/+6
|\ \ \ \ \ \ | | | | | | | | | | | | | | PICA: Alignment happens locally in vertex
| * | | | | | PICA: Alignment happens locally in vertexJannik Vogel2016-03-171-6/+6
| | | | | | |
* | | | | | | Merge pull request #1539 from lioncash/constbunnei2016-03-173-18/+19
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | video_core: Don't cast away const
| * | | | | | video_core: Don't cast away constLioncash2016-03-173-18/+19
| | |_|_|/ / | |/| | | |
* | | | | | Merge pull request #1466 from LittleWhite-tb/gamelist-update-recentYuri Kunde Schlesner2016-03-172-5/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Register ROM started through the gamelist in the list of ROM recently started
| * | | | | Register ROM started through the gamelist in the list of ROM recently startedLittleWhite2016-03-162-5/+4
| | | | | |
* | | | | | Merge pull request #1537 from lioncash/constYuri Kunde Schlesner2016-03-173-12/+12
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | core/video_core: Minor const-related changes
| * | | | | core/video_core: Make NumIds functions constexprLioncash2016-03-173-3/+3
| | | | | |
| * | | | | core/video_core: Don't cast away const in subscript operatorsLioncash2016-03-173-9/+9
|/ / / / / | | | | | | | | | | | | | | | Not to say these subscript operators aren't totally ugly as is.
* | | | | Merge pull request #1519 from JayFoxRox/vp-offset-fixbunnei2016-03-161-2/+2
|\ \ \ \ \ | | | | | | | | | | | | PICA: Fix viewport offset
| * | | | | PICA: Fix viewport offsetJannik Vogel2016-03-141-2/+2
| | |_|_|/ | |/| | |
* | | | | Merge pull request #1503 from bunnei/clear-jit-cachebunnei2016-03-163-7/+27
|\ \ \ \ \ | | | | | | | | | | | | Clear JIT cache
| * | | | | shader_jit_x64: Clear cache after code space fills up.bunnei2016-03-123-2/+19
| | | | | |
| * | | | | shader_jit_x64: Make assert outputs more useful & cleanup formatting.bunnei2016-03-121-4/+7
| | | | | |
| * | | | | shader: Update log message to use proper log class.bunnei2016-03-121-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #1479 from JayFoxRox/mad-encodingbunnei2016-03-164-31/+43
|\ \ \ \ \ | | | | | | | | | | | | Fix MAD/MADI encoding
| * | | | | PICA: Fix MAD/MADI encodingJannik Vogel2016-03-153-31/+43
| | | | | |
| * | | | | Update nihstro to latest masterJannik Vogel2016-03-151-0/+0
| | | | | |
* | | | | | Merge pull request #1526 from bunnei/sdl-rgb8bunnei2016-03-151-0/+4
|\ \ \ \ \ \ | |/ / / / / |/| | | | | SDL2: Explicitly use RGB8 color buffer.
| * | | | | SDL2: Explicitly use RGB8 color buffer.bunnei2016-03-151-0/+4
| | | | | |
* | | | | | Merge pull request #1528 from MerryMage/citra-shutdownlinkmauve2016-03-151-8/+6
|\ \ \ \ \ \ | |/ / / / / |/| | | | | citra: Shutdown cleanly if ROM load fails
| * | | | | citra: Shutdown cleanly if ROM load failsMerryMage2016-03-151-8/+6
|/ / / / /
* | | | | Merge pull request #1409 from JamePeng/Reorganize-NDMbunnei2016-03-148-26/+124
|\ \ \ \ \ | |_|/ / / |/| | | | Reorganize the ndm service path for implement dummy function
| * | | | Reorganize the ndm service path for dummy implement functionJamePeng2016-03-148-26/+124
|/ / / / | | | | | | | | | | | | | | | | | | | | SuspendDaemons , ResumeDaemons , OverrideDefaultDaemons The NDM file move to /core/hle/service/ndm/ now!
* | | | Merge pull request #1509 from lioncash/noncopybunnei2016-03-131-3/+3
|\ \ \ \ | | | | | | | | | | common: Minor changes to NonCopyable
| * | | | common_types: Make NonCopyable constructor constexprLioncash2016-03-131-1/+1
| | | | |
| * | | | common_types: Specify const in deleted copy constructor/assignment operatorLioncash2016-03-131-2/+2
| |/ / /
* | | | Merge pull request #1510 from wwylele/fix_padYuri Kunde Schlesner2016-03-131-1/+1
|\ \ \ \ | |_|/ / |/| | | hid: fix pad update
| * | | hid: fix pad updatewwylele2016-03-131-1/+1
|/ / /
* | | Merge pull request #1496 from JayFoxRox/align-attribsYuri Kunde Schlesner2016-03-133-1/+28
|\ \ \ | | | | | | | | Align attribute components
| * | | PICA: Align vertex attributesJannik Vogel2016-03-133-1/+28
|/ / /
* | | Merge pull request #1506 from lioncash/enumYuri Kunde Schlesner2016-03-1315-39/+30
|\ \ \ | |/ / |/| | svc: Minor enum changes
| * | svc: Move ResetType enum to the kernel event headerLioncash2016-03-1310-16/+17
| | |
| * | svc: Remove unused ArbitrationType enumLioncash2016-03-121-9/+0
| | | | | | | | | | | | An equivalent enum already exists within address_arbiter.h
| * | svc: Make ResetType an enum classLioncash2016-03-1211-24/+23
|/ /
* | Merge pull request #1266 from Subv/miiappletbunnei2016-03-127-2/+156
|\ \ | | | | | | HLE/Applets: Implemented a dummy Mii Selector applet.
| * | HLE/Applets: Implemented a dummy Mii Selector applet.Subv2016-03-127-2/+156
| | | | | | | | | | | | This prevents some games (like Super Mario 3D Land) from freezing when trying to launch it, however, it's not complete and won't let you go past Mii selection as the parameter structure hasn't been reverse engineered yet.
* | | Merge pull request #1500 from lioncash/nullptrbunnei2016-03-121-1/+1
|\ \ \ | | | | | | | | gsp_gpu: Change 0 literal to nullptr
| * | | gsp_gpu: Change 0 literal to nullptrLioncash2016-03-121-1/+1
| | | |
* | | | Merge pull request #1499 from lioncash/servicesbunnei2016-03-124-1/+16
|\ \ \ \ | |/ / / |/| | | hle: Update service function tables
| * | | hle: Update service function tablesLioncash2016-03-124-1/+16
|/ / /
* | | Merge pull request #1476 from lioncash/emitbunnei2016-03-101-59/+54
|\ \ \ | | | | | | | | emitter: constexpr/misc changes
| * | | emitter: templatize ImmPtrLioncash2016-03-091-2/+6
| | | |
| * | | emitter: constexpr-ify helper functionsLioncash2016-03-091-19/+17
| | | |
| * | | emitter: Get rid of CanDoOpWithLioncash2016-03-091-7/+0
| | | | | | | | | | | | | | | | | | | | This was removed in Dolphin as there were no particular uses for it. I'm sure the same will apply to citra.
| * | | emitter: constexpr-ify OpArgLioncash2016-03-091-30/+30
| | | |
| * | | emitter: friend class OpArg with XEmitterLioncash2016-03-091-3/+4
| | | |
| * | | emitter: Remove unimplemented prototypeLioncash2016-03-091-1/+0
| | | |
* | | | Merge pull request #1475 from lioncash/alignYuri Kunde Schlesner2016-03-102-13/+5
|\ \ \ \ | | | | | | | | | | Common: Get rid of alignment macros
| * | | | Common: Get rid of alignment macrosLioncash2016-03-092-13/+5
| |/ / / | | | | | | | | | | | | | | | | The gl rasterizer already uses alignas, so we may as well move everything over.
* | | | Merge pull request #1478 from JayFoxRox/masterYuri Kunde Schlesner2016-03-101-2/+2
|\ \ \ \ | | | | | | | | | | Fix attribute mapping in vs debugger
| * | | | Fix attribute mapping in vs debuggerJannik Vogel2016-03-091-2/+2
| | |_|/ | |/| |
* | | | Merge pull request #1482 from LittleWhite-tb/mac-opengl-checkMathew Maidment2016-03-091-0/+2
|\ \ \ \ | | | | | | | | | | Fix missing return
| * | | | Fix missing returnLittleWhite2016-03-091-0/+2
|/ / / /
* | | | Merge pull request #1474 from lioncash/rendererbunnei2016-03-096-25/+25
|\ \ \ \ | |/ / / |/| | | renderer_base: Minor changes
| * | | renderer_base: In-class initialize variablesLioncash2016-03-091-5/+2
| | | |
| * | | render_base: Clarify/normalize getter functionsLioncash2016-03-091-2/+2
| | | |
| * | | renderer_base: Don't directly expose the rasterizer unique_ptrLioncash2016-03-096-18/+21
| |/ / | | | | | | | | | | | | There's no reason to allow direct access to the unique_ptr instance. Only its contained pointer.
* | | Merge pull request #1344 from LittleWhite-tb/error-outputbunnei2016-03-0912-24/+95
|\ \ \ | |/ / |/| | Output errors in GUI
| * | Improve error report from Init() functionsLittleWhite2016-03-0812-27/+72
| | | | | | | | | | | | Add error popup when citra initialization failed
| * | Display errors in GUI when loading ROM failedLittleWhite2016-03-032-3/+29
| | |
* | | Merge pull request #1441 from MerryMage/dsp-pipesbunnei2016-03-084-77/+345
|\ \ \ | | | | | | | | AudioCore: Implement Pipe 2
| * | | DSP: Implement Pipe 2MerryMage2016-03-064-77/+345
| | | | | | | | | | | | | | | | | | | | | | | | Pipe 2 is a DSP pipe that is used to initialize both the DSP hardware (the application signals to the DSP to initialize) and the application (the DSP provides the memory location of structures in the shared memory region).
* | | | Merge pull request #1467 from LittleWhite-tb/bug-shader-objectbunnei2016-03-081-0/+4
|\ \ \ \ | | | | | | | | | | Set the appropriate locale to get float conversion working using to_string
| * | | | Set the appropriate locale to get float conversion working using std::to_stringLittleWhite2016-03-071-0/+4
| |/ / /
* | | | Merge pull request #1462 from yuriks/depth-test-writebunnei2016-03-062-10/+12
|\ \ \ \ | |/ / / |/| | | Pica: Write depth value even when depth test is disabled
| * | | Pica: Write depth value even when depth test is disabledYuri Kunde Schlesner2016-03-062-10/+12
| | | | | | | | | | | | | | | | This has been confirmed on hardware. Fixes Etrian Odyssey IV.
* | | | Merge pull request #1463 from yuriks/non-app-regionYuri Kunde Schlesner2016-03-063-3/+6
|\ \ \ \ | | | | | | | | | | Memory: Do correct Phys->Virt address translation for non-APP linheap
| * | | | Memory: Do correct Phys->Virt address translation for non-APP linheapYuri Kunde Schlesner2016-03-063-3/+6
|/ / / /
* | | | Merge pull request #1455 from yuriks/ResultVal-unionMathew Maidment2016-03-061-42/+16
|\ \ \ \ | |/ / / |/| | | core: Use unrestricted union to hold storage of ResultVal value
| * | | core: Use unrestricted union to hold storage of ResultVal valueYuri Kunde Schlesner2016-03-051-42/+16
| | | |
* | | | Merge pull request #1459 from MerryMage/dsp-firmware-hashMathew Maidment2016-03-061-8/+21
|\ \ \ \ | | | | | | | | | | DSP: Print hash of firmware to console
| * | | | DSP: Print hash of firmware to consoleMerryMage2016-03-061-8/+21
|/ / / /
* | | | Merge pull request #1454 from yuriks/log-program-idYuri Kunde Schlesner2016-03-051-1/+2
|\ \ \ \ | |/ / / |/| | | Loader/NCCH: Log the program ID during loading
| * | | Loader/NCCH: Log the program ID during loadingYuri Kunde Schlesner2016-03-051-1/+2
|/ / / | | | | | | | | | | | | This is useful for all sorts of things, but mainly to identify save folders more easily.
* | | Merge pull request #1429 from mailwl/branch-acubunnei2016-03-051-2/+17
|\ \ \ | | | | | | | | ac:u IsConnected implemented
| * | | ac:u: Stub IsConnectedmailwl2016-03-041-2/+17
| | | |
* | | | Merge pull request #1389 from yuriks/stub-cambunnei2016-03-043-20/+563
|\ \ \ \ | |/ / / |/| | | Stub CAM:U service
| * | | Service/CAM: Add doxycomments to all service functionsYuri Kunde Schlesner2016-03-011-0/+217
| | | |
| * | | Service/CAM: Dummy implementation of some functionsYuri Kunde Schlesner2016-02-133-20/+346
| | | | | | | | | | | | | | | | Thanks to @mailwl for the initial version of the stubs.
* | | | Merge pull request #1448 from bunnei/remove-glfwbunnei2016-03-0415-3718/+0
|\ \ \ \ | |_|/ / |/| | | externals: Remove unused GLFW library from the repo.
| * | | externals: Remove unused GLFW library from the repo.bunnei2016-03-0415-3718/+0
|/ / /
* | | Merge pull request #1446 from vitorsilverio/patch-2Mathew Maidment2016-03-031-3/+3
|\ \ \ | | | | | | | | Update Building Links
| * | | Update Building LinksVitor2016-03-031-3/+3
|/ / / | | | | | | Links on README.md don't exist.
* | | Merge pull request #1394 from ds84182/immediate-mode-vtxbunnei2016-03-0321-61/+177
|\ \ \ | | | | | | | | Add immediate mode vertex submission
| * | | Add immediate mode vertex submissionDwayne Slater2016-03-0321-61/+177
| | | |
* | | | Merge pull request #1403 from MerryMage/sdlbunnei2016-03-0317-314/+559
|\ \ \ \ | |/ / / |/| | | Dependencies: Remove GLFW, Add SDL2
| * | | Config: Use unique_ptr instead of raw pointerMerryMage2016-03-022-14/+12
| | | |
| * | | Dependencies: Remove GLFW, Add SDL2MerryMage2016-03-0217-304/+551
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | citra: Remove GLFW, Add SDL2 FindSDL2: Do not CACHE SDL2_* variables if library is not found EmuWindow_SDL2: Set minimal client area at initialisation time EmuWindow_SDL2: Corrections EmuWindow_SDL2: Fix no decorations on startup on OS X cmake: windows_copy_files
* | | | Merge pull request #1434 from Kloen/legendbunnei2016-03-021-0/+1
|\ \ \ \ | | | | | | | | | | Add THREADPROCESSORID_ALL on SVC::CreateThread
| * | | | ThreadProcessorId_All on SVC::CreateThreadKloen2016-03-011-0/+1
| | | | |
* | | | | Merge pull request #1297 from Subv/savesbunnei2016-03-012-3/+5
|\ \ \ \ \ | | | | | | | | | | | | DiskDirectory: Initialize the directory member with valid info.
| * | | | | DiskDirectory: Initialize the directory member with valid info.Subv2016-01-162-3/+5
| | | | | |
* | | | | | Merge pull request #1433 from yuriks/config-000A0000bunnei2016-03-011-3/+17
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | Service/CFG: Add block 0x000A0000 (username) to default config file
| * | | | | Service/CFG: Fix potential endianess issueYuri Kunde Schlesner2016-03-011-2/+3
| | | | | |
| * | | | | Service/CFG: Add block 0x000A0000 (username) to default config fileYuri Kunde Schlesner2016-03-011-1/+14
|/ / / / /
* | | | | Merge pull request #1427 from MerryMage/emit-lbitYuri Kunde Schlesner2016-02-281-2/+2
|\ \ \ \ \ | | | | | | | | | | | | x64 Emitter: Fix L bit in VEX prefix
| * | | | | x64 Emitter: Fix L bit in VEX prefixMerryMage2016-02-271-2/+2
| | |/ / / | |/| | |
* | | | | Merge pull request #1418 from mailwl/branch-irbunnei2016-02-265-18/+144
|\ \ \ \ \ | | | | | | | | | | | | Initial implementation ir:user
| * | | | | Initial implementation ir:usermailwl2016-02-265-18/+144
|/ / / / /
* | | | | Merge pull request #1352 from LittleWhite-tb/exit_checkbunnei2016-02-262-0/+26
|\ \ \ \ \ | |/ / / / |/| | | | Add check before closure when emulation is running
| * | | | Add a configuration entry to enable/disable the checkLittleWhite2016-02-042-9/+10
| | | | |
| * | | | Add check before closure when emulation is runningLittleWhite2016-02-042-0/+25
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Implement confirmation in a specific function Fix typos and coding style Coding convention
* | | | | Merge pull request #1424 from MerryMage/lut_initbunnei2016-02-261-0/+4
|\ \ \ \ \ | | | | | | | | | | | | renderer_opengl: Initalise fragment shader LUT textures
| * | | | | renderer_opengl: Initalise fragment shader LUT texturesMerryMage2016-02-261-0/+4
| | | | | |
* | | | | | Merge pull request #1386 from MerryMage/audio-core-skeletonbunnei2016-02-2619-69/+873
|\ \ \ \ \ \ | | | | | | | | | | | | | | Audio Core: Skeleton
| * | | | | | AudioCore: Skeleton ImplementationMerryMage2016-02-2119-69/+873
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit: * Adds a new subproject, audio_core. * Defines structures that exist in DSP shared memory. * Hooks up various other parts of the emulator into audio core. This sets the foundation for a later HLE DSP implementation.
* | | | | | Merge pull request #1422 from vgturtle127/patch-1bunnei2016-02-251-0/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Add website to README. Be proud of it!
| * | | | | | Add website to README. Be proud of it!Derek "Turtle" Roe2016-02-251-0/+2
|/ / / / / /
* | | | | | Merge pull request #1395 from ds84182/padding-attributesbunnei2016-02-251-7/+17
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Add support for padding vertex attributes
| * | | | | Fix out of bounds array access when loading a component >= 12Dwayne Slater2016-02-211-1/+4
| | | | | |
| * | | | | Add support for padding vertex attributesDwayne Slater2016-02-211-6/+13
| | | | | |
* | | | | | Merge pull request #1406 from MerryMage/bitfield2bunnei2016-02-1412-60/+56
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | BitField: Make trivially copyable and remove assignment operator.
| * | | | | BitField: Make trivially copyable and remove assignment operatorMerryMage2016-02-1212-60/+56
|/ / / / /
* | | | | Merge pull request #1264 from bunnei/fragment-lighting-hwbunnei2016-02-0615-160/+1167
|\ \ \ \ \ | |/ / / / |/| | | | Fragment lighting support in the HW renderer
| * | | | pica: Cleanup lighting register definitions and documentation.bunnei2016-02-052-48/+51
| | | | |
| * | | | gl_rasterizer: Use alignas(16) instead of explicit padding.bunnei2016-02-051-13/+6
| | | | |
| * | | | renderer_opengl: Use GLvec3/GLvec4 aliases for commonly used types.bunnei2016-02-054-14/+18
| | | | |
| * | | | gl_rasterizer: Fix issue with interpolation of opposite quaternions.bunnei2016-02-052-4/+32
| | | | |
| * | | | pica_types: Fix typo in docstring.bunnei2016-02-051-1/+1
| | | | |
| * | | | pica_types: Replace float24/20/16 with a template class.bunnei2016-02-055-116/+82
| | | | |
| * | | | command_processor: Add an assertion to ensure LUTs are not written past their boundaries.bunnei2016-02-051-0/+3
| | | | |
| * | | | gl_rasterizer: Remove unnecessary casts.bunnei2016-02-051-6/+6
| | | | |
| * | | | gl_rasterizer: Fix PicaShaderConfig on GCC.bunnei2016-02-051-29/+27
| | | | |
| * | | | gl_rasterizer: Initial implementation of bump mapping.bunnei2016-02-053-5/+42
| | | | |
| * | | | gl_shader_gen: Fix bug in LUT range (should within range [0, 255] not [0, 256]).bunnei2016-02-051-3/+3
| | | | |
| * | | | gl_shader_gen: Implement lighting red, green, and blue reflection.bunnei2016-02-053-21/+77
| | | | |
| * | | | gl_shader_gen: View should be normalized.bunnei2016-02-051-2/+2
| | | | |
| * | | | gl_shader_gen: Implement fragment lighting fresnel effect.bunnei2016-02-053-9/+38
| | | | |
| * | | | gl_shader_gen: Implement fragment lighting specular 1 component.bunnei2016-02-053-11/+41
| | | | |
| * | | | gl_shader_gen: Add support for D0 LUT scaling.bunnei2016-02-053-3/+71
| | | | |
| * | | | gl_shader_gen: Refactor lighting config to match Pica register naming.bunnei2016-02-053-42/+50
| | | | | | | | | | | | | | | | | | | | - Also implement D0 LUT enable.
| * | | | pica: Cleanup and add some comments to lighting registers.bunnei2016-02-052-19/+19
| | | | |
| * | | | gl_rasterizer: Minor naming refactor on Pica register naming.bunnei2016-02-052-20/+23
| | | | |
| * | | | gl_shader_gen: Reorganize and cleanup lighting code.bunnei2016-02-051-100/+107
| | | | | | | | | | | | | | | | | | | | - No functional difference.
| * | | | gl_shader_gen: Fix directional lights.bunnei2016-02-051-1/+1
| | | | |
| * | | | gl_shader_gen: Fix bug with lighting where clamp highlights was only applied to last light.bunnei2016-02-051-6/+6
| | | | |
| * | | | gl_shader_gen: View vector needs to be normalized when computing half angle vector.bunnei2016-02-051-3/+4
| | | | |
| * | | | renderer_opengl: Use textures for fragment shader LUTs instead of UBOs.bunnei2016-02-055-27/+64
| | | | | | | | | | | | | | | | | | | | | | | | | - Gets us LUT interpolation for free. - Some older Intel GPU drivers did not support the big UBOs needed to store the LUTs.
| * | | | renderer_opengl: Initial implementation of basic specular lighting.bunnei2016-02-054-13/+165
| | | | |
| * | | | renderer_opengl: Implement HW fragment lighting distance attenuation.bunnei2016-02-052-17/+38
| | | | |
| * | | | renderer_opengl: Implement HW fragment lighting LUTs within our default UBO.bunnei2016-02-054-16/+67
| | | | |
| * | | | renderer_opengl: Implement diffuse component of HW fragment lighting.bunnei2016-02-056-15/+270
| | | | |
| * | | | pica: Implement decoding of basic fragment lighting components.bunnei2016-02-055-15/+120
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | - Diffuse - Distance attenuation - float16/float20 types - Vertex Shader 'view' output
| * | | | pica: Implement fragment lighting LUTs.bunnei2016-02-052-0/+34
| | | | |
| * | | | pica: Add decodings for distance attenuation and LUT registers.bunnei2016-02-051-1/+104
| | | | |
| * | | | pica: Add pica_types module and move float24 definition.bunnei2016-02-053-112/+127
|/ / / /
* | | | Merge pull request #1391 from tfarley/hw-fb-sync-fixbunnei2016-02-052-42/+34
|\ \ \ \ | | | | | | | | | | hwrasterizer: Use proper cached framebuffer addr/size
| * | | | hwrasterizer: Use proper cached fb addr/sizetfarley2016-02-032-42/+34
| |/ / /
* | | | Merge pull request #1392 from lioncash/moveYuri Kunde Schlesner2016-02-051-18/+2
|\ \ \ \ | |/ / / |/| | | backend: defaulted move constructor/assignment
| * | | backend: defaulted move constructor/assignmentLioncash2016-02-051-18/+2
|/ / /
* | | Merge pull request #1387 from lioncash/funcbunnei2016-02-0369-137/+43
|\ \ \ | | | | | | | | services: minor changes
| * | | services: Get rid of unnecessary includesLioncash2016-02-0269-132/+32
| | | |
| * | | services: Update function tablesLioncash2016-02-022-5/+11
| | | |
* | | | Merge pull request #1388 from yuriks/spammy-opengl-debugMathew Maidment2016-02-031-2/+0
|\ \ \ \ | |/ / / |/| | | OpenGL: Downgrade GL_DEBUG_SEVERITY_NOTIFICATION to Debug logging level
| * | | OpenGL: Downgrade GL_DEBUG_SEVERITY_NOTIFICATION to Debug logging levelYuri Kunde Schlesner2016-02-031-2/+0
|/ / / | | | | | | | | | | | | | | | The nVidia driver is *extremely* spammy on this category, sending a message on every buffer or texture upload, slowing down the emulator and making the log useless.
* | | Merge pull request #1377 from MerryMage/mmiobunnei2016-01-316-13/+127
|\ \ \ | | | | | | | | Memory: Implemented MMIO
| * | | Memory: Implement MMIOMerryMage2016-01-306-13/+127
| | | |
* | | | Merge pull request #1379 from lioncash/colorbunnei2016-01-281-8/+8
|\ \ \ \ | | | | | | | | | | color: Make trivial helpers constexpr
| * | | | color: Make trivial helpers constexprLioncash2016-01-281-8/+8
|/ / / /
* | | | Merge pull request #1367 from yuriks/jit-jmpbunnei2016-01-272-6/+6
|\ \ \ \ | | | | | | | | | | Shader JIT: Fix off-by-one error when compiling JMPs
| * | | | Shader JIT: Fix off-by-one error when compiling JMPsYuri Kunde Schlesner2016-01-242-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | There was a mistake in the JMP code which meant that one instruction at the destination would be skipped when the jump was taken. This commit also changes the meaning of the culprit parameter to make it less confusing and avoid similar mistakes in the future.
* | | | | Merge pull request #1369 from yuriks/jmpu-invertedbunnei2016-01-262-2/+5
|\ \ \ \ \ | | | | | | | | | | | | Shader: Implement "invert condition" feature of IFU instruction
| * | | | | Shader: Implement "invert condition" feature of IFU instructionYuri Kunde Schlesner2016-01-252-2/+5
| |/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | If the bit 0 of the JMPU instruction is set, then the jump condition will be inverted. That is, a jump will happen when the boolean is false instead of when it is true.
* | | | | Merge pull request #1370 from yuriks/gpureg-namesbunnei2016-01-251-57/+465
|\ \ \ \ \ | | | | | | | | | | | | Debugger: Use 3dbrew names for GPU registers
| * | | | | Debugger: Use 3dbrew names for GPU registersYuri Kunde Schlesner2016-01-251-57/+465
| |/ / / / | | | | | | | | | | | | | | | | | | | | This list was imported from the 3dbrew wiki page and is pretty much complete.
* | | | | Merge pull request #1373 from lioncash/castYuri Kunde Schlesner2016-01-251-3/+3
|\ \ \ \ \ | | | | | | | | | | | | elf: Don't cast away const
| * | | | | elf: Don't cast away constLioncash2016-01-251-3/+3
| | | | | |
* | | | | | Merge pull request #1372 from lioncash/tieYuri Kunde Schlesner2016-01-251-7/+7
|\ \ \ \ \ \ | |/ / / / / |/| | | | | key_map: Use std::tie for comparisons
| * | | | | key_map: Use std::tie for comparisonsLioncash2016-01-251-7/+7
| |/ / / /
* | | | | Merge pull request #1371 from lioncash/returnYuri Kunde Schlesner2016-01-252-8/+8
|\ \ \ \ \ | |/ / / / |/| | | | archive_backend: Remove unnecessary const from return types
| * | | | archive_backend: Remove unnecessary const from return typesLioncash2016-01-252-8/+8
|/ / / / | | | | | | | | | | | | This doesn't return by reference so const isn't really necessary
* | | | Merge pull request #1334 from tfarley/hw-depth-modifiersbunnei2016-01-213-2/+24
|\ \ \ \ | | | | | | | | | | hwrasterizer: Use depth offset
| * | | | hwrasterizer: Use depth offsettfarley2016-01-213-2/+24
| | | | |
* | | | | Merge pull request #1363 from robturn/masterMathew Maidment2016-01-191-9/+9
|\ \ \ \ \ | |_|/ / / |/| | | | DisassembleMemHalf: actually use width in determining opcode name
| * | | | ARM_Disasm::DisassembleMemHalf: actually use width in determining opcode namerob turner2016-01-191-9/+9
|/ / / /
* | | | Merge pull request #1360 from lioncash/varMathew Maidment2016-01-171-2/+1
|\ \ \ \ | |_|/ / |/| | | command_processor: Get rid of variable shadowing
| * | | command_processor: Get rid of variable shadowingLioncash2016-01-171-2/+1
|/ / /
* | | Update README.mdYuri Kunde Schlesner2016-01-161-0/+2
| | |
* | | Update CONTRIBUTING.mdYuri Kunde Schlesner2016-01-161-0/+8
|/ /
* | Merge pull request #1327 from Subv/unmap_memblockbunnei2016-01-155-5/+60
|\ \ | | | | | | HLE/SVC: Implement UnmapMemoryBlock.
| * | HLE/SVC: Implement UnmapMemoryBlock.Subv2016-01-145-5/+60
| | | | | | | | | | | | This implementation will need to be (almost completely) changed when we implement multiprocess support.
* | | Merge pull request #1196 from linkmauve/khr_debugbunnei2016-01-133-384/+648
|\ \ \ | | | | | | | | Add optional GL_KHR_debug support
| * | | OpenGL: Log GL_KHR_debug messages we receiveEmmanuel Gil Peyrot2015-10-241-0/+57
| | | | | | | | | | | | | | | | | | | | This allows the driver to communicate errors, warnings and improvement suggestions about our usage of the API.
| * | | Externals: Regenerate GLAD with GL_KHR_debug support.Emmanuel Gil Peyrot2015-10-172-384/+591
| | | |
* | | | Change default gameListRootDir from "" to "."archshift2016-01-071-1/+1
| | | | | | | | | | | | Not much thought went into that one...
* | | | Merge pull request #1283 from Subv/soc_fixupbunnei2016-01-051-3/+13
|\ \ \ \ | | | | | | | | | | HLE/Sockets: Fixed the buffer offset in recvfrom.
| * | | | HLE/Sockets: Fixed the buffer offset in recvfrom.Subv2015-12-241-3/+13
| | | | | | | | | | | | | | | | | | | | Closes #1277
* | | | | Merge pull request #1339 from archshift/cmake-2015archshift2016-01-051-1/+3
|\ \ \ \ \ | | | | | | | | | | | | Update appveyor.yml to use VS2015 CMake generator
| * | | | | Update appveyor.yml to use VS2015 CMake generatorarchshift2016-01-041-1/+3
| | | | | |
* | | | | | Merge pull request #1330 from archshift/add-defaultsbunnei2016-01-031-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Gamelist: supply default settings for QSettings config
| * | | | | | Gamelist: supply default settings for QSettings configarchshift2016-01-011-1/+1
| |/ / / / /
* | | | | | Merge pull request #1310 from lioncash/servicesbunnei2015-12-3125-113/+369
|\ \ \ \ \ \ | | | | | | | | | | | | | | services: Update some function tables
| * | | | | | services: Update some function tablesLioncash2015-12-3025-113/+369
| | | | | | |
* | | | | | | Merge pull request #1316 from lioncash/decodebunnei2015-12-312-206/+202
|\ \ \ \ \ \ \ | |_|_|_|_|/ / |/| | | | | | arm_dyncom_dec: Fix decoding of VMLS
| * | | | | | arm_dyncom_dec: Fix decoding of VMLSLioncash2015-12-302-206/+202
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Previously, all VMLS variants would misdecode as CDP (which isn't necessarily wrong in itself, however VMLS has it's own label of execution)
* | | | | | Merge pull request #1309 from lioncash/renderbunnei2015-12-302-6/+10
|\ \ \ \ \ \ | |/ / / / / |/| | | | | video_core: Make the renderer global a unique_ptr
| * | | | | video_core: Make the renderer global a unique_ptrLioncash2015-12-302-6/+10
|/ / / / /
* | | | | Merge pull request #1306 from Subv/syncbunnei2015-12-301-3/+3
|\ \ \ \ \ | | | | | | | | | | | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered
| * | | | | HLE/Timers: Reset OneShot timers when they are acquired instead of when they're triggered.Subv2015-12-301-3/+3
| | | | | | | | | | | | | | | | | | | | | | | | Closes #1139
* | | | | | Merge pull request #1303 from lioncash/uniquebunnei2015-12-304-20/+20
|\ \ \ \ \ \ | |_|/ / / / |/| | | | | core: Use unique_ptr for holding the interpreter instances
| * | | | | core: Use unique_ptr for holding the interpreter instancesLioncash2015-12-304-20/+20
| |/ / / /
* | | | | Merge pull request #1305 from lioncash/overridebunnei2015-12-301-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | swrasterizer: Add missing override specifier
| * | | | swrasterizer: Add missing override specifierLioncash2015-12-301-1/+1
|/ / / /
* | | | Merge pull request #1300 from Subv/arbitrateaddressbunnei2015-12-292-9/+18
|\ \ \ \ | | | | | | | | | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.
| * | | | SVC: Fixed ArbitrateAddress to behave as it does on hardware.Subv2015-12-282-9/+18
| | | | | | | | | | | | | | | | | | | | This was verified with hwtests that i plan to upload later on.
* | | | | Merge pull request #1301 from lioncash/mrc-apsrMathew Maidment2015-12-281-12/+9
|\ \ \ \ \ | | | | | | | | | | | | dyncom: Handle modifying the APSR via an MRC instruction
| * | | | | dyncom: Handle modifying the APSR via an MRC instructionLioncash2015-12-281-12/+9
|/ / / / /
* | | | | Merge pull request #1296 from lioncash/warnbunnei2015-12-271-1/+1
|\ \ \ \ \ | | | | | | | | | | | | svc: Remove superfluous printf argument
| * | | | | svc: Remove superfluous printf argumentLioncash2015-12-251-1/+1
| |/ / / /
* | | | | Merge pull request #1290 from LFsWang/masterbunnei2015-12-271-4/+14
|\ \ \ \ \ | |/ / / / |/| | | | Add a return value in ForeachDirectoryEntry
| * | | | Add missing return values in ForeachDirectoryEntryLFsWang2015-12-231-4/+14
| | | | | | | | | | | | | | | | | | | | | | | | | ForeachDirectoryEntry is changed by #1256 ,but return value at last line was missing.
* | | | | Merge pull request #1287 from lioncash/memoryMathew Maidment2015-12-231-97/+29
|\ \ \ \ \ | |/ / / / |/| | | | dyncom: Minor changes
| * | | | dyncom: Remove PC dispatch from several instructionsLioncash2015-12-211-94/+0
| | | | | | | | | | | | | | | | | | | | These instructions aren't capable of using the PC as a destination
| * | | | dyncom: Handle unprivileged load/store variants correctlyLioncash2015-12-201-7/+33
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | LDRT/LDRBT/STRBT/STRT should simulate the load or store as if the host CPU is in user mode. STRT is also allowed to use the PC as an operand
* | | | | Merge pull request #1289 from yuriks/reset-rasterizerYuri Kunde Schlesner2015-12-211-0/+1
|\ \ \ \ \ | |/ / / / |/| | | | VideoCore: Sync state after changing rasterizers
| * | | | VideoCore: Sync state after changing rasterizersYuri Kunde Schlesner2015-12-211-0/+1
|/ / / / | | | | | | | | | | | | | | | | This fixes various bugs that appear in the HW rasterizer after switching between it and the SW one during emulation.
* | | | Merge pull request #1281 from lioncash/compileYuri Kunde Schlesner2015-12-131-1/+1
|\ \ \ \ | |/ / / |/| | | svc: Fix compilation with LOG_TRACE enabled
| * | | svc: Fix compilation with LOG_TRACE enabledLioncash2015-12-131-1/+1
|/ / /
* | | Merge pull request #1267 from yuriks/flipped-framebufferYuri Kunde Schlesner2015-12-104-12/+17
|\ \ \ | | | | | | | | OpenGL: Flip framebuffers during transfer rather than when rendering
| * | | OpenGL: Flip framebuffers during transfer rather than when renderingYuri Kunde Schlesner2015-12-052-12/+11
| | | |
| * | | OpenGL: Add support for glFrontFace in the state trackerYuri Kunde Schlesner2015-12-052-0/+6
| | | |
* | | | Merge pull request #1269 from Subv/triangle_fanbunnei2015-12-081-5/+4
|\ \ \ \ | | | | | | | | | | GPU/PrimitiveAssembler: Fixed drawing triangle fans.
| * | | | GPU/PrimitiveAssembler: Fixed drawing triangle fans.Subv2015-12-061-5/+4
| | |_|/ | |/| | | | | | | | | | It was skipping the second vertex assignment and using uninitialized garbage when assembling the corresponding triangle.
* | | | Merge pull request #1272 from yuriks/merge-rasterizerYuri Kunde Schlesner2015-12-0818-101/+138
|\ \ \ \ | | | | | | | | | | VideoCore: Unify interface to OpenGL and SW rasterizers
| * | | | VideoCore: Unify interface to OpenGL and SW rasterizersYuri Kunde Schlesner2015-12-0816-78/+116
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This removes explicit checks sprinkled all over the codebase to instead just have the SW rasterizer expose an implementation with no-ops for most operations.
| * | | | VideoCore: Rename HWRasterizer methods to be less confusingYuri Kunde Schlesner2015-12-077-22/+22
| | | | |
| * | | | OpenGL: Rename cache functions to better match what they actually doYuri Kunde Schlesner2015-12-073-12/+11
| | |/ / | |/| |
* | | | Merge pull request #1271 from lioncash/dyncom-miscbunnei2015-12-075-28/+23
|\ \ \ \ | |/ / / |/| | | dyncom: Miscellaneous minor changes
| * | | dyncom: Remove static keyword from header functionsLioncash2015-12-063-19/+19
| | | |
| * | | arm_interface: Make GetNumInstructions constLioncash2015-12-061-1/+1
| | | |
| * | | arm_interface: directly initialize class membersLioncash2015-12-061-7/+2
| | | |
| * | | dyncom: const correctness changesLioncash2015-12-063-7/+7
|/ / /
* | | Merge pull request #1252 from Subv/cambunnei2015-12-043-0/+158
|\ \ \ | |/ / |/| | Services/Cam: Added new log type and camera enums from 3dbrew.
| * | Services/Cam: Added new log type and camera enums from 3dbrew.Subv2015-11-233-0/+158
| | | | | | | | | | | | | | | Followup to #1102 Original author @mailwl
* | | Merge pull request #1261 from yuriks/tev-buffer-delaybunnei2015-12-022-12/+19
|\ \ \ | | | | | | | | PICA: Properly emulate 1-stage delay in the combiner buffer
| * | | PICA: Properly emulate 1-stage delay in the combiner bufferYuri Kunde Schlesner2015-12-012-12/+19
|/ / / | | | | | | | | | | | | | | | | | | | | | | | | This was discovered and verified by @fincs. The tev combiner buffer actually lags behind by one stage, meaning stage 1 reads the initial color, stage 2 reads stage 0's output, and so on. Fixes character portraits in Fire Emblem: Awakening and world textures in Zelda: ALBW. Closes #1140.
* | | Merge pull request #1257 from yuriks/svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
|\ \ \ | | | | | | | | Kernel: Implement svcGetSystemInfo
| * | | Kernel: Implement svcGetSystemInfoYuri Kunde Schlesner2015-12-017-1/+95
|/ / / | | | | | | | | | | | | This makes smealum/ctrulib@b96dd51d3349961189d4ab1bc2a5c45deff21c09 work with Citra.
* | | Merge pull request #1259 from lioncash/zeroMathew Maidment2015-11-291-11/+11
|\ \ \ | | | | | | | | armstate: Zero out the registers on creation
| * | | armstate: Zero out the registers on creationLioncash2015-11-291-11/+11
|/ / / | | | | | | | | | | | | std::array isn't always guaranteed to explicitly zero out it's contents without an initializer list.
* | | Core/ARM11: Correct the size of the VFP register array in the ThreadContext structure.Subv2015-11-291-1/+1
| | | | | | | | | | | | The VFP registers are 64 bits each, and there are 32 of them.
* | | Merge pull request #1225 from lioncash/cleanbunnei2015-11-291-12/+13
|\ \ \ | | | | | | | | csnd_snd: Get rid of type punning
| * | | csnd_snd: Get rid of type punningLioncash2015-10-281-12/+13
| | | |
* | | | Merge pull request #1256 from archshift/refactor-scandirbunnei2015-11-293-57/+62
|\ \ \ \ | | | | | | | | | | Refactor ScanDirectoryTreeAndCallback to separate errors and retvals
| * | | | Refactor ScanDirectoryTreeAndCallback to separate errors and retvalsarchshift2015-11-273-57/+62
|/ / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | ScanDirectoryTreeAndCallback, before this change, coupled error/return codes and actual return values (number of entries found). This caused confusion and difficulty interpreting the precise way the function worked. Supersedes, and closes #1255.
* | | | Merge pull request #1254 from bunnei/fix-gl-uniformsbunnei2015-11-262-6/+8
|\ \ \ \ | | | | | | | | | | renderer_opengl: Fix uniform issues with #1253
| * | | | renderer_opengl: Fix uniform issues introduced with kemenaran/avoid-explicit-uniform-location.bunnei2015-11-262-6/+8
|/ / / /
* | | | Merge pull request #1253 from kemenaran/avoid-explicit-uniform-locationbunnei2015-11-263-15/+5
|\ \ \ \ | | | | | | | | | | Use regular uniform location
| * | | | Use regular uniform locationPierre de La Morinerie2015-11-253-15/+5
|/ / / / | | | | | | | | | | | | | | | | | | | | The support for GL_ARB_explicit_uniform_location is not that good (53% according to http://feedback.wildfiregames.com/report/opengl/feature/GL_ARB_explicit_uniform_location). This fix the shader compilation on Intel HD 4000 (#1222).
* | | | Merge pull request #1248 from polaris-/add-ssl-stubsbunnei2015-11-241-2/+51
|\ \ \ \ | |_|/ / |/| | | Add stub functions for Initialize and GenerateRandomData in ssl:C
| * | | Add stub functions for Initialize and GenerateRandomData in ssl:Cpolaris-2015-11-221-2/+51
| | | |
* | | | Merge pull request #1246 from polaris-/patch-1bunnei2015-11-221-26/+31
|\ \ \ \ | | | | | | | | | | Fix read and write register blocks in gdbstub
| * | | | Fix read and write register blocks in gdbstubpolaris-2015-11-221-26/+31
| | | | | | | | | | | | | | | | | | | | Previously, the padding wasn't correctly accounted for which caused the gdbstub to read and write everything after R15 (starting with the dummy FPA registers) incorrectly, which caused CPSR to not be handled correctly. Everything appears to be working as expected with this change.
* | | | | Merge pull request #1247 from polaris-/add-ssl-stubsbunnei2015-11-221-0/+2
|\ \ \ \ \ | |/ / / / |/| / / / | |/ / / Add Initialize and GenerateRandomData function names to ssl:C
| * / / Add Initialize and GenerateRandomData stubspolaris-2015-11-221-0/+2
|/ / /
* | | Merge pull request #1237 from Subv/ubosbunnei2015-11-196-13/+67
|\ \ \ | | | | | | | | Shaders: Use UBOs instead of individual uniforms in the generated frag shaders
| * | | FragShader: Use an UBO instead of several individual uniformsSubv2015-11-196-13/+67
| | | |
* | | | Merge pull request #1239 from wwylele/silent-vec-warningbunnei2015-11-181-0/+4
|\ \ \ \ | | | | | | | | | | Common: silence Vec warnings on msvc
| * | | | fix failure on gcc and clangwwylele2015-11-121-3/+3
| | | | |
| * | | | disable unary minus when the type is not signedwwylele2015-11-121-0/+4
|/ / / / | | | | | | | | | | | | silent warning C4146 on msvc
* | | | Merge pull request #1238 from citra-emu/neobrain-rttiTony Wasserka2015-11-121-2/+1
|\ \ \ \ | | | | | | | | | | Enable RTTI on Windows builds.
| * | | | Enable RTTI on Windows builds.Tony Wasserka2015-11-121-2/+1
|/ / / /
* | | | Merge pull request #1122 from polaris-/gdbstubbunnei2015-11-1218-9/+1190
|\ \ \ \ | |/ / / |/| | | gdbstub implementation
| * | | Fix bug with reading addresses and lengthspolaris-2015-11-041-45/+55
| | | |
| * | | Change headerspolaris-2015-10-291-2/+2
| | | |
| * | | Add some headers so TravisCI will hopefully workpolaris-2015-10-221-0/+2
| | | |
| * | | Use CHAR_BIT instead of 8polaris-2015-10-221-11/+11
| | | |
| * | | Handle changes pointed out in comments on PRpolaris-2015-10-223-65/+36
| | | |
| * | | Add a register variable to loopspolaris-2015-10-211-6/+9
| | | |
| * | | Update register read loops to go with last commitpolaris-2015-10-211-6/+7
| | | |
| * | | Pad responses to gdb for VFP registerspolaris-2015-10-211-0/+3
| | | |
| * | | Try to add support for VFP registerspolaris-2015-10-211-4/+21
| | | |
| * | | Fix buffer overflow commentspolaris-2015-10-211-2/+3
| | | |
| * | | Remove unnecessary new lines, changed Deinit to Shutdownpolaris-2015-10-125-11/+8
| | | |
| * | | Use BreakpointAddress struct instead of passing address directlypolaris-2015-10-043-8/+18
| | | |
| * | | Toggle use_gdbstub in citra GLFWpolaris-2015-10-041-0/+1
| |\ \ \
| | * | | Implement gdbstubpolaris-2015-09-2018-9/+1182
| | | | |
| * | | | Implement gdbstubpolaris-2015-10-0418-9/+1174
| | | | |
* | | | | Merge pull request #1236 from Subv/log_overflowbunnei2015-11-101-0/+2
|\ \ \ \ \ | | | | | | | | | | | | GPU/Loaders: Log an error when a loader tries to load from a component beyond the available ones
| * | | | | GPU/Loaders: Log an error when a loader tries to load from a component beyond the available ones (12).Subv2015-11-101-0/+2
|/ / / / / | | | | | | | | | | | | | | | Related to #1170
* | | | | .travis-deps.sh: don't install pkgbuild on OS Xarchshift2015-11-041-1/+1
| | | | | | | | | | | | | | | | | | | | pkgbuild is now provided by Travis itself, so homebrew throws an error upon trying to install it.
* | | | | .travis-deps.sh: update curl invocation to follow 302 redirectsarchshift2015-11-041-1/+1
| |_|/ / |/| | | | | | | | | | | CMake recently 302'd the download URL we're using. To prevent any issues, just follow the redirect with cURL.
* | | | Merge pull request #1165 from esoteric-programmer/masterbunnei2015-10-282-4/+66
|\ \ \ \ | | | | | | | | | | Added CSND_ExecuteType0Commands stub.
| * | | | Added CSND stub.Matthias Ernst2015-10-282-4/+66
| | |/ / | |/| |
* | | | Merge pull request #1208 from archshift/free-bytesbunnei2015-10-288-1/+60
|\ \ \ \ | | | | | | | | | | Implement FS_User::GetFreeBytes
| * | | | Implement FS_User::GetFreeBytesarchshift2015-10-288-1/+60
| | | | |
* | | | | Merge pull request #1217 from filfat/masterbunnei2015-10-273-1/+21
|\ \ \ \ \ | | | | | | | | | | | | Add GetTotalStepCount Stub
| * | | | | Fix copy pasteFiliph Sandström2015-10-241-1/+1
| | | | | |
| * | | | | Fix wrong branchFiliph Sandström2015-10-231-0/+12
| | | | | |
| * | | | | Add GetTotalStepCount StubFiliph Sandström2015-10-231-1/+1
| | | | | |
| * | | | | Update ptm.hFiliph Sandström2015-10-231-0/+8
|/ / / / /
* | | | | Merge pull request #1209 from wwylele/file-path-encodingbunnei2015-10-232-5/+5
|\ \ \ \ \ | | | | | | | | | | | | citra-qt: Change file path encoding
| * | | | | change file path encoding to Local8bit()wwylele2015-10-202-5/+5
| | | | | | | | | | | | | | | | | | | | | | | | to support non-latin characters
* | | | | | Merge pull request #1187 from bunnei/shader-genbunnei2015-10-2212-620/+678
|\ \ \ \ \ \ | |/ / / / / |/| | | | | GLSL Fragment Shader Generation
| * | | | | gl_shader_gen: Use explicit locations for vertex shader attributes.bunnei2015-10-222-15/+9
| | | | | |
| * | | | | gl_shader_gen: Optimize code for AppendAlphaTestCondition.bunnei2015-10-221-16/+11
| | | | | | | | | | | | | | | | | | | | | | | | - Also add a comment to AppendColorCombiner.
| * | | | | gl_rasterizer: Define enum types for each vertex texcoord attribute.bunnei2015-10-223-12/+14
| | | | | |
| * | | | | gl_shader_gen: Various cleanups to shader generation.bunnei2015-10-223-48/+52
| | | | | |
| * | | | | gl_rasterizer: Use MMH3 hash for shader cache hey.bunnei2015-10-225-101/+63
| | | | | | | | | | | | | | | | | | | | | | | | - Includes a check to confirm no hash collisions.
| * | | | | gl_shader_gen: Require explicit uniform locations.bunnei2015-10-223-56/+34
| | | | | | | | | | | | | | | | | | | | | | | | - Fixes uniform issue on AMD.
| * | | | | gl_shader_gen: Rename 'o' to 'attr' in vertex/fragment shaders.bunnei2015-10-221-11/+11
| | | | | |
| * | | | | gl_shader_gen: AppendAlphaModifier default should be 0.0, not vec4(0.0).bunnei2015-10-221-1/+1
| | | | | |
| * | | | | gl_shader_gen: Fix bug where TEV stage outputs should be clamped.bunnei2015-10-221-3/+3
| | | | | |
| * | | | | gl_rasterizer: Add documentation to ShaderCacheKey.bunnei2015-10-221-0/+16
| | | | | |
| * | | | | gl_shader_gen: Add additional function documentation.bunnei2015-10-222-0/+18
| | | | | |
| * | | | | gl_shader_util: Cleanup header file + add docstring.bunnei2015-10-221-1/+7
| | | | | |
| * | | | | gl_shader_gen: Various cleanups + moved TEV stage generation to its own function.bunnei2015-10-221-161/+170
| | | | | |
| * | | | | renderer_opengl: Refactor shader generation/caching to be more organized + various cleanups.bunnei2015-10-2211-788/+527
| | | | | |
| * | | | | gl_rasterizer: Move logic for creating ShaderCacheKey to a static function.bunnei2015-10-223-22/+50
| | | | | |
| * | | | | gl_shader_util: Use vec3 constants for AppendColorCombiner.bunnei2015-10-221-6/+6
| | | | | |
| * | | | | gl_rasterizer: Fix typo in uploading TEV const color uniforms.bunnei2015-10-221-5/+5
| | | | | |
| * | | | | gl_shader_util: Fix precision bug with alpha testing.bunnei2015-10-222-9/+9
| | | | | | | | | | | | | | | | | | | | | | | | - Alpha testing is not done with float32 precision, this makes the HW renderer match the SW renderer.
| * | | | | Initial implementation of fragment shader generation with caching.Subv2015-10-227-261/+568
|/ / / / /
* | | | | Merge pull request #1207 from kemenaran/persist-citra-settings-in-qtbunnei2015-10-201-0/+8
|\ \ \ \ \ | | | | | | | | | | | | citra-qt: save hardware-rendering and shaders-jit settings
| * | | | | citra-qt: persist hardware-rendering and shaders-jit settingsPierre de La Morinerie2015-10-181-0/+8
| |/ / / / | | | | | | | | | | | | | | | | | | | | Before this changing these settings from the GUI would apply the settings, but they were reseted to the default values when exiting citra.
* | | | | Merge pull request #1204 from kemenaran/qt-add-mac-iconbunnei2015-10-202-1/+3
|\ \ \ \ \ | | | | | | | | | | | | citra-qt: Add icon to the OS X app
| * | | | | citra-qt: Add icon to Mac appPierre de La Morinerie2015-10-142-1/+3
| |/ / / / | | | | | | | | | | Previously the Mac app didn't have any icon.
* | | | | Merge pull request #1199 from Gareth422/encryption-checkbunnei2015-10-203-20/+25
|\ \ \ \ \ | |/ / / / |/| | | | Loader: Implement NCCH encryption check
| * | | | Loader: Change NCCH header types to be explicitly little-endianGareth Poole2015-10-112-18/+17
| | | | |
| * | | | Loader: Implement encryption checkGareth Poole2015-10-113-2/+8
| | | | |
* | | | | Merge pull request #1194 from linkmauve/no-newlinebunnei2015-10-107-55/+55
|\ \ \ \ \ | |/ / / / |/| | | | Remove newlines in LOG_* calls
| * | | | CitraQt, SkyEye, Loader, VideoCore: Remove newlines in LOG_* calls.Emmanuel Gil Peyrot2015-10-097-55/+55
| | |_|/ | |/| | | | | | | | | | The LOG_* function itself already appends one.
* | | | Merge pull request #1195 from Gareth422/secondarybunnei2015-10-101-2/+2
|\ \ \ \ | |/ / / |/| | | Fixed spelling errors
| * | | Fixed spelling errorsGareth Poole2015-10-091-2/+2
|/ / /
* | | Merge pull request #1189 from archshift/game-list-toggle-windowbunnei2015-10-071-0/+1
|\ \ \ | | | | | | | | Game list: propely hide on toggling window mode
| * | | Game list: propely hide on toggling window modearchshift2015-10-061-0/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | Properly hides the game list upon toggling from external window mode to single window mode. Previously, both the game list and the render window would have been shown at the same time upon toggling.
* | | | Merge pull request #1190 from rohit-n/sign-comparebunnei2015-10-074-9/+9
|\ \ \ \ | |/ / / |/| | | Silence -Wsign-compare warnings.
| * | | Silence -Wsign-compare warnings.Rohit Nirmal2015-10-074-9/+9
|/ / /
* | | Merge pull request #1164 from kemenaran/qt-high-dpi-fixesbunnei2015-10-074-12/+63
|\ \ \ | |_|/ |/| | citra-qt: high-DPI fixes and Retina on OS X
| * | citra-qt: Fix mouse events coordinates on high-DPI screensPierre de La Morinerie2015-10-042-12/+21
| | |
| * | citra-qt: Enable high-DPI widgets on Mac appPierre de La Morinerie2015-10-041-0/+4
| | | | | | | | | | | | | | | | | | | | | | | | | | | The OS will render the widgets using the system screen DPI (instead of being locked at @1x resolution). This has no impact on the existing high-DPI rendering code in Citra, which means that the resolution of the emulated content is increased to the real number of pixels, as on other platforms.
| * | citra-qt: Use custom Info.plist for Mac buildsPierre de La Morinerie2015-10-042-0/+38
|/ / | | | | | | | | | | Instead of letting CMake re-generate an automatic Info.plist file on every build, use our own. This allows greater control on the application bundle settings.
* | OS X build uploading: auto-confirm SSH host keyarchshift2015-10-041-1/+1
| | | | | | | | Prevents error verifying host key (and we can't manually verify since the prompt is obviously non-interactive).
* | Merge pull request #1176 from lioncash/vs2015-code-junking-daybunnei2015-10-031-11/+0
|\ \ | | | | | | Obligatory "Throw out workarounds VS2013 once limited us to" PR
| * | bit_field: Re-enable code on MSVCLioncash2015-10-011-11/+0
| | |
* | | Merge pull request #1095 from archshift/game-listbunnei2015-10-0213-123/+556
|\ \ \ | | | | | | | | Initial implementation of a game list
| * | | Game list: save and load column sizes, sort order, to QSettingsarchshift2015-10-023-0/+24
| | | |
| * | | Add menu item for selecting the game list folderarchshift2015-10-023-1/+23
| | | |
| * | | Initial implementation of a game listarchshift2015-10-026-2/+356
| | | |
| * | | Add helper function for creating a readable byte size string.archshift2015-10-022-0/+16
| | | |
| * | | Don't show render window until a game is startedarchshift2015-10-022-4/+13
| | | |
| * | | Split up FileUtil::ScanDirectoryTree to be able to use callbacks for custom behaviorarchshift2015-10-012-103/+83
| | | | | | | | | | | | | | | | | | | | Converted FileUtil::ScanDirectoryTree and FileUtil::DeleteDirRecursively to use the new ScanDirectoryTreeAndCallback function internally.
| * | | Expose loader helper functions for identifying files.archshift2015-10-012-13/+41
| | | |
* | | | Merge pull request #1180 from lioncash/symbolbunnei2015-10-012-35/+27
|\ \ \ \ | | | | | | | | | | symbols: Minor changes
| * | | | symbols: Replace an insert call with emplaceLioncash2015-09-301-1/+1
| | | | |
| * | | | symbols: Get rid of initial underscores in variable namesLioncash2015-09-302-20/+20
| | | | |
| * | | | symbols: Directly initialize TSymbol membersLioncash2015-09-301-8/+3
| | | | |
| * | | | symbols: Simplify GetSymbolLioncash2015-09-301-8/+5
| | |/ / | |/| |
* | | | Merge pull request #1177 from linkmauve/fix-msvc-todobunnei2015-09-301-4/+3
|\ \ \ \ | | | | | | | | | | Use a constexpr function for country initialization in service/cfg
| * | | | Service/CFG: Use a constexpr function for country initializationEmmanuel Gil Peyrot2015-09-301-4/+3
| | | | | | | | | | | | | | | | | | | | This fixes a TODO left over from when we supported MSVC 2013.
* | | | | Merge pull request #1178 from lioncash/fmtbunnei2015-09-301-1/+1
|\ \ \ \ \ | |/ / / / |/| | | | ivfc_archive: Fix a printf specifier
| * | | | ivfc_archive: Fix a printf specifierLioncash2015-09-301-1/+1
| |/ / /
* | | | Merge pull request #1174 from bunnei/vs2015bunnei2015-09-301-2/+1
|\ \ \ \ | |/ / / |/| | | AppVeyor: Use Visual Studio 2015
| * | | AppVeyor: Use Visual Studio 2015bunnei2015-09-301-2/+1
|/ / /
* | | Merge pull request #1172 from martinlindhe/fix-warningsbunnei2015-09-305-6/+8
|\ \ \ | | | | | | | | Fix some xcode 7 (llvm) warnings
| * | | fix some xcode 7.0 warningsMartin Lindhe2015-09-295-6/+8
| | | |
* | | | Merge pull request #1171 from LittleWhite-tb/qt-no-refresh-nologobunnei2015-09-292-4/+14
|\ \ \ \ | |/ / / |/| | | Fix refresh issue (only)
| * | | Fix for the refresh issue when no rendering is doneLittleWhite2015-09-242-4/+14
|/ / /
* | | Merge pull request #1160 from lioncash/clangbunnei2015-09-2213-41/+27
|\ \ \ | | | | | | | | Silence some clang warnings
| * | | hash: Get rid of unused functionsLioncash2015-09-161-16/+0
| | | |
| * | | general: Silence some warnings when using clangLioncash2015-09-1612-25/+27
| | |/ | |/|
* | | Merge pull request #1106 from Kloen/fix-connectbunnei2015-09-222-5/+13
|\ \ \ | | | | | | | | citra-qt: Fix connect error on startup (#449)
| * | | citra-qt: Fix connect error on startupKloen2015-09-182-5/+13
| |/ /
* | | Merge pull request #1167 from Cruel/masterbunnei2015-09-223-3/+61
|\ \ \ | |/ / |/| | Implement 3dsx RomFS
| * | Implement 3dsx RomFSCruel2015-09-213-3/+61
|/ /
* | Merge pull request #1097 from yuriks/cfg-blocksYuri Kunde Schlesner2015-09-143-92/+108
|\ \ | |/ |/| Service/CFG: Add additional blocks to default save data
| * Service/CFG: Add default entry for block 0x000A0001 (birthday)Yuri Kunde Schlesner2015-09-141-0/+6
| |
| * Service/CFG: Correct flags in 2 default blocksYuri Kunde Schlesner2015-09-141-2/+2
| | | | | | | | Verified against a 9.2.0-20 config save
| * CMake: Silence more MSVC "deprecation" warningsYuri Kunde Schlesner2015-09-141-1/+1
| |
| * Service/CFG: Add additional blocks to default save dataYuri Kunde Schlesner2015-09-141-0/+34
| | | | | | | | These blocks are required by various games to boot.
| * Fix narrowing conversion warningYuri Kunde Schlesner2015-09-141-1/+1
| |
| * Service/CFG: Move several private types from the header to the cppYuri Kunde Schlesner2015-09-142-63/+49
| |
| * Service/CFG: Clean up default block creationYuri Kunde Schlesner2015-09-142-27/+17
|/
* Merge pull request #1123 from yuriks/gsp-flushYuri Kunde Schlesner2015-09-143-15/+36
|\ | | | | GSP: Implement command 0x05, used for flushing caches
| * GSP: Implement command 0x05, used for flushing cachesYuri Kunde Schlesner2015-09-143-15/+36
| | | | | | | | | | | | May fix additional texture caching issues. (Though mostly in homebrew, I haven't seen any commercial software use this to flush anything but command lists.)
* | Merge pull request #1111 from LittleWhite-tb/qt-close-renderwindowbunnei2015-09-143-0/+15
|\ \ | |/ |/| Stop emulation when render window is closed
| * Stop emulation when render window is closedLittleWhite2015-09-073-0/+15
| |
* | Merge pull request #1152 from lioncash/nullptrbunnei2015-09-125-22/+9
|\ \ | | | | | | Replace 0 literals with nullptr where applicable
| * | memory_util: Remove unnecessary assignment in FreeMemoryPagesLioncash2015-09-121-3/+0
| | |
| * | memory_util: Remove commented out printf statementsLioncash2015-09-121-10/+0
| | |
| * | general: Replace 0 literals with nullptr where applicableLioncash2015-09-125-9/+9
|/ /
* | Merge pull request #1151 from lioncash/returnYuri Kunde Schlesner2015-09-121-0/+1
|\ \ | | | | | | synchronized_wrapper: Add missing return in SynchronizedRef move assignment operator
| * | synchronized_wrapper: Add missing return in SynchronizedRef move assignment operatorLioncash2015-09-121-0/+1
|/ /
* | Merge pull request #1147 from lioncash/nullptrYuri Kunde Schlesner2015-09-1111-38/+38
|\ \ | | | | | | General: Replace NULL and '0' usages with nullptr where applicable
| * | General: Replace NULL and '0' usages with nullptr where applicableLioncash2015-09-1111-38/+38
| | |
* | | Merge pull request #1149 from lioncash/overrideYuri Kunde Schlesner2015-09-111-1/+1
|\ \ \ | | | | | | | | graphics_breakpoints_p: Add missing override specifier
| * | | graphics_breakpoints_p: Add missing override specifierLioncash2015-09-111-1/+1
| | | |
* | | | Merge pull request #1142 from lioncash/hdrqtYuri Kunde Schlesner2015-09-1124-100/+81
|\ \ \ \ | | | | | | | | | | citra_qt: Reorganize headers
| * | | | citra_qt: Reorganize headersLioncash2015-09-1124-100/+81
| | | | |
* | | | | Merge pull request #1143 from lioncash/vcore-hdrYuri Kunde Schlesner2015-09-1119-62/+56
|\ \ \ \ \ | |_|/ / / |/| | | | video_core: Reorganize headers
| * | | | video_core: Reorganize headersLioncash2015-09-1119-62/+56
| | |/ / | |/| |
* | | | Merge pull request #1144 from lioncash/removebunnei2015-09-114-176/+0
|\ \ \ \ | | | | | | | | | | common: Get rid of debug_interface.h
| * | | | common: Get rid of debug_interface.hLioncash2015-09-114-176/+0
| |/ / / | | | | | | | | | | | | | | | | | | | | This is technically unused. Also removes TMemChecks because it relies on this. Whenever memory breakpoints are implemented for real, it should be designed to match the codebase debugging mechanisms.
* | | | Merge pull request #1145 from lioncash/castbunnei2015-09-111-2/+2
|\ \ \ \ | |/ / / |/| | | common: Get rid of a cast in swap.h
| * | | common: Get rid of a cast in swap.hLioncash2015-09-111-2/+2
|/ / /
* | | Merge pull request #1141 from lioncash/hdrYuri Kunde Schlesner2015-09-115-13/+3
|\ \ \ | |/ / |/| | video_core: Remove unnecessary includes from headers
| * | video_core: Remove unnecessary includes from headersLioncash2015-09-115-13/+3
|/ /
* | Merge pull request #1130 from lioncash/blockYuri Kunde Schlesner2015-09-101-14/+7
|\ \ | | | | | | memory: Get rid of pointer casts
| * | memory: Get rid of pointer castsLioncash2015-09-101-14/+7
| | |
* | | Merge pull request #1128 from yuriks/cmake-optionsbunnei2015-09-101-5/+7
|\ \ \ | | | | | | | | CMake: Make all cache options appear even in case of errors
| * | | CMake: Make all cache options appear even in case of errorsYuri Kunde Schlesner2015-09-091-5/+7
| |/ / | | | | | | | | | | | | | | | | | | | | | The `option` commands have been moved to the top of the file, so that the relevant options are registered in the CMake cache even if one of the required libraries is not found. This solves an ergonomic problem when using bundled libraries where you have to first download GLFW before being able to select the option to also download Qt.
* | | Merge pull request #1133 from lioncash/emplace-backbunnei2015-09-101-3/+3
|\ \ \ | | | | | | | | gl_rasterizer: Replace push_back calls with emplace_back in AddTriangle
| * | | gl_rasterizer: Replace push_back calls with emplace_back in AddTriangleLioncash2015-09-101-3/+3
| |/ /
* | | Merge pull request #1136 from lioncash/protobunnei2015-09-101-3/+0
|\ \ \ | | | | | | | | renderer_opengl: Remove unimplemented function declaration
| * | | renderer_opengl: Remove unimplemented function declarationLioncash2015-09-101-3/+0
| | | |
* | | | Merge pull request #1137 from lioncash/docbunnei2015-09-107-11/+9
|\ \ \ \ | | | | | | | | | | General: Fix up doxygen comments
| * | | | General: Fix up doxygen commentsLioncash2015-09-107-11/+9
| |/ / /
* | | | Merge pull request #1135 from lioncash/unusedbunnei2015-09-103-4/+0
|\ \ \ \ | |/ / / |/| | | video_core: Remove unused variables
| * | | video_core: Remove unused variablesLioncash2015-09-103-4/+0
|/ / /
* | | Merge pull request #1131 from lioncash/uninitYuri Kunde Schlesner2015-09-101-3/+6
|\ \ \ | | | | | | | | y2r: Give local variables an initial value
| * | | y2r: Give local variables an initial valueLioncash2015-09-101-3/+6
| |/ / | | | | | | | | | Keeps compilers/static analyzers quiet.
* | | Merge pull request #1132 from lioncash/unimplYuri Kunde Schlesner2015-09-101-2/+0
|\ \ \ | |/ / |/| | disk_archive: Remove unimplemented constructor declarations
| * | disk_archive: Remove unimplemented constructor declarationsLioncash2015-09-101-2/+0
|/ /
* | Merge pull request #1020 from yuriks/qt-binariesbunnei2015-09-093-55/+81
|\ \ | | | | | | CMake: Add option to download Qt binaries
| * | CMake: Point binary downloads to new official repoYuri Kunde Schlesner2015-09-091-1/+1
| | |
| * | CMake: Remove support for QTDIR environment variableYuri Kunde Schlesner2015-09-092-9/+3
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Using this variable is problematic is the user has several versions of Qt installed on their system. There is no way to know ahead of time if the Qt version pointed to by QTDIR matches the toolchain that is being targeted. The Qt installation path can still be easily specified if it's not found by CMake by setting the Qt5_DIR cache variable after the initial configuration run, so this shouldn't present an usability issue.
| * | CMake: Don't complain when Boost isn't found in the system.Yuri Kunde Schlesner2015-09-091-1/+1
| | |
| * | CMake: Use HINTS option instead of modifying CMAKE_PREFIX_PATH for QtYuri Kunde Schlesner2015-09-091-4/+11
| | |
| * | CMake: Add option to download Qt and GLFW binaries over HTTPYuri Kunde Schlesner2015-09-093-46/+45
| | |
| * | CMake: Fix architecture detection on MSVCYuri Kunde Schlesner2015-09-091-5/+31
|/ / | | | | | | | | CMAKE_SYSTEM_ARCHICTETURE always returns the *host* not target arch when using the MSVC generators. (CMake bugs 15170 and 14342.)
* | Merge pull request #1125 from yuriks/uilayout-configYuri Kunde Schlesner2015-09-081-0/+7
|\ \ | | | | | | citra-qt: Separate UI layout state in a separate section of the config
| * | citra-qt: Separate UI layout state in a separate section of the configYuri Kunde Schlesner2015-09-081-0/+7
| | | | | | | | | | | | Closes #1113
* | | Merge pull request #1124 from yuriks/trim-mruYuri Kunde Schlesner2015-09-081-0/+4
|\ \ \ | |/ / |/| | citra-qt: Trim recently used files list to size when insterting new item
| * | citra-qt: Trim recently used files list to size when insterting new itemYuri Kunde Schlesner2015-09-081-0/+4
|/ / | | | | | | | | | | Even though they weren't visible in the UI, old entries would never be removed from the list and would be stored in the config file across sessions.
* | Merge pull request #1118 from Kloen/monospace-fontbunnei2015-09-072-1/+35
|\ \ | | | | | | citra-qt: Use monospace font on Disassembler and ARM Registers
| * | citra-qt: Use monospace font on Disassembler and ARM RegistersKloen2015-09-072-1/+35
| |/
* | Merge pull request #1121 from aroulin/shader-minor-fixesbunnei2015-09-072-16/+22
|\ \ | | | | | | Shader: Use constants and proper type casts
| * | Shader JIT: Use SCALE constant from emitteraroulin2015-09-071-4/+4
| | |
| * | Shader: Fix size_t to int casts of register offsetsaroulin2015-09-072-15/+21
| |/
* | Merge pull request #1052 from yuriks/vertex-disasmYuri Kunde Schlesner2015-09-073-127/+187
|\ \ | |/ |/| Shader Debugger Improvements
| * Shader Debugger: Allow editing of input vertex dataYuri Kunde Schlesner2015-09-071-0/+2
| |
| * Shader Debugger: Highlight current instruction instead of focusingYuri Kunde Schlesner2015-09-071-4/+15
| | | | | | | | | | This avoid some annoying focus stealing in some situations, and looks nicer in general.
| * Shader Debugger: Remove useless signalYuri Kunde Schlesner2015-09-072-10/+2
| |
| * Shader Debugger: Fix only first vertex attribute being loadedYuri Kunde Schlesner2015-09-071-7/+7
| |
| * Shader Debugger: Fix freeze when double-clicking shader disassemblyYuri Kunde Schlesner2015-09-073-14/+4
| |
| * Shader Debugger: Improve space efficiency of the layoutYuri Kunde Schlesner2015-09-071-9/+18
| |
| * Shader Disassembly: Fix printing of jump offsetsYuri Kunde Schlesner2015-09-071-4/+4
| |
| * Shader Disassembly: Fix disassembly of IFU/CALLU instructionsYuri Kunde Schlesner2015-09-071-0/+1
| |
| * Shader Disassembly: Implement support for MAD/MADIYuri Kunde Schlesner2015-09-071-0/+31
| |
| * Shader Disassembly: Introduce variables to hold common subexpressionsYuri Kunde Schlesner2015-09-071-16/+20
| |
| * Shader Debugger: Initialize input_vertex to prevent crashesYuri Kunde Schlesner2015-09-071-0/+7
| | | | | | | | | | | | If the first type of breakpoint to be hit wasn't "Vertex Loaded", the input_vertex would contain garbage, which would be passed to the shader interpreter and ocasionally cause crashes.
| * Shader Disassembly: Cleanup code and improve output alignmentYuri Kunde Schlesner2015-09-071-66/+79
|/
* Merge pull request #1117 from yuriks/fix-glad-buildYuri Kunde Schlesner2015-09-071-0/+3
|\ | | | | CMake: Add missing library required by Linux for compiling glad
| * CMake: Add missing library required by Linux for compiling gladYuri Kunde Schlesner2015-09-071-0/+3
| |
* | Merge pull request #1114 from archshift/conditioncode_alLioncash2015-09-062-132/+132
|\ \ | | | | | | DynCom: Converted all magic 0xE condition code checks to ConditionCode::AL
| * | DynCom: Converted all 0xE condition code checks to ConditionCode::ALarchshift2015-09-062-132/+132
| |/
* | Merge pull request #1104 from yuriks/opengl-samplersbunnei2015-09-0511-36/+133
|\ \ | |/ |/| OpenGL: Use Sampler Objects to decouple sampler config from textures
| * OpenGL: Use Sampler Objects to decouple sampler config from texturesYuri Kunde Schlesner2015-09-034-21/+76
| | | | | | | | Fixes #978
| * OpenGL: Remove ugly and endian-unsafe color pointer castsYuri Kunde Schlesner2015-09-034-9/+13
| |
| * OpenGL: Add support for Sampler Objects to state trackerYuri Kunde Schlesner2015-09-033-4/+42
| |
| * citra-qt: Move system shutdown to run inside EmuThreadYuri Kunde Schlesner2015-09-032-3/+3
|/ | | | | | This stops (for some reason sporadic) crashes and OpenGL errors during shutdown, when the OpenGL renderer tries to clean up objects from the UI thread, which has no OpenGL context active.
* Merge pull request #1087 from yuriks/opengl-gladYuri Kunde Schlesner2015-09-0320-2817/+3984
|\ | | | | Replace the previous OpenGL loader with a glad-generated 3.3 one
| * Increase required OpenGL version to 3.3Yuri Kunde Schlesner2015-08-302-2/+2
| | | | | | | | | | This gives us several niceties such as Sampler Objects, shader attribute locations and Timer Queries.
| * Replace the previous OpenGL loader with a glad-generated 3.3 oneYuri Kunde Schlesner2015-08-3019-2815/+3982
| | | | | | | | | | | | The main advantage of switching to glad from glLoadGen is that, apart from being actively maintained, it supports a customizable entrypoint loader function, which makes it possible to also support OpenGL ES.
* | Merge pull request #1101 from archshift/camu-service-namesbunnei2015-09-031-3/+60
|\ \ | | | | | | Add cam:u service function names to its function table
| * | Add cam:u service function names to its function tablearchshift2015-09-031-3/+60
| | |
* | | Merge pull request #1088 from aroulin/x64-emitter-abi-callbunnei2015-09-027-452/+298
|\ \ \ | | | | | | | | x64: Proper stack alignment in shader JIT function calls
| * | | x64: Proper stack alignment in shader JIT function callsaroulin2015-09-015-452/+108
| | | | | | | | | | | | | | | | | | | | Import Dolphin stack handling and register saving routines Also removes the x86 parts from abi files
| * | | Common: Import BitSet from Dolphinaroulin2015-09-012-0/+190
| | | |
* | | | Merge pull request #1099 from aroulin/video-core-format-specifierbunnei2015-09-022-2/+3
|\ \ \ \ | |/ / / |/| | | video_core: Fix format specifiers warnings
| * | | video_core: Fix format specifiers warningsaroulin2015-09-022-2/+3
|/ / /
* | | Merge pull request #1072 from yuriks/GetSystemTick-advance-timebunnei2015-09-011-1/+4
|\ \ \ | |/ / |/| | SVC: Advance time when calling GetSystemTick to escape busy-wait loops
| * | SVC: Advance time when calling GetSystemTick to escape busy-wait loopsYuri Kunde Schlesner2015-08-301-1/+4
| | | | | | | | | | | | | | | | | | | | | | | | Cubic Ninja waited for the frame to end by spinning on a loop calling GetSystemTick while doing nothing else. Since GetSystemTick doesn't cause a reschedule (which advances time), this meant that very little emulated time would pass inside that loop, causing the game to spend most of the frame burning away CPU.
* | | Merge pull request #1083 from yuriks/microprofile-vs2015bunnei2015-09-011-0/+5
|\ \ \ | | | | | | | | Common: Fix MicroProfile compilation in MSVC2015
| * | | Common: Fix MicroProfile compilation in MSVC2015Yuri Kunde Schlesner2015-08-281-0/+5
| | | |
* | | | Merge pull request #1092 from Subv/vertex_offsetTony Wasserka2015-08-312-1/+7
|\ \ \ \ | | | | | | | | | | Pica: Add the vertex_offset register to the Pica registers map.
| * | | | Pica: Added the primitive_restart register (0x25f) to the registers map.Subv2015-08-312-1/+5
| | | | |
| * | | | Pica: Add the vertex_offset register to the Pica registers map.Subv2015-08-312-0/+2
| | | | |
* | | | | Merge pull request #1086 from yuriks/precommit-hookbunnei2015-08-311-2/+4
|\ \ \ \ \ | | | | | | | | | | | | Only check src/ directory for whitespace errors in the pre-commit hook
| * | | | | Only check src/ directory for whitespace errors in the pre-commit hookYuri Kunde Schlesner2015-08-311-2/+4
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | | | | | | | | | | | This allows importing of external libraries into externals/ without having to reformat them. Unfortunately it also allows whitespace to be introduced in files like the root CMakeLists.txt, but that is a small downside compared to the tradeoff.
* | | | | Merge pull request #1091 from aroulin/shader-sge-nan-fixbunnei2015-08-311-3/+3
|\ \ \ \ \ | |_|/ / / |/| | | | Shader JIT: Fix SGE/SGEI NaN behavior
| * | | | Shader JIT: Fix SGE/SGEI NaN behavioraroulin2015-08-311-3/+3
|/ / / / | | | | | | | | | | | | | | | | SGE was incorrectly emulated w.r.t. NaN behavior as the CMPSS SSE instruction was used with NLT
* | | | Merge pull request #1059 from Subv/vertex_offsetbunnei2015-08-302-2/+8
|\ \ \ \ | | | | | | | | | | GPU: Implemented register 0x22A PICA_REG_DRAW_VERTEX_OFFSET
| * | | | GPU: Implemented register 0x22A.Subv2015-08-302-2/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This is the equivalent of the "first" parameter in glDrawArrays, it tells the GPU the vertex index at which to start rendering. Register 0x22A doesn't affect indexed rendering.
* | | | | Merge pull request #1085 from Subv/fs_statbunnei2015-08-301-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Services/FS: Correctly tell the guest app whether a file was correctly opened or not
| * | | | Services/FS: Correctly tell the guest app whether a file was correctly opened or not.Subv2015-08-291-1/+1
| |/ / / | | | | | | | | | | | | Closes #1067
* | | | Merge pull request #1049 from Subv/stencilbunnei2015-08-306-28/+111
|\ \ \ \ | |_|/ / |/| | | Rasterizer: Corrected the stencil implementation.
| * | | HWRenderer: Added a workaround for the Intel Windows driver bug that causes glTexSubImage2D to not change the stencil buffer.Subv2015-08-241-2/+9
| | | | | | | | | | | | | | | | Reported here https://communities.intel.com/message/324464
| * | | HWRasterizer: Implemented stencil ops 6 and 7.Subv2015-08-211-1/+3
| | | |
| * | | SWRasterizer: Implemented stencil ops 6 and 7.Subv2015-08-212-6/+14
| | | | | | | | | | | | | | | | IncrementWrap and DecrementWrap, verified with hwtests.
| * | | HWRasterizer: Implemented stencil op 1 (GL_ZERO)Subv2015-08-211-1/+1
| | | |
| * | | SWRasterizer: Implemented stencil action 1 (GL_ZERO).Subv2015-08-212-1/+4
| | | | | | | | | | | | | | | | Verified with hwtests.
| * | | SWRasterizer: Removed a todo. Verified with hwtests.Subv2015-08-211-1/+0
| | | |
| * | | SWRenderer: The stencil depth_pass action is executed even if depth testing is disabled.Subv2015-08-211-7/+5
| | | | | | | | | | | | | | | | The HW renderer already did this.
| * | | Rasterizer: Abstract duplicated stencil code into a lambda.Subv2015-08-211-6/+9
| | | |
| * | | GLRasterizer: Implemented stencil testing in the hw renderer.Subv2015-08-204-2/+44
| | | |
| * | | GPU/Rasterizer: Corrected the stencil implementation.Subv2015-08-202-18/+39
| |/ / | | | | | | | | | Verified the behavior with hardware tests.
* | | Merge pull request #1080 from yuriks/linear-heap-base-typoYuri Kunde Schlesner2015-08-281-1/+1
|\ \ \ | | | | | | | | Kernel: Fix wrong linear heap base on titles using newer kernels
| * | | Kernel: Fix wrong linear heap base on titles using newer kernelsYuri Kunde Schlesner2015-08-281-1/+1
|/ / / | | | | | | | | | Typo which sneaked in through review on #1025
* | | Merge pull request #1075 from yuriks/ControlMem-fixesbunnei2015-08-284-4/+37
|\ \ \ | | | | | | | | Fix heap-management regressions
| * | | Kernel: Fix assertion failure when ControlMemory is called with size=0Yuri Kunde Schlesner2015-08-271-0/+8
| | | |
| * | | Core: Improve APT Shared Font hackYuri Kunde Schlesner2015-08-273-4/+29
| | | | | | | | | | | | | | | | Should fix invalid read loops in some games
* | | | Merge pull request #1065 from yuriks/shader-fpYuri Kunde Schlesner2015-08-284-57/+100
|\ \ \ \ | | | | | | | | | | Shader FP compliance fixes
| * | | | fixup! Shaders: Fix multiplications between 0.0 and infYuri Kunde Schlesner2015-08-241-4/+4
| | | | |
| * | | | Shader JIT: Tiny micro-optimization in DPHYuri Kunde Schlesner2015-08-241-4/+4
| | | | |
| * | | | Shaders: Fix multiplications between 0.0 and infYuri Kunde Schlesner2015-08-243-40/+58
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | The PICA200 semantics for multiplication are so that when multiplying inf by exactly 0.0, the result is 0.0, instead of NaN, as defined by IEEE. This is relied upon by games. Fixes #1024 (missing OoT interface items)
| * | | | Shaders: Explicitly conform to PICA semantics in MAX/MINYuri Kunde Schlesner2015-08-242-2/+10
| | | | |
| * | | | Shader JIT: Add name to second scratch register (XMM4)Yuri Kunde Schlesner2015-08-241-3/+5
| | | | |
| * | | | Shader JIT: Fix CMP NaN behavior to match hardwareYuri Kunde Schlesner2015-08-241-8/+23
| | | | |
* | | | | Merge pull request #1068 from bunnei/gl-hash-texturesbunnei2015-08-283-8/+18
|\ \ \ \ \ | | | | | | | | | | | | gl_rasterizer_cache: Cache textures based on hash in addition to address.
| * | | | | gl_rasterizer_cache: Detect and ignore unnecessary texture flushes.bunnei2015-08-283-8/+18
|/ / / / /
* | | | | Merge pull request #1079 from aroulin/albw-jit-bugbunnei2015-08-271-2/+2
|\ \ \ \ \ | |_|/ / / |/| | | | Shader JIT: Fix float to integer rounding in MOVA
| * | | | Shader JIT: Fix float to integer rounding in MOVAaroulin2015-08-271-2/+2
|/ / / / | | | | | | | | | | | | MOVA converts new address register values from floats to integers using truncation
* | | | Merge pull request #1074 from lioncash/boolbunnei2015-08-271-57/+39
|\ \ \ \ | | | | | | | | | | dyncom: Minor changes to CondPassed
| * | | | dyncom: Simplify some comparisons in CondPassedLioncash2015-08-261-4/+4
| | | | |
| * | | | dyncom: Change return type of CondPassed to boolLioncash2015-08-261-57/+39
| | | | |
* | | | | Merge pull request #1078 from archshift/arm-build-fixbunnei2015-08-271-0/+2
|\ \ \ \ \ | |/ / / / |/| | | | Shader JIT: ifdef out reference to ifdef'd out shader_map
| * | | | Shader JIT: ifdef out reference to ifdef'd out shader_maparchshift2015-08-271-0/+2
|/ / / / | | | | | | | | | | | | | | | | shader_map was only defined on x86 architectures, but was cleared on shutdown with no ifdef protection. Ifdef this out so non-x86 architectures can be built.
* | | | Merge pull request #1073 from lioncash/guardarchshift2015-08-261-0/+2
|\ \ \ \ | |_|_|/ |/| | | citra-qt: Add a missing header guard to util.h
| * | | citra-qt: Add a missing header guard to util.hLioncash2015-08-261-0/+2
|/ / /
* | | Merge pull request #1048 from yuriks/microprofileYuri Kunde Schlesner2015-08-2530-5/+11174
|\ \ \ | | | | | | | | Integrate the MicroProfile profiling library
| * | | Integrate the MicroProfile profiling libraryYuri Kunde Schlesner2015-08-2524-0/+11142
| | | | | | | | | | | | | | | | | | | | This brings goodies such as a configurable user interface and multi-threaded timeline view.
| * | | citra-qt: Add helper function to get a monospace QFontYuri Kunde Schlesner2015-08-256-5/+32
|/ / /
* | | Merge pull request #1063 from Subv/hw_renderer_debug_fbbunnei2015-08-241-2/+6
|\ \ \ | | | | | | | | HWRenderer: Only reload the framebuffer from gpu memory if the hw renderer is in use during a breakpoint
| * | | HWRenderer: Only reload the framebuffer from gpu memory if the hw renderer is in use during a breakpoint.Subv2015-08-231-2/+6
| | |/ | |/|
* | | Merge pull request #1064 from lioncash/matrYuri Kunde Schlesner2015-08-241-2/+2
|\ \ \ | |_|/ |/| | shader_jit: Replace two MDisp usages with MatR
| * | shader_jit: Replace two MDisp usages with MatRLioncash2015-08-241-2/+2
|/ /
* | Merge pull request #1062 from aroulin/shader-rcp-rsqbunnei2015-08-234-10/+12
|\ \ | | | | | | Shader: RCP and RSQ computes only the 1st component
| * | Shader: Use std::sqrt for float instead of sqrtaroulin2015-08-231-1/+1
| | |
| * | Shader: RCP and RSQ computes only the 1st componentaroulin2015-08-232-10/+10
| | |
| * | x64-emitter: add RCPSS SSE instructionaroulin2015-08-232-0/+2
| | |
* | | Merge pull request #1057 from aroulin/shader-dph-dphibunnei2015-08-233-3/+44
|\ \ \ | |/ / |/| | Shader: Implement DPH and DPHI in interpreter/JIT
| * | Shader: implement DPH/DPHI in JITaroulin2015-08-222-2/+36
| | |
| * | Shader: implement DPH/DPHI in interpreteraroulin2015-08-221-1/+8
| | | | | | | | | | | | | | | Tests revealed that the component with w=1 is SRC1 and not SRC2, it is now fixed on 3dbrew.
* | | Merge pull request #1058 from lioncash/ptrLioncash2015-08-232-4/+27
|\ \ \ | | | | | | | | emitter: Remove pointer casts
| * | | emitter: Remove pointer castsLioncash2015-08-212-4/+27
| |/ / | | | | | | | | | This should also technically silence quite a few ubsan warnings.
* | | Fix broken boot introduced by last-minute change in #1025Yuri Kunde Schlesner2015-08-221-1/+1
| | |
* | | Merge pull request #1025 from yuriks/heap-managementYuri Kunde Schlesner2015-08-2229-316/+729
|\ \ \ | |/ / |/| | Kernel: Correct(er) handling of Heap and Linear Heap allocations
| * | Kernel: Remove unused legacy heap MapBlock_* functionsYuri Kunde Schlesner2015-08-163-78/+0
| | |
| * | APT: Adjust shared font hack so it works with the new linear heap codeYuri Kunde Schlesner2015-08-161-10/+11
| | |
| * | Kernel: Implement svcGetProcessInfo in a basic wayYuri Kunde Schlesner2015-08-166-3/+73
| | | | | | | | | | | | | | | This also adds some basic memory usage accounting. These two types are used by Super Smash Bros. during startup.
| * | Kernel: Add more infrastructure to support different memory layoutsYuri Kunde Schlesner2015-08-1610-28/+148
| | | | | | | | | | | | | | | | | | This adds some structures necessary to support multiple memory regions in the future. It also adds support for different system memory types and the new linear heap mapping at 0x30000000.
| * | HLE: Remove empty ConfigMem and SharedPage Shutdown functionsYuri Kunde Schlesner2015-08-165-10/+0
| | |
| * | Move core/mem_map.{cpp,h} => core/hle/kernel/memory.{cpp,h}Yuri Kunde Schlesner2015-08-166-6/+5
| | |
| * | Memory: Move address type conversion routines to memory.cpp/hYuri Kunde Schlesner2015-08-169-53/+47
| | | | | | | | | | | | | | | These helpers aren't really part of the kernel, and mem_map.cpp/h is going to be moved there next.
| * | Process: Store kernel compatibility version during loadingYuri Kunde Schlesner2015-08-162-3/+7
| | |
| * | Kernel: Properly implement ControlMemory FREE and COMMITYuri Kunde Schlesner2015-08-166-38/+338
| | |
| * | Memory: Move PAGE_MASK and PAGE_BITS to memory.hYuri Kunde Schlesner2015-08-162-3/+2
| | |
| * | VMManager: Introduce names for used ResultCodesYuri Kunde Schlesner2015-08-162-6/+11
| | |
| * | VMManager: Make LogLayout log level configurable as a parameterYuri Kunde Schlesner2015-08-164-13/+22
| | |
| * | VMManager: Change block offsets to size_tYuri Kunde Schlesner2015-08-162-3/+3
| | |
* | | Merge pull request #1056 from lioncash/emitterbunnei2015-08-212-822/+773
|\ \ \ | | | | | | | | emitter: Minor cleanup
| * | | emitter: Remove unnecessary definesLioncash2015-08-201-5/+1
| | | |
| * | | emitter: Remove unnecessary else keywordsLioncash2015-08-201-7/+7
| | | |
| * | | emitter: Remove unused codeLioncash2015-08-202-44/+0
| | | |
| * | | emitter: Remove unimplemented JMP prototypeLioncash2015-08-201-1/+0
| | | |
| * | | emitter: Pass OpArg by reference where possibleLioncash2015-08-202-763/+763
| | | |
| * | | emitter: Remove unnecessary inline specifiersLioncash2015-08-201-33/+33
|/ / / | | | | | | | | | Functions implemented in a class definition are already implicitly inline.
* | | Merge pull request #1035 from darkf/mingw-fixbunnei2015-08-203-5/+12
|\ \ \ | | | | | | | | Fix building under MinGW
| * | | Fix building under MinGWdarkf2015-08-183-5/+12
| | | |
* | | | Merge pull request #1055 from aroulin/shader-sge-sgei-sltbunnei2015-08-203-15/+50
|\ \ \ \ | | | | | | | | | | Shader: Implement SGE, SGEI and SLT in interpreter/JIT
| * | | | Shader: implement SGE, SGEI and SLT in JITaroulin2015-08-192-15/+36
| | | | |
| * | | | Shader: implement SGE, SGEI in interpreteraroulin2015-08-191-0/+14
| | | | |
* | | | | Merge pull request #1045 from LittleWhite-tb/qt-recent-filesYuri Kunde Schlesner2015-08-192-11/+33
|\ \ \ \ \ | |/ / / / |/| | | | Improvements for MRU
| * | | | Improvements for MRULittleWhite2015-08-192-11/+33
| | |_|/ | |/| | | | | | | | | | | | | | avoid duplicates always put the last file loaded to top of the list
* | | | Merge pull request #996 from yuriks/texture-copyYuri Kunde Schlesner2015-08-194-36/+101
|\ \ \ \ | | | | | | | | | | GPU: Implement TextureCopy-mode display transfers
| * | | | GPU: Implement TextureCopy-mode display transfersYuri Kunde Schlesner2015-08-164-36/+101
| | |_|/ | |/| | | | | | | | | | Fixes glitchy garbage in Fire Emblem 3D scenes.
* | | | Merge pull request #1047 from aroulin/shader-ex2-lg2bunnei2015-08-192-0/+33
|\ \ \ \ | | | | | | | | | | Shader: Save caller-saved registers in JIT before a CALL
| * | | | Shader: Save caller-saved registers in JIT before a CALLaroulin2015-08-192-0/+33
| | | | |
* | | | | Merge pull request #1037 from aroulin/shader-ex2-lg2bunnei2015-08-193-2/+58
|\| | | | | |_|/ / |/| | | Shader: Implement EX2 and LG2 in interpreter/JIT
| * | | Shader: implement EX2 and LG2 in JITaroulin2015-08-172-2/+22
| | | |
| * | | Shader: implement EX2 and LG2 in interpreteraroulin2015-08-161-0/+36
| | | |
* | | | Merge pull request #1038 from LittleWhite-tb/contributing-includebunnei2015-08-171-0/+16
|\ \ \ \ | | | | | | | | | | Add coding style about includes
| * | | | Add coding style about includesLittleWhite2015-08-161-0/+16
| |/ / /
* | | | Merge pull request #1034 from yuriks/rg8-texturesbunnei2015-08-174-2/+27
|\ \ \ \ | | | | | | | | | | videocore: Added RG8 texture support
| * | | | citra-qt: Give RG8 format a proper name in the texture viewerYuri Kunde Schlesner2015-08-161-1/+1
| | | | |
| * | | | videocore: Added RG8 texture supportPatrick Martin2015-08-163-1/+26
| | |_|/ | |/| |
* | | | Merge pull request #1043 from yuriks/boost-v1_59Yuri Kunde Schlesner2015-08-171-0/+0
|\ \ \ \ | | | | | | | | | | Update boost external to v1.59.0
| * | | | Update boost external to v1.59.0Yuri Kunde Schlesner2015-08-171-0/+0
|/ / / /
* | | | Merge pull request #1036 from LittleWhite-tb/fix-compilation-memsetYuri Kunde Schlesner2015-08-161-1/+2
|\ \ \ \ | |_|/ / |/| | | Fix Linux GCC 4.9 build (complaining about undeclared memset)
| * | | Fix Linux GCC 4.9 build (complaining about undeclared memset)LittleWhite2015-08-161-1/+2
|/ / /
* | | Build fix for Debug configurations.Tony Wasserka2015-08-161-1/+1
| | |
* | | Merge pull request #997 from Lectem/cmdlist_full_debugTony Wasserka2015-08-164-50/+52
|\ \ \ | | | | | | | | citra-qt: Improve pica command list widget (add mask, fix some issues)
| * | | citra-qt/debug_utils: Use lock_guard everywhereLectem2015-07-261-6/+5
| | | | | | | | | | | | | | | | | | | | unique_lock were being used as lock_guards. Also replaced manual lock/unlock by lock_guard for harmonization.
| * | | citra-qt/command list: Do not recreate a widget after each selectionLectem2015-07-261-10/+10
| | | | | | | | | | | | | | | | Recreating / replacing a widget is slow since it triggers a layout pass.
| * | | citra-qt/command list: Add mask columnLectem2015-07-264-33/+34
| | | |
| * | | citra-qt/command list: monospace font on windowsLectem2015-07-261-1/+3
| | | |
* | | | Merge pull request #933 from neobrain/shader_debuggerTony Wasserka2015-08-1611-97/+674
|\ \ \ \ | | | | | | | | | | Shader debugger improvements
| * | | | citra-qt/VertexShader: Minor UI improvements.Tony Wasserka2015-08-162-10/+11
| | | | | | | | | | | | | | | | | | | | | | | | | Renamed "Iteration index" to the (hopefully) more intuitive "Cycle Index". Added flexible space at the bottom of the widget.
| * | | | citra-qt: Fix comment style.Tony Wasserka2015-08-161-5/+6
| | | | |
| * | | | Introduce a shader tracer to allow inspection of input/output values for each processed instruction.Tony Wasserka2015-08-1610-83/+587
| | | | |
| * | | | Pica/DebugUtils: Include uniform information into shader dumps.Tony Wasserka2015-08-163-14/+53
| | | | |
| * | | | citra-qt: Improve shader debugger.Tony Wasserka2015-08-166-16/+48
| | | | | | | | | | | | | | | | | | | | Now supports dumping the current shader and recognizes a larger number of output semantics.
| * | | | citra-qt: Print the correct swizzle mask for SRC2 in the shader disassembler.Tony Wasserka2015-08-161-3/+3
|/ / / /
* | | | Merge pull request #1033 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-0/+6
|\ \ \ \ | |_|/ / |/| | | Handle `FileType::CIA` in `switch` statements
| * | | Properly indicate that CIA support is not implemented yetBenjamin Barenblat2015-08-151-0/+4
| | | | | | | | | | | | | | | | | | | | Make `Loader::LoadFile` return an `ErrorNotImplemented` if you call it on a CIA file.
| * | | Give CIA file type a nameBenjamin Barenblat2015-08-151-0/+2
| | | | | | | | | | | | | | | | | | | | Make `GetFileTypeString` return ‘CIA’ for CIA (CTR Importable Archive) files.
* | | | Merge pull request #1017 from LittleWhite-tb/qt-recent-filesbunnei2015-08-163-18/+91
|\ \ \ \ | | | | | | | | | | citra-qt: save path for recent files loaded
| * | | | Add menu and logic to save and load recently loaded files.LittleWhite2015-08-113-18/+91
| | | | | | | | | | | | | | | | | | | | | | | | | This menu is only for ROM and will not save symbols recently loaded. When the menu is empty, the menu is disabled (greyed out)
* | | | | Merge pull request #1032 from lioncash/swapbunnei2015-08-162-12/+6
|\ \ \ \ \ | |_|_|_|/ |/| | | | vfp: use std::swap where applicable
| * | | | vfp: use std::swap where applicableLioncash2015-08-162-12/+6
| | | | |
* | | | | Merge pull request #1031 from bbarenblat/masterYuri Kunde Schlesner2015-08-161-1/+2
|\ \ \ \ \ | | |_|/ / | |/| | | Handle invalid `Log::Class`
| * | | | Handle invalid `Log::Class`Benjamin Barenblat2015-08-151-1/+2
| |/ / / | | | | | | | | | | | | | | | | | | | | Add a case of `Log::Class::Count` to the switch statement that dispatches on `Log::Class`. The case simply calls the `UNREACHABLE` macro.
* | | | Merge pull request #1002 from bunnei/shader-jitbunnei2015-08-1649-338/+5532
|\ \ \ \ | |/ / / |/| | | Vertex Shader JIT for X86-64
| * | | Shader: Use a POD struct for registers.bunnei2015-08-165-40/+43
| | | |
| * | | Rename ARCHITECTURE_X64 definition to ARCHITECTURE_x86_64.bunnei2015-08-1611-34/+34
| | | |
| * | | Common: Cleanup CPU capability detection code.bunnei2015-08-165-203/+146
| | | |
| * | | Common: Move cpu_detect to x64 directory.bunnei2015-08-165-7/+6
| | | |
| * | | x64: Refactor to remove fake interfaces and general cleanups.bunnei2015-08-1616-666/+52
| | | |
| * | | JIT: Support negative address offsets.bunnei2015-08-161-26/+25
| | | |
| * | | Shader: Initial implementation of x86_x64 JIT compiler for Pica vertex shaders.bunnei2015-08-1619-3/+967
| | | | | | | | | | | | | | | | | | | | - Config: Add an option for selecting to use shader JIT or interpreter. - Qt: Add a menu option for enabling/disabling the shader JIT.
| * | | Common: Added MurmurHash3 hash function for general-purpose use.bunnei2015-08-156-3/+159
| | | |
| * | | Common: Ported over boilerplate x86 JIT code from Dolphin/PPSSPP.bunnei2015-08-1511-6/+4382
| | | |
| * | | Common: Ported over Dolphin's code for x86 CPU capability detection.bunnei2015-08-155-19/+286
| | | |
| * | | Shader: Define a common interface for running vertex shader programs.bunnei2015-08-157-186/+289
| | | |
| * | | Shader: Move shader code to its own subdirectory, "shader".bunnei2015-08-1510-13/+13
| | | |
| * | | GPU: Refactor "VertexShader" namespace to "Shader".bunnei2015-08-1514-51/+49
|/ / / | | | | | | | | | - Also renames "vertex_shader.*" to "shader_interpreter.*"
* | | Merge pull request #1027 from lioncash/debuggerbunnei2015-08-146-49/+225
|\ \ \ | | | | | | | | debugger: Add the ability to view VFP register contents
| * | | registers: Support viewing VFP registersLioncash2015-08-072-44/+172
| | | |
| * | | arm_interface: Implement interface for retrieving VFP registersLioncash2015-08-074-1/+49
| | | |
| * | | registers: Fix a typo with CPSR's nameLioncash2015-08-072-36/+36
| | | |
* | | | Merge pull request #1030 from archshift/force-inlinebunnei2015-08-122-7/+8
|\ \ \ \ | | | | | | | | | | Stop defining GCC always_inline attributes as __forceinline
| * | | | Stop defining GCC always_inline attributes as __forceinlinearchshift2015-08-122-7/+8
|/ / / / | | | | | | | | | | | | | | | | __forceinline is a MSVC extension, which may confuse some people working on the codebase. Furthermore, the C++ standard dictates that all names which contain adjacent underscores are reserved.
* | | | Merge pull request #893 from linkmauve/remove-uint._t-int._tbunnei2015-08-118-346/+356
|\ \ \ \ | | | | | | | | | | Replace standard uint*_t and int*_t with CommonTypes’ u* and s* types
| * | | | ARM Core, Video Core, CitraQt, Citrace: Use CommonTypes types instead of the standard u?int*_t types.Emmanuel Gil Peyrot2015-08-118-346/+356
| | | | |
* | | | | Merge pull request #1023 from yuriks/gl-state-bugsbunnei2015-08-116-26/+48
|\ \ \ \ \ | |/ / / / |/| | | | OpenGL: Fix state tracking in situations with reused object handles
| * | | | OpenGL: Fix state tracking in situations with reused object handlesYuri Kunde Schlesner2015-08-064-0/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an OpenGL object is created, bound to a binding using the state tracker, and then destroyed, a newly created object can be assigned the same numeric handle by OpenGL. However, even though it is a new object, and thus needs to be bound to the binding again, the state tracker compared the current and previous handles and concluded that no change needed to be made, leading to failure to bind objects in certain cases. This manifested as broken text in VVVVVV, which this commit fixes along with similar texturing problems in other games.
| * | | | OpenGL: Remove redundant texture.enable_2d field from OpenGLStateYuri Kunde Schlesner2015-08-064-26/+3
| | |/ / | |/| | | | | | | | | | | | | | All uses of this field where it's false can just set the texture id to 0 instead.
* | | | Merge pull request #1028 from aroulin/arm-disas-media-instrbunnei2015-08-112-1/+545
|\ \ \ \ | | | | | | | | | | arm_disasm: ARMv6 media instructions
| * | | | arm_disasm: ARMv6 mul/div and abs media instructionsaroulin2015-08-112-1/+119
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | SMLAD, SMUAD, SMLSD, SMUSD, SMLALD, SMLSLD, SMMLA, SMMUL, SMMLS USAD8, USADA8
| * | | | arm_disasm: ARMv6 parallel add/sub media instructionsaroulin2015-08-112-0/+167
| | | | | | | | | | | | | | | | | | | | {S, U, Q, UQ, SH, UH}{ADD16, ASX, SAX, SUB16, ADD8, SUB8}
| * | | | arm_disasm: ARMv6 reversal media instructionsaroulin2015-08-092-0/+26
| | | | | | | | | | | | | | | | | | | | | | | | | REV, REV16, REVSH Only their ARM encoding, Thumb encoding is still missing.
| * | | | arm_disasm: ARMv6 saturation media instructionsaroulin2015-08-092-2/+55
| | | | | | | | | | | | | | | | | | | | SSAT, SSAT16, USAT, USAT16
| * | | | arm_disasm: ARMv6 packing and sign-extend media instructionsaroulin2015-08-092-1/+181
|/ / / / | | | | | | | | | | | | | | | | | | | | PKH, SEL SXTAB, SXTAB16, SXTB, SXTB16, SXTH, SXTAH UXTAB, UXTAB16, UXTB, UXTB16, UXTH, UXTAH
* | | | Merge pull request #1026 from lioncash/disasmLioncash2015-08-071-12/+4
|\ \ \ \ | |_|/ / |/| | | arm_disasm: Remove unnecessary code
| * | | arm_disasm: Remove unnecessary codeLioncash2015-08-071-12/+4
| | | | | | | | | | | | | | | | This part of disassembly only determines the opcode, there's no need for offset calculation here.
* | | | Merge pull request #1022 from aroulin/disas-missing-v6k-instructionsLioncash2015-08-072-6/+153
|\ \ \ \ | |_|/ / |/| | | Disassembler: ARMv6K instructions
| * | | Disassembler: ARMv6K REX instructionsaroulin2015-08-062-6/+97
| | | |
| * | | Disassembler: ARMv6K hint instructionsaroulin2015-08-062-0/+56
|/ / /
* | | Merge pull request #1018 from bbarenblat/masterbunnei2015-08-052-1/+8
|\ \ \ | | | | | | | | Handle invalid `Log::Level::Count`
| * | | Use UNREACHABLE macro for impossible cases in previous commitBenjamin Barenblat2015-08-032-4/+3
| | | | | | | | | | | | | | | | Use the UNREACHABLE macro instead of `ASSERT(false, ...);`.
| * | | Handle invalid `Log::Level::Count`Benjamin Barenblat2015-08-022-1/+9
| | | | | | | | | | | | | | | | | | | | | | | | Add a case of `Log::Level::Count` to all switch statements that dispatch on `Log::Level`. The case simply asserts `false` and notes the invalid log level.
* | | | Merge pull request #1015 from yuriks/vertex-cachingbunnei2015-08-051-62/+89
|\ \ \ \ | | | | | | | | | | Videocore: Implement simple vertex caching
| * | | | Videocore: Implement simple vertex cachingYuri Kunde Schlesner2015-08-051-62/+89
|/ / / / | | | | | | | | | | | | | | | | | | | | This gives a ~2/3 reduction in the amount of vertices that need to be processed through the vertex loaders and the vertex shader, yielding a good speedup.
* | | | Merge pull request #1019 from yuriks/msvc2015-workaroundbunnei2015-08-041-0/+14
|\ \ \ \ | |/ / / |/| | | Common: Work around bug in MSVC2015 standard library
| * | | Common: Work around bug in MSVC2015 standard libraryYuri Kunde Schlesner2015-08-031-0/+14
|/ / / | | | | | | | | | | | | | | | The char16_t/char32_t implementations aren't present in the library and cause linker errors. This is a known issue that wasn't fixed in VS2015 RTM.
* | | Merge pull request #999 from LittleWhite-tb/qt-save-locationYuri Kunde Schlesner2015-08-011-5/+20
|\ \ \ | | | | | | | | Save the path leading where the last file have been loaded
| * | | Save the path leading where the last file have been loadedLittleWhite2015-07-311-5/+20
|/ / / | | | | | | | | | | | | | | | I use two variables to save the path for the ROMs and the symbols. Use of QSettings to avoid new member variable to the class. Global settings of QSettings is done in main.
* | | Merge pull request #1008 from lioncash/pcbunnei2015-07-302-21/+40
|\ \ \ | | | | | | | | dyncom: Handle the case where PC is the source register for STR/VSTM/VLDM
| * | | dyncom: Handle the case where PC is the source register for STR/VSTM/VLDMLioncash2015-07-292-21/+40
| |/ /
* | | Merge pull request #1006 from yuriks/fb-commit-profilebunnei2015-07-301-0/+7
|\ \ \ | | | | | | | | OpenGL: Add a profiler category measuring framebuffer readback
| * | | OpenGL: Add a profiler category measuring framebuffer readbackYuri Kunde Schlesner2015-07-281-0/+7
| | | |
* | | | Merge pull request #1014 from lioncash/unused-warnbunnei2015-07-292-3/+5
|\ \ \ \ | | | | | | | | | | core: Eliminate some unused variable warnings
| * | | | core: Eliminate some unused variable warningsLioncash2015-07-292-3/+5
| | | | |
* | | | | Merge pull request #1011 from lioncash/initializerbunnei2015-07-292-2/+2
|\ \ \ \ \ | | | | | | | | | | | | citra-qt: Adjust initializer list order
| * | | | | citra-qt: Adjust initializer list orderLioncash2015-07-292-2/+2
| | | | | | | | | | | | | | | | | | | | | | | | Silences a warning.
* | | | | | Merge pull request #963 from yuriks/gpu-fixesbunnei2015-07-292-42/+44
|\ \ \ \ \ \ | | | | | | | | | | | | | | Misc. GPU vertex loading fixes
| * | | | | | VideoCore: Fix values of unset components in input attribute arraysYuri Kunde Schlesner2015-07-231-42/+38
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | If an input attribute array had a field with less than 4 components, the remaining components were left unset if not specified by a default vertex attribute. If neither mechanism would set a component, it would assume a garbage value. It has been verified that the hardware behavior is to instead to set the missing components from the fixed default of (0 0 0 1). The default vertex attribute values aren't used at all if a vertex array is specified for that attribute. Fixes UI graphics on Fire Emblem: Awakening, a small texturing glitch when selecting a character in Cubic Ninja, as well as eliminating the unset-W hack which was required for Ocarina of Time to not have garbled triangles. This change has been tested against hardware.
| * | | | | | VideoCore: Saturate vertex colors before interpolatingYuri Kunde Schlesner2015-07-231-0/+6
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | During testing, it was discovered that hardware does not interpolate colors output by the vertex shader as-is. Rather, it drops the sign and saturates the value to 1.0. This is done before interpolation, such that (e.g.) interpolating outputs 1.5 and -0.5 is equivalent to as if the shader had output the values 1.0 and 0.5 instead, with the interpolated value never crossing 0.0. This change has been tested against hardware.
* | | | | | | Merge pull request #1013 from lioncash/unusedYuri Kunde Schlesner2015-07-291-3/+0
|\ \ \ \ \ \ \ | |_|_|/ / / / |/| | | | | | dyncom: Remove an unused variable
| * | | | | | dyncom: Remove an unused variableLioncash2015-07-291-3/+0
| | |/ / / / | |/| | | | | | | | | | | | | | | | This was used prior to InterpreterTranslate existing.
* | | | | | Merge pull request #1012 from lioncash/prototypebunnei2015-07-292-0/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | core: Fix missing prototype warnings
| * | | | | | core: Fix missing prototype warningsLioncash2015-07-292-0/+2
| |/ / / / /
* | | | | | Merge pull request #1010 from lioncash/refbunnei2015-07-292-2/+2
|\ \ \ \ \ \ | |/ / / / / |/| | | | | citra-qt: Pass string by const reference
| * | | | | citra-qt: Pass string by const referenceLioncash2015-07-292-2/+2
|/ / / / /
* | | | | Merge pull request #1009 from lioncash/tableYuri Kunde Schlesner2015-07-291-1/+2
|\ \ \ \ \ | | | | | | | | | | | | am_net: Update function table data
| * | | | | am_net: Add missing function to the function tableLioncash2015-07-291-0/+1
| | | | | |
| * | | | | am_net: Add correct function name to the function tableLioncash2015-07-291-1/+1
| | |_|/ / | |/| | |
* | | | | Merge pull request #982 from Subv/homebunnei2015-07-297-18/+84
|\ \ \ \ \ | | | | | | | | | | | | Service/APT: Return proper parameters in GetLockHandle.
| * | | | | Service/APT: Fixed a regression, PreloadLibraryApplet should also start an applet when called.Subv2015-07-246-5/+36
| | | | | |
| * | | | | Service/APT: Return proper parameters in GetLockHandle.Subv2015-07-244-14/+49
| | |/ / / | |/| | | | | | | | | | | | | | | | | | Documented some APT functions This allows applets to boot.
* | | | | Merge pull request #1004 from yuriks/msvc-link-optbunnei2015-07-291-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | Enable linker optimizations in MSVC Release builds
| * | | | Enable linker optimizations in MSVC Release buildsYuri Kunde Schlesner2015-07-281-1/+1
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Apparently /DEBUG implicitly disables linker optimizations. This explicitly re-enables them, giving a 40% reduction in binary sizes and a very slight runtime speed improvement.
* | | | | Merge pull request #1007 from lioncash/pcbunnei2015-07-291-7/+33
|\ \ \ \ \ | | | | | | | | | | | | dyncom: Handle left-operand PC correctly for data-processing ops
| * | | | | dyncom: Handle left-operand PC correctly for data-processing opsLioncash2015-07-291-7/+33
|/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | This is considered deprecated in the ARM manual (using PC as an operand), however, this is still able to be executed on the MPCore (which I'm quite sure would be rare to begin with).
* | | | | Merge pull request #899 from zawata/Winsock-Deprecationbunnei2015-07-281-2/+8
|\ \ \ \ \ | | | | | | | | | | | | SOC:U : Fix WinSock function deprecation
| * | | | | SOC:U : Update deprecated function gethostbyname() to getaddrinfo()zawata2015-07-201-2/+8
| | | | | |
* | | | | | Merge pull request #998 from LittleWhite-tb/qt-continue-menuYuri Kunde Schlesner2015-07-281-0/+3
|\ \ \ \ \ \ | |_|_|_|/ / |/| | | | | Update Start menu text to match with the real state of the emulator.
| * | | | | Update Start menu text to match with the real state of the emulator.LittleWhite2015-07-281-0/+3
|/ / / / / | | | | | | | | | | | | | | | Move start menu text update in ShutdownGame as adviced by neobrain
* | | | | Merge pull request #1005 from chinhodado/patch-1Yuri Kunde Schlesner2015-07-281-1/+2
|\ \ \ \ \ | | | | | | | | | | | | Settings: Fix saving wrong values for input configuration
| * | | | | Settings: Fix saving wrong values for input configurationTrung Do2015-07-281-1/+2
|/ / / / /
* | | | | Merge pull request #1003 from lioncash/armcruftbunnei2015-07-286-124/+91
|\ \ \ \ \ | | | | | | | | | | | | dyncom: Minor cleanups.
| * | | | | dyncom: Remove an unnecessary typedefLioncash2015-07-282-7/+5
| | | | | |
| * | | | | dyncom: Use enum class for instruction decoding resultsLioncash2015-07-285-41/+40
| | | | | |
| * | | | | dyncom: Remove code duplication regarding thumb instructionsLioncash2015-07-283-23/+12
| | | | | |
| * | | | | dyncom: Migrate exclusive memory access control into armstateLioncash2015-07-282-50/+35
| | | | | |
| * | | | | dyncom: Remove duplicated typedef and externLioncash2015-07-281-4/+0
| | |/ / / | |/| | | | | | | | | | | | | These are already present in arm_dyncom_dec.h.
* | | | | Merge pull request #873 from jroweboy/input_arrayTony Wasserka2015-07-287-145/+80
|\ \ \ \ \ | |/ / / / |/| | | | Move input values into an array.
| * | | | Move input values into an arrayJames Rowe2015-07-287-145/+80
| | | | |
* | | | | Merge pull request #1001 from lioncash/armbunnei2015-07-2712-1109/+1028
|\ \ \ \ \ | | | | | | | | | | | | dyncom: Centralize state-related functions.
| * | | | | dyncom: Use std::array for register arraysLioncash2015-07-262-28/+29
| | | | | |
| * | | | | dyncom: Use ARMul_State as an objectLioncash2015-07-2612-1105/+1023
| | | | | | | | | | | | | | | | | | | | | | | | Gets rid of C-like parameter passing.
* | | | | | Merge pull request #991 from yuriks/globjectsbunnei2015-07-263-143/+79
|\ \ \ \ \ \ | | | | | | | | | | | | | | OpenGL: Make OpenGL object resource wrappers fully inline
| * | | | | | OpenGL: Make OpenGL object resource wrappers fully inlineYuri Kunde Schlesner2015-07-263-143/+79
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | The functions are so simple that having them separate only bloats the code and hinders optimization.
* | | | | | Merge pull request #992 from yuriks/hot-path-debugbunnei2015-07-265-13/+18
|\ \ \ \ \ \ | | | | | | | | | | | | | | VideoCore: #ifdef out some debugging routines
| * | | | | | VideoCore: #ifdef out some debugging routinesYuri Kunde Schlesner2015-07-265-13/+18
| |/ / / / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Some disabled debugging functionality was being called from rendering routines in VideoCore. Although disabled, many of them still allocated memory or did some extra work that was enough to show up in a profiler. Gives a slight (~2ms) speedup.
* | | | | | Merge pull request #987 from yuriks/regnamesTony Wasserka2015-07-262-65/+72
|\ \ \ \ \ \ | | | | | | | | | | | | | | Videocore: Don't reinitialize register name map on every query.
| * | | | | | Videocore: Don't reinitialize register name map on every queryYuri Kunde Schlesner2015-07-262-65/+72
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This greatly speeds up the command list debug widget.
* | | | | | | Merge pull request #995 from linkmauve/remove-dead-optionYuri Kunde Schlesner2015-07-261-4/+0
|\ \ \ \ \ \ \ | |_|_|_|_|_|/ |/| | | | | | Remove dead gpu_refresh_rate option from the default ini file
| * | | | | | Citra: Remove dead gpu_refresh_rate option from the default ini file.Emmanuel Gil Peyrot2015-07-261-4/+0
| | | | | | |
* | | | | | | Merge pull request #986 from Lectem/better_widgetsTony Wasserka2015-07-261-12/+22
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | citra-qt: Improve pica command list widget.
| * | | | | | | citra-qt/command list: Enable uniform row heights and automatically resize columns.Lectem2015-07-251-0/+8
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Uniform row heights enables some optimisations for a smoother scrolling. Resize columns to content so that we don't have to do it manually
| * | | | | | | citra-qt/command list: Split register and value columns.Lectem2015-07-251-12/+14
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Also removed the extra spaces for each cell
* | | | | | | | Merge pull request #994 from yuriks/vsh-interpreter-optYuri Kunde Schlesner2015-07-261-30/+27
|\ \ \ \ \ \ \ \ | |_|/ / / / / / |/| | | | | | | Optimisations and cleanups in the shader interpreter
| * | | | | | | Videocore: Simplify variables in vertex shader interpreterYuri Kunde Schlesner2015-07-261-24/+21
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Simplifies the code and gives a tiny speed-up.
| * | | | | | | Videocore: Replace std::stack in shader interpreter with static_vectorYuri Kunde Schlesner2015-07-261-6/+6
| | |_|/ / / / | |/| | | | | | | | | | | | | | | | | | | Shaves off 1/3rd of the vertex shader time in Fire Emblem
* | | | | | | Merge pull request #993 from yuriks/update-nihstroTony Wasserka2015-07-261-0/+0
|\ \ \ \ \ \ \ | |/ / / / / / |/| | | | | | Update nihstro to latest master.
| * | | | | | Update nihstro to latest masterYuri Kunde Schlesner2015-07-261-0/+0
|/ / / / / /
* | | | | | Merge pull request #990 from lioncash/armbunnei2015-07-2623-415/+320
|\ \ \ \ \ \ | |_|_|/ / / |/| | | | | dyncom: General cleanup
| * | | | | dyncom: Remove unnecessary initialization code.Lioncash2015-07-264-59/+2
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | Targeting ARM version variants was only a thing on armemu. The reset routine also does basically the same thing as NewState.
| * | | | | dyncom: Remove unnecessary abort-related cruftLioncash2015-07-262-48/+1
| | | | | | | | | | | | | | | | | | | | | | | | Both the MPCore and the ARM9 have the same data abort model (base restored), so differentiating isn't necessary.
| * | | | | dyncom: Rename armdefs.h to armstate.hLioncash2015-07-2616-34/+33
| | | | | |
| * | | | | dyncom: Get rid of skyeye typedefsLioncash2015-07-268-62/+56
| | | | | |
| * | | | | dyncom: Move helper functions to their own headerLioncash2015-07-2610-41/+57
| | | | | |
| * | | | | dyncom: Move arminit.cpp and armsupp.cpp into skyeye_commonLioncash2015-07-263-2/+2
|/ / / / /
* | | | | Merge pull request #989 from lioncash/externYuri Kunde Schlesner2015-07-261-25/+25
|\ \ \ \ \ | | | | | | | | | | | | armdefs: Remove unnecessary extern keywords
| * | | | | armdefs: Remove unnecessary extern keywordsLioncash2015-07-261-25/+25
| |/ / / /
* | | | | Merge pull request #988 from lioncash/elseYuri Kunde Schlesner2015-07-261-9/+9
|\ \ \ \ \ | |/ / / / |/| | | | loader: Remove unnecessary else usages
| * | | | loader: Remove unnecessary else usagesLioncash2015-07-261-9/+9
|/ / / /
* | | | Merge pull request #888 from zawata/Warning-Fixes-2Yuri Kunde Schlesner2015-07-252-3/+3
|\ \ \ \ | |/ / / |/| | | Core\HLE : Fix Warning
| * | | Core\HLE : Fix Warningzawata2015-07-172-3/+3
| |/ / | | | | | | | | | "signed/unsigned mismatch"
* | | Address error that remained in last mergeYuri Kunde Schlesner2015-07-251-1/+1
| | |
* | | Merge pull request #892 from zawata/another-warning-fixesYuri Kunde Schlesner2015-07-259-24/+24
|\ \ \ | | | | | | | | Yet More Warning Fixes
| * | | Vertex Shader : Undo castingzawata2015-07-191-1/+1
| | | |
| * | | Video_Core : Type fixeszawata2015-07-192-2/+2
| | | |
| * | | Core : Change variable typezawata2015-07-191-1/+1
| | | | | | | | | | | | | | | | and fix various warnings
| * | | Video_Core: Finally fix pesky warningzawata2015-07-191-1/+1
| | | |
| * | | Citra_QT : Another Conversion Warning Fixzawata2015-07-191-1/+1
| | | |
| * | | Video_Core : Change Tabs to Spaceszawata2015-07-191-0/+15
| | | | | | | | | | | | | | | | | | | | | | | | | | | | This really should be universalized, I keep getting errors creating commits because lines I've edited use tabs instead of spaces(and yes I did read the contributing guide and i know they are supposed to be spaces)
| * | | Video_Core : Fix Conversion Warningszawata2015-07-193-18/+3
| | | |
| * | | Core : Fix Conversion Warningszawata2015-07-191-1/+1
| | | |
| * | | Common : Fix Conversion Warningszawata2015-07-191-1/+1
| | | |
| * | | Citra_QT : Fix Conversion Warningszawata2015-07-192-2/+2
| | | |
* | | | Merge pull request #981 from Subv/checkboxesYuri Kunde Schlesner2015-07-253-71/+40
|\ \ \ \ | | | | | | | | | | Qt/GPU Breakpoints: Changed the widget to have a checkbox next to each bp type
| * | | | Qt/GPU Breakpoints: Changed the widget so that we don't have to select and click the Enable button when enabling/disabling a breakpoint, now it is done via a checkbox next to the breakpoint's name.Subv2015-07-243-71/+40
| | | | |
* | | | | Merge pull request #983 from yuriks/null-memory-fillYuri Kunde Schlesner2015-07-241-13/+18
|\ \ \ \ \ | | | | | | | | | | | | GSP: Don't try to write memory fill registers if start address is 0
| * | | | | GSP: Don't try to write memory fill registers if start address is 0Yuri Kunde Schlesner2015-07-241-13/+18
| | |_|_|/ | |/| | | | | | | | | | | | | | | | | | Verified to be what GSP does via REing. Fixes invalid virt->phys translation error spam in some games.
* | | | | Merge pull request #980 from Subv/more_breakpointsTony Wasserka2015-07-245-7/+24
|\ \ \ \ \ | |/ / / / |/| | | | Qt/GPU Breakpoints: Added three more breakpoint types.
| * | | | Qt/GPU Breakpoints: Added three more breakpoint types:Subv2015-07-235-7/+24
| |/ / / | | | | | | | | | | | | | | | | | | | | * IncomingDisplayTransfer: Triggered just before a display transfer is performed. * GSPCommandProcessed: Triggered right after a GSP command is processed. * BufferSwapped: Triggered when the frames flip
* | | | Merge pull request #977 from yuriks/glenable-tex2dbunnei2015-07-231-8/+5
|\ \ \ \ | | | | | | | | | | GL Renderer: Remove erroneous glEnable(GL_TEXTURE_2D) calls
| * | | | GL Renderer: Remove erroneous glEnable(GL_TEXTURE_2D) callsYuri Kunde Schlesner2015-07-221-8/+5
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | In OpenGL 3, texturing is always enabled, and this call is invalid. While it produced no effect in the rest of the execution, it wouldn't have the intended effect of disabling texturing for that unit. Instead bind a null texture to the unit.
* | | | | Merge pull request #979 from Subv/border_colorbunnei2015-07-231-2/+9
|\ \ \ \ \ | |_|/ / / |/| | | | Rasterizer/GL: Set the border color when binding a texture.
| * | | | Rasterizer/GL: Set the border color when binding a texture.Subv2015-07-231-2/+9
|/ / / /
* | | | Merge pull request #968 from Subv/texture_filteringbunnei2015-07-224-3/+37
|\ \ \ \ | | | | | | | | | | GPU: Added registers for min and mag texture filters
| * | | | GPU: Added registers for min and mag texture filters and implemented them in the hw renderer.Subv2015-07-214-3/+37
| | | | |
* | | | | Merge pull request #962 from Subv/am_appbunnei2015-07-223-3/+33
|\ \ \ \ \ | |_|/ / / |/| | | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.
| * | | | Services/AM: Stubbed am:app::GetNumContentInfos to return 0 results.Subv2015-07-213-3/+33
| |/ / / | | | | | | | | | | | | | | | | | | | | Named the service functions in am:app as per 3dbrew. This fixes an illegal read loop in Steel Diver
* | | | Merge pull request #966 from Subv/logbunnei2015-07-211-4/+8
|\ \ \ \ | | | | | | | | | | Services/Logging: Log more useful information when some operations fail.
| * | | | Services/Logging: Log more useful information when some operations fail.Subv2015-07-211-4/+8
| |/ / / | | | | | | | | | | | | Namely OpenFileDirectly, OpenDirectory and OpenArchive
* | | | Merge pull request #957 from Subv/hwtest_crashbunnei2015-07-211-0/+8
|\ \ \ \ | | | | | | | | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.
| * | | | Kernel/Scheduling: Clean up a thread's wait_objects when its scheduled.Subv2015-07-211-0/+8
| |/ / / | | | | | | | | | | | | They'll be reset if needed during the next svcWaitSynchronization call (if there's any pending)
* | | | Merge pull request #929 from neobrain/geoshader_definitionsTony Wasserka2015-07-216-150/+163
|\ \ \ \ | | | | | | | | | | Pica/Shader: Add geometry shader definitions.
| * | | | Pica/Shader: Add geometry shader definitions.Tony Wasserka2015-07-156-150/+163
| | | | |
* | | | | Merge pull request #964 from lioncash/svcLioncash2015-07-213-6/+6
|\ \ \ \ \ | | | | | | | | | | | | dyncom: Pass SVC immediates directly.
| * | | | | dyncom: Pass SVC immediates directly.Lioncash2015-07-213-6/+6
| | | | | | | | | | | | | | | | | | | | | | | | Previously it would just re-read the already decoded instruction and extract the immediate value.
* | | | | | Resolve issue accidentally left unaddressed in PR #930Yuri Kunde Schlesner2015-07-211-1/+1
|/ / / / /
* | | | | Merge pull request #959 from Subv/homeSebastian Valle2015-07-211-1/+3
|\ \ \ \ \ | | | | | | | | | | | | Services/CFG: Added some missing functions to cfg:s
| * | | | | Services/CFG: Added some missing functions to cfg:sSubv2015-07-211-1/+3
| | |/ / / | |/| | |
* | | | | Merge pull request #930 from neobrain/copypaste_commandlistYuri Kunde Schlesner2015-07-212-1/+31
|\ \ \ \ \ | |/ / / / |/| | | | citra-qt: Add support for copying the command list contents to clipboard.
| * | | | citra-qt: Add support for copying the command list contents to clipboard.Tony Wasserka2015-07-152-1/+31
| |/ / /
* | | | Merge pull request #939 from Subv/queryprocmembunnei2015-07-202-6/+28
|\ \ \ \ | | | | | | | | | | Kernel/SVC: Implemented svcQueryProcessMemory
| * | | | Kernel/SVC: Implemented svcQueryProcessMemorySubv2015-07-172-6/+28
| | | | |
* | | | | Merge pull request #951 from Subv/bit5bunnei2015-07-202-12/+31
|\ \ \ \ \ | | | | | | | | | | | | GPU/DisplayTransfer: Implemented bit 5 in the transfer flags.
| * | | | | GPU/DisplayTransfer: Implemented bit 5 in the transfer flags.Subv2015-07-202-12/+31
| | | | | | | | | | | | | | | | | | | | | | | | It tells the GPU to not swizzle/de-swizzle the input during the transfer.
* | | | | | Merge pull request #944 from Subv/spambunnei2015-07-201-3/+7
|\ \ \ \ \ \ | | | | | | | | | | | | | | GLRasterizer: Don't try to get a pointer to the depth buffer if it doesn't exist.
| * | | | | | GLRasterizer: Don't try to get a pointer to the depth buffer if it doesn't exist.Subv2015-07-191-3/+7
| | | | | | |
* | | | | | | Merge pull request #946 from archshift/update-frdubunnei2015-07-201-1/+12
|\ \ \ \ \ \ \ | | | | | | | | | | | | | | | | Add more frd:u unknown service commands from 3dbrew
| * | | | | | | Add more frd:u unknown service commands from 3dbrewarchshift2015-07-191-1/+12
| |/ / / / / /
* | | | | | | Merge pull request #950 from lioncash/bxLioncash2015-07-201-3/+5
|\ \ \ \ \ \ \ | |_|/ / / / / |/| | | | | | dyncom: Properly retrieve the PC value in BX if used.
| * | | | | | dyncom: Properly retrieve the PC value in BX if used.Lioncash2015-07-201-3/+5
|/ / / / / /
* | | | | | Merge pull request #949 from yuriks/fix-stTony Wasserka2015-07-201-2/+2
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica: Correct switched S/T texture wrapping registers.
| * | | | | | Pica: Correct switched S/T texture wrapping registersYuri Kunde Schlesner2015-07-201-2/+2
|/ / / / / / | | | | | | | | | | | | | | | | | | This was found and hwtested by Lectem
* | | | | | Merge pull request #948 from yuriks/fix-dp3Tony Wasserka2015-07-201-1/+1
|\ \ \ \ \ \ | | | | | | | | | | | | | | Pica/VertexShader: Fix DP3 instruction, which wasn't assigning to the w component.
| * | | | | | Pica: Fix DP3 instruction, which wasn't assigning to the w componentYuri Kunde Schlesner2015-07-201-1/+1
|/ / / / / /
* | | | | | Merge pull request #947 from archshift/hex-logYuri Kunde Schlesner2015-07-191-1/+1
|\ \ \ \ \ \ | |/ / / / / |/| | | | | Change trace/unimplemented service call logs to use hex
| * | | | | Change trace/unimplemented service call logs to use hexarchshift2015-07-191-1/+1
|/ / / / / | | | | | | | | | | | | | | | Changes the log to use hex in the parameter list instead of decimal.
* | | | | Merge pull request #943 from Subv/ia4Tony Wasserka2015-07-192-1/+2
|\ \ \ \ \ | |_|_|/ / |/| | | | Rasterizer/Textures: Fixed a bug where the I4 format would get twice the real stride.
| * | | | Rasterizer/Textures: Fixed a bug where the I4 format would get twice the real stride.Subv2015-07-192-1/+2
|/ / / / | | | | | | | | | | | | Also added its name to the texture viewer widget
* | | | Merge pull request #941 from citra-emu/armv6-thumb-movYuri Kunde Schlesner2015-07-181-10/+4
|\ \ \ \ | | | | | | | | | | Dyncom: Support for a new ARMv6 Thumb MOV encoding
| * | | | Dyncom: Support for a missing ARMv6 Thumb MOV encodingYuri Kunde Schlesner2015-07-181-10/+4
| |/ / /
* | | | Merge pull request #942 from linkmauve/masterTony Wasserka2015-07-181-3/+0
|\ \ \ \ | |/ / / |/| | | Remove the unused and commented GetThemeDir prototype from FileUtil
| * | | Common: Remove the unused and commented GetThemeDir prototype from FileUtil.Emmanuel Gil Peyrot2015-07-181-3/+0
|/ / /
* | | Merge pull request #938 from Subv/querymemYuri Kunde Schlesner2015-07-172-4/+24
|\ \ \ | | | | | | | | Kernel/SVC: Implemented svcQueryMemory.
| * | | Kernel/SVC: Implemented svcQueryMemory.Subv2015-07-172-4/+24
| | | |
* | | | Merge pull request #937 from yuriks/codeset-leakbunnei2015-07-1712-8/+45
|\ \ \ \ | |/ / / |/| | | Ensure all kernel objects are released during shutdown
| * | | Ensure all kernel objects are released during shutdownYuri Kunde Schlesner2015-07-1712-8/+45
| | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | | This commit fixes several kernel object leaks. The most severe of them was threads not being removed from the private handle table used for CoreTiming events. This resulted in Threads never being released, which in turn held references to Process, causing CodeSets to never be freed when loading other applications.
* | | | Merge pull request #936 from archshift/kill-sourceforgearchshift2015-07-171-1/+1
|\ \ \ \ | | | | | | | | | | Update homebrew before building, which no longer uses SourceForge
| * | | | Update homebrew before building, which no longer uses SourceForgearchshift2015-07-171-1/+1
| | | | |
* | | | | Merge pull request #935 from lioncash/smlawYuri Kunde Schlesner2015-07-171-1/+1
|\ \ \ \ \ | |_|/ / / |/| | | | arm_dyncom_interpreter: Simplify assignment in SMLAW
| * | | | arm_dyncom_interpreter: Simplify assignment in SMLAWLioncash2015-07-171-1/+1
|/ / / / | | | | | | | | | | | | Also a side-benefit of not having implementation-defined behavior.
* | | | Remove webchat link from readmeYuri Kunde Schlesner2015-07-171-1/+1
| | | | | | | | | | | | Hopefully this should reduce the amount of drive-by spam and annoying support requests in the channel.
* | | | Merge pull request #918 from yuriks/romfsbunnei2015-07-1717-97/+111
|\ \ \ \ | |/ / / |/| | | Do not load entire RomFS to memory, read from the file as needed instead (rebased)
| * | | Loader: Fix variable type and remove unused variableYuri Kunde Schlesner2015-07-141-2/+1
| | | |
| * | | Archive: Correct a few incorrect types in function signaturesYuri Kunde Schlesner2015-07-146-22/+22
| | | | | | | | | | | | | | | | Buffer lengths should be size_t, and file offsets should be u64.
| * | | Loader: Remove unnecessary pointer indirection to IOFileYuri Kunde Schlesner2015-07-1410-50/+50
| | | |
| * | | FS: Stream RomFS from file instead of loading all of it to memorycondut2015-07-149-32/+47
| | | |
* | | | Merge pull request #931 from neobrain/move_default_attr_handlerTony Wasserka2015-07-151-40/+40
|\ \ \ \ | | | | | | | | | | Pica/CommandProcessor: Move default attribute setup to the proper position.
| * | | | Pica/CommandProcessor: Move default attribute setup to the proper position.Tony Wasserka2015-07-151-40/+40
| | |/ / | |/| |
* | | | Merge pull request #932 from neobrain/proper_triangle_countTony Wasserka2015-07-151-1/+1
|\ \ \ \ | |/ / / |/| | | Pica/Clipper: Output proper number of triangles in debugging logs.
| * | | Pica/Clipper: Output proper number of triangles in debugging logs.Tony Wasserka2015-07-151-1/+1
|/ / /
* | | Merge pull request #928 from JSFernandes/masterTony Wasserka2015-07-142-2/+1
|\ \ \ | | | | | | | | Fix permissions in pre-commit hook.
| * | | Fix permissions in pre-commit hookJSFernandes2015-07-142-2/+1
| |/ /
* | | Merge pull request #767 from Lectem/DOT3_RGBYuri Kunde Schlesner2015-07-142-1/+13
|\ \ \
| * | | VideoCore: Implement the DOT3_RGB combinerLectem2015-07-142-1/+13
|/ / /
* | | Merge pull request #904 from aroulin/y2r-narrowing-warningarchshift2015-07-141-1/+1
|\ \ \ | | | | | | | | Y2R: Fix narrowing warning
| * | | Y2R: Fix narrowing warningaroulin2015-07-121-1/+1
| | | |
* | | | Fix uploading of builds by adding exec bit to .travis-upload.sharchshift2015-07-141-0/+0
| |/ / |/| | | | | | | | Fixes regression introduced by 6fc605a
* | | Merge pull request #927 from yuriks/getopt-fixTony Wasserka2015-07-142-3/+2
|\ \ \ | | | | | | | | getopt: Fix compilation settings.
| * | | getopt: Fix macro redefinition warningYuri Kunde Schlesner2015-07-141-1/+0
| | | | | | | | | | | | | | | | We already define _CRT_SECURE_NO_WARNINGS
| * | | getopt: Fix compilation settingsYuri Kunde Schlesner2015-07-141-2/+2
|/ / / | | | | | | | | | | | | | | | INTERFACE doesn't define the symbol when compiling the library itself. PUBLIC should be used when the definition is needed both by the library and by the users.
* | | Merge pull request #924 from aroulin/qt-disassembly-stepYuri Kunde Schlesner2015-07-132-2/+5
|\ \ \ | | | | | | | | Qt: Fix disassembly widget stepping
| * | | Qt: Fix disassembly widget steppingaroulin2015-07-132-2/+5
| | | |
* | | | Merge pull request #793 from neobrain/stencilTony Wasserka2015-07-135-20/+258
|\ \ \ \ | | | | | | | | | | Pica: Implement stencil testing.
| * | | | Pica: Implement stencil testing.Tony Wasserka2015-07-133-13/+199
| | | | |
| * | | | citra-qt: Add depth formats to framebuffer viewing widget.Tony Wasserka2015-07-132-6/+33
| | | | |
| * | | | citra-qt: Properly specify the framebuffer format.Tony Wasserka2015-07-132-3/+28
|/ / / /
* | | | Merge pull request #702 from neobrain/citraceTony Wasserka2015-07-1317-31/+765
|\ \ \ \ | |/ / / |/| | | Add CiTrace recording support.
| * | | CiTrace: Clean up initialization method.Tony Wasserka2015-07-133-79/+61
| | | |
| * | | CiTrace: Record LCD registers. Cleanup recording code.Tony Wasserka2015-07-131-7/+11
| | | |
| * | | CiTrace: Record default vertex attributes.Tony Wasserka2015-07-135-43/+65
| | | |
| * | | Clean up command_processor.cpp.Tony Wasserka2015-07-131-22/+27
| | | |
| * | | citra-qt: Properly disable the CiTrace widget upon starting/stopping emulation.Tony Wasserka2015-07-133-2/+39
| | | |
| * | | Add CiTrace recording support.Tony Wasserka2015-07-1315-4/+641
| | | | | | | | | | | | | | | | | | | | | | | | This is exposed in the GUI as a new "CiTrace Recording" widget. Playback is implemented by a standalone 3DS homebrew application (which only runs reliably within Citra currently; on an actual 3DS it will often crash still).
| * | | GPU: Be robust against nullptr addresses; properly reset busy bits in the trigger registers.Tony Wasserka2015-07-131-27/+34
| | | |
| * | | FileUtil: Add a WriteObject method for writing a single, POD-type object.Tony Wasserka2015-07-131-0/+10
| | | |
| * | | HW: Fix a stupid issue which led to unknown register reads/writes.Tony Wasserka2015-07-131-0/+30
|/ / /
* | | Merge pull request #859 from Apology11/masterYuri Kunde Schlesner2015-07-131-2/+4
|\ \ \ | | | | | | | | build with visual studio 2015
| * | | don´t define snprintf on Visual Studio 2015Apology112015-07-121-2/+4
| |/ / | | | | | | Visual Studio 2015 defines this in stdio now
* | | Merge pull request #921 from linkmauve/fix-appletbunnei2015-07-127-7/+32
|\ \ \ | | | | | | | | Fix applet includes using iwyu
| * | | Core: Fix applet includes using iwyu.Emmanuel Gil Peyrot2015-07-127-7/+32
| |/ /
* | | Kernel: Add CodeSet case to Object::IsWaitableYuri Kunde Schlesner2015-07-121-0/+1
| | |
* | | Merge pull request #881 from gwicks/masterTony Wasserka2015-07-126-3/+1156
|\ \ \ | |/ / |/| | GLFW: Switch argument parsing to use getopt.
| * | Implement new argument parsing using getopt and add the corresponding library to externalsGreg Wicks2015-07-126-3/+1156
|/ /
* | Merge pull request #823 from Subv/applets_drawingbunnei2015-07-1211-58/+567
|\ \ | | | | | | Library applet support (swkbd for now)
| * | Applets: Reworked how the Applet update event is handled.Subv2015-07-127-35/+61
| | | | | | | | | | | | Applets are now cleaned up in AppletUpdateEvent after calling their respective Update method.
| * | Applets: Add infrastructure to allow custom drawing and input handling in Applets.Subv2015-07-127-39/+162
| | |
| * | HLE/APT: Initial HLE support for applets.Subv2015-07-129-50/+410
| | | | | | | | | | | | Currently only the SWKBD is emulated, and there's currently no way to ask the user for input, so it always returns "Subv" as the text.
* | | Merge pull request #912 from yuriks/process-loadingYuri Kunde Schlesner2015-07-1214-74/+242
|\ \ \ | |/ / |/| | Core: Properly configure address space during binary loading
| * | Core: Properly configure address space when loading a binaryYuri Kunde Schlesner2015-07-1211-52/+223
| | | | | | | | | | | | | | | | | | The code now properly configures the process image to match the loaded binary segments (code, rodata, data) instead of just blindly allocating a large chunk of dummy memory.
| * | Memory: Fix unmapping of pagesYuri Kunde Schlesner2015-07-121-4/+2
| | |
| * | Loader: Clean up 3dsx loader a bit, fixing a potential buffer overrunYuri Kunde Schlesner2015-07-121-13/+16
| | |
| * | Loader: Make 3dsx loader logs a bit less confusingYuri Kunde Schlesner2015-07-121-6/+3
| | |
| * | Kernel: Remove unused member from EventYuri Kunde Schlesner2015-07-122-2/+1
|/ /
* | Merge pull request #914 from yuriks/bitfield-maskYuri Kunde Schlesner2015-07-121-2/+2
|\ \ | | | | | | Common: Fix mask generation in BitField
| * | Common: Remove redundant masking in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
| | | | | | | | | | | | | | | For the signed case, the shifts already remove the rest of the value, so ANDing by the mask is redundant.
| * | Common: Fix mask generation in BitFieldYuri Kunde Schlesner2015-07-101-1/+1
| | | | | | | | | | | | Fixes #913
* | | Merge pull request #910 from linkmauve/installTony Wasserka2015-07-122-2/+6
|\ \ \ | | | | | | | | Tell CMake to install the compiled binaries on Linux.
| * | | Citra, CitraQt: Tell cmake to install the compiled binaries.Emmanuel Gil Peyrot2015-07-092-2/+6
| |/ / | | | | | | | | | | | | This will help packaging tremendously, as a `make DESTDIR=… install` will now put every file at their place (on Linux and related).
* | | Merge pull request #907 from Lectem/clamp_to_borderTony Wasserka2015-07-123-13/+28
|\ \ \ | | | | | | | | Add GL_CLAMP_TO_BORDER support.
| * | | Added GL_CLAMP_TO_BORDER supportLectem2015-07-093-13/+28
| | | |
* | | | Merge pull request #915 from citra-emu/travis-containerbunnei2015-07-124-18/+31
|\ \ \ \ | | | | | | | | | | Travis: Remove use of sudo to enable use container-based builds
| * | | | Travis: Replace `before_install` with `install`Yuri Kunde Schlesner2015-07-111-8/+3
| | | | |
| * | | | Travis: Update GLFW on Linux to 3.1.1Yuri Kunde Schlesner2015-07-111-5/+5
| | | | |
| * | | | Travis: Remove use of sudo to enable use container-based buildsYuri Kunde Schlesner2015-07-114-10/+28
| | |/ / | |/| |
* | | | Merge pull request #919 from yuriks/styleguidebunnei2015-07-121-22/+16
|\ \ \ \ | | | | | | | | | | Update style rules with to better match current practice.
| * | | | Update style rules with to better match current practice.Yuri Kunde Schlesner2015-07-121-22/+16
|/ / / /
* | | | Merge pull request #909 from yuriks/build-flagsbunnei2015-07-111-15/+17
|\ \ \ \ | | | | | | | | | | CMake: Fix Debug build configuration in MSVC
| * | | | CMake: Fix Debug build configuration in MSVCYuri Kunde Schlesner2015-07-091-15/+17
| |/ / / | | | | | | | | | | | | | | | | | | | | | | | | | | | | Debug was missing compiler flags, causing MSVC to default it to building with optimizations enabled (making for a not very useful binary for actual debugging...). Additionally, the variables were re-organized to remove some redundancy, the old Release build type was removed, and RelWithDebInfo was renamed to take its place instead.
* | | | Merge pull request #916 from lioncash/unusedYuri Kunde Schlesner2015-07-112-43/+0
|\ \ \ \ | | | | | | | | | | Common: Remove thunk.h
| * | | | Common: Remove thunk.hLioncash2015-07-112-43/+0
|/ / / / | | | | | | | | | | | | This isn't used, and there's no implementations of the member functions.
* | | | Merge pull request #876 from linkmauve/include-cleanupsYuri Kunde Schlesner2015-07-11108-402/+374
|\ \ \ \ | |/ / / |/| | | Cleanup includes, mostly in common
| * | | Core: Cleanup hw includes.Emmanuel Gil Peyrot2015-06-2813-11/+31
| | | |
| * | | Core: Cleanup soc:U includes.Emmanuel Gil Peyrot2015-06-282-26/+36
| | | |
| * | | Core, VideoCore: Replace or fix exit() calls.Emmanuel Gil Peyrot2015-06-283-10/+15
| | | |
| * | | Core: Cleanup file_sys includes.Emmanuel Gil Peyrot2015-06-2822-38/+73
| | | |
| * | | Core: Cleanup core includes.Emmanuel Gil Peyrot2015-06-289-15/+16
| | | |
| * | | CitraQt: Cleanup includes.Emmanuel Gil Peyrot2015-06-2820-16/+45
| | | |
| * | | Common: Cleanup emu_window includes.Emmanuel Gil Peyrot2015-06-285-13/+23
| | | |
| * | | Common: Remove unused ROUND_UP_POW2 macro.Emmanuel Gil Peyrot2015-06-281-7/+0
| | | |
| * | | Common: Cleanup key_map includes.Emmanuel Gil Peyrot2015-06-2813-19/+32
| | | |
| * | | Common: Cleanup memory and misc includes.Emmanuel Gil Peyrot2015-06-2810-25/+22
| | | |
| * | | Common: Cleanup profiler includes.Emmanuel Gil Peyrot2015-06-284-7/+10
| | | |
| * | | Common: Cleanup thread includes.Emmanuel Gil Peyrot2015-06-282-18/+15
| | | |
| * | | Common: Fix string_util includes.Emmanuel Gil Peyrot2015-06-282-3/+9
| | | |
| * | | Common: Fix FileUtil includes, and everything relying on those.Emmanuel Gil Peyrot2015-06-2810-7/+21
| | | |
| * | | Citra: Fix the includes a bit, thanks to include-what-you-use.Emmanuel Gil Peyrot2015-06-285-8/+19
| | | |
| * | | Common: Remove now-unused EMU_PLATFORM define, fixes issue #373.Emmanuel Gil Peyrot2015-06-272-34/+0
| | | |
| * | | Common: Remove unused SSE version checking and a GCC macro.Emmanuel Gil Peyrot2015-06-271-25/+0
| | | |
| * | | Services: Use the standard _WIN32 define in soc:U instead of our own EMU_PLATFORM.Emmanuel Gil Peyrot2015-06-271-8/+7
| | | |
| * | | Common: Remove unused fifo_queue.h.Emmanuel Gil Peyrot2015-06-272-112/+0
| | | |
* | | | Merge pull request #906 from aroulin/loader-format-specifier-warningYuri Kunde Schlesner2015-07-081-1/+0
|\ \ \ \ | | | | | | | | | | Loader: Fix format specifier warning
| * | | | Loader: Remove log line causing warningaroulin2015-07-081-1/+0
| | |/ / | |/| |
* | | | Merge pull request #905 from yuriks/submodule-depthbunnei2015-07-071-1/+1
|\ \ \ \ | |/ / / |/| | | AppVeyor: Remove submodule checkout depth
| * | | AppVeyor: Remove submodule checkout depthYuri Kunde Schlesner2015-07-071-1/+1
| | | | | | | | | | | | | | | | | | | | This avoid intermittent build failures due to a commit not being reachable using a fixed depth, at the expense of longer checkout times.
* | | | Merge pull request #797 from linkmauve/blended-downscalingbunnei2015-07-061-33/+46
|\ \ \ \ | | | | | | | | | | Implement blended downscaling for display transfers
| * | | | GPU: Implement blended downscaling for display transfers.Emmanuel Gil Peyrot2015-06-281-27/+40
| | | | |
| * | | | GPU: Use shifts instead of multiplications to calculate the actual size of the output.Emmanuel Gil Peyrot2015-06-281-6/+6
| | |/ / | |/| |
* | | | Merge pull request #885 from Subv/ipc_headersbunnei2015-07-061-5/+13
|\ \ \ \ | |_|/ / |/| | | Services/SOC: Added command headers to some of the soc commands.
| * | | Services/SOC: Added command headers to some of the soc commands.Subv2015-06-251-5/+13
| | | |
* | | | Merge pull request #897 from lioncash/returnYuri Kunde Schlesner2015-06-292-4/+2
|\ \ \ \ | | | | | | | | | | vfp: Change return type of VFPInit from unsigned int to void.